diff options
| author | root <root@zombrain.(none)> | 2011-07-25 08:54:41 (GMT) |
|---|---|---|
| committer | root <root@zombrain.(none)> | 2011-07-25 08:54:41 (GMT) |
| commit | ab4fcaad149d4bdccefa8f693c2a8e044b40dd4c (patch) | |
| tree | c95c280caabc70e7aedbde723e38820047357be7 /include | |
initial state (xorg-server 1.10.2)
Diffstat (limited to 'include')
74 files changed, 14912 insertions, 0 deletions
diff --git a/include/Makefile.am b/include/Makefile.am new file mode 100644 index 0000000..42f0082 --- /dev/null +++ b/include/Makefile.am @@ -0,0 +1,71 @@ +if XORG +sdk_HEADERS = \ + XIstubs.h \ + Xprintf.h \ + callback.h \ + closestr.h \ + closure.h \ + colormap.h \ + colormapst.h \ + hotplug.h \ + cursor.h \ + cursorstr.h \ + dix.h \ + dixaccess.h \ + dixevents.h \ + dixfont.h \ + dixfontstr.h \ + dixgrabs.h \ + dixstruct.h \ + events.h \ + exevents.h \ + extension.h \ + extinit.h \ + extnsionst.h \ + gc.h \ + gcstruct.h \ + globals.h \ + input.h \ + inputstr.h \ + list.h \ + misc.h \ + miscstruct.h \ + opaque.h \ + os.h \ + pixmap.h \ + pixmapstr.h \ + privates.h \ + property.h \ + propertyst.h \ + ptrveloc.h \ + region.h \ + regionstr.h \ + registry.h \ + resource.h \ + rgb.h \ + screenint.h \ + scrnintstr.h \ + selection.h \ + servermd.h \ + site.h \ + swaprep.h \ + swapreq.h \ + validate.h \ + window.h \ + windowstr.h \ + xkbfile.h \ + xkbsrv.h \ + xkbstr.h \ + xkbrules.h \ + xserver-properties.h + +nodist_sdk_HEADERS = xorg-server.h +endif + +AM_CFLAGS = $(DIX_CFLAGS) + +EXTRA_DIST = \ + dix-config-apple-verbatim.h \ + eventconvert.h eventstr.h inpututils.h \ + protocol-versions.h \ + xsha1.h diff --git a/include/Makefile.in b/include/Makefile.in new file mode 100644 index 0000000..b0a920a --- /dev/null +++ b/include/Makefile.in @@ -0,0 +1,855 @@ +# Makefile.in generated by automake 1.11.1 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005, 2006, 2007, 2008, 2009 Free Software Foundation, +# Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkglibexecdir = $(libexecdir)/@PACKAGE@ +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +subdir = include +DIST_COMMON = $(am__sdk_HEADERS_DIST) $(srcdir)/Makefile.am \ + $(srcdir)/Makefile.in $(srcdir)/dix-config.h.in \ + $(srcdir)/do-not-use-config.h.in $(srcdir)/kdrive-config.h.in \ + $(srcdir)/version-config.h.in $(srcdir)/xkb-config.h.in \ + $(srcdir)/xorg-config.h.in $(srcdir)/xorg-server.h.in \ + $(srcdir)/xwin-config.h.in +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/m4/ac_define_dir.m4 \ + $(top_srcdir)/m4/ax_tls.m4 $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = do-not-use-config.h xorg-server.h dix-config.h \ + xorg-config.h xkb-config.h xwin-config.h kdrive-config.h \ + version-config.h +CONFIG_CLEAN_FILES = +CONFIG_CLEAN_VPATH_FILES = +AM_V_GEN = $(am__v_GEN_$(V)) +am__v_GEN_ = $(am__v_GEN_$(AM_DEFAULT_VERBOSITY)) +am__v_GEN_0 = @echo " GEN " $@; +AM_V_at = $(am__v_at_$(V)) +am__v_at_ = $(am__v_at_$(AM_DEFAULT_VERBOSITY)) +am__v_at_0 = @ +SOURCES = +DIST_SOURCES = +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`; +am__install_max = 40 +am__nobase_strip_setup = \ + srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'` +am__nobase_strip = \ + for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||" +am__nobase_list = $(am__nobase_strip_setup); \ + for p in $$list; do echo "$$p $$p"; done | \ + sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \ + $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \ + if (++n[$$2] == $(am__install_max)) \ + { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \ + END { for (dir in files) print dir, files[dir] }' +am__base_list = \ + sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \ + sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g' +am__installdirs = "$(DESTDIR)$(sdkdir)" "$(DESTDIR)$(sdkdir)" +am__sdk_HEADERS_DIST = XIstubs.h Xprintf.h callback.h closestr.h \ + closure.h colormap.h colormapst.h hotplug.h cursor.h \ + cursorstr.h dix.h dixaccess.h dixevents.h dixfont.h \ + dixfontstr.h dixgrabs.h dixstruct.h events.h exevents.h \ + extension.h extinit.h extnsionst.h gc.h gcstruct.h globals.h \ + input.h inputstr.h list.h misc.h miscstruct.h opaque.h os.h \ + pixmap.h pixmapstr.h privates.h property.h propertyst.h \ + ptrveloc.h region.h regionstr.h registry.h resource.h rgb.h \ + screenint.h scrnintstr.h selection.h servermd.h site.h \ + swaprep.h swapreq.h validate.h window.h windowstr.h xkbfile.h \ + xkbsrv.h xkbstr.h xkbrules.h xserver-properties.h +HEADERS = $(nodist_sdk_HEADERS) $(sdk_HEADERS) +ETAGS = etags +CTAGS = ctags +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +ADMIN_MAN_DIR = @ADMIN_MAN_DIR@ +ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@ +ALLOCA = @ALLOCA@ +AMTAR = @AMTAR@ +AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ +APPLE_APPLICATIONS_DIR = @APPLE_APPLICATIONS_DIR@ +APPLE_APPLICATION_NAME = @APPLE_APPLICATION_NAME@ +APP_MAN_DIR = @APP_MAN_DIR@ +APP_MAN_SUFFIX = @APP_MAN_SUFFIX@ +AR = @AR@ +ARM_BACKTRACE_CFLAGS = @ARM_BACKTRACE_CFLAGS@ +AS = @AS@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BASE_FONT_PATH = @BASE_FONT_PATH@ +BUILD_DATE = @BUILD_DATE@ +BUILD_TIME = @BUILD_TIME@ +CC = @CC@ +CCAS = @CCAS@ +CCASDEPMODE = @CCASDEPMODE@ +CCASFLAGS = @CCASFLAGS@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CHANGELOG_CMD = @CHANGELOG_CMD@ +COMPILEDDEFAULTFONTPATH = @COMPILEDDEFAULTFONTPATH@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CWARNFLAGS = @CWARNFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DARWIN_LIBS = @DARWIN_LIBS@ +DBUS_CFLAGS = @DBUS_CFLAGS@ +DBUS_LIBS = @DBUS_LIBS@ +DEFAULT_LIBRARY_PATH = @DEFAULT_LIBRARY_PATH@ +DEFAULT_LOGDIR = @DEFAULT_LOGDIR@ +DEFAULT_LOGPREFIX = @DEFAULT_LOGPREFIX@ +DEFAULT_MODULE_PATH = @DEFAULT_MODULE_PATH@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DGA_CFLAGS = @DGA_CFLAGS@ +DGA_LIBS = @DGA_LIBS@ +DIX_CFLAGS = @DIX_CFLAGS@ +DIX_LIB = @DIX_LIB@ +DLLTOOL = @DLLTOOL@ +DLOPEN_LIBS = @DLOPEN_LIBS@ +DMXEXAMPLES_DEP_CFLAGS = @DMXEXAMPLES_DEP_CFLAGS@ +DMXEXAMPLES_DEP_LIBS = @DMXEXAMPLES_DEP_LIBS@ +DMXMODULES_CFLAGS = @DMXMODULES_CFLAGS@ +DMXMODULES_LIBS = @DMXMODULES_LIBS@ +DMXXIEXAMPLES_DEP_CFLAGS = @DMXXIEXAMPLES_DEP_CFLAGS@ +DMXXIEXAMPLES_DEP_LIBS = @DMXXIEXAMPLES_DEP_LIBS@ +DMXXMUEXAMPLES_DEP_CFLAGS = @DMXXMUEXAMPLES_DEP_CFLAGS@ +DMXXMUEXAMPLES_DEP_LIBS = @DMXXMUEXAMPLES_DEP_LIBS@ +DOXYGEN = @DOXYGEN@ +DRI2PROTO_CFLAGS = @DRI2PROTO_CFLAGS@ +DRI2PROTO_LIBS = @DRI2PROTO_LIBS@ +DRIPROTO_CFLAGS = @DRIPROTO_CFLAGS@ +DRIPROTO_LIBS = @DRIPROTO_LIBS@ +DRIVER_MAN_DIR = @DRIVER_MAN_DIR@ +DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@ +DRI_CFLAGS = @DRI_CFLAGS@ +DRI_DRIVER_PATH = @DRI_DRIVER_PATH@ +DRI_LIBS = @DRI_LIBS@ +DSYMUTIL = @DSYMUTIL@ +DTRACE = @DTRACE@ +DUMPBIN = @DUMPBIN@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +FGREP = @FGREP@ +FILE_MAN_DIR = @FILE_MAN_DIR@ +FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@ +FONT100DPIDIR = @FONT100DPIDIR@ +FONT75DPIDIR = @FONT75DPIDIR@ +FONTMISCDIR = @FONTMISCDIR@ +FONTOTFDIR = @FONTOTFDIR@ +FONTROOTDIR = @FONTROOTDIR@ +FONTTTFDIR = @FONTTTFDIR@ +FONTTYPE1DIR = @FONTTYPE1DIR@ +FOP = @FOP@ +GLIB_CFLAGS = @GLIB_CFLAGS@ +GLIB_LIBS = @GLIB_LIBS@ +GLX_ARCH_DEFINES = @GLX_ARCH_DEFINES@ +GLX_DEFINES = @GLX_DEFINES@ +GLX_TLS = @GLX_TLS@ +GL_CFLAGS = @GL_CFLAGS@ +GL_LIBS = @GL_LIBS@ +GREP = @GREP@ +HAL_CFLAGS = @HAL_CFLAGS@ +HAL_LIBS = @HAL_LIBS@ +INSTALL = @INSTALL@ +INSTALL_CMD = @INSTALL_CMD@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +KDRIVE_CFLAGS = @KDRIVE_CFLAGS@ +KDRIVE_INCS = @KDRIVE_INCS@ +KDRIVE_LIBS = @KDRIVE_LIBS@ +KDRIVE_LOCAL_LIBS = @KDRIVE_LOCAL_LIBS@ +KDRIVE_PURE_INCS = @KDRIVE_PURE_INCS@ +KDRIVE_PURE_LIBS = @KDRIVE_PURE_LIBS@ +LAUNCHD_ID_PREFIX = @LAUNCHD_ID_PREFIX@ +LD = @LD@ +LDFLAGS = @LDFLAGS@ +LD_EXPORT_SYMBOLS_FLAG = @LD_EXPORT_SYMBOLS_FLAG@ +LEX = @LEX@ +LEXLIB = @LEXLIB@ +LEX_OUTPUT_ROOT = @LEX_OUTPUT_ROOT@ +LIBDRM_CFLAGS = @LIBDRM_CFLAGS@ +LIBDRM_LIBS = @LIBDRM_LIBS@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBSHA1_CFLAGS = @LIBSHA1_CFLAGS@ +LIBSHA1_LIBS = @LIBSHA1_LIBS@ +LIBTOOL = @LIBTOOL@ +LIB_MAN_DIR = @LIB_MAN_DIR@ +LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@ +LIPO = @LIPO@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAIN_LIB = @MAIN_LIB@ +MAKEINFO = @MAKEINFO@ +MANIFEST_TOOL = @MANIFEST_TOOL@ +MAN_SUBSTS = @MAN_SUBSTS@ +MISC_MAN_DIR = @MISC_MAN_DIR@ +MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@ +MKDIR_P = @MKDIR_P@ +NM = @NM@ +NMEDIT = @NMEDIT@ +OBJC = @OBJC@ +OBJCCLD = @OBJCCLD@ +OBJCDEPMODE = @OBJCDEPMODE@ +OBJCFLAGS = @OBJCFLAGS@ +OBJCLINK = @OBJCLINK@ +OBJDUMP = @OBJDUMP@ +OBJEXT = @OBJEXT@ +OPENSSL_CFLAGS = @OPENSSL_CFLAGS@ +OPENSSL_LIBS = @OPENSSL_LIBS@ +OS_LIB = @OS_LIB@ +OTOOL = @OTOOL@ +OTOOL64 = @OTOOL64@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_URL = @PACKAGE_URL@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PCIACCESS_CFLAGS = @PCIACCESS_CFLAGS@ +PCIACCESS_LIBS = @PCIACCESS_LIBS@ +PCI_TXT_IDS_PATH = @PCI_TXT_IDS_PATH@ +PERL = @PERL@ +PIXMAN_CFLAGS = @PIXMAN_CFLAGS@ +PIXMAN_LIBS = @PIXMAN_LIBS@ +PKG_CONFIG = @PKG_CONFIG@ +PKG_CONFIG_LIBDIR = @PKG_CONFIG_LIBDIR@ +PKG_CONFIG_PATH = @PKG_CONFIG_PATH@ +PROJECTROOT = @PROJECTROOT@ +RANLIB = @RANLIB@ +RAWCPP = @RAWCPP@ +RAWCPPFLAGS = @RAWCPPFLAGS@ +RELEASE_DATE = @RELEASE_DATE@ +SDK_REQUIRED_MODULES = @SDK_REQUIRED_MODULES@ +SED = @SED@ +SELINUX_CFLAGS = @SELINUX_CFLAGS@ +SELINUX_LIBS = @SELINUX_LIBS@ +SERVER_MISC_CONFIG_PATH = @SERVER_MISC_CONFIG_PATH@ +SET_MAKE = @SET_MAKE@ +SHA1_CFLAGS = @SHA1_CFLAGS@ +SHA1_LIBS = @SHA1_LIBS@ +SHELL = @SHELL@ +SOLARIS_ASM_CFLAGS = @SOLARIS_ASM_CFLAGS@ +SOLARIS_INOUT_ARCH = @SOLARIS_INOUT_ARCH@ +STRIP = @STRIP@ +STYLESHEET_SRCDIR = @STYLESHEET_SRCDIR@ +SYSCONFDIR = @SYSCONFDIR@ +TSLIB_CFLAGS = @TSLIB_CFLAGS@ +TSLIB_LIBS = @TSLIB_LIBS@ +UDEV_CFLAGS = @UDEV_CFLAGS@ +UDEV_LIBS = @UDEV_LIBS@ +UTILS_SYS_LIBS = @UTILS_SYS_LIBS@ +VENDOR_NAME_SHORT = @VENDOR_NAME_SHORT@ +VERSION = @VERSION@ +WINDOWSWM_CFLAGS = @WINDOWSWM_CFLAGS@ +WINDOWSWM_LIBS = @WINDOWSWM_LIBS@ +WINDRES = @WINDRES@ +X11EXAMPLES_DEP_CFLAGS = @X11EXAMPLES_DEP_CFLAGS@ +X11EXAMPLES_DEP_LIBS = @X11EXAMPLES_DEP_LIBS@ +XDMCP_CFLAGS = @XDMCP_CFLAGS@ +XDMCP_LIBS = @XDMCP_LIBS@ +XDMXCONFIG_DEP_CFLAGS = @XDMXCONFIG_DEP_CFLAGS@ +XDMXCONFIG_DEP_LIBS = @XDMXCONFIG_DEP_LIBS@ +XDMX_CFLAGS = @XDMX_CFLAGS@ +XDMX_LIBS = @XDMX_LIBS@ +XDMX_SYS_LIBS = @XDMX_SYS_LIBS@ +XEPHYR_CFLAGS = @XEPHYR_CFLAGS@ +XEPHYR_INCS = @XEPHYR_INCS@ +XEPHYR_LIBS = @XEPHYR_LIBS@ +XF86CONFIGDIR = @XF86CONFIGDIR@ +XF86CONFIGFILE = @XF86CONFIGFILE@ +XF86VIDMODE_CFLAGS = @XF86VIDMODE_CFLAGS@ +XF86VIDMODE_LIBS = @XF86VIDMODE_LIBS@ +XKB_BASE_DIRECTORY = @XKB_BASE_DIRECTORY@ +XKB_BIN_DIRECTORY = @XKB_BIN_DIRECTORY@ +XKB_COMPILED_DIR = @XKB_COMPILED_DIR@ +XKM_OUTPUT_DIR = @XKM_OUTPUT_DIR@ +XLIB_CFLAGS = @XLIB_CFLAGS@ +XLIB_LIBS = @XLIB_LIBS@ +XMLTO = @XMLTO@ +XNESTMODULES_CFLAGS = @XNESTMODULES_CFLAGS@ +XNESTMODULES_LIBS = @XNESTMODULES_LIBS@ +XNEST_LIBS = @XNEST_LIBS@ +XNEST_SYS_LIBS = @XNEST_SYS_LIBS@ +XORG_CFLAGS = @XORG_CFLAGS@ +XORG_INCS = @XORG_INCS@ +XORG_LIBS = @XORG_LIBS@ +XORG_MAN_PAGE = @XORG_MAN_PAGE@ +XORG_MODULES_CFLAGS = @XORG_MODULES_CFLAGS@ +XORG_MODULES_LIBS = @XORG_MODULES_LIBS@ +XORG_OS = @XORG_OS@ +XORG_OS_SUBDIR = @XORG_OS_SUBDIR@ +XORG_SGML_PATH = @XORG_SGML_PATH@ +XORG_SYS_LIBS = @XORG_SYS_LIBS@ +XPBPROXY_CFLAGS = @XPBPROXY_CFLAGS@ +XPBPROXY_LIBS = @XPBPROXY_LIBS@ +XQUARTZ_SPARKLE = @XQUARTZ_SPARKLE@ +XRESEXAMPLES_DEP_CFLAGS = @XRESEXAMPLES_DEP_CFLAGS@ +XRESEXAMPLES_DEP_LIBS = @XRESEXAMPLES_DEP_LIBS@ +XSERVERCFLAGS_CFLAGS = @XSERVERCFLAGS_CFLAGS@ +XSERVERCFLAGS_LIBS = @XSERVERCFLAGS_LIBS@ +XSERVERLIBS_CFLAGS = @XSERVERLIBS_CFLAGS@ +XSERVERLIBS_LIBS = @XSERVERLIBS_LIBS@ +XSERVER_LIBS = @XSERVER_LIBS@ +XSERVER_SYS_LIBS = @XSERVER_SYS_LIBS@ +XSL_STYLESHEET = @XSL_STYLESHEET@ +XTSTEXAMPLES_DEP_CFLAGS = @XTSTEXAMPLES_DEP_CFLAGS@ +XTSTEXAMPLES_DEP_LIBS = @XTSTEXAMPLES_DEP_LIBS@ +XVFB_LIBS = @XVFB_LIBS@ +XVFB_SYS_LIBS = @XVFB_SYS_LIBS@ +XWINMODULES_CFLAGS = @XWINMODULES_CFLAGS@ +XWINMODULES_LIBS = @XWINMODULES_LIBS@ +XWIN_LIBS = @XWIN_LIBS@ +XWIN_SERVER_NAME = @XWIN_SERVER_NAME@ +XWIN_SYS_LIBS = @XWIN_SYS_LIBS@ +YACC = @YACC@ +YFLAGS = @YFLAGS@ +__XCONFIGDIR__ = @__XCONFIGDIR__@ +__XCONFIGFILE__ = @__XCONFIGFILE__@ +abi_ansic = @abi_ansic@ +abi_extension = @abi_extension@ +abi_videodrv = @abi_videodrv@ +abi_xinput = @abi_xinput@ +abs_builddir = @abs_builddir@ +abs_srcdir = @abs_srcdir@ +abs_top_builddir = @abs_top_builddir@ +abs_top_srcdir = @abs_top_srcdir@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_DUMPBIN = @ac_ct_DUMPBIN@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +builddir = @builddir@ +datadir = @datadir@ +datarootdir = @datarootdir@ +docdir = @docdir@ +driverdir = @driverdir@ +dvidir = @dvidir@ +exec_prefix = @exec_prefix@ +extdir = @extdir@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +htmldir = @htmldir@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localedir = @localedir@ +localstatedir = @localstatedir@ +logdir = @logdir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +moduledir = @moduledir@ +oldincludedir = @oldincludedir@ +pdfdir = @pdfdir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +psdir = @psdir@ +sbindir = @sbindir@ +sdkdir = @sdkdir@ +sharedstatedir = @sharedstatedir@ +srcdir = @srcdir@ +symbol_visibility = @symbol_visibility@ +sysconfdir = @sysconfdir@ +sysconfigdir = @sysconfigdir@ +target_alias = @target_alias@ +top_build_prefix = @top_build_prefix@ +top_builddir = @top_builddir@ +top_srcdir = @top_srcdir@ +@XORG_TRUE@sdk_HEADERS = \ +@XORG_TRUE@ XIstubs.h \ +@XORG_TRUE@ Xprintf.h \ +@XORG_TRUE@ callback.h \ +@XORG_TRUE@ closestr.h \ +@XORG_TRUE@ closure.h \ +@XORG_TRUE@ colormap.h \ +@XORG_TRUE@ colormapst.h \ +@XORG_TRUE@ hotplug.h \ +@XORG_TRUE@ cursor.h \ +@XORG_TRUE@ cursorstr.h \ +@XORG_TRUE@ dix.h \ +@XORG_TRUE@ dixaccess.h \ +@XORG_TRUE@ dixevents.h \ +@XORG_TRUE@ dixfont.h \ +@XORG_TRUE@ dixfontstr.h \ +@XORG_TRUE@ dixgrabs.h \ +@XORG_TRUE@ dixstruct.h \ +@XORG_TRUE@ events.h \ +@XORG_TRUE@ exevents.h \ +@XORG_TRUE@ extension.h \ +@XORG_TRUE@ extinit.h \ +@XORG_TRUE@ extnsionst.h \ +@XORG_TRUE@ gc.h \ +@XORG_TRUE@ gcstruct.h \ +@XORG_TRUE@ globals.h \ +@XORG_TRUE@ input.h \ +@XORG_TRUE@ inputstr.h \ +@XORG_TRUE@ list.h \ +@XORG_TRUE@ misc.h \ +@XORG_TRUE@ miscstruct.h \ +@XORG_TRUE@ opaque.h \ +@XORG_TRUE@ os.h \ +@XORG_TRUE@ pixmap.h \ +@XORG_TRUE@ pixmapstr.h \ +@XORG_TRUE@ privates.h \ +@XORG_TRUE@ property.h \ +@XORG_TRUE@ propertyst.h \ +@XORG_TRUE@ ptrveloc.h \ +@XORG_TRUE@ region.h \ +@XORG_TRUE@ regionstr.h \ +@XORG_TRUE@ registry.h \ +@XORG_TRUE@ resource.h \ +@XORG_TRUE@ rgb.h \ +@XORG_TRUE@ screenint.h \ +@XORG_TRUE@ scrnintstr.h \ +@XORG_TRUE@ selection.h \ +@XORG_TRUE@ servermd.h \ +@XORG_TRUE@ site.h \ +@XORG_TRUE@ swaprep.h \ +@XORG_TRUE@ swapreq.h \ +@XORG_TRUE@ validate.h \ +@XORG_TRUE@ window.h \ +@XORG_TRUE@ windowstr.h \ +@XORG_TRUE@ xkbfile.h \ +@XORG_TRUE@ xkbsrv.h \ +@XORG_TRUE@ xkbstr.h \ +@XORG_TRUE@ xkbrules.h \ +@XORG_TRUE@ xserver-properties.h + +@XORG_TRUE@nodist_sdk_HEADERS = xorg-server.h +AM_CFLAGS = $(DIX_CFLAGS) +EXTRA_DIST = \ + dix-config-apple-verbatim.h \ + eventconvert.h eventstr.h inpututils.h \ + protocol-versions.h \ + xsha1.h + +all: do-not-use-config.h xorg-server.h dix-config.h xorg-config.h xkb-config.h xwin-config.h kdrive-config.h version-config.h + $(MAKE) $(AM_MAKEFLAGS) all-am + +.SUFFIXES: +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \ + && { if test -f $@; then exit 0; else break; fi; }; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign include/Makefile'; \ + $(am__cd) $(top_srcdir) && \ + $(AUTOMAKE) --foreign include/Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(am__aclocal_m4_deps): + +do-not-use-config.h: stamp-h1 + @if test ! -f $@; then \ + rm -f stamp-h1; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h1; \ + else :; fi + +stamp-h1: $(srcdir)/do-not-use-config.h.in $(top_builddir)/config.status + @rm -f stamp-h1 + cd $(top_builddir) && $(SHELL) ./config.status include/do-not-use-config.h +$(srcdir)/do-not-use-config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + ($(am__cd) $(top_srcdir) && $(AUTOHEADER)) + rm -f stamp-h1 + touch $@ + +xorg-server.h: stamp-h2 + @if test ! -f $@; then \ + rm -f stamp-h2; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h2; \ + else :; fi + +stamp-h2: $(srcdir)/xorg-server.h.in $(top_builddir)/config.status + @rm -f stamp-h2 + cd $(top_builddir) && $(SHELL) ./config.status include/xorg-server.h + +dix-config.h: stamp-h3 + @if test ! -f $@; then \ + rm -f stamp-h3; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h3; \ + else :; fi + +stamp-h3: $(srcdir)/dix-config.h.in $(top_builddir)/config.status + @rm -f stamp-h3 + cd $(top_builddir) && $(SHELL) ./config.status include/dix-config.h + +xorg-config.h: stamp-h4 + @if test ! -f $@; then \ + rm -f stamp-h4; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h4; \ + else :; fi + +stamp-h4: $(srcdir)/xorg-config.h.in $(top_builddir)/config.status + @rm -f stamp-h4 + cd $(top_builddir) && $(SHELL) ./config.status include/xorg-config.h + +xkb-config.h: stamp-h5 + @if test ! -f $@; then \ + rm -f stamp-h5; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h5; \ + else :; fi + +stamp-h5: $(srcdir)/xkb-config.h.in $(top_builddir)/config.status + @rm -f stamp-h5 + cd $(top_builddir) && $(SHELL) ./config.status include/xkb-config.h + +xwin-config.h: stamp-h6 + @if test ! -f $@; then \ + rm -f stamp-h6; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h6; \ + else :; fi + +stamp-h6: $(srcdir)/xwin-config.h.in $(top_builddir)/config.status + @rm -f stamp-h6 + cd $(top_builddir) && $(SHELL) ./config.status include/xwin-config.h + +kdrive-config.h: stamp-h7 + @if test ! -f $@; then \ + rm -f stamp-h7; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h7; \ + else :; fi + +stamp-h7: $(srcdir)/kdrive-config.h.in $(top_builddir)/config.status + @rm -f stamp-h7 + cd $(top_builddir) && $(SHELL) ./config.status include/kdrive-config.h + +version-config.h: stamp-h8 + @if test ! -f $@; then \ + rm -f stamp-h8; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h8; \ + else :; fi + +stamp-h8: $(srcdir)/version-config.h.in $(top_builddir)/config.status + @rm -f stamp-h8 + cd $(top_builddir) && $(SHELL) ./config.status include/version-config.h + +distclean-hdr: + -rm -f do-not-use-config.h stamp-h1 xorg-server.h stamp-h2 dix-config.h stamp-h3 xorg-config.h stamp-h4 xkb-config.h stamp-h5 xwin-config.h stamp-h6 kdrive-config.h stamp-h7 version-config.h stamp-h8 + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs +install-nodist_sdkHEADERS: $(nodist_sdk_HEADERS) + @$(NORMAL_INSTALL) + test -z "$(sdkdir)" || $(MKDIR_P) "$(DESTDIR)$(sdkdir)" + @list='$(nodist_sdk_HEADERS)'; test -n "$(sdkdir)" || list=; \ + for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + echo "$$d$$p"; \ + done | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_HEADER) $$files '$(DESTDIR)$(sdkdir)'"; \ + $(INSTALL_HEADER) $$files "$(DESTDIR)$(sdkdir)" || exit $$?; \ + done + +uninstall-nodist_sdkHEADERS: + @$(NORMAL_UNINSTALL) + @list='$(nodist_sdk_HEADERS)'; test -n "$(sdkdir)" || list=; \ + files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \ + test -n "$$files" || exit 0; \ + echo " ( cd '$(DESTDIR)$(sdkdir)' && rm -f" $$files ")"; \ + cd "$(DESTDIR)$(sdkdir)" && rm -f $$files +install-sdkHEADERS: $(sdk_HEADERS) + @$(NORMAL_INSTALL) + test -z "$(sdkdir)" || $(MKDIR_P) "$(DESTDIR)$(sdkdir)" + @list='$(sdk_HEADERS)'; test -n "$(sdkdir)" || list=; \ + for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + echo "$$d$$p"; \ + done | $(am__base_list) | \ + while read files; do \ + echo " $(INSTALL_HEADER) $$files '$(DESTDIR)$(sdkdir)'"; \ + $(INSTALL_HEADER) $$files "$(DESTDIR)$(sdkdir)" || exit $$?; \ + done + +uninstall-sdkHEADERS: + @$(NORMAL_UNINSTALL) + @list='$(sdk_HEADERS)'; test -n "$(sdkdir)" || list=; \ + files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \ + test -n "$$files" || exit 0; \ + echo " ( cd '$(DESTDIR)$(sdkdir)' && rm -f" $$files ")"; \ + cd "$(DESTDIR)$(sdkdir)" && rm -f $$files + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) '{ files[$$0] = 1; nonempty = 1; } \ + END { if (nonempty) { for (i in files) print i; }; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: $(HEADERS) $(SOURCES) do-not-use-config.h.in xorg-server.h.in dix-config.h.in xorg-config.h.in xkb-config.h.in xwin-config.h.in kdrive-config.h.in version-config.h.in $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + set x; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) do-not-use-config.h.in xorg-server.h.in dix-config.h.in xorg-config.h.in xkb-config.h.in xwin-config.h.in kdrive-config.h.in version-config.h.in $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) '{ files[$$0] = 1; nonempty = 1; } \ + END { if (nonempty) { for (i in files) print i; }; }'`; \ + shift; \ + if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + if test $$# -gt 0; then \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + "$$@" $$unique; \ + else \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$unique; \ + fi; \ + fi +ctags: CTAGS +CTAGS: $(HEADERS) $(SOURCES) do-not-use-config.h.in xorg-server.h.in dix-config.h.in xorg-config.h.in xkb-config.h.in xwin-config.h.in kdrive-config.h.in version-config.h.in $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + list='$(SOURCES) $(HEADERS) do-not-use-config.h.in xorg-server.h.in dix-config.h.in xorg-config.h.in xkb-config.h.in xwin-config.h.in kdrive-config.h.in version-config.h.in $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) '{ files[$$0] = 1; nonempty = 1; } \ + END { if (nonempty) { for (i in files) print i; }; }'`; \ + test -z "$(CTAGS_ARGS)$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && $(am__cd) $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) "$$here" + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + +distdir: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + list='$(DISTFILES)'; \ + dist_files=`for file in $$list; do echo $$file; done | \ + sed -e "s|^$$srcdirstrip/||;t" \ + -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \ + case $$dist_files in \ + */*) $(MKDIR_P) `echo "$$dist_files" | \ + sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \ + sort -u` ;; \ + esac; \ + for file in $$dist_files; do \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + if test -d $$d/$$file; then \ + dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test -d "$(distdir)/$$file"; then \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \ + find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \ + fi; \ + cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \ + else \ + test -f "$(distdir)/$$file" \ + || cp -p $$d/$$file "$(distdir)/$$file" \ + || exit 1; \ + fi; \ + done +check-am: all-am +check: check-am +all-am: Makefile $(HEADERS) do-not-use-config.h xorg-server.h \ + dix-config.h xorg-config.h xkb-config.h xwin-config.h \ + kdrive-config.h version-config.h +installdirs: + for dir in "$(DESTDIR)$(sdkdir)" "$(DESTDIR)$(sdkdir)"; do \ + test -z "$$dir" || $(MKDIR_P) "$$dir"; \ + done +install: install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-am + +clean-am: clean-generic clean-libtool mostlyclean-am + +distclean: distclean-am + -rm -f Makefile +distclean-am: clean-am distclean-generic distclean-hdr distclean-tags + +dvi: dvi-am + +dvi-am: + +html: html-am + +html-am: + +info: info-am + +info-am: + +install-data-am: install-nodist_sdkHEADERS install-sdkHEADERS + +install-dvi: install-dvi-am + +install-dvi-am: + +install-exec-am: + +install-html: install-html-am + +install-html-am: + +install-info: install-info-am + +install-info-am: + +install-man: + +install-pdf: install-pdf-am + +install-pdf-am: + +install-ps: install-ps-am + +install-ps-am: + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-generic mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: uninstall-nodist_sdkHEADERS uninstall-sdkHEADERS + +.MAKE: all install-am install-strip + +.PHONY: CTAGS GTAGS all all-am check check-am clean clean-generic \ + clean-libtool ctags distclean distclean-generic distclean-hdr \ + distclean-libtool distclean-tags distdir dvi dvi-am html \ + html-am info info-am install install-am install-data \ + install-data-am install-dvi install-dvi-am install-exec \ + install-exec-am install-html install-html-am install-info \ + install-info-am install-man install-nodist_sdkHEADERS \ + install-pdf install-pdf-am install-ps install-ps-am \ + install-sdkHEADERS install-strip installcheck installcheck-am \ + installdirs maintainer-clean maintainer-clean-generic \ + mostlyclean mostlyclean-generic mostlyclean-libtool pdf pdf-am \ + ps ps-am tags uninstall uninstall-am \ + uninstall-nodist_sdkHEADERS uninstall-sdkHEADERS + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/include/XIstubs.h b/include/XIstubs.h new file mode 100644 index 0000000..6ab82df --- /dev/null +++ b/include/XIstubs.h @@ -0,0 +1,49 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef XI_STUBS_H +#define XI_STUBS_H 1 + +extern _X_EXPORT int +SetDeviceMode ( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + int /* mode */); + +extern _X_EXPORT int +SetDeviceValuators ( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + int * /* valuators */, + int /* first_valuator */, + int /* num_valuators */); + +extern _X_EXPORT int +ChangeDeviceControl ( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + xDeviceCtl * /* control */); + +#endif /* XI_STUBS_H */ diff --git a/include/Xprintf.h b/include/Xprintf.h new file mode 100644 index 0000000..5177122 --- /dev/null +++ b/include/Xprintf.h @@ -0,0 +1,69 @@ +/* + * Copyright (c) 2010, Oracle and/or its affiliates. All rights reserved. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + */ + +#ifndef XPRINTF_H +#define XPRINTF_H + +#include <stdio.h> +#include <stdarg.h> +#include <X11/Xfuncproto.h> + +#ifndef _X_RESTRICT_KYWD +# if defined(restrict) /* assume autoconf set it correctly */ || \ + (defined(__STDC__) && (__STDC_VERSION__ - 0 >= 199901L)) /* C99 */ +# define _X_RESTRICT_KYWD restrict +# elif defined(__GNUC__) && !defined(__STRICT_ANSI__) /* gcc w/C89+extensions */ +# define _X_RESTRICT_KYWD __restrict__ +# else +# define _X_RESTRICT_KYWD +# endif +#endif + +/* + * These functions provide a portable implementation of the common (but not + * yet universal) asprintf & vasprintf routines to allocate a buffer big + * enough to sprintf the arguments to. The XNF variants terminate the server + * if the allocation fails. + * The buffer allocated is returned in the pointer provided in the first + * argument. The return value is the size of the allocated buffer, or -1 + * on failure. + */ +extern _X_EXPORT int Xasprintf (char **ret, + const char * _X_RESTRICT_KYWD fmt, + ...) _X_ATTRIBUTE_PRINTF(2,3); +extern _X_EXPORT int Xvasprintf (char **ret, + const char * _X_RESTRICT_KYWD fmt, + va_list va) _X_ATTRIBUTE_PRINTF(2,0); +extern _X_EXPORT int XNFasprintf (char **ret, + const char * _X_RESTRICT_KYWD fmt, + ...) _X_ATTRIBUTE_PRINTF(2,3); +extern _X_EXPORT int XNFvasprintf (char **ret, + const char * _X_RESTRICT_KYWD fmt, + va_list va) _X_ATTRIBUTE_PRINTF(2,0); + +#if !defined(HAVE_ASPRINTF) && !defined(HAVE_VASPRINTF) +# define asprintf Xasprintf +# define vasprintf Xvasprintf +#endif + +#endif /* XPRINTF_H */ diff --git a/include/callback.h b/include/callback.h new file mode 100644 index 0000000..9a1da73 --- /dev/null +++ b/include/callback.h @@ -0,0 +1,94 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef CALLBACK_H +#define CALLBACK_H + +#include <X11/X.h> /* for GContext, Mask */ +#include <X11/Xdefs.h> /* for Bool */ +#include <X11/Xproto.h> +#include <X11/Xfuncproto.h> + +/* + * callback manager stuff + */ + +#ifndef _XTYPEDEF_CALLBACKLISTPTR +typedef struct _CallbackList *CallbackListPtr; /* also in misc.h */ +#define _XTYPEDEF_CALLBACKLISTPTR +#endif + +typedef void (*CallbackProcPtr) ( + CallbackListPtr *, pointer, pointer); + +extern _X_EXPORT Bool AddCallback( + CallbackListPtr * /*pcbl*/, + CallbackProcPtr /*callback*/, + pointer /*data*/); + +extern _X_EXPORT Bool DeleteCallback( + CallbackListPtr * /*pcbl*/, + CallbackProcPtr /*callback*/, + pointer /*data*/); + +extern _X_EXPORT void _CallCallbacks( + CallbackListPtr * /*pcbl*/, + pointer /*call_data*/); + +static inline void +CallCallbacks(CallbackListPtr *pcbl, pointer call_data) +{ + if (!pcbl || !*pcbl) return; + _CallCallbacks(pcbl, call_data); +} + +extern _X_EXPORT void DeleteCallbackList( + CallbackListPtr * /*pcbl*/); + +extern _X_EXPORT void InitCallbackManager(void); + +#endif /* CALLBACK_H */ diff --git a/include/closestr.h b/include/closestr.h new file mode 100644 index 0000000..ab18ef9 --- /dev/null +++ b/include/closestr.h @@ -0,0 +1,127 @@ +/* + +Copyright 1991, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. + +*/ + + +#ifndef CLOSESTR_H +#define CLOSESTR_H + +#include <X11/Xproto.h> +#include "closure.h" +#include "dix.h" +#include "misc.h" +#include "gcstruct.h" + +/* closure structures */ + +/* OpenFont */ + +typedef struct _OFclosure { + ClientPtr client; + short current_fpe; + short num_fpes; + FontPathElementPtr *fpe_list; + Mask flags; + +/* XXX -- get these from request buffer instead? */ + char *origFontName; + int origFontNameLen; + XID fontid; + char *fontname; + int fnamelen; + FontPtr non_cachable_font; +} OFclosureRec; + +/* ListFontsWithInfo */ + +#define XLFDMAXFONTNAMELEN 256 +typedef struct _LFWIstate { + char pattern[XLFDMAXFONTNAMELEN]; + int patlen; + int current_fpe; + int max_names; + Bool list_started; + pointer private; +} LFWIstateRec, *LFWIstatePtr; + +typedef struct _LFWIclosure { + ClientPtr client; + int num_fpes; + FontPathElementPtr *fpe_list; + xListFontsWithInfoReply *reply; + int length; + LFWIstateRec current; + LFWIstateRec saved; + int savedNumFonts; + Bool haveSaved; + char *savedName; +} LFWIclosureRec; + +/* ListFonts */ + +typedef struct _LFclosure { + ClientPtr client; + int num_fpes; + FontPathElementPtr *fpe_list; + FontNamesPtr names; + LFWIstateRec current; + LFWIstateRec saved; + Bool haveSaved; + char *savedName; + int savedNameLen; +} LFclosureRec; + +/* PolyText */ + +typedef struct _PTclosure { + ClientPtr client; + DrawablePtr pDraw; + GC *pGC; + unsigned char *pElt; + unsigned char *endReq; + unsigned char *data; + int xorg; + int yorg; + CARD8 reqType; + XID did; + int err; +} PTclosureRec; + +/* ImageText */ + +typedef struct _ITclosure { + ClientPtr client; + DrawablePtr pDraw; + GC *pGC; + BYTE nChars; + unsigned char *data; + int xorg; + int yorg; + CARD8 reqType; + XID did; +} ITclosureRec; +#endif /* CLOSESTR_H */ diff --git a/include/closure.h b/include/closure.h new file mode 100644 index 0000000..b261f5e --- /dev/null +++ b/include/closure.h @@ -0,0 +1,57 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef CLOSURE_H +#define CLOSURE_H 1 + +typedef struct _LFclosure *LFclosurePtr; +typedef struct _LFWIclosure *LFWIclosurePtr; +typedef struct _OFclosure *OFclosurePtr; +typedef struct _PTclosure *PTclosurePtr; +typedef struct _ITclosure *ITclosurePtr; + +#endif /* CLOSURE_H */ diff --git a/include/colormap.h b/include/colormap.h new file mode 100644 index 0000000..1b15748 --- /dev/null +++ b/include/colormap.h @@ -0,0 +1,189 @@ +/* + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +*/ + +#ifndef CMAP_H +#define CMAP_H 1 + +#include <X11/Xproto.h> +#include "screenint.h" +#include "window.h" + +/* these follow X.h's AllocNone and AllocAll */ +#define CM_PSCREEN 2 +#define CM_PWIN 3 +/* Passed internally in colormap.c */ +#define REDMAP 0 +#define GREENMAP 1 +#define BLUEMAP 2 +#define PSEUDOMAP 3 +#define AllocPrivate (-1) +#define AllocTemporary (-2) +#define DynamicClass 1 + +/* Values for the flags field of a colormap. These should have 1 bit set + * and not overlap */ +#define IsDefault 1 +#define AllAllocated 2 +#define BeingCreated 4 + + +typedef CARD32 Pixel; +typedef struct _CMEntry *EntryPtr; +/* moved to screenint.h: typedef struct _ColormapRec *ColormapPtr */ +typedef struct _colorResource *colorResourcePtr; + +extern _X_EXPORT int CreateColormap( + Colormap /*mid*/, + ScreenPtr /*pScreen*/, + VisualPtr /*pVisual*/, + ColormapPtr* /*ppcmap*/, + int /*alloc*/, + int /*client*/); + +extern _X_EXPORT int FreeColormap( + pointer /*pmap*/, + XID /*mid*/); + +extern _X_EXPORT int TellLostMap( + WindowPtr /*pwin*/, + pointer /* Colormap *pmid */); + +extern _X_EXPORT int TellGainedMap( + WindowPtr /*pwin*/, + pointer /* Colormap *pmid */); + +extern _X_EXPORT int CopyColormapAndFree( + Colormap /*mid*/, + ColormapPtr /*pSrc*/, + int /*client*/); + +extern _X_EXPORT int AllocColor( + ColormapPtr /*pmap*/, + unsigned short* /*pred*/, + unsigned short* /*pgreen*/, + unsigned short* /*pblue*/, + Pixel* /*pPix*/, + int /*client*/); + +extern _X_EXPORT void FakeAllocColor( + ColormapPtr /*pmap*/, + xColorItem * /*item*/); + +extern _X_EXPORT void FakeFreeColor( + ColormapPtr /*pmap*/, + Pixel /*pixel*/); + +typedef int (*ColorCompareProcPtr)( + EntryPtr /*pent*/, + xrgb * /*prgb*/); + +extern _X_EXPORT int FindColor( + ColormapPtr /*pmap*/, + EntryPtr /*pentFirst*/, + int /*size*/, + xrgb* /*prgb*/, + Pixel* /*pPixel*/, + int /*channel*/, + int /*client*/, + ColorCompareProcPtr /*comp*/); + +extern _X_EXPORT int QueryColors( + ColormapPtr /*pmap*/, + int /*count*/, + Pixel* /*ppixIn*/, + xrgb* /*prgbList*/, + ClientPtr client); + +extern _X_EXPORT int FreeClientPixels( + pointer /*pcr*/, + XID /*fakeid*/); + +extern _X_EXPORT int AllocColorCells( + int /*client*/, + ColormapPtr /*pmap*/, + int /*colors*/, + int /*planes*/, + Bool /*contig*/, + Pixel* /*ppix*/, + Pixel* /*masks*/); + +extern _X_EXPORT int AllocColorPlanes( + int /*client*/, + ColormapPtr /*pmap*/, + int /*colors*/, + int /*r*/, + int /*g*/, + int /*b*/, + Bool /*contig*/, + Pixel* /*pixels*/, + Pixel* /*prmask*/, + Pixel* /*pgmask*/, + Pixel* /*pbmask*/); + +extern _X_EXPORT int FreeColors( + ColormapPtr /*pmap*/, + int /*client*/, + int /*count*/, + Pixel* /*pixels*/, + Pixel /*mask*/); + +extern _X_EXPORT int StoreColors( + ColormapPtr /*pmap*/, + int /*count*/, + xColorItem* /*defs*/, + ClientPtr client); + +extern _X_EXPORT int IsMapInstalled( + Colormap /*map*/, + WindowPtr /*pWin*/); + +extern _X_EXPORT Bool ResizeVisualArray( + ScreenPtr /* pScreen */, + int /* new_vis_count */, + DepthPtr /* depth */); + +#endif /* CMAP_H */ diff --git a/include/colormapst.h b/include/colormapst.h new file mode 100644 index 0000000..b597e2c --- /dev/null +++ b/include/colormapst.h @@ -0,0 +1,132 @@ +/* + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +*/ + +#ifndef CMAPSTRUCT_H +#define CMAPSTRUCT_H 1 + +#include <X11/Xarch.h> + +#include "colormap.h" +#include "screenint.h" +#include "privates.h" + +/* Shared color -- the color is used by AllocColorPlanes */ +typedef struct +{ + unsigned short color; + short refcnt; +} SHAREDCOLOR; + +/* LOCO -- a local color for a PseudoColor cell. DirectColor maps always + * use the first value (called red) in the structure. What channel they + * are really talking about depends on which map they are in. */ +typedef struct +{ + unsigned short red, green, blue; +} LOCO; + +/* SHCO -- a shared color for a PseudoColor cell. Used with AllocColorPlanes. + * DirectColor maps always use the first value (called red) in the structure. + * What channel they are really talking about depends on which map they + * are in. */ +typedef struct +{ + SHAREDCOLOR *red, *green, *blue; +} SHCO; + + +/* color map entry */ +typedef struct _CMEntry +{ + union + { + LOCO local; + SHCO shco; + } co; + short refcnt; + Bool fShared; +} Entry; + +/* + * COLORMAPs can be used for either Direct or Pseudo color. PseudoColor + * only needs one cell table, we arbitrarily pick red. We keep track + * of that table with freeRed, numPixelsRed, and clientPixelsRed + * + * The padN variables are unfortunate ABI BC. See fdo bug #6924. + */ + +typedef struct _ColormapRec +{ + VisualPtr pVisual; + short class; /* PseudoColor or DirectColor */ +#if defined(_LP64) + short pad0; + XID pad1; +#endif + XID mid; /* client's name for colormap */ +#if defined(_LP64) && (X_BYTE_ORDER == X_LITTLE_ENDIAN) + XID pad2; +#endif + ScreenPtr pScreen; /* screen map is associated with */ + short flags; /* 1 = IsDefault + * 2 = AllAllocated */ + int freeRed; + int freeGreen; + int freeBlue; + int *numPixelsRed; + int *numPixelsGreen; + int *numPixelsBlue; + Pixel **clientPixelsRed; + Pixel **clientPixelsGreen; + Pixel **clientPixelsBlue; + Entry *red; + Entry *green; + Entry *blue; + PrivateRec *devPrivates; +} ColormapRec; + +#endif /* COLORMAP_H */ diff --git a/include/cursor.h b/include/cursor.h new file mode 100644 index 0000000..59978d4 --- /dev/null +++ b/include/cursor.h @@ -0,0 +1,140 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef CURSOR_H +#define CURSOR_H + +#include "misc.h" +#include "screenint.h" +#include "window.h" +#include "privates.h" + +#define NullCursor ((CursorPtr)NULL) + +/* Provide support for alpha composited cursors */ +#define ARGB_CURSOR + +struct _DeviceIntRec; + +typedef struct _Cursor *CursorPtr; +typedef struct _CursorMetric *CursorMetricPtr; + +extern _X_EXPORT DevPrivateKeyRec cursorScreenDevPriv[MAXSCREENS]; +#define CursorScreenKey(pScreen) (cursorScreenDevPriv + (pScreen)->myNum) + +extern _X_EXPORT CursorPtr rootCursor; + +extern _X_EXPORT int FreeCursor( + pointer /*pCurs*/, + XID /*cid*/); + +extern _X_EXPORT int AllocARGBCursor( + unsigned char* /*psrcbits*/, + unsigned char* /*pmaskbits*/, + CARD32* /*argb*/, + CursorMetricPtr /*cm*/, + unsigned /*foreRed*/, + unsigned /*foreGreen*/, + unsigned /*foreBlue*/, + unsigned /*backRed*/, + unsigned /*backGreen*/, + unsigned /*backBlue*/, + CursorPtr* /*ppCurs*/, + ClientPtr /*client*/, + XID /*cid*/); + +extern _X_EXPORT int AllocGlyphCursor( + Font /*source*/, + unsigned int /*sourceChar*/, + Font /*mask*/, + unsigned int /*maskChar*/, + unsigned /*foreRed*/, + unsigned /*foreGreen*/, + unsigned /*foreBlue*/, + unsigned /*backRed*/, + unsigned /*backGreen*/, + unsigned /*backBlue*/, + CursorPtr* /*ppCurs*/, + ClientPtr /*client*/, + XID /*cid*/); + +extern _X_EXPORT CursorPtr CreateRootCursor( + char* /*pfilename*/, + unsigned int /*glyph*/); + +extern _X_EXPORT int ServerBitsFromGlyph( + FontPtr /*pfont*/, + unsigned int /*ch*/, + CursorMetricPtr /*cm*/, + unsigned char ** /*ppbits*/); + +extern _X_EXPORT Bool CursorMetricsFromGlyph( + FontPtr /*pfont*/, + unsigned /*ch*/, + CursorMetricPtr /*cm*/); + +extern _X_EXPORT void CheckCursorConfinement( + WindowPtr /*pWin*/); + +extern _X_EXPORT void NewCurrentScreen( + struct _DeviceIntRec* /*pDev*/, + ScreenPtr /*newScreen*/, + int /*x*/, + int /*y*/); + +extern _X_EXPORT Bool PointerConfinedToScreen(struct _DeviceIntRec* /* pDev */); + +extern _X_EXPORT void GetSpritePosition( + struct _DeviceIntRec* /* pDev */, + int * /*px*/, + int * /*py*/); + +#ifdef PANORAMIX +extern _X_EXPORT int XineramaGetCursorScreen(struct _DeviceIntRec* pDev); +#endif /* PANORAMIX */ + +#endif /* CURSOR_H */ diff --git a/include/cursorstr.h b/include/cursorstr.h new file mode 100644 index 0000000..6a4d0db --- /dev/null +++ b/include/cursorstr.h @@ -0,0 +1,99 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef CURSORSTRUCT_H +#define CURSORSTRUCT_H + +#include "cursor.h" +#include "privates.h" +/* + * device-independent cursor storage + */ + +/* + * source and mask point directly to the bits, which are in the server-defined + * bitmap format. + */ +typedef struct _CursorBits { + unsigned char *source; /* points to bits */ + unsigned char *mask; /* points to bits */ + Bool emptyMask; /* all zeros mask */ + unsigned short width, height, xhot, yhot; /* metrics */ + int refcnt; /* can be shared */ + PrivateRec *devPrivates; /* set by pScr->RealizeCursor*/ +#ifdef ARGB_CURSOR + CARD32 *argb; /* full-color alpha blended */ +#endif +} CursorBits, *CursorBitsPtr; + +#define CURSOR_BITS_SIZE (sizeof(CursorBits) + dixPrivatesSize(PRIVATE_CURSOR_BITS)) + +typedef struct _Cursor { + CursorBitsPtr bits; + unsigned short foreRed, foreGreen, foreBlue; /* device-independent color */ + unsigned short backRed, backGreen, backBlue; /* device-independent color */ + int refcnt; + PrivateRec *devPrivates; /* set by pScr->RealizeCursor*/ + XID id; +#ifdef XFIXES + CARD32 serialNumber; + Atom name; +#endif +} CursorRec; + +#define CURSOR_REC_SIZE (sizeof(CursorRec) + dixPrivatesSize(PRIVATE_CURSOR)) + +typedef struct _CursorMetric { + unsigned short width, height, xhot, yhot; +} CursorMetricRec; + +typedef struct { + int x, y; + ScreenPtr pScreen; +} HotSpot; + +#endif /* CURSORSTRUCT_H */ diff --git a/include/dix-config-apple-verbatim.h b/include/dix-config-apple-verbatim.h new file mode 100644 index 0000000..f429d20 --- /dev/null +++ b/include/dix-config-apple-verbatim.h @@ -0,0 +1,8 @@ +/* Do not include this file directly. It is included at the end of <dix-config.h> */ + +/* Correctly set _XSERVER64 for OSX fat binaries */ +#if defined(__LP64__) && !defined(_XSERVER64) +#define _XSERVER64 1 +#elif !defined(__LP64__) && defined(_XSERVER64) +#undef _XSERVER64 +#endif diff --git a/include/dix-config.h.in b/include/dix-config.h.in new file mode 100644 index 0000000..d81264d --- /dev/null +++ b/include/dix-config.h.in @@ -0,0 +1,452 @@ +/* dix-config.h.in: not at all generated. -*- c -*- */ + +#ifndef _DIX_CONFIG_H_ +#define _DIX_CONFIG_H_ + +/* Support BigRequests extension */ +#undef BIGREQS + +/* Builder address */ +#undef BUILDERADDR + +/* Operating System Name */ +#undef OSNAME + +/* Operating System Vendor */ +#undef OSVENDOR + +/* Builder string */ +#undef BUILDERSTRING + +/* Default font path */ +#undef COMPILEDDEFAULTFONTPATH + +/* Miscellaneous server configuration files path */ +#undef SERVER_MISC_CONFIG_PATH + +/* Support Composite Extension */ +#undef COMPOSITE + +/* Support Damage extension */ +#undef DAMAGE + +/* Build for darwin with Quartz support */ +#undef DARWIN_WITH_QUARTZ + +/* Use OsVendorVErrorF */ +#undef DDXOSVERRORF + +/* Use ddxBeforeReset */ +#undef DDXBEFORERESET + +/* Build DPMS extension */ +#undef DPMSExtension + +/* Build GLX extension */ +#undef GLXEXT + +/* Build GLX DRI loader */ +#undef GLX_DRI + +/* Path to DRI drivers */ +#undef DRI_DRIVER_PATH + +/* Support XDM-AUTH*-1 */ +#undef HASXDMAUTH + +/* Define to 1 if you have the `getdtablesize' function. */ +#undef HAS_GETDTABLESIZE + +/* Define to 1 if you have the `getifaddrs' function. */ +#undef HAS_GETIFADDRS + +/* Define to 1 if you have the `getpeereid' function. */ +#undef HAS_GETPEEREID + +/* Define to 1 if you have the `getpeerucred' function. */ +#undef HAS_GETPEERUCRED + +/* Define to 1 if you have the `mmap' function. */ +#undef HAS_MMAP + +/* Support SHM */ +#undef HAS_SHM + +/* Have the 'strlcpy' function */ +#undef HAS_STRLCPY + +/* Define to 1 if you have the <asm/mtrr.h> header file. */ +#undef HAVE_ASM_MTRR_H + +/* Has backtrace support */ +#undef HAVE_BACKTRACE + +/* Define to 1 if you have the <byteswap.h> header file. */ +#undef HAVE_BYTESWAP_H + +/* Define to 1 if you have cbrt */ +#undef HAVE_CBRT + +/* Define to 1 if you have the <dbm.h> header file. */ +#undef HAVE_DBM_H + +/* Define to 1 if you have the <dirent.h> header file, and it defines `DIR'. + */ +#undef HAVE_DIRENT_H + +/* Define to 1 if you have the <dlfcn.h> header file. */ +#undef HAVE_DLFCN_H + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Have execinfo.h */ +#undef HAVE_EXECINFO_H + +/* Define to 1 if you have the <fcntl.h> header file. */ +#undef HAVE_FCNTL_H + +/* Define to 1 if you have the `geteuid' function. */ +#undef HAVE_GETEUID + +/* Define to 1 if you have the `getisax' function. */ +#undef HAVE_GETISAX + +/* Define to 1 if you have the `getuid' function. */ +#undef HAVE_GETUID + +/* Define to 1 if you have the `getzoneid' function. */ +#undef HAVE_GETZONEID + +/* Define to 1 if you have the <inttypes.h> header file. */ +#undef HAVE_INTTYPES_H + +/* Have Quartz */ +#undef XQUARTZ + +/* Support application updating through sparkle. */ +#undef XQUARTZ_SPARKLE + +/* Prefix to use for launchd identifiers */ +#undef LAUNCHD_ID_PREFIX + +/* Build a standalone xpbproxy */ +#undef STANDALONE_XPBPROXY + +/* Define to 1 if you have the `m' library (-lm). */ +#undef HAVE_LIBM + +/* Define to 1 if you have the `link' function. */ +#undef HAVE_LINK + +/* Define to 1 if you have the <linux/agpgart.h> header file. */ +#undef HAVE_LINUX_AGPGART_H + +/* Define to 1 if you have the <linux/apm_bios.h> header file. */ +#undef HAVE_LINUX_APM_BIOS_H + +/* Define to 1 if you have the <linux/fb.h> header file. */ +#undef HAVE_LINUX_FB_H + +/* Define to 1 if you have the `mkstemp' function. */ +#undef HAVE_MKSTEMP + +/* Define to 1 if you have the <ndbm.h> header file. */ +#undef HAVE_NDBM_H + +/* Define to 1 if you have the <ndir.h> header file, and it defines `DIR'. */ +#undef HAVE_NDIR_H + +/* Define to 1 if you have the <rpcsvc/dbm.h> header file. */ +#undef HAVE_RPCSVC_DBM_H + +/* Define to use libc SHA1 functions */ +#undef HAVE_SHA1_IN_LIBC + +/* Define to use CommonCrypto SHA1 functions */ +#undef HAVE_SHA1_IN_COMMONCRYPTO + +/* Define to use libmd SHA1 functions */ +#undef HAVE_SHA1_IN_LIBMD + +/* Define to use libgcrypt SHA1 functions */ +#undef HAVE_SHA1_IN_LIBGCRYPT + +/* Define to use libsha1 for SHA1 */ +#undef HAVE_SHA1_IN_LIBSHA1 + +/* Define to 1 if you have the `shmctl64' function. */ +#undef HAVE_SHMCTL64 + +/* Define to 1 if you have the <stdint.h> header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the <stdlib.h> header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the `strchr' function. */ +#undef HAVE_STRCHR + +/* Define to 1 if you have the <strings.h> header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the <string.h> header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strtol' function. */ +#undef HAVE_STRTOL + +/* Define to 1 if SYSV IPC is available */ +#undef HAVE_SYSV_IPC + +/* Define to 1 if you have the <sys/agpio.h> header file. */ +#undef HAVE_SYS_AGPIO_H + +/* Define to 1 if you have the <sys/dir.h> header file, and it defines `DIR'. + */ +#undef HAVE_SYS_DIR_H + +/* Define to 1 if you have the <sys/io.h> header file. */ +#undef HAVE_SYS_IO_H + +/* Define to 1 if you have the <sys/ndir.h> header file, and it defines `DIR'. + */ +#undef HAVE_SYS_NDIR_H + +/* Define to 1 if you have the <sys/stat.h> header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the <sys/types.h> header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have the <sys/utsname.h> header file. */ +#undef HAVE_SYS_UTSNAME_H + +/* Define to 1 if you have the <sys/vm86.h> header file. */ +#undef HAVE_SYS_VM86_H + +/* Define to 1 if you have the <tslib.h> header file. */ +#undef HAVE_TSLIB_H + +/* Define to 1 if you have the <unistd.h> header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the <fnmatch.h> header file. */ +#undef HAVE_FNMATCH_H + +/* Have /dev/urandom */ +#undef HAVE_URANDOM + +/* Define to 1 if you have the `vprintf' function. */ +#undef HAVE_VPRINTF + +/* Define to 1 if you have the `vasprintf' function. */ +#undef HAVE_VASPRINTF + +/* Support IPv6 for TCP connections */ +#undef IPv6 + +/* Support os-specific local connections */ +#undef LOCALCONN + +/* Support MIT-SHM Extension */ +#undef MITSHM + +/* Enable some debugging code */ +#undef DEBUG + +/* Name of package */ +#undef PACKAGE + +/* Internal define for Xinerama */ +#undef PANORAMIX + +/* Overall prefix */ +#undef PROJECTROOT + +/* Support RANDR extension */ +#undef RANDR + +/* Support Record extension */ +#undef XRECORD + +/* Support RENDER extension */ +#undef RENDER + +/* Support X resource extension */ +#undef RES + +/* Support MIT-SCREEN-SAVER extension */ +#undef SCREENSAVER + +/* Support Secure RPC ("SUN-DES-1") authentication for X11 clients */ +#undef SECURE_RPC + +/* Support SHAPE extension */ +#undef SHAPE + +/* Define to 1 on systems derived from System V Release 4 */ +#undef SVR4 + +/* Support TCP socket connections */ +#undef TCPCONN + +/* Enable touchscreen support */ +#undef TOUCHSCREEN + +/* Support tslib touchscreen abstraction library */ +#undef TSLIB + +/* Support UNIX socket connections */ +#undef UNIXCONN + +/* Define to use byteswap macros from <sys/endian.h> */ +#undef USE_SYS_ENDIAN_H + +/* unaligned word accesses behave as expected */ +#undef WORKING_UNALIGNED_INT + +/* Build X string registry */ +#undef XREGISTRY + +/* Build X-ACE extension */ +#undef XACE + +/* Build SELinux extension */ +#undef XSELINUX + +/* Support XCMisc extension */ +#undef XCMISC + +/* Build Security extension */ +#undef XCSECURITY + +/* Support Xdmcp */ +#undef XDMCP + +/* Build XFree86 BigFont extension */ +#undef XF86BIGFONT + +/* Support XFree86 Video Mode extension */ +#undef XF86VIDMODE + +/* Support XFixes extension */ +#undef XFIXES + +/* Build XDGA support */ +#undef XFreeXDGA + +/* Support Xinerama extension */ +#undef XINERAMA + +/* Vendor release */ +#undef XORG_RELEASE + +/* Current Xorg version */ +#undef XORG_VERSION_CURRENT + +/* Xorg release date */ +#undef XORG_DATE + +/* Build Xv Extension */ +#undef XvExtension + +/* Build XvMC Extension */ +#undef XvMCExtension + +/* Support XSync extension */ +#undef XSYNC + +/* Support XTest extension */ +#undef XTEST + +/* Support Xv extension */ +#undef XV + +/* Support DRI extension */ +#undef XF86DRI + +/* Build DRI2 extension */ +#undef DRI2 + +/* Build DBE support */ +#undef DBE + +/* Vendor name */ +#undef XVENDORNAME + +/* Enable GNU and other extensions to the C environment for GLIBC */ +#undef _GNU_SOURCE + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `int' if <sys/types.h> does not define. */ +#undef pid_t + +/* Build Rootless code */ +#undef ROOTLESS + +/* Define to 1 if unsigned long is 64 bits. */ +#undef _XSERVER64 + +/* System is BSD-like */ +#undef CSRG_BASED + +/* Define to 1 if `struct sockaddr_in' has a `sin_len' member */ +#undef BSD44SOCKETS + +/* Support D-Bus */ +#undef HAVE_DBUS + +/* Use libudev for input hotplug */ +#undef CONFIG_UDEV + +/* Use D-Bus for input hotplug */ +#undef CONFIG_NEED_DBUS + +/* Support the D-Bus hotplug API */ +#undef CONFIG_DBUS_API + +/* Support HAL for hotplug */ +#undef CONFIG_HAL + +/* Have a monotonic clock from clock_gettime() */ +#undef MONOTONIC_CLOCK + +/* Define to 1 if the DTrace Xserver provider probes should be built in */ +#undef XSERVER_DTRACE + +/* Define to 16-bit byteswap macro */ +#undef bswap_16 + +/* Define to 32-bit byteswap macro */ +#undef bswap_32 + +/* Define to 64-bit byteswap macro */ +#undef bswap_64 + +/* Need the strcasecmp function. */ +#undef NEED_STRCASECMP + +/* Need the strncasecmp function. */ +#undef NEED_STRNCASECMP + +/* Need the strcasestr function. */ +#undef NEED_STRCASESTR + +/* Define to 1 if you have the `ffs' function. */ +#undef HAVE_FFS + +/* If the compiler supports a TLS storage class define it to that here */ +#undef TLS + +/* Correctly set _XSERVER64 for OSX fat binaries */ +#ifdef __APPLE__ +#include "dix-config-apple-verbatim.h" +#endif + +#endif /* _DIX_CONFIG_H_ */ diff --git a/include/dix.h b/include/dix.h new file mode 100644 index 0000000..12e4b59 --- /dev/null +++ b/include/dix.h @@ -0,0 +1,609 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef DIX_H +#define DIX_H + +#include "callback.h" +#include "gc.h" +#include "window.h" +#include "input.h" +#include "cursor.h" +#include "geext.h" +#include "events.h" +#include <X11/extensions/XI.h> + +#define EARLIER -1 +#define SAMETIME 0 +#define LATER 1 + +#define NullClient ((ClientPtr) 0) +#define REQUEST(type) \ + type *stuff = (type *)client->requestBuffer + + +#define REQUEST_SIZE_MATCH(req)\ + if ((sizeof(req) >> 2) != client->req_len)\ + return(BadLength) + +#define REQUEST_AT_LEAST_SIZE(req) \ + if ((sizeof(req) >> 2) > client->req_len )\ + return(BadLength) + +#define REQUEST_FIXED_SIZE(req, n)\ + if (((sizeof(req) >> 2) > client->req_len) || \ + (((sizeof(req) + (n) + 3) >> 2) != client->req_len)) \ + return(BadLength) + +#define LEGAL_NEW_RESOURCE(id,client)\ + if (!LegalNewID(id,client)) \ + {\ + client->errorValue = id;\ + return BadIDChoice;\ + } + +#define VALIDATE_DRAWABLE_AND_GC(drawID, pDraw, mode)\ + {\ + int rc = dixLookupDrawable(&(pDraw), drawID, client, M_ANY, mode);\ + if (rc != Success)\ + return rc;\ + rc = dixLookupGC(&(pGC), stuff->gc, client, DixUseAccess);\ + if (rc != Success)\ + return rc;\ + if ((pGC->depth != pDraw->depth) || (pGC->pScreen != pDraw->pScreen))\ + return BadMatch;\ + }\ + if (pGC->serialNumber != pDraw->serialNumber)\ + ValidateGC(pDraw, pGC); + + +#define WriteReplyToClient(pClient, size, pReply) { \ + if ((pClient)->swapped) \ + (*ReplySwapVector[((xReq *)(pClient)->requestBuffer)->reqType]) \ + (pClient, (int)(size), pReply); \ + else (void) WriteToClient(pClient, (int)(size), (char *)(pReply)); } + +#define WriteSwappedDataToClient(pClient, size, pbuf) \ + if ((pClient)->swapped) \ + (*(pClient)->pSwapReplyFunc)(pClient, (int)(size), pbuf); \ + else (void) WriteToClient (pClient, (int)(size), (char *)(pbuf)); + +typedef struct _TimeStamp *TimeStampPtr; + +#ifndef _XTYPEDEF_CLIENTPTR +typedef struct _Client *ClientPtr; /* also in misc.h */ +#define _XTYPEDEF_CLIENTPTR +#endif + +typedef struct _WorkQueue *WorkQueuePtr; + +extern _X_EXPORT ClientPtr clients[MAXCLIENTS]; +extern _X_EXPORT ClientPtr serverClient; +extern _X_EXPORT int currentMaxClients; +extern _X_EXPORT char dispatchExceptionAtReset; + +typedef int HWEventQueueType; +typedef HWEventQueueType* HWEventQueuePtr; + +extern _X_EXPORT HWEventQueuePtr checkForInput[2]; + +typedef struct _TimeStamp { + CARD32 months; /* really ~49.7 days */ + CARD32 milliseconds; +} TimeStamp; + +/* dispatch.c */ + +extern _X_EXPORT void SetInputCheck( + HWEventQueuePtr /*c0*/, + HWEventQueuePtr /*c1*/); + +extern _X_EXPORT void CloseDownClient( + ClientPtr /*client*/); + +extern _X_EXPORT void UpdateCurrentTime(void); + +extern _X_EXPORT void UpdateCurrentTimeIf(void); + +extern _X_EXPORT int dixDestroyPixmap( + pointer /*value*/, + XID /*pid*/); + +extern _X_EXPORT void InitClient( + ClientPtr /*client*/, + int /*i*/, + pointer /*ospriv*/); + +extern _X_EXPORT ClientPtr NextAvailableClient( + pointer /*ospriv*/); + +extern _X_EXPORT void SendErrorToClient( + ClientPtr /*client*/, + unsigned int /*majorCode*/, + unsigned int /*minorCode*/, + XID /*resId*/, + int /*errorCode*/); + +extern _X_EXPORT void MarkClientException( + ClientPtr /*client*/); + +extern _X_HIDDEN Bool CreateConnectionBlock(void); +/* dixutils.c */ + +extern _X_EXPORT int CompareISOLatin1Lowered( + unsigned char * /*a*/, + int alen, + unsigned char * /*b*/, + int blen); + +extern _X_EXPORT int dixLookupWindow( + WindowPtr *result, + XID id, + ClientPtr client, + Mask access_mode); + +extern _X_EXPORT int dixLookupDrawable( + DrawablePtr *result, + XID id, + ClientPtr client, + Mask type_mask, + Mask access_mode); + +extern _X_EXPORT int dixLookupGC( + GCPtr *result, + XID id, + ClientPtr client, + Mask access_mode); + +extern _X_EXPORT int dixLookupFontable( + FontPtr *result, + XID id, + ClientPtr client, + Mask access_mode); + +extern _X_EXPORT int dixLookupClient( + ClientPtr *result, + XID id, + ClientPtr client, + Mask access_mode); + +extern _X_EXPORT void NoopDDA(void); + +extern _X_EXPORT int AlterSaveSetForClient( + ClientPtr /*client*/, + WindowPtr /*pWin*/, + unsigned /*mode*/, + Bool /*toRoot*/, + Bool /*map*/); + +extern _X_EXPORT void DeleteWindowFromAnySaveSet( + WindowPtr /*pWin*/); + +extern _X_EXPORT void BlockHandler( + pointer /*pTimeout*/, + pointer /*pReadmask*/); + +extern _X_EXPORT void WakeupHandler( + int /*result*/, + pointer /*pReadmask*/); + +void +EnableLimitedSchedulingLatency(void); + +void +DisableLimitedSchedulingLatency(void); + +typedef void (* WakeupHandlerProcPtr)( + pointer /* blockData */, + int /* result */, + pointer /* pReadmask */); + +extern _X_EXPORT Bool RegisterBlockAndWakeupHandlers( + BlockHandlerProcPtr /*blockHandler*/, + WakeupHandlerProcPtr /*wakeupHandler*/, + pointer /*blockData*/); + +extern _X_EXPORT void RemoveBlockAndWakeupHandlers( + BlockHandlerProcPtr /*blockHandler*/, + WakeupHandlerProcPtr /*wakeupHandler*/, + pointer /*blockData*/); + +extern _X_EXPORT void InitBlockAndWakeupHandlers(void); + +extern _X_EXPORT void ProcessWorkQueue(void); + +extern _X_EXPORT void ProcessWorkQueueZombies(void); + +extern _X_EXPORT Bool QueueWorkProc( + Bool (* /*function*/)( + ClientPtr /*clientUnused*/, + pointer /*closure*/), + ClientPtr /*client*/, + pointer /*closure*/ +); + +typedef Bool (* ClientSleepProcPtr)( + ClientPtr /*client*/, + pointer /*closure*/); + +extern _X_EXPORT Bool ClientSleep( + ClientPtr /*client*/, + ClientSleepProcPtr /* function */, + pointer /*closure*/); + +#ifndef ___CLIENTSIGNAL_DEFINED___ +#define ___CLIENTSIGNAL_DEFINED___ +extern _X_EXPORT Bool ClientSignal( + ClientPtr /*client*/); +#endif /* ___CLIENTSIGNAL_DEFINED___ */ + +extern _X_EXPORT void ClientWakeup( + ClientPtr /*client*/); + +extern _X_EXPORT Bool ClientIsAsleep( + ClientPtr /*client*/); + +/* atom.c */ + +extern _X_EXPORT Atom MakeAtom( + const char * /*string*/, + unsigned /*len*/, + Bool /*makeit*/); + +extern _X_EXPORT Bool ValidAtom( + Atom /*atom*/); + +extern _X_EXPORT const char *NameForAtom( + Atom /*atom*/); + +extern _X_EXPORT void AtomError(void) _X_NORETURN; + +extern _X_EXPORT void FreeAllAtoms(void); + +extern _X_EXPORT void InitAtoms(void); + +/* main.c */ + +extern _X_EXPORT void SetVendorRelease(int release); + +extern _X_EXPORT void SetVendorString(char *string); + +/* events.c */ + +extern void SetMaskForEvent( + int /* deviceid */, + Mask /* mask */, + int /* event */); + +extern _X_EXPORT void ConfineToShape( + DeviceIntPtr /* pDev */, + RegionPtr /* shape */, + int* /* px */, + int* /* py */); + +extern _X_EXPORT Bool IsParent( + WindowPtr /* maybeparent */, + WindowPtr /* child */); + +extern _X_EXPORT WindowPtr GetCurrentRootWindow(DeviceIntPtr pDev); + +extern _X_EXPORT WindowPtr GetSpriteWindow(DeviceIntPtr pDev); + + +extern _X_EXPORT void NoticeEventTime(InternalEvent *ev); + +extern void EnqueueEvent( + InternalEvent * /* ev */, + DeviceIntPtr /* device */); + +extern void ActivatePointerGrab( + DeviceIntPtr /* mouse */, + GrabPtr /* grab */, + TimeStamp /* time */, + Bool /* autoGrab */); + +extern void DeactivatePointerGrab( + DeviceIntPtr /* mouse */); + +extern void ActivateKeyboardGrab( + DeviceIntPtr /* keybd */, + GrabPtr /* grab */, + TimeStamp /* time */, + Bool /* passive */); + +extern void DeactivateKeyboardGrab( + DeviceIntPtr /* keybd */); + +extern BOOL ActivateFocusInGrab( + DeviceIntPtr /* dev */, + WindowPtr /* old */, + WindowPtr /* win */); + +extern void AllowSome( + ClientPtr /* client */, + TimeStamp /* time */, + DeviceIntPtr /* thisDev */, + int /* newState */); + +extern void ReleaseActiveGrabs( + ClientPtr client); + +extern GrabPtr CheckPassiveGrabsOnWindow( + WindowPtr /* pWin */, + DeviceIntPtr /* device */, + DeviceEvent * /* event */, + BOOL /* checkCore */, + BOOL /* activate */); + +extern _X_EXPORT int DeliverEventsToWindow( + DeviceIntPtr /* pWin */, + WindowPtr /* pWin */, + xEventPtr /* pEvents */, + int /* count */, + Mask /* filter */, + GrabPtr /* grab */); + +extern int DeliverDeviceEvents( + WindowPtr /* pWin */, + InternalEvent* /* event */, + GrabPtr /* grab */, + WindowPtr /* stopAt */, + DeviceIntPtr /* dev */); + +extern void InitializeSprite( + DeviceIntPtr /* pDev */, + WindowPtr /* pWin */); + +extern void UpdateSpriteForScreen( + DeviceIntPtr /* pDev */, + ScreenPtr /* pScreen */); + +extern _X_EXPORT void WindowHasNewCursor( + WindowPtr /* pWin */); + +extern Bool CheckDeviceGrabs( + DeviceIntPtr /* device */, + DeviceEvent* /* event */, + WindowPtr /* ancestor */); + +extern void DeliverFocusedEvent( + DeviceIntPtr /* keybd */, + InternalEvent* /* event */, + WindowPtr /* window */); + +extern void DeliverGrabbedEvent( + InternalEvent* /* event */, + DeviceIntPtr /* thisDev */, + Bool /* deactivateGrab */); + +extern void FixKeyState( + DeviceEvent* /* event */, + DeviceIntPtr /* keybd */); + +extern void RecalculateDeliverableEvents( + WindowPtr /* pWin */); + +extern _X_EXPORT int OtherClientGone( + pointer /* value */, + XID /* id */); + +extern void DoFocusEvents( + DeviceIntPtr /* dev */, + WindowPtr /* fromWin */, + WindowPtr /* toWin */, + int /* mode */); + +extern int SetInputFocus( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + Window /* focusID */, + CARD8 /* revertTo */, + Time /* ctime */, + Bool /* followOK */); + +extern int GrabDevice( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + unsigned /* this_mode */, + unsigned /* other_mode */, + Window /* grabWindow */, + unsigned /* ownerEvents */, + Time /* ctime */, + GrabMask* /* mask */, + int /* grabtype */, + Cursor /* curs */, + Window /* confineToWin */, + CARD8 * /* status */); + +extern void InitEvents(void); + +extern void CloseDownEvents(void); + +extern void DeleteWindowFromAnyEvents( + WindowPtr /* pWin */, + Bool /* freeResources */); + + +extern Mask EventMaskForClient( + WindowPtr /* pWin */, + ClientPtr /* client */); + + + +extern _X_EXPORT int DeliverEvents( + WindowPtr /*pWin*/, + xEventPtr /*xE*/, + int /*count*/, + WindowPtr /*otherParent*/); + +extern Bool CheckMotion( + DeviceEvent* /* ev */, + DeviceIntPtr /* pDev */); + +extern _X_EXPORT void WriteEventsToClient( + ClientPtr /*pClient*/, + int /*count*/, + xEventPtr /*events*/); + +extern _X_EXPORT int TryClientEvents( + ClientPtr /*client*/, + DeviceIntPtr /* device */, + xEventPtr /*pEvents*/, + int /*count*/, + Mask /*mask*/, + Mask /*filter*/, + GrabPtr /*grab*/); + +extern _X_EXPORT void WindowsRestructured(void); + +extern int SetClientPointer( + ClientPtr /* client */, + DeviceIntPtr /* device */); + +extern _X_EXPORT DeviceIntPtr PickPointer( + ClientPtr /* client */); + +extern _X_EXPORT DeviceIntPtr PickKeyboard( + ClientPtr /* client */); + +extern Bool IsInterferingGrab( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + xEvent* /* events */); + +#ifdef PANORAMIX +extern _X_EXPORT void ReinitializeRootWindow(WindowPtr win, int xoff, int yoff); +#endif + +#ifdef RANDR +extern _X_EXPORT void +ScreenRestructured (ScreenPtr pScreen); +#endif + +extern _X_EXPORT int ffs(int i); + + +/* + * ServerGrabCallback stuff + */ + +extern _X_EXPORT CallbackListPtr ServerGrabCallback; + +typedef enum {SERVER_GRABBED, SERVER_UNGRABBED, + CLIENT_PERVIOUS, CLIENT_IMPERVIOUS } ServerGrabState; + +typedef struct { + ClientPtr client; + ServerGrabState grabstate; +} ServerGrabInfoRec; + +/* + * EventCallback stuff + */ + +extern _X_EXPORT CallbackListPtr EventCallback; + +typedef struct { + ClientPtr client; + xEventPtr events; + int count; +} EventInfoRec; + +/* + * DeviceEventCallback stuff + */ + +extern _X_EXPORT CallbackListPtr DeviceEventCallback; + +typedef struct { + InternalEvent *event; + DeviceIntPtr device; +} DeviceEventInfoRec; + +extern int XItoCoreType(int xi_type); +extern Bool DevHasCursor(DeviceIntPtr pDev); +extern Bool _X_EXPORT IsPointerDevice( DeviceIntPtr dev); +extern Bool _X_EXPORT IsKeyboardDevice(DeviceIntPtr dev); +extern Bool IsPointerEvent(InternalEvent *event); +extern _X_EXPORT Bool IsMaster(DeviceIntPtr dev); + +extern _X_HIDDEN void CopyKeyClass(DeviceIntPtr device, DeviceIntPtr master); +extern _X_HIDDEN int CorePointerProc(DeviceIntPtr dev, int what); +extern _X_HIDDEN int CoreKeyboardProc(DeviceIntPtr dev, int what); + + +/* + * These are deprecated compatibility functions and will be removed soon! + * Please use the noted replacements instead. + */ +/* replaced by dixLookupWindow */ +extern _X_EXPORT WindowPtr SecurityLookupWindow( + XID id, + ClientPtr client, + Mask access_mode); +/* replaced by dixLookupWindow */ +extern _X_EXPORT WindowPtr LookupWindow( + XID id, + ClientPtr client); + +/* replaced by dixLookupDrawable */ +extern _X_EXPORT pointer SecurityLookupDrawable( + XID id, + ClientPtr client, + Mask access_mode); + +/* replaced by dixLookupDrawable */ +extern _X_EXPORT pointer LookupDrawable( + XID id, + ClientPtr client); + +/* replaced by dixLookupClient */ +extern _X_EXPORT ClientPtr LookupClient( + XID id, + ClientPtr client); + +#endif /* DIX_H */ diff --git a/include/dixaccess.h b/include/dixaccess.h new file mode 100644 index 0000000..7180acd --- /dev/null +++ b/include/dixaccess.h @@ -0,0 +1,54 @@ +/*********************************************************** + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +******************************************************************/ + +#ifndef DIX_ACCESS_H +#define DIX_ACCESS_H + +/* These are the access modes that can be passed in the last parameter + * to several of the dix lookup functions. They were originally part + * of the Security extension, now used by XACE. + * + * You can or these values together to indicate multiple modes + * simultaneously. + */ + +#define DixUnknownAccess 0 /* don't know intentions */ +#define DixReadAccess (1<<0) /* inspecting the object */ +#define DixWriteAccess (1<<1) /* changing the object */ +#define DixDestroyAccess (1<<2) /* destroying the object */ +#define DixCreateAccess (1<<3) /* creating the object */ +#define DixGetAttrAccess (1<<4) /* get object attributes */ +#define DixSetAttrAccess (1<<5) /* set object attributes */ +#define DixListPropAccess (1<<6) /* list properties of object */ +#define DixGetPropAccess (1<<7) /* get properties of object */ +#define DixSetPropAccess (1<<8) /* set properties of object */ +#define DixGetFocusAccess (1<<9) /* get focus of object */ +#define DixSetFocusAccess (1<<10) /* set focus of object */ +#define DixListAccess (1<<11) /* list objects */ +#define DixAddAccess (1<<12) /* add object */ +#define DixRemoveAccess (1<<13) /* remove object */ +#define DixHideAccess (1<<14) /* hide object */ +#define DixShowAccess (1<<15) /* show object */ +#define DixBlendAccess (1<<16) /* mix contents of objects */ +#define DixGrabAccess (1<<17) /* exclusive access to object */ +#define DixFreezeAccess (1<<18) /* freeze status of object */ +#define DixForceAccess (1<<19) /* force status of object */ +#define DixInstallAccess (1<<20) /* install object */ +#define DixUninstallAccess (1<<21) /* uninstall object */ +#define DixSendAccess (1<<22) /* send to object */ +#define DixReceiveAccess (1<<23) /* receive from object */ +#define DixUseAccess (1<<24) /* use object */ +#define DixManageAccess (1<<25) /* manage object */ +#define DixDebugAccess (1<<26) /* debug object */ +#define DixBellAccess (1<<27) /* audible sound */ +#define DixPostAccess (1<<28) /* post or follow-up call */ + +#endif /* DIX_ACCESS_H */ diff --git a/include/dixevents.h b/include/dixevents.h new file mode 100644 index 0000000..b915345 --- /dev/null +++ b/include/dixevents.h @@ -0,0 +1,91 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef DIXEVENTS_H +#define DIXEVENTS_H + +extern _X_EXPORT void SetCriticalEvent(int /* event */); + +extern _X_EXPORT CursorPtr GetSpriteCursor(DeviceIntPtr /*pDev*/); + +extern _X_EXPORT int ProcAllowEvents(ClientPtr /* client */); + +extern _X_EXPORT int MaybeDeliverEventsToClient( + WindowPtr /* pWin */, + xEvent * /* pEvents */, + int /* count */, + Mask /* filter */, + ClientPtr /* dontClient */); + +extern _X_EXPORT int ProcWarpPointer(ClientPtr /* client */); + +extern _X_EXPORT int EventSelectForWindow( + WindowPtr /* pWin */, + ClientPtr /* client */, + Mask /* mask */); + +extern _X_EXPORT int EventSuppressForWindow( + WindowPtr /* pWin */, + ClientPtr /* client */, + Mask /* mask */, + Bool * /* checkOptional */); + +extern _X_EXPORT int ProcSetInputFocus(ClientPtr /* client */); + +extern _X_EXPORT int ProcGetInputFocus(ClientPtr /* client */); + +extern _X_EXPORT int ProcGrabPointer(ClientPtr /* client */); + +extern _X_EXPORT int ProcChangeActivePointerGrab(ClientPtr /* client */); + +extern _X_EXPORT int ProcUngrabPointer(ClientPtr /* client */); + +extern _X_EXPORT int ProcGrabKeyboard(ClientPtr /* client */); + +extern _X_EXPORT int ProcUngrabKeyboard(ClientPtr /* client */); + +extern _X_EXPORT int ProcQueryPointer(ClientPtr /* client */); + +extern _X_EXPORT int ProcSendEvent(ClientPtr /* client */); + +extern _X_EXPORT int ProcUngrabKey(ClientPtr /* client */); + +extern _X_EXPORT int ProcGrabKey(ClientPtr /* client */); + +extern _X_EXPORT int ProcGrabButton(ClientPtr /* client */); + +extern _X_EXPORT int ProcUngrabButton(ClientPtr /* client */); + +extern _X_EXPORT int ProcRecolorCursor(ClientPtr /* client */); + +#ifdef PANORAMIX +extern _X_EXPORT void PostSyntheticMotion(DeviceIntPtr pDev, + int x, + int y, + int screen, + unsigned long time); +#endif + +#endif /* DIXEVENTS_H */ diff --git a/include/dixfont.h b/include/dixfont.h new file mode 100644 index 0000000..617b94a --- /dev/null +++ b/include/dixfont.h @@ -0,0 +1,184 @@ +/*********************************************************** +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef DIXFONT_H +#define DIXFONT_H 1 + +#include "dix.h" +#include <X11/fonts/font.h> +#include "closure.h" +#include <X11/fonts/fontstruct.h> + +#define NullDIXFontProp ((DIXFontPropPtr)0) + +typedef struct _DIXFontProp *DIXFontPropPtr; + +extern _X_EXPORT Bool SetDefaultFont(char * /*defaultfontname*/); + +extern _X_EXPORT void QueueFontWakeup(FontPathElementPtr /*fpe*/); + +extern _X_EXPORT void RemoveFontWakeup(FontPathElementPtr /*fpe*/); + +extern _X_EXPORT void FontWakeup(pointer /*data*/, + int /*count*/, + pointer /*LastSelectMask*/); + +extern _X_EXPORT int OpenFont(ClientPtr /*client*/, + XID /*fid*/, + Mask /*flags*/, + unsigned /*lenfname*/, + char * /*pfontname*/); + +extern _X_EXPORT int CloseFont(pointer /*pfont*/, + XID /*fid*/); + +typedef struct _xQueryFontReply *xQueryFontReplyPtr; + +extern _X_EXPORT void QueryFont(FontPtr /*pFont*/, + xQueryFontReplyPtr /*pReply*/, + int /*nProtoCCIStructs*/); + +extern _X_EXPORT int ListFonts(ClientPtr /*client*/, + unsigned char * /*pattern*/, + unsigned int /*length*/, + unsigned int /*max_names*/); + +extern _X_EXPORT int +doListFontsWithInfo(ClientPtr /*client*/, + LFWIclosurePtr /*c*/); + +extern _X_EXPORT int doPolyText(ClientPtr /*client*/, + PTclosurePtr /*c*/ +); + +extern _X_EXPORT int PolyText(ClientPtr /*client*/, + DrawablePtr /*pDraw*/, + GCPtr /*pGC*/, + unsigned char * /*pElt*/, + unsigned char * /*endReq*/, + int /*xorg*/, + int /*yorg*/, + int /*reqType*/, + XID /*did*/); + +extern _X_EXPORT int doImageText(ClientPtr /*client*/, + ITclosurePtr /*c*/); + +extern _X_EXPORT int ImageText(ClientPtr /*client*/, + DrawablePtr /*pDraw*/, + GCPtr /*pGC*/, + int /*nChars*/, + unsigned char * /*data*/, + int /*xorg*/, + int /*yorg*/, + int /*reqType*/, + XID /*did*/); + +extern _X_EXPORT int SetFontPath(ClientPtr /*client*/, + int /*npaths*/, + unsigned char * /*paths*/); + +extern _X_EXPORT int SetDefaultFontPath(char * /*path*/); + +extern _X_EXPORT int GetFontPath(ClientPtr client, + int *count, + int *length, + unsigned char **result); + +extern _X_EXPORT void DeleteClientFontStuff(ClientPtr /*client*/); + +/* Quartz support on Mac OS X pulls in the QuickDraw + framework whose InitFonts function conflicts here. */ +#ifdef __APPLE__ +#define InitFonts Darwin_X_InitFonts +#endif +extern _X_EXPORT void InitFonts(void); + +extern _X_EXPORT void FreeFonts(void); + +extern _X_EXPORT FontPtr find_old_font(XID /*id*/); + +extern _X_EXPORT void GetGlyphs(FontPtr /*font*/, + unsigned long /*count*/, + unsigned char * /*chars*/, + FontEncoding /*fontEncoding*/, + unsigned long * /*glyphcount*/, + CharInfoPtr * /*glyphs*/); + +extern _X_EXPORT void QueryGlyphExtents(FontPtr /*pFont*/, + CharInfoPtr * /*charinfo*/, + unsigned long /*count*/, + ExtentInfoPtr /*info*/); + +extern _X_EXPORT Bool QueryTextExtents(FontPtr /*pFont*/, + unsigned long /*count*/, + unsigned char * /*chars*/, + ExtentInfoPtr /*info*/); + +extern _X_EXPORT Bool ParseGlyphCachingMode(char * /*str*/); + +extern _X_EXPORT void InitGlyphCaching(void); + +extern _X_EXPORT void SetGlyphCachingMode(int /*newmode*/); + +extern _X_EXPORT void register_fpe_functions(void); + +/* + * libXfont stubs. + */ +extern _X_EXPORT int client_auth_generation(ClientPtr client); + +extern _X_EXPORT void DeleteFontClientID(Font id); + +extern _X_EXPORT FontResolutionPtr GetClientResolutions(int *num); + +extern _X_EXPORT int GetDefaultPointSize(void); + +extern _X_EXPORT Font GetNewFontClientID(void); + +extern _X_EXPORT int init_fs_handlers(FontPathElementPtr fpe, + BlockHandlerProcPtr block_handler); + +extern _X_EXPORT int RegisterFPEFunctions(NameCheckFunc name_func, + InitFpeFunc init_func, + FreeFpeFunc free_func, + ResetFpeFunc reset_func, + OpenFontFunc open_func, + CloseFontFunc close_func, + ListFontsFunc list_func, + StartLfwiFunc start_lfwi_func, + NextLfwiFunc next_lfwi_func, + WakeupFpeFunc wakeup_func, + ClientDiedFunc client_died, + LoadGlyphsFunc load_glyphs, + StartLaFunc start_list_alias_func, + NextLaFunc next_list_alias_func, + SetPathFunc set_path_func); + +extern _X_EXPORT void remove_fs_handlers(FontPathElementPtr fpe, + BlockHandlerProcPtr blockHandler, + Bool all); + +extern _X_EXPORT int StoreFontClientFont(FontPtr pfont, Font id); + +#endif /* DIXFONT_H */ diff --git a/include/dixfontstr.h b/include/dixfontstr.h new file mode 100644 index 0000000..c559e86 --- /dev/null +++ b/include/dixfontstr.h @@ -0,0 +1,93 @@ +/*********************************************************** +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef DIXFONTSTRUCT_H +#define DIXFONTSTRUCT_H + +#include "servermd.h" +#include "dixfont.h" +#include <X11/fonts/fontstruct.h> +#include "closure.h" +#include <X11/Xproto.h> /* for xQueryFontReply */ + +#define FONTCHARSET(font) (font) +#define FONTMAXBOUNDS(font,field) (font)->info.maxbounds.field +#define FONTMINBOUNDS(font,field) (font)->info.minbounds.field +#define TERMINALFONT(font) (font)->info.terminalFont +#define FONTASCENT(font) (font)->info.fontAscent +#define FONTDESCENT(font) (font)->info.fontDescent +#define FONTGLYPHS(font) 0 +#define FONTCONSTMETRICS(font) (font)->info.constantMetrics +#define FONTCONSTWIDTH(font) (font)->info.constantWidth +#define FONTALLEXIST(font) (font)->info.allExist +#define FONTFIRSTCOL(font) (font)->info.firstCol +#define FONTLASTCOL(font) (font)->info.lastCol +#define FONTFIRSTROW(font) (font)->info.firstRow +#define FONTLASTROW(font) (font)->info.lastRow +#define FONTDEFAULTCH(font) (font)->info.defaultCh +#define FONTINKMIN(font) (&((font)->info.ink_minbounds)) +#define FONTINKMAX(font) (&((font)->info.ink_maxbounds)) +#define FONTPROPS(font) (font)->info.props +#define FONTGLYPHBITS(base,pci) ((unsigned char *) (pci)->bits) +#define FONTINFONPROPS(font) (font)->info.nprops + +/* some things haven't changed names, but we'll be careful anyway */ + +#define FONTREFCNT(font) (font)->refcnt + +/* + * for linear char sets + */ +#define N1dChars(pfont) (FONTLASTCOL(pfont) - FONTFIRSTCOL(pfont) + 1) + +/* + * for 2D char sets + */ +#define N2dChars(pfont) (N1dChars(pfont) * \ + (FONTLASTROW(pfont) - FONTFIRSTROW(pfont) + 1)) + +#ifndef GLYPHPADBYTES +#define GLYPHPADBYTES -1 +#endif + +#if GLYPHPADBYTES == 0 || GLYPHPADBYTES == 1 +#define GLYPHWIDTHBYTESPADDED(pci) (GLYPHWIDTHBYTES(pci)) +#define PADGLYPHWIDTHBYTES(w) (((w)+7)>>3) +#endif + +#if GLYPHPADBYTES == 2 +#define GLYPHWIDTHBYTESPADDED(pci) ((GLYPHWIDTHBYTES(pci)+1) & ~0x1) +#define PADGLYPHWIDTHBYTES(w) (((((w)+7)>>3)+1) & ~0x1) +#endif + +#if GLYPHPADBYTES == 4 +#define GLYPHWIDTHBYTESPADDED(pci) ((GLYPHWIDTHBYTES(pci)+3) & ~0x3) +#define PADGLYPHWIDTHBYTES(w) (((((w)+7)>>3)+3) & ~0x3) +#endif + +#if GLYPHPADBYTES == 8 /* for a cray? */ +#define GLYPHWIDTHBYTESPADDED(pci) ((GLYPHWIDTHBYTES(pci)+7) & ~0x7) +#define PADGLYPHWIDTHBYTES(w) (((((w)+7)>>3)+7) & ~0x7) +#endif + +#endif /* DIXFONTSTRUCT_H */ diff --git a/include/dixgrabs.h b/include/dixgrabs.h new file mode 100644 index 0000000..3b2a46d --- /dev/null +++ b/include/dixgrabs.h @@ -0,0 +1,60 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef DIXGRABS_H +#define DIXGRABS_H 1 + +struct _GrabParameters; + +extern GrabPtr CreateGrab( + int /* client */, + DeviceIntPtr /* device */, + DeviceIntPtr /* modDevice */, + WindowPtr /* window */, + GrabType /* grabtype */, + GrabMask * /* mask */, + struct _GrabParameters * /* param */, + int /* type */, + KeyCode /* keybut */, + WindowPtr /* confineTo */, + CursorPtr /* cursor */); + +extern _X_EXPORT int DeletePassiveGrab( + pointer /* value */, + XID /* id */); + +extern _X_EXPORT Bool GrabMatchesSecond( + GrabPtr /* pFirstGrab */, + GrabPtr /* pSecondGrab */, + Bool /*ignoreDevice*/); + +extern _X_EXPORT int AddPassiveGrabToList( + ClientPtr /* client */, + GrabPtr /* pGrab */); + +extern _X_EXPORT Bool DeletePassiveGrabFromList( + GrabPtr /* pMinuendGrab */); + +#endif /* DIXGRABS_H */ diff --git a/include/dixstruct.h b/include/dixstruct.h new file mode 100644 index 0000000..8547b16 --- /dev/null +++ b/include/dixstruct.h @@ -0,0 +1,190 @@ +/*********************************************************** +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef DIXSTRUCT_H +#define DIXSTRUCT_H + +#include "dix.h" +#include "resource.h" +#include "cursor.h" +#include "gc.h" +#include "pixmap.h" +#include "privates.h" +#include <X11/Xmd.h> + +/* + * direct-mapped hash table, used by resource manager to store + * translation from client ids to server addresses. + */ + +extern _X_EXPORT CallbackListPtr ClientStateCallback; + +typedef struct { + ClientPtr client; + xConnSetupPrefix *prefix; + xConnSetup *setup; +} NewClientInfoRec; + +typedef void (*ReplySwapPtr) ( + ClientPtr /* pClient */, + int /* size */, + void * /* pbuf */); + +extern _X_EXPORT void ReplyNotSwappd ( + ClientPtr /* pClient */, + int /* size */, + void * /* pbuf */) _X_NORETURN; + +typedef enum {ClientStateInitial, + ClientStateAuthenticating, + ClientStateRunning, + ClientStateRetained, + ClientStateGone, + ClientStateCheckingSecurity, + ClientStateCheckedSecurity} ClientState; + +#ifdef XFIXES +typedef struct _saveSet { + struct _Window *windowPtr; + Bool toRoot; + Bool map; +} SaveSetElt; +#define SaveSetWindow(ss) ((ss).windowPtr) +#define SaveSetToRoot(ss) ((ss).toRoot) +#define SaveSetShouldMap(ss) ((ss).map) +#define SaveSetAssignWindow(ss,w) ((ss).windowPtr = (w)) +#define SaveSetAssignToRoot(ss,tr) ((ss).toRoot = (tr)) +#define SaveSetAssignMap(ss,m) ((ss).map = (m)) +#else +typedef struct _Window *SaveSetElt; +#define SaveSetWindow(ss) (ss) +#define SaveSetToRoot(ss) FALSE +#define SaveSetShouldMap(ss) TRUE +#define SaveSetAssignWindow(ss,w) ((ss) = (w)) +#define SaveSetAssignToRoot(ss,tr) +#define SaveSetAssignMap(ss,m) +#endif + +typedef struct _Client { + int index; + Mask clientAsMask; + pointer requestBuffer; + pointer osPrivate; /* for OS layer, including scheduler */ + Bool swapped; + ReplySwapPtr pSwapReplyFunc; + XID errorValue; + int sequence; + int closeDownMode; + int clientGone; + int noClientException; /* this client died or needs to be + * killed */ + int ignoreCount; /* count for Attend/IgnoreClient */ + SaveSetElt *saveSet; + int numSaved; + int (**requestVector) ( + ClientPtr /* pClient */); + CARD32 req_len; /* length of current request */ + Bool big_requests; /* supports large requests */ + int priority; + ClientState clientState; + PrivateRec *devPrivates; + unsigned short xkbClientFlags; + unsigned short mapNotifyMask; + unsigned short newKeyboardNotifyMask; + unsigned short vMajor,vMinor; + KeyCode minKC,maxKC; + + unsigned long replyBytesRemaining; + int smart_priority; + long smart_start_tick; + long smart_stop_tick; + long smart_check_tick; + + DeviceIntPtr clientPtr; +} ClientRec; + +/* + * Scheduling interface + */ +extern _X_EXPORT long SmartScheduleTime; +extern _X_EXPORT long SmartScheduleInterval; +extern _X_EXPORT long SmartScheduleSlice; +extern _X_EXPORT long SmartScheduleMaxSlice; +extern _X_EXPORT Bool SmartScheduleDisable; +extern _X_EXPORT void SmartScheduleStartTimer(void); +extern _X_EXPORT void SmartScheduleStopTimer(void); +#define SMART_MAX_PRIORITY (20) +#define SMART_MIN_PRIORITY (-20) + +extern _X_EXPORT void SmartScheduleInit(void); + + +/* This prototype is used pervasively in Xext, dix */ +#define DISPATCH_PROC(func) int func(ClientPtr /* client */) + +typedef struct _WorkQueue { + struct _WorkQueue *next; + Bool (*function) ( + ClientPtr /* pClient */, + pointer /* closure */ +); + ClientPtr client; + pointer closure; +} WorkQueueRec; + +extern _X_EXPORT TimeStamp currentTime; +extern _X_EXPORT TimeStamp lastDeviceEventTime; + +extern _X_EXPORT int CompareTimeStamps( + TimeStamp /*a*/, + TimeStamp /*b*/); + +extern _X_EXPORT TimeStamp ClientTimeToServerTime(CARD32 /*c*/); + +typedef struct _CallbackRec { + CallbackProcPtr proc; + pointer data; + Bool deleted; + struct _CallbackRec *next; +} CallbackRec, *CallbackPtr; + +typedef struct _CallbackList { + int inCallback; + Bool deleted; + int numDeleted; + CallbackPtr list; +} CallbackListRec; + +/* proc vectors */ + +extern _X_EXPORT int (* InitialVector[3]) (ClientPtr /*client*/); + +extern _X_EXPORT int (* ProcVector[256]) (ClientPtr /*client*/); + +extern _X_EXPORT int (* SwappedProcVector[256]) (ClientPtr /*client*/); + +extern _X_EXPORT ReplySwapPtr ReplySwapVector[256]; + +extern _X_EXPORT int ProcBadRequest(ClientPtr /*client*/); + +#endif /* DIXSTRUCT_H */ diff --git a/include/do-not-use-config.h.in b/include/do-not-use-config.h.in new file mode 100644 index 0000000..7427a6d --- /dev/null +++ b/include/do-not-use-config.h.in @@ -0,0 +1,794 @@ +/* include/do-not-use-config.h.in. Generated from configure.ac by autoheader. */ + +/* Define if building universal (internal helper macro) */ +#undef AC_APPLE_UNIVERSAL_BUILD + +/* Build AIGLX loader */ +#undef AIGLX + +/* Default base font path */ +#undef BASE_FONT_PATH + +/* Support BigRequests extension */ +#undef BIGREQS + +/* Define to 1 if `struct sockaddr_in' has a `sin_len' member */ +#undef BSD44SOCKETS + +/* Builder address */ +#undef BUILDERADDR + +/* Builder string */ +#undef BUILDERSTRING + +/* Default font path */ +#undef COMPILEDDEFAULTFONTPATH + +/* Support Composite Extension */ +#undef COMPOSITE + +/* Use the D-Bus input configuration API */ +#undef CONFIG_DBUS_API + +/* Use the HAL hotplug API */ +#undef CONFIG_HAL + +/* Use D-Bus for input hotplug */ +#undef CONFIG_NEED_DBUS + +/* Use libudev for input hotplug */ +#undef CONFIG_UDEV + +/* Define to one of `_getb67', `GETB67', `getb67' for Cray-2 and Cray-YMP + systems. This function is required for `alloca.c' support on those systems. + */ +#undef CRAY_STACKSEG_END + +/* System is BSD-like */ +#undef CSRG_BASED + +/* Simple debug messages */ +#undef CYGDEBUG + +/* Debug window manager */ +#undef CYGMULTIWINDOW_DEBUG + +/* Debug messages for window handling */ +#undef CYGWINDOWING_DEBUG + +/* Define to 1 if using `alloca.c'. */ +#undef C_ALLOCA + +/* Support Damage extension */ +#undef DAMAGE + +/* Support DBE extension */ +#undef DBE + +/* Use ddxBeforeReset */ +#undef DDXBEFORERESET + +/* Use OsVendorVErrorF */ +#undef DDXOSVERRORF + +/* Enable debugging code */ +#undef DEBUG + +/* Default library install path */ +#undef DEFAULT_LIBRARY_PATH + +/* Default log location */ +#undef DEFAULT_LOGDIR + +/* Default log location */ +#undef DEFAULT_LOGPREFIX + +/* Default module search path */ +#undef DEFAULT_MODULE_PATH + +/* Support DGA extension */ +#undef DGA + +/* Support DPMS extension */ +#undef DPMSExtension + +/* Build DRI2 extension */ +#undef DRI2 + +/* Build DRI2 AIGLX loader */ +#undef DRI2_AIGLX + +/* Default DRI driver path */ +#undef DRI_DRIVER_PATH + +/* Build GLX extension */ +#undef GLXEXT + +/* Support XDM-AUTH*-1 */ +#undef HASXDMAUTH + +/* System has /dev/xf86 aperture driver */ +#undef HAS_APERTURE_DRV + +/* Cygwin has /dev/windows for signaling new win32 messages */ +#undef HAS_DEVWINDOWS + +/* Have the 'getdtablesize' function. */ +#undef HAS_GETDTABLESIZE + +/* Have the 'getifaddrs' function. */ +#undef HAS_GETIFADDRS + +/* Have the 'getpeereid' function. */ +#undef HAS_GETPEEREID + +/* Have the 'getpeerucred' function. */ +#undef HAS_GETPEERUCRED + +/* Have the 'mmap' function. */ +#undef HAS_MMAP + +/* Define to 1 if NetBSD built-in MTRR support is available */ +#undef HAS_MTRR_BUILTIN + +/* MTRR support available */ +#undef HAS_MTRR_SUPPORT + +/* Support SHM */ +#undef HAS_SHM + +/* Have the 'strlcpy' function */ +#undef HAS_STRLCPY + +/* Use Windows sockets */ +#undef HAS_WINSOCK + +/* Define to 1 if you have `alloca', as a function or macro. */ +#undef HAVE_ALLOCA + +/* Define to 1 if you have <alloca.h> and it should be used (not on Ultrix). + */ +#undef HAVE_ALLOCA_H + +/* Define to 1 if you have the <asm/mtrr.h> header file. */ +#undef HAVE_ASM_MTRR_H + +/* Define to 1 if you have the `authdes_create' function. */ +#undef HAVE_AUTHDES_CREATE + +/* Define to 1 if you have the `authdes_seccreate' function. */ +#undef HAVE_AUTHDES_SECCREATE + +/* Has backtrace support */ +#undef HAVE_BACKTRACE + +/* Define to 1 if you have the <byteswap.h> header file. */ +#undef HAVE_BYTESWAP_H + +/* Have the 'cbrt' function */ +#undef HAVE_CBRT + +/* Define to 1 if you have the `clock_gettime' function. */ +#undef HAVE_CLOCK_GETTIME + +/* Define to 1 if you have the <dbm.h> header file. */ +#undef HAVE_DBM_H + +/* Have D-Bus support */ +#undef HAVE_DBUS + +/* Define to 1 if you have the <dirent.h> header file, and it defines `DIR'. + */ +#undef HAVE_DIRENT_H + +/* Define to 1 if you have the <dlfcn.h> header file. */ +#undef HAVE_DLFCN_H + +/* Define to 1 if you don't have `vprintf' but do have `_doprnt.' */ +#undef HAVE_DOPRNT + +/* Have execinfo.h */ +#undef HAVE_EXECINFO_H + +/* Define to 1 if you have the <fcntl.h> header file. */ +#undef HAVE_FCNTL_H + +/* Define to 1 if you have the `ffs' function. */ +#undef HAVE_FFS + +/* Define to 1 if you have the <fnmatch.h> header file. */ +#undef HAVE_FNMATCH_H + +/* Define to 1 if you have the `geteuid' function. */ +#undef HAVE_GETEUID + +/* Define to 1 if you have the `getisax' function. */ +#undef HAVE_GETISAX + +/* Define to 1 if you have the `getopt' function. */ +#undef HAVE_GETOPT + +/* Define to 1 if you have the `getopt_long' function. */ +#undef HAVE_GETOPT_LONG + +/* Define to 1 if you have the `getuid' function. */ +#undef HAVE_GETUID + +/* Define to 1 if you have the `getzoneid' function. */ +#undef HAVE_GETZONEID + +/* Define to 1 if you have the <inttypes.h> header file. */ +#undef HAVE_INTTYPES_H + +/* Define to 1 if you have the `audit' library (-laudit). */ +#undef HAVE_LIBAUDIT + +/* Define to 1 if you have the <libaudit.h> header file. */ +#undef HAVE_LIBAUDIT_H + +/* Define to 1 if you have the `m' library (-lm). */ +#undef HAVE_LIBM + +/* Define to 1 if you have the `ws2_32' library (-lws2_32). */ +#undef HAVE_LIBWS2_32 + +/* Define to 1 if you have the `link' function. */ +#undef HAVE_LINK + +/* Define to 1 if you have the <linux/agpgart.h> header file. */ +#undef HAVE_LINUX_AGPGART_H + +/* Define to 1 if you have the <linux/apm_bios.h> header file. */ +#undef HAVE_LINUX_APM_BIOS_H + +/* Define to 1 if you have the <linux/fb.h> header file. */ +#undef HAVE_LINUX_FB_H + +/* Define to 1 if you have the <machine/mtrr.h> header file. */ +#undef HAVE_MACHINE_MTRR_H + +/* Define to 1 if you have the `memmove' function. */ +#undef HAVE_MEMMOVE + +/* Define to 1 if you have the <memory.h> header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#undef HAVE_MEMSET + +/* Define to 1 if you have the `mkstemp' function. */ +#undef HAVE_MKSTEMP + +/* Define to 1 if you have the <ndbm.h> header file. */ +#undef HAVE_NDBM_H + +/* Define to 1 if you have the <ndir.h> header file, and it defines `DIR'. */ +#undef HAVE_NDIR_H + +/* Define to 1 if you have the `pci_device_enable' function. */ +#undef HAVE_PCI_DEVICE_ENABLE + +/* Define to 1 if you have the `pci_device_is_boot_vga' function. */ +#undef HAVE_PCI_DEVICE_IS_BOOT_VGA + +/* Define to 1 if you have the `pci_device_vgaarb_init' function. */ +#undef HAVE_PCI_DEVICE_VGAARB_INIT + +/* Define to 1 if you have the `pci_system_init_dev_mem' function. */ +#undef HAVE_PCI_SYSTEM_INIT_DEV_MEM + +/* Define to 1 if you have the <rpcsvc/dbm.h> header file. */ +#undef HAVE_RPCSVC_DBM_H + +/* Use CommonCrypto SHA1 functions */ +#undef HAVE_SHA1_IN_COMMONCRYPTO + +/* Use libc SHA1 functions */ +#undef HAVE_SHA1_IN_LIBC + +/* Use libgcrypt SHA1 functions */ +#undef HAVE_SHA1_IN_LIBGCRYPT + +/* Use libmd SHA1 functions */ +#undef HAVE_SHA1_IN_LIBMD + +/* Use libsha1 for SHA1 */ +#undef HAVE_SHA1_IN_LIBSHA1 + +/* Define to 1 if you have the `shmctl64' function. */ +#undef HAVE_SHMCTL64 + +/* Define to 1 if the system has the type `socklen_t'. */ +#undef HAVE_SOCKLEN_T + +/* Define to 1 if you have the <stdint.h> header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the <stdlib.h> header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the `strcasestr' function. */ +#undef HAVE_STRCASESTR + +/* Define to 1 if you have the `strchr' function. */ +#undef HAVE_STRCHR + +/* Define to 1 if you have the <strings.h> header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the <string.h> header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the <stropts.h> header file. */ +#undef HAVE_STROPTS_H + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strtol' function. */ +#undef HAVE_STRTOL + +/* Define to 1 if SYSV IPC is available */ +#undef HAVE_SYSV_IPC + +/* Define to 1 if you have the <sys/agpgart.h> header file. */ +#undef HAVE_SYS_AGPGART_H + +/* Define to 1 if you have the <sys/agpio.h> header file. */ +#undef HAVE_SYS_AGPIO_H + +/* Define to 1 if you have the <sys/dir.h> header file, and it defines `DIR'. + */ +#undef HAVE_SYS_DIR_H + +/* Define to 1 if you have the <sys/io.h> header file. */ +#undef HAVE_SYS_IO_H + +/* Define to 1 if you have the <sys/kd.h> header file. */ +#undef HAVE_SYS_KD_H + +/* Define to 1 if you have the <sys/linker.h> header file. */ +#undef HAVE_SYS_LINKER_H + +/* Define to 1 if you have the <sys/memrange.h> header file. */ +#undef HAVE_SYS_MEMRANGE_H + +/* Define to 1 if you have the <sys/ndir.h> header file, and it defines `DIR'. + */ +#undef HAVE_SYS_NDIR_H + +/* Define to 1 if you have the <sys/stat.h> header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the <sys/types.h> header file. */ +#undef HAVE_SYS_TYPES_H + +/* Define to 1 if you have the <sys/utsname.h> header file. */ +#undef HAVE_SYS_UTSNAME_H + +/* Define to 1 if you have the <sys/vm86.h> header file. */ +#undef HAVE_SYS_VM86_H + +/* Define to 1 if you have the <sys/vt.h> header file. */ +#undef HAVE_SYS_VT_H + +/* Define to 1 if you have the <unistd.h> header file. */ +#undef HAVE_UNISTD_H + +/* Define to 1 if you have the `vasprintf' function. */ +#undef HAVE_VASPRINTF + +/* Define to 1 if you have the `vprintf' function. */ +#undef HAVE_VPRINTF + +/* Define to 1 if you have the `vsnprintf' function. */ +#undef HAVE_VSNPRINTF + +/* Define to 1 if you have the `walkcontext' function. */ +#undef HAVE_WALKCONTEXT + +/* Support IPv6 for TCP connections */ +#undef IPv6 + +/* Build kdrive ddx */ +#undef KDRIVEDDXACTIONS + +/* Build fbdev-based kdrive server */ +#undef KDRIVEFBDEV + +/* Build Kdrive X server */ +#undef KDRIVESERVER + +/* Enable KDrive evdev driver */ +#undef KDRIVE_EVDEV + +/* Enable KDrive kbd driver */ +#undef KDRIVE_KBD + +/* Enable KDrive mouse driver */ +#undef KDRIVE_MOUSE + +/* Prefix to use for launchd identifiers */ +#undef LAUNCHD_ID_PREFIX + +/* Support os-specific local connections */ +#undef LOCALCONN + +/* Define to the sub-directory in which libtool stores uninstalled libraries. + */ +#undef LT_OBJDIR + +/* Support MIT-SHM extension */ +#undef MITSHM + +/* Have monotonic clock from clock_gettime() */ +#undef MONOTONIC_CLOCK + +/* Do not have 'strcasecmp'. */ +#undef NEED_STRCASECMP + +/* Do not have 'strcasestr'. */ +#undef NEED_STRCASESTR + +/* Do not have 'strncasecmp'. */ +#undef NEED_STRNCASECMP + +/* Need XFree86 helper functions */ +#undef NEED_XF86_PROTOTYPES + +/* Need XFree86 typedefs */ +#undef NEED_XF86_TYPES + +/* Define to 1 if modules should avoid the libcwrapper */ +#undef NO_LIBCWRAPPER + +/* Operating System Name */ +#undef OSNAME + +/* Operating System Vendor */ +#undef OSVENDOR + +/* Name of package */ +#undef PACKAGE + +/* Define to the address where bug reports for this package should be sent. */ +#undef PACKAGE_BUGREPORT + +/* Define to the full name of this package. */ +#undef PACKAGE_NAME + +/* Define to the full name and version of this package. */ +#undef PACKAGE_STRING + +/* Define to the one symbol short name of this package. */ +#undef PACKAGE_TARNAME + +/* Define to the home page for this package. */ +#undef PACKAGE_URL + +/* Define to the version of this package. */ +#undef PACKAGE_VERSION + +/* Major version of this package */ +#undef PACKAGE_VERSION_MAJOR + +/* Minor version of this package */ +#undef PACKAGE_VERSION_MINOR + +/* Patch version of this package */ +#undef PACKAGE_VERSION_PATCHLEVEL + +/* Internal define for Xinerama */ +#undef PANORAMIX + +/* System has PC console */ +#undef PCCONS_SUPPORT + +/* Default PCI text file ID path */ +#undef PCI_TXT_IDS_PATH + +/* System has PC console */ +#undef PCVT_SUPPORT + +/* Overall prefix */ +#undef PROJECTROOT + +/* Support RANDR extension */ +#undef RANDR + +/* Make PROJECT_ROOT relative to the xserver location */ +#undef RELOCATE_PROJECTROOT + +/* Support RENDER extension */ +#undef RENDER + +/* Support X resource extension */ +#undef RES + +/* Define as the return type of signal handlers (`int' or `void'). */ +#undef RETSIGTYPE + +/* Build Rootless code */ +#undef ROOTLESS + +/* Support MIT-SCREEN-SAVER extension */ +#undef SCREENSAVER + +/* Support Secure RPC ("SUN-DES-1") authentication for X11 clients */ +#undef SECURE_RPC + +/* Server miscellaneous config path */ +#undef SERVER_MISC_CONFIG_PATH + +/* Support SHAPE extension */ +#undef SHAPE + +/* The size of `unsigned long', as computed by sizeof. */ +#undef SIZEOF_UNSIGNED_LONG + +/* If using the C implementation of alloca, define if you know the + direction of stack growth for your system; otherwise it will be + automatically deduced at runtime. + STACK_DIRECTION > 0 => grows toward higher addresses + STACK_DIRECTION < 0 => grows toward lower addresses + STACK_DIRECTION = 0 => direction of growth unknown */ +#undef STACK_DIRECTION + +/* Build a standalone xpbproxy */ +#undef STANDALONE_XPBPROXY + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Support PC98 */ +#undef SUPPORT_PC98 + +/* Define to 1 on systems derived from System V Release 4 */ +#undef SVR4 + +/* Location of system.XWinrc */ +#undef SYSCONFDIR + +/* System has syscons console */ +#undef SYSCONS_SUPPORT + +/* Support TCP socket connections */ +#undef TCPCONN + +/* If the compiler supports a TLS storage class define it to that here */ +#undef TLS + +/* Have tslib support */ +#undef TSLIB + +/* Enable unit tests */ +#undef UNITTESTS + +/* Support UNIX socket connections */ +#undef UNIXCONN + +/* NetBSD PIO alpha IO */ +#undef USE_ALPHA_PIO + +/* BSD AMD64 iopl */ +#undef USE_AMD64_IOPL + +/* BSD /dev/io */ +#undef USE_DEV_IO + +/* BSD i386 iopl */ +#undef USE_I386_IOPL + +/* Use SIGIO handlers for input device events by default */ +#undef USE_SIGIO_BY_DEFAULT + +/* Define to use byteswap macros from <sys/endian.h> */ +#undef USE_SYS_ENDIAN_H + +/* Vendor man version */ +#undef VENDOR_MAN_VERSION + +/* Vendor name */ +#undef VENDOR_NAME + +/* Vendor name */ +#undef VENDOR_NAME_SHORT + +/* Vendor release */ +#undef VENDOR_RELEASE + +/* Version number of package */ +#undef VERSION + +/* Building with libdrm support */ +#undef WITH_LIBDRM + +/* Building vgahw module */ +#undef WITH_VGAHW + +/* Define WORDS_BIGENDIAN to 1 if your processor stores words with the most + significant byte first (like Motorola and SPARC, unlike Intel). */ +#if defined AC_APPLE_UNIVERSAL_BUILD +# if defined __BIG_ENDIAN__ +# define WORDS_BIGENDIAN 1 +# endif +#else +# ifndef WORDS_BIGENDIAN +# undef WORDS_BIGENDIAN +# endif +#endif + +/* System has wscons console */ +#undef WSCONS_SUPPORT + +/* Build X-ACE extension */ +#undef XACE + +/* Build XCalibrate extension */ +#undef XCALIBRATE + +/* Support XCMisc extension */ +#undef XCMISC + +/* Build Security extension */ +#undef XCSECURITY + +/* Support XDM Control Protocol */ +#undef XDMCP + +/* Support XF86 Big font extension */ +#undef XF86BIGFONT + +/* Name of configuration file */ +#undef XF86CONFIGFILE + +/* Build DRI extension */ +#undef XF86DRI + +/* Support XFree86 Video Mode extension */ +#undef XF86VIDMODE + +/* Support XFixes extension */ +#undef XFIXES + +/* Building loadable XFree86 server */ +#undef XFree86LOADER + +/* Building XFree86 server */ +#undef XFree86Server + +/* Build XDGA support */ +#undef XFreeXDGA + +/* Support Xinerama extension */ +#undef XINERAMA + +/* Support X Input extension */ +#undef XINPUT + +/* Path to XKB data */ +#undef XKB_BASE_DIRECTORY + +/* Path to XKB bin dir */ +#undef XKB_BIN_DIRECTORY + +/* Default XKB layout */ +#undef XKB_DFLT_LAYOUT + +/* Default XKB model */ +#undef XKB_DFLT_MODEL + +/* Default XKB options */ +#undef XKB_DFLT_OPTIONS + +/* Default XKB ruleset */ +#undef XKB_DFLT_RULES + +/* Default XKB variant */ +#undef XKB_DFLT_VARIANT + +/* Path to XKB output dir */ +#undef XKM_OUTPUT_DIR + +/* Building Xorg server */ +#undef XORGSERVER + +/* Vendor release */ +#undef XORG_DATE + +/* Vendor man version */ +#undef XORG_MAN_VERSION + +/* Building Xorg server */ +#undef XORG_SERVER + +/* Current Xorg version */ +#undef XORG_VERSION_CURRENT + +/* Have Quartz */ +#undef XQUARTZ + +/* Support application updating through sparkle. */ +#undef XQUARTZ_SPARKLE + +/* Support Record extension */ +#undef XRECORD + +/* Build registry module */ +#undef XREGISTRY + +/* Build SELinux extension */ +#undef XSELINUX + +/* Define to 1 if the DTrace Xserver provider probes should be built in. */ +#undef XSERVER_DTRACE + +/* Use libpciaccess for all pci manipulation */ +#undef XSERVER_LIBPCIACCESS + +/* Support XSync extension */ +#undef XSYNC + +/* Support XTest extension */ +#undef XTEST + +/* Support Xv extension */ +#undef XV + +/* Vendor name */ +#undef XVENDORNAME + +/* Short vendor name */ +#undef XVENDORNAMESHORT + +/* Build Xv extension */ +#undef XvExtension + +/* Build XvMC extension */ +#undef XvMCExtension + +/* Define to 1 if `lex' declares `yytext' as a `char *' by default, not a + `char[]'. */ +#undef YYTEXT_POINTER + +/* Number of bits in a file offset, on hosts where this is settable. */ +#undef _FILE_OFFSET_BITS + +/* Enable GNU and other extensions to the C environment for glibc */ +#undef _GNU_SOURCE + +/* Define for large files, on AIX-style hosts. */ +#undef _LARGE_FILES + +/* Define to 1 if unsigned long is 64 bits. */ +#undef _XSERVER64 + +/* Vendor web address for support */ +#undef __VENDORDWEBSUPPORT__ + +/* Name of configuration directory */ +#undef __XCONFIGDIR__ + +/* Name of configuration file */ +#undef __XCONFIGFILE__ + +/* Name of X server */ +#undef __XSERVERNAME__ + +/* Define to 16-bit byteswap macro */ +#undef bswap_16 + +/* Define to 32-bit byteswap macro */ +#undef bswap_32 + +/* Define to 64-bit byteswap macro */ +#undef bswap_64 + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define to `int' if <sys/types.h> does not define. */ +#undef pid_t + +/* Define to `unsigned int' if <sys/types.h> does not define. */ +#undef size_t diff --git a/include/eventconvert.h b/include/eventconvert.h new file mode 100644 index 0000000..b1196a0 --- /dev/null +++ b/include/eventconvert.h @@ -0,0 +1,40 @@ +/* + * Copyright © 2009 Red Hat, Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + */ + +#ifndef _EVENTCONVERT_H_ +#include <X11/X.h> +#include <X11/extensions/XIproto.h> +#include "input.h" +#include "events.h" + +#define FP1616(integral, frac) ((integral) * (1 << 16) + (frac) * (1 << 16)) + +_X_EXPORT int EventToCore(InternalEvent *event, xEvent *core); +_X_EXPORT int EventToXI(InternalEvent *ev, xEvent **xi, int *count); +_X_EXPORT int EventToXI2(InternalEvent *ev, xEvent **xi); +_X_INTERNAL int GetCoreType(InternalEvent* ev); +_X_INTERNAL int GetXIType(InternalEvent* ev); +_X_INTERNAL int GetXI2Type(InternalEvent* ev); + +#endif /* _EVENTCONVERT_H_ */ diff --git a/include/events.h b/include/events.h new file mode 100644 index 0000000..375173a --- /dev/null +++ b/include/events.h @@ -0,0 +1,38 @@ +/* + * Copyright © 2009 Red Hat, Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + */ + +#ifndef EVENTS_H +#define EVENTS_H +typedef struct _DeviceEvent DeviceEvent; +typedef struct _DeviceChangedEvent DeviceChangedEvent; +#if XFreeXDGA +typedef struct _DGAEvent DGAEvent; +#endif +typedef struct _RawDeviceEvent RawDeviceEvent; +#ifdef XQUARTZ +typedef struct _XQuartzEvent XQuartzEvent; +#endif +typedef union _InternalEvent InternalEvent; + +#endif diff --git a/include/eventstr.h b/include/eventstr.h new file mode 100644 index 0000000..673207c --- /dev/null +++ b/include/eventstr.h @@ -0,0 +1,246 @@ +/* + * Copyright © 2009 Red Hat, Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + */ + +#ifndef EVENTSTR_H +#define EVENTSTR_H + +#include <events.h> +/** + * @file events.h + * This file describes the event structures used internally by the X + * server during event generation and event processing. + * + * When are internal events used? + * Events from input devices are stored as internal events in the EQ and + * processed as internal events until late in the processing cycle. Only then + * do they switch to their respective wire events. + */ + +/** + * Event types. Used exclusively internal to the server, not visible on the + * protocol. + * + * Note: Keep KeyPress to Motion aligned with the core events. + * Keep ET_Raw* in the same order as KeyPress - Motion + */ +enum EventType { + ET_KeyPress = 2, + ET_KeyRelease, + ET_ButtonPress, + ET_ButtonRelease, + ET_Motion, + ET_Enter, + ET_Leave, + ET_FocusIn, + ET_FocusOut, + ET_ProximityIn, + ET_ProximityOut, + ET_DeviceChanged, + ET_Hierarchy, + ET_DGAEvent, + ET_RawKeyPress, + ET_RawKeyRelease, + ET_RawButtonPress, + ET_RawButtonRelease, + ET_RawMotion, + ET_XQuartz, + ET_Internal = 0xFF /* First byte */ +}; + +#define CHECKEVENT(ev) if (ev && ((InternalEvent*)(ev))->any.header != 0xFF) \ + FatalError("Wrong event type %d.\n", \ + ((InternalEvent*)(ev))->any.header); + +/** + * Used for ALL input device events internal in the server until + * copied into the matching protocol event. + * + * Note: We only use the device id because the DeviceIntPtr may become invalid while + * the event is in the EQ. + */ +struct _DeviceEvent +{ + unsigned char header; /**< Always ET_Internal */ + enum EventType type; /**< One of EventType */ + int length; /**< Length in bytes */ + Time time; /**< Time in ms */ + int deviceid; /**< Device to post this event for */ + int sourceid; /**< The physical source device */ + union { + uint32_t button; /**< Button number */ + uint32_t key; /**< Key code */ + } detail; + int16_t root_x; /**< Pos relative to root window in integral data */ + float root_x_frac; /**< Pos relative to root window in frac part */ + int16_t root_y; /**< Pos relative to root window in integral part */ + float root_y_frac; /**< Pos relative to root window in frac part */ + uint8_t buttons[(MAX_BUTTONS + 7)/8]; /**< Button mask */ + struct { + uint8_t mask[(MAX_VALUATORS + 7)/8]; /**< Valuator mask */ + uint8_t mode[(MAX_VALUATORS + 7)/8]; /**< Valuator mode (Abs or Rel)*/ + int32_t data[MAX_VALUATORS]; /**< Valuator data */ + int32_t data_frac[MAX_VALUATORS]; /**< Fractional part for data */ + } valuators; + struct { + uint32_t base; /**< XKB base modifiers */ + uint32_t latched; /**< XKB latched modifiers */ + uint32_t locked; /**< XKB locked modifiers */ + uint32_t effective;/**< XKB effective modifiers */ + } mods; + struct { + uint8_t base; /**< XKB base group */ + uint8_t latched; /**< XKB latched group */ + uint8_t locked; /**< XKB locked group */ + uint8_t effective;/**< XKB effective group */ + } group; + Window root; /**< Root window of the event */ + int corestate; /**< Core key/button state BEFORE the event */ + int key_repeat; /**< Internally-generated key repeat event */ +}; + + +/* Flags used in DeviceChangedEvent to signal if the slave has changed */ +#define DEVCHANGE_SLAVE_SWITCH 0x2 +/* Flags used in DeviceChangedEvent to signal whether the event was a + * pointer event or a keyboard event */ +#define DEVCHANGE_POINTER_EVENT 0x4 +#define DEVCHANGE_KEYBOARD_EVENT 0x8 +/* device capabilities changed */ +#define DEVCHANGE_DEVICE_CHANGE 0x10 + +/** + * Sent whenever a device's capabilities have changed. + */ +struct _DeviceChangedEvent +{ + unsigned char header; /**< Always ET_Internal */ + enum EventType type; /**< ET_DeviceChanged */ + int length; /**< Length in bytes */ + Time time; /**< Time in ms */ + int deviceid; /**< Device whose capabilities have changed */ + int flags; /**< Mask of ::HAS_NEW_SLAVE, + ::POINTER_EVENT, ::KEYBOARD_EVENT */ + int masterid; /**< MD when event was generated */ + int sourceid; /**< The device that caused the change */ + + struct { + int num_buttons; /**< Number of buttons */ + Atom names[MAX_BUTTONS];/**< Button names */ + } buttons; + + int num_valuators; /**< Number of axes */ + struct { + uint32_t min; /**< Minimum value */ + uint32_t max; /**< Maximum value */ + /* FIXME: frac parts of min/max */ + uint32_t resolution; /**< Resolution counts/m */ + uint8_t mode; /**< Relative or Absolute */ + Atom name; /**< Axis name */ + } valuators[MAX_VALUATORS]; + + struct { + int min_keycode; + int max_keycode; + } keys; +}; + +#if XFreeXDGA +/** + * DGAEvent, used by DGA to intercept and emulate input events. + */ +struct _DGAEvent +{ + unsigned char header; /**< Always ET_Internal */ + enum EventType type; /**< ET_DGAEvent */ + int length; /**< Length in bytes */ + Time time; /**< Time in ms */ + int subtype; /**< KeyPress, KeyRelease, ButtonPress, + ButtonRelease, MotionNotify */ + int detail; /**< Button number or key code */ + int dx; /**< Relative x coordinate */ + int dy; /**< Relative y coordinate */ + int screen; /**< Screen number this event applies to */ + uint16_t state; /**< Core modifier/button state */ +}; +#endif + +/** + * Raw event, contains the data as posted by the device. + */ +struct _RawDeviceEvent +{ + unsigned char header; /**< Always ET_Internal */ + enum EventType type; /**< ET_Raw */ + int length; /**< Length in bytes */ + Time time; /**< Time in ms */ + int deviceid; /**< Device to post this event for */ + int sourceid; /**< The physical source device */ + union { + uint32_t button; /**< Button number */ + uint32_t key; /**< Key code */ + } detail; + struct { + uint8_t mask[(MAX_VALUATORS + 7)/8]; /**< Valuator mask */ + int32_t data[MAX_VALUATORS]; /**< Valuator data */ + int32_t data_frac[MAX_VALUATORS]; /**< Fractional part for data */ + int32_t data_raw[MAX_VALUATORS]; /**< Valuator data as posted */ + int32_t data_raw_frac[MAX_VALUATORS];/**< Fractional part for data_raw */ + } valuators; +}; + +#ifdef XQUARTZ +#define XQUARTZ_EVENT_MAXARGS 5 +struct _XQuartzEvent { + unsigned char header; /**< Always ET_Internal */ + enum EventType type; /**< Always ET_XQuartz */ + int length; /**< Length in bytes */ + Time time; /**< Time in ms. */ + int subtype; /**< Subtype defined by XQuartz DDX */ + uint32_t data[XQUARTZ_EVENT_MAXARGS]; /**< Up to 5 32bit values passed to handler */ +}; +#endif + +/** + * Event type used inside the X server for input event + * processing. + */ +union _InternalEvent { + struct { + unsigned char header; /**< Always ET_Internal */ + enum EventType type; /**< One of ET_* */ + int length; /**< Length in bytes */ + Time time; /**< Time in ms. */ + } any; + DeviceEvent device_event; + DeviceChangedEvent changed_event; +#if XFreeXDGA + DGAEvent dga_event; +#endif + RawDeviceEvent raw_event; +#ifdef XQUARTZ + XQuartzEvent xquartz_event; +#endif +}; + +#endif diff --git a/include/exevents.h b/include/exevents.h new file mode 100644 index 0000000..2b22698 --- /dev/null +++ b/include/exevents.h @@ -0,0 +1,312 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +/******************************************************************** + * Interface of 'exevents.c' + */ + +#ifndef EXEVENTS_H +#define EXEVENTS_H + +#include <X11/extensions/XIproto.h> +#include "inputstr.h" + +/*************************************************************** + * Interface available to drivers * + ***************************************************************/ + +extern _X_EXPORT int InitProximityClassDeviceStruct( + DeviceIntPtr /* dev */); + +extern _X_EXPORT void InitValuatorAxisStruct( + DeviceIntPtr /* dev */, + int /* axnum */, + Atom /* label */, + int /* minval */, + int /* maxval */, + int /* resolution */, + int /* min_res */, + int /* max_res */, + int /* mode */); + +/* Input device properties */ +extern _X_EXPORT void XIDeleteAllDeviceProperties( + DeviceIntPtr /* device */ +); + +extern _X_EXPORT int XIDeleteDeviceProperty( + DeviceIntPtr /* device */, + Atom /* property */, + Bool /* fromClient */ +); + +extern _X_EXPORT int XIChangeDeviceProperty( + DeviceIntPtr /* dev */, + Atom /* property */, + Atom /* type */, + int /* format*/, + int /* mode*/, + unsigned long /* len*/, + const pointer /* value*/, + Bool /* sendevent*/ + ); + +extern _X_EXPORT int XIGetDeviceProperty( + DeviceIntPtr /* dev */, + Atom /* property */, + XIPropertyValuePtr* /* value */ +); + +extern _X_EXPORT int XISetDevicePropertyDeletable( + DeviceIntPtr /* dev */, + Atom /* property */, + Bool /* deletable */ +); + +extern _X_EXPORT long XIRegisterPropertyHandler( + DeviceIntPtr dev, + int (*SetProperty) (DeviceIntPtr dev, + Atom property, + XIPropertyValuePtr prop, + BOOL checkonly), + int (*GetProperty) (DeviceIntPtr dev, + Atom property), + int (*DeleteProperty) (DeviceIntPtr dev, + Atom property) +); + +extern _X_EXPORT void XIUnregisterPropertyHandler( + DeviceIntPtr dev, + long id +); + +extern _X_EXPORT Atom XIGetKnownProperty( + char* name +); + +extern _X_EXPORT DeviceIntPtr XIGetDevice(xEvent *ev); + +extern _X_EXPORT int XIPropToInt( + XIPropertyValuePtr val, + int *nelem_return, + int **buf_return +); + +extern _X_EXPORT int XIPropToFloat( + XIPropertyValuePtr val, + int *nelem_return, + float **buf_return +); + +/**************************************************************************** + * End of driver interface * + ****************************************************************************/ + + +/** + * Attached to the devPrivates of each client. Specifies the version number as + * supported by the client. + */ +typedef struct _XIClientRec { + int major_version; + int minor_version; +} XIClientRec, *XIClientPtr; + + +typedef struct _GrabParameters { + int grabtype; /* GRABTYPE_CORE, etc. */ + unsigned int ownerEvents; + unsigned int this_device_mode; + unsigned int other_devices_mode; + Window grabWindow; + Window confineTo; + Cursor cursor; + unsigned int modifiers; +} GrabParameters; + + +extern int +UpdateDeviceState ( + DeviceIntPtr /* device */, + DeviceEvent* /* xE */); + +extern void +ProcessOtherEvent ( + InternalEvent* /* ev */, + DeviceIntPtr /* other */); + +extern void +DeviceFocusEvent( + DeviceIntPtr /* dev */, + int /* type */, + int /* mode */, + int /* detail */, + WindowPtr /* pWin */); + +extern int +CheckGrabValues( + ClientPtr /* client */, + GrabParameters* /* param */); + +extern int +GrabButton( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + DeviceIntPtr /* modifier_device */, + int /* button */, + GrabParameters* /* param */, + GrabType /* grabtype */, + GrabMask* /* eventMask */); + +extern int +GrabKey( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + DeviceIntPtr /* modifier_device */, + int /* key */, + GrabParameters* /* param */, + GrabType /* grabtype */, + GrabMask* /* eventMask */); + +extern int +GrabWindow( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + int /* type */, + GrabParameters* /* param */, + GrabMask* /* eventMask */); + +extern int +SelectForWindow( + DeviceIntPtr /* dev */, + WindowPtr /* pWin */, + ClientPtr /* client */, + Mask /* mask */, + Mask /* exclusivemasks */); + +extern int +AddExtensionClient ( + WindowPtr /* pWin */, + ClientPtr /* client */, + Mask /* mask */, + int /* mskidx */); + +extern void +RecalculateDeviceDeliverableEvents( + WindowPtr /* pWin */); + +extern int +InputClientGone( + WindowPtr /* pWin */, + XID /* id */); + +extern int +SendEvent ( + ClientPtr /* client */, + DeviceIntPtr /* d */, + Window /* dest */, + Bool /* propagate */, + xEvent * /* ev */, + Mask /* mask */, + int /* count */); + +extern int +SetButtonMapping ( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + int /* nElts */, + BYTE * /* map */); + +extern int +ChangeKeyMapping( + ClientPtr /* client */, + DeviceIntPtr /* dev */, + unsigned /* len */, + int /* type */, + KeyCode /* firstKeyCode */, + CARD8 /* keyCodes */, + CARD8 /* keySymsPerKeyCode */, + KeySym * /* map */); + +extern void +DeleteWindowFromAnyExtEvents( + WindowPtr /* pWin */, + Bool /* freeResources */); + +extern int +MaybeSendDeviceMotionNotifyHint ( + deviceKeyButtonPointer * /* pEvents */, + Mask /* mask */); + +extern void +CheckDeviceGrabAndHintWindow ( + WindowPtr /* pWin */, + int /* type */, + deviceKeyButtonPointer * /* xE */, + GrabPtr /* grab */, + ClientPtr /* client */, + Mask /* deliveryMask */); + +extern void +MaybeStopDeviceHint( + DeviceIntPtr /* dev */, + ClientPtr /* client */); + +extern int +DeviceEventSuppressForWindow( + WindowPtr /* pWin */, + ClientPtr /* client */, + Mask /* mask */, + int /* maskndx */); + +extern void +SendEventToAllWindows( + DeviceIntPtr /* dev */, + Mask /* mask */, + xEvent * /* ev */, + int /* count */); + +extern _X_HIDDEN void XI2EventSwap( + xGenericEvent * /* from */, + xGenericEvent * /* to */); + +/* For an event such as MappingNotify which affects client interpretation + * of input events sent by device dev, should we notify the client, or + * would it merely be irrelevant and confusing? */ +extern int +XIShouldNotify(ClientPtr client, DeviceIntPtr dev); + +extern void +XISendDeviceChangedEvent(DeviceIntPtr device, DeviceIntPtr master, + DeviceChangedEvent *dce); + +extern int +XISetEventMask(DeviceIntPtr dev, WindowPtr win, ClientPtr client, + unsigned int len, unsigned char* mask); + +extern int +XICheckInvalidMaskBits(ClientPtr client, unsigned char *mask, int len); + +#endif /* EXEVENTS_H */ diff --git a/include/extension.h b/include/extension.h new file mode 100644 index 0000000..29a11c3 --- /dev/null +++ b/include/extension.h @@ -0,0 +1,67 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef EXTENSION_H +#define EXTENSION_H + +_XFUNCPROTOBEGIN + +extern _X_EXPORT unsigned short StandardMinorOpcode(ClientPtr /*client*/); + +extern _X_EXPORT unsigned short MinorOpcodeOfRequest(ClientPtr /*client*/); + +extern _X_EXPORT Bool EnableDisableExtension(char *name, Bool enable); + +extern _X_EXPORT void EnableDisableExtensionError(char *name, Bool enable); + +extern _X_EXPORT void InitExtensions(int argc, char **argv); + +extern _X_EXPORT void CloseDownExtensions(void); + +_XFUNCPROTOEND + +#endif /* EXTENSION_H */ diff --git a/include/extinit.h b/include/extinit.h new file mode 100644 index 0000000..c3aa7b6 --- /dev/null +++ b/include/extinit.h @@ -0,0 +1,47 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +/******************************************************************** + * Interface of extinit.c + */ + +#ifndef EXTINIT_H +#define EXTINIT_H + +#include "extnsionst.h" + +extern void +XInputExtensionInit( + void + ); + +extern _X_EXPORT void +AssignTypeAndName ( + DeviceIntPtr /* dev */, + Atom /* type */, + char * /* name */ + ); + +#endif /* EXTINIT_H */ diff --git a/include/extnsionst.h b/include/extnsionst.h new file mode 100644 index 0000000..bb66dfb --- /dev/null +++ b/include/extnsionst.h @@ -0,0 +1,112 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef EXTENSIONSTRUCT_H +#define EXTENSIONSTRUCT_H + +#include "dix.h" +#include "misc.h" +#include "screenint.h" +#include "extension.h" +#include "gc.h" +#include "privates.h" + +typedef struct _ExtensionEntry { + int index; + void (* CloseDown)( /* called at server shutdown */ + struct _ExtensionEntry * /* extension */); + char *name; /* extension name */ + int base; /* base request number */ + int eventBase; + int eventLast; + int errorBase; + int errorLast; + int num_aliases; + char **aliases; + pointer extPrivate; + unsigned short (* MinorOpcode)( /* called for errors */ + ClientPtr /* client */); + PrivateRec *devPrivates; +} ExtensionEntry; + +/* + * The arguments may be different for extension event swapping functions. + * Deal with this by casting when initializing the event's EventSwapVector[] + * entries. + */ +typedef void (*EventSwapPtr) (xEvent *, xEvent *); + +extern _X_EXPORT EventSwapPtr EventSwapVector[128]; + +extern _X_EXPORT void NotImplemented ( /* FIXME: this may move to another file... */ + xEvent *, + xEvent *) _X_NORETURN; + +#define SetGCVector(pGC, VectorElement, NewRoutineAddress, Atom) \ + pGC->VectorElement = NewRoutineAddress; + +#define GetGCValue(pGC, GCElement) (pGC->GCElement) + +extern _X_EXPORT ExtensionEntry *AddExtension( + char* /*name*/, + int /*NumEvents*/, + int /*NumErrors*/, + int (* /*MainProc*/)(ClientPtr /*client*/), + int (* /*SwappedMainProc*/)(ClientPtr /*client*/), + void (* /*CloseDownProc*/)(ExtensionEntry * /*extension*/), + unsigned short (* /*MinorOpcodeProc*/)(ClientPtr /*client*/) +); + +extern _X_EXPORT Bool AddExtensionAlias( + char* /*alias*/, + ExtensionEntry * /*extension*/); + +extern _X_EXPORT ExtensionEntry *CheckExtension(const char *extname); +extern _X_EXPORT ExtensionEntry *GetExtensionEntry(int major); + +#endif /* EXTENSIONSTRUCT_H */ + diff --git a/include/gc.h b/include/gc.h new file mode 100644 index 0000000..2079cfa --- /dev/null +++ b/include/gc.h @@ -0,0 +1,163 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef GC_H +#define GC_H + +#include <X11/X.h> /* for GContext, Mask */ +#include <X11/Xdefs.h> /* for Bool */ +#include <X11/Xproto.h> +#include "screenint.h" /* for ScreenPtr */ +#include "pixmap.h" /* for DrawablePtr */ + +/* clientClipType field in GC */ +#define CT_NONE 0 +#define CT_PIXMAP 1 +#define CT_REGION 2 +#define CT_UNSORTED 6 +#define CT_YSORTED 10 +#define CT_YXSORTED 14 +#define CT_YXBANDED 18 + +#define GCQREASON_VALIDATE 1 +#define GCQREASON_CHANGE 2 +#define GCQREASON_COPY_SRC 3 +#define GCQREASON_COPY_DST 4 +#define GCQREASON_DESTROY 5 + +#define GC_CHANGE_SERIAL_BIT (((unsigned long)1)<<31) +#define GC_CALL_VALIDATE_BIT (1L<<30) +#define GCExtensionInterest (1L<<29) + +#define DRAWABLE_SERIAL_BITS (~(GC_CHANGE_SERIAL_BIT)) + +#define MAX_SERIAL_NUM (1L<<28) + +#define NEXT_SERIAL_NUMBER ((++globalSerialNumber) > MAX_SERIAL_NUM ? \ + (globalSerialNumber = 1): globalSerialNumber) + +typedef struct _GCInterest *GCInterestPtr; +typedef struct _GC *GCPtr; +typedef struct _GCOps *GCOpsPtr; + +extern _X_EXPORT void ValidateGC( + DrawablePtr /*pDraw*/, + GCPtr /*pGC*/); + +typedef union { + CARD32 val; + pointer ptr; +} ChangeGCVal, *ChangeGCValPtr; + +extern int ChangeGCXIDs( + ClientPtr /*client*/, + GCPtr /*pGC*/, + BITS32 /*mask*/, + CARD32 * /*pval*/); + +extern _X_EXPORT int ChangeGC( + ClientPtr /*client*/, + GCPtr /*pGC*/, + BITS32 /*mask*/, + ChangeGCValPtr /*pCGCV*/); + +extern _X_EXPORT GCPtr CreateGC( + DrawablePtr /*pDrawable*/, + BITS32 /*mask*/, + XID* /*pval*/, + int* /*pStatus*/, + XID /*gcid*/, + ClientPtr /*client*/); + +extern _X_EXPORT int CopyGC( + GCPtr/*pgcSrc*/, + GCPtr/*pgcDst*/, + BITS32 /*mask*/); + +extern _X_EXPORT int FreeGC( + pointer /*pGC*/, + XID /*gid*/); + +extern _X_EXPORT void FreeGCperDepth( + int /*screenNum*/); + +extern _X_EXPORT Bool CreateGCperDepth( + int /*screenNum*/); + +extern _X_EXPORT Bool CreateDefaultStipple( + int /*screenNum*/); + +extern _X_EXPORT void FreeDefaultStipple( + int /*screenNum*/); + +extern _X_EXPORT int SetDashes( + GCPtr /*pGC*/, + unsigned /*offset*/, + unsigned /*ndash*/, + unsigned char* /*pdash*/); + +extern _X_EXPORT int VerifyRectOrder( + int /*nrects*/, + xRectangle* /*prects*/, + int /*ordering*/); + +extern _X_EXPORT int SetClipRects( + GCPtr /*pGC*/, + int /*xOrigin*/, + int /*yOrigin*/, + int /*nrects*/, + xRectangle* /*prects*/, + int /*ordering*/); + +extern _X_EXPORT GCPtr GetScratchGC( + unsigned /*depth*/, + ScreenPtr /*pScreen*/); + +extern _X_EXPORT void FreeScratchGC( + GCPtr /*pGC*/); + +#endif /* GC_H */ diff --git a/include/gcstruct.h b/include/gcstruct.h new file mode 100644 index 0000000..4fea02c --- /dev/null +++ b/include/gcstruct.h @@ -0,0 +1,322 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + + + +#ifndef GCSTRUCT_H +#define GCSTRUCT_H + +#include "gc.h" + +#include "regionstr.h" +#include "region.h" +#include "pixmap.h" +#include "screenint.h" +#include "privates.h" +#include <X11/Xprotostr.h> + +#define GCAllBits ((1 << (GCLastBit + 1)) - 1) + +/* + * functions which modify the state of the GC + */ + +typedef struct _GCFuncs { + void (* ValidateGC)( + GCPtr /*pGC*/, + unsigned long /*stateChanges*/, + DrawablePtr /*pDrawable*/); + + void (* ChangeGC)( + GCPtr /*pGC*/, + unsigned long /*mask*/); + + void (* CopyGC)( + GCPtr /*pGCSrc*/, + unsigned long /*mask*/, + GCPtr /*pGCDst*/); + + void (* DestroyGC)( + GCPtr /*pGC*/); + + void (* ChangeClip)( + GCPtr /*pGC*/, + int /*type*/, + pointer /*pvalue*/, + int /*nrects*/); + + void (* DestroyClip)( + GCPtr /*pGC*/); + + void (* CopyClip)( + GCPtr /*pgcDst*/, + GCPtr /*pgcSrc*/); +} GCFuncs; + +/* + * graphics operations invoked through a GC + */ + +typedef struct _GCOps { + void (* FillSpans)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*nInit*/, + DDXPointPtr /*pptInit*/, + int * /*pwidthInit*/, + int /*fSorted*/); + + void (* SetSpans)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + char * /*psrc*/, + DDXPointPtr /*ppt*/, + int * /*pwidth*/, + int /*nspans*/, + int /*fSorted*/); + + void (* PutImage)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*depth*/, + int /*x*/, + int /*y*/, + int /*w*/, + int /*h*/, + int /*leftPad*/, + int /*format*/, + char * /*pBits*/); + + RegionPtr (* CopyArea)( + DrawablePtr /*pSrc*/, + DrawablePtr /*pDst*/, + GCPtr /*pGC*/, + int /*srcx*/, + int /*srcy*/, + int /*w*/, + int /*h*/, + int /*dstx*/, + int /*dsty*/); + + RegionPtr (* CopyPlane)( + DrawablePtr /*pSrcDrawable*/, + DrawablePtr /*pDstDrawable*/, + GCPtr /*pGC*/, + int /*srcx*/, + int /*srcy*/, + int /*width*/, + int /*height*/, + int /*dstx*/, + int /*dsty*/, + unsigned long /*bitPlane*/); + void (* PolyPoint)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*mode*/, + int /*npt*/, + DDXPointPtr /*pptInit*/); + + void (* Polylines)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*mode*/, + int /*npt*/, + DDXPointPtr /*pptInit*/); + + void (* PolySegment)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*nseg*/, + xSegment * /*pSegs*/); + + void (* PolyRectangle)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*nrects*/, + xRectangle * /*pRects*/); + + void (* PolyArc)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*narcs*/, + xArc * /*parcs*/); + + void (* FillPolygon)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*shape*/, + int /*mode*/, + int /*count*/, + DDXPointPtr /*pPts*/); + + void (* PolyFillRect)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*nrectFill*/, + xRectangle * /*prectInit*/); + + void (* PolyFillArc)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*narcs*/, + xArc * /*parcs*/); + + int (* PolyText8)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*x*/, + int /*y*/, + int /*count*/, + char * /*chars*/); + + int (* PolyText16)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*x*/, + int /*y*/, + int /*count*/, + unsigned short * /*chars*/); + + void (* ImageText8)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*x*/, + int /*y*/, + int /*count*/, + char * /*chars*/); + + void (* ImageText16)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*x*/, + int /*y*/, + int /*count*/, + unsigned short * /*chars*/); + + void (* ImageGlyphBlt)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*x*/, + int /*y*/, + unsigned int /*nglyph*/, + CharInfoPtr * /*ppci*/, + pointer /*pglyphBase*/); + + void (* PolyGlyphBlt)( + DrawablePtr /*pDrawable*/, + GCPtr /*pGC*/, + int /*x*/, + int /*y*/, + unsigned int /*nglyph*/, + CharInfoPtr * /*ppci*/, + pointer /*pglyphBase*/); + + void (* PushPixels)( + GCPtr /*pGC*/, + PixmapPtr /*pBitMap*/, + DrawablePtr /*pDst*/, + int /*w*/, + int /*h*/, + int /*x*/, + int /*y*/); +} GCOps; + +/* there is padding in the bit fields because the Sun compiler doesn't + * force alignment to 32-bit boundaries. losers. + */ +typedef struct _GC { + ScreenPtr pScreen; + unsigned char depth; + unsigned char alu; + unsigned short lineWidth; + unsigned short dashOffset; + unsigned short numInDashList; + unsigned char *dash; + unsigned int lineStyle : 2; + unsigned int capStyle : 2; + unsigned int joinStyle : 2; + unsigned int fillStyle : 2; + unsigned int fillRule : 1; + unsigned int arcMode : 1; + unsigned int subWindowMode : 1; + unsigned int graphicsExposures : 1; + unsigned int clientClipType : 2; /* CT_<kind> */ + unsigned int miTranslate:1; /* should mi things translate? */ + unsigned int tileIsPixel:1; /* tile is solid pixel */ + unsigned int fExpose:1; /* Call exposure handling */ + unsigned int freeCompClip:1; /* Free composite clip */ + unsigned int scratch_inuse:1; /* is this GC in a pool for reuse? */ + unsigned int unused:13; /* see comment above */ + unsigned long planemask; + unsigned long fgPixel; + unsigned long bgPixel; + /* + * alas -- both tile and stipple must be here as they + * are independently specifiable + */ + PixUnion tile; + PixmapPtr stipple; + DDXPointRec patOrg; /* origin for (tile, stipple) */ + struct _Font *font; + DDXPointRec clipOrg; + pointer clientClip; + unsigned long stateChanges; /* masked with GC_<kind> */ + unsigned long serialNumber; + GCFuncs *funcs; + GCOps *ops; + PrivateRec *devPrivates; + /* + * The following were moved here from private storage to allow device- + * independent access to them from screen wrappers. + * --- 1997.11.03 Marc Aurele La France (tsi@xfree86.org) + */ + PixmapPtr pRotatedPixmap; /* tile/stipple rotated for alignment */ + RegionPtr pCompositeClip; + /* fExpose & freeCompClip defined above */ +} GC; + +#endif /* GCSTRUCT_H */ diff --git a/include/globals.h b/include/globals.h new file mode 100644 index 0000000..8b80a65 --- /dev/null +++ b/include/globals.h @@ -0,0 +1,125 @@ + +#ifndef _XSERV_GLOBAL_H_ +#define _XSERV_GLOBAL_H_ + +#include "window.h" /* for WindowPtr */ + +/* Global X server variables that are visible to mi, dix, os, and ddx */ + +extern _X_EXPORT CARD32 defaultScreenSaverTime; +extern _X_EXPORT CARD32 defaultScreenSaverInterval; +extern _X_EXPORT CARD32 ScreenSaverTime; +extern _X_EXPORT CARD32 ScreenSaverInterval; + +#ifdef SCREENSAVER +extern _X_EXPORT Bool screenSaverSuspended; +#endif + +extern _X_EXPORT char *defaultFontPath; +extern _X_EXPORT int monitorResolution; +extern _X_EXPORT int defaultColorVisualClass; + +extern _X_EXPORT int GrabInProgress; +extern _X_EXPORT Bool noTestExtensions; + +extern _X_EXPORT char *ConnectionInfo; + +#ifdef DPMSExtension +extern _X_EXPORT CARD32 DPMSStandbyTime; +extern _X_EXPORT CARD32 DPMSSuspendTime; +extern _X_EXPORT CARD32 DPMSOffTime; +extern _X_EXPORT CARD16 DPMSPowerLevel; +extern _X_EXPORT Bool DPMSEnabled; +extern _X_EXPORT Bool DPMSDisabledSwitch; +extern _X_EXPORT Bool DPMSCapableFlag; +#endif + +#ifdef PANORAMIX +extern _X_EXPORT Bool PanoramiXExtensionDisabledHack; +#endif + +#ifdef COMPOSITE +extern _X_EXPORT Bool noCompositeExtension; +#endif + +#ifdef DAMAGE +extern _X_EXPORT Bool noDamageExtension; +#endif + +#ifdef DBE +extern _X_EXPORT Bool noDbeExtension; +#endif + +#ifdef DPMSExtension +extern _X_EXPORT Bool noDPMSExtension; +#endif + +#ifdef GLXEXT +extern _X_EXPORT Bool noGlxExtension; +#endif + +#ifdef SCREENSAVER +extern _X_EXPORT Bool noScreenSaverExtension; +#endif + +#ifdef MITSHM +extern _X_EXPORT Bool noMITShmExtension; +#endif + +#ifdef RANDR +extern _X_EXPORT Bool noRRExtension; +#endif + +extern _X_EXPORT Bool noRenderExtension; + +#ifdef XCSECURITY +extern _X_EXPORT Bool noSecurityExtension; +#endif + +#ifdef RES +extern _X_EXPORT Bool noResExtension; +#endif + +#ifdef XF86BIGFONT +extern _X_EXPORT Bool noXFree86BigfontExtension; +#endif + +#ifdef XFreeXDGA +extern _X_EXPORT Bool noXFree86DGAExtension; +#endif + +#ifdef XF86DRI +extern _X_EXPORT Bool noXFree86DRIExtension; +#endif + +#ifdef XF86VIDMODE +extern _X_EXPORT Bool noXFree86VidModeExtension; +#endif + +#ifdef XFIXES +extern _X_EXPORT Bool noXFixesExtension; +#endif + +#ifdef PANORAMIX +extern _X_EXPORT Bool noPanoramiXExtension; +#endif + +#ifdef XSELINUX +extern _X_EXPORT Bool noSELinuxExtension; + +#define SELINUX_MODE_DEFAULT 0 +#define SELINUX_MODE_DISABLED 1 +#define SELINUX_MODE_PERMISSIVE 2 +#define SELINUX_MODE_ENFORCING 3 +extern _X_EXPORT int selinuxEnforcingState; +#endif + +#ifdef XV +extern _X_EXPORT Bool noXvExtension; +#endif + +#ifdef DRI2 +extern _X_EXPORT Bool noDRI2Extension; +#endif + +#endif /* !_XSERV_GLOBAL_H_ */ diff --git a/include/hotplug.h b/include/hotplug.h new file mode 100644 index 0000000..d074df3 --- /dev/null +++ b/include/hotplug.h @@ -0,0 +1,32 @@ +/* + * Copyright © 2006-2007 Daniel Stone + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + * Author: Daniel Stone <daniel@fooishbar.org> + */ + +#ifndef HOTPLUG_H +#define HOTPLUG_H + +extern _X_EXPORT void config_init(void); +extern _X_EXPORT void config_fini(void); + +#endif /* HOTPLUG_H */ diff --git a/include/input.h b/include/input.h new file mode 100644 index 0000000..908e595 --- /dev/null +++ b/include/input.h @@ -0,0 +1,594 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + +#ifndef INPUT_H +#define INPUT_H + +#include "misc.h" +#include "screenint.h" +#include <X11/Xmd.h> +#include <X11/Xproto.h> +#include <stdint.h> +#include "window.h" /* for WindowPtr */ +#include "xkbrules.h" +#include "events.h" + +#define DEVICE_INIT 0 +#define DEVICE_ON 1 +#define DEVICE_OFF 2 +#define DEVICE_CLOSE 3 + +#define POINTER_RELATIVE (1 << 1) +#define POINTER_ABSOLUTE (1 << 2) +#define POINTER_ACCELERATE (1 << 3) +#define POINTER_SCREEN (1 << 4) /* Data in screen coordinates */ + +/*int constants for pointer acceleration schemes*/ +#define PtrAccelNoOp 0 +#define PtrAccelPredictable 1 +#define PtrAccelLightweight 2 +#define PtrAccelDefault PtrAccelPredictable + +#define MAX_VALUATORS 36 +/* Maximum number of valuators, divided by six, rounded up, to get number + * of events. */ +#define MAX_VALUATOR_EVENTS 6 +#define MAX_BUTTONS 256 /* completely arbitrarily chosen */ + +#define NO_AXIS_LIMITS -1 + +#define MAP_LENGTH 256 +#define DOWN_LENGTH 32 /* 256/8 => number of bytes to hold 256 bits */ +#define NullGrab ((GrabPtr)NULL) +#define PointerRootWin ((WindowPtr)PointerRoot) +#define NoneWin ((WindowPtr)None) +#define NullDevice ((DevicePtr)NULL) + +#ifndef FollowKeyboard +#define FollowKeyboard 3 +#endif +#ifndef FollowKeyboardWin +#define FollowKeyboardWin ((WindowPtr) FollowKeyboard) +#endif +#ifndef RevertToFollowKeyboard +#define RevertToFollowKeyboard 3 +#endif + +typedef unsigned long Leds; +typedef struct _OtherClients *OtherClientsPtr; +typedef struct _InputClients *InputClientsPtr; +typedef struct _DeviceIntRec *DeviceIntPtr; +typedef struct _ValuatorClassRec *ValuatorClassPtr; +typedef struct _ClassesRec *ClassesPtr; +typedef struct _SpriteRec *SpritePtr; +typedef union _GrabMask GrabMask; + +typedef struct _EventList { + xEvent* event; + int evlen; /* length of allocated memory for event in bytes. This is not + the actual length of the event. The event's actual length is + 32 for standard events or 32 + + ((xGenericEvent*)event)->length * 4 for GenericEvents. + For events in the EQ, the length is + ((InternalEvent*)event)->u.any.length */ +} EventList, *EventListPtr; + +/* The DIX stores incoming input events in this list */ +extern EventListPtr InputEventList; +extern int InputEventListLen; + +typedef int (*DeviceProc)( + DeviceIntPtr /*device*/, + int /*what*/); + +typedef void (*ProcessInputProc)( + InternalEvent * /*event*/, + DeviceIntPtr /*device*/); + +typedef Bool (*DeviceHandleProc)( + DeviceIntPtr /*device*/, + void* /*data*/ + ); + +typedef void (*DeviceUnwrapProc)( + DeviceIntPtr /*device*/, + DeviceHandleProc /*proc*/, + void* /*data*/ + ); + +/* pointer acceleration handling */ +typedef void (*PointerAccelSchemeProc)( + DeviceIntPtr /*pDev*/, + int /*first_valuator*/, + int /*num_valuators*/, + int* /*valuators*/, + int /*evtime*/); + +typedef void (*DeviceCallbackProc)( + DeviceIntPtr /*pDev*/); + +typedef struct _DeviceRec { + pointer devicePrivate; + ProcessInputProc processInputProc; /* current */ + ProcessInputProc realInputProc; /* deliver */ + ProcessInputProc enqueueInputProc; /* enqueue */ + Bool on; /* used by DDX to keep state */ +} DeviceRec, *DevicePtr; + +typedef struct _ValuatorMask ValuatorMask; + +typedef struct { + int click, bell, bell_pitch, bell_duration; + Bool autoRepeat; + unsigned char autoRepeats[32]; + Leds leds; + unsigned char id; +} KeybdCtrl; + +typedef struct { + KeySym *map; + KeyCode minKeyCode, + maxKeyCode; + int mapWidth; +} KeySymsRec, *KeySymsPtr; + +typedef struct { + int num, den, threshold; + unsigned char id; +} PtrCtrl; + +typedef struct { + int resolution, min_value, max_value; + int integer_displayed; + unsigned char id; +} IntegerCtrl; + +typedef struct { + int max_symbols, num_symbols_supported; + int num_symbols_displayed; + KeySym *symbols_supported; + KeySym *symbols_displayed; + unsigned char id; +} StringCtrl; + +typedef struct { + int percent, pitch, duration; + unsigned char id; +} BellCtrl; + +typedef struct { + Leds led_values; + Mask led_mask; + unsigned char id; +} LedCtrl; + +extern _X_EXPORT KeybdCtrl defaultKeyboardControl; +extern _X_EXPORT PtrCtrl defaultPointerControl; + +typedef struct _InputOption { + char *key; + char *value; + struct _InputOption *next; +} InputOption; + +typedef struct _InputAttributes { + char *product; + char *vendor; + char *device; + char *pnp_id; + char *usb_id; + char **tags; /* null-terminated */ + uint32_t flags; +} InputAttributes; + +#define ATTR_KEYBOARD (1<<0) +#define ATTR_POINTER (1<<1) +#define ATTR_JOYSTICK (1<<2) +#define ATTR_TABLET (1<<3) +#define ATTR_TOUCHPAD (1<<4) +#define ATTR_TOUCHSCREEN (1<<5) + +/* Key/Button has been run through all input processing and events sent to clients. */ +#define KEY_PROCESSED 1 +#define BUTTON_PROCESSED 1 +/* Key/Button has not been fully processed, no events have been sent. */ +#define KEY_POSTED 2 +#define BUTTON_POSTED 2 + +extern void set_key_down(DeviceIntPtr pDev, int key_code, int type); +extern void set_key_up(DeviceIntPtr pDev, int key_code, int type); +extern int key_is_down(DeviceIntPtr pDev, int key_code, int type); +extern void set_button_down(DeviceIntPtr pDev, int button, int type); +extern void set_button_up(DeviceIntPtr pDev, int button, int type); +extern int button_is_down(DeviceIntPtr pDev, int button, int type); + +extern void InitCoreDevices(void); +extern void InitXTestDevices(void); + +extern _X_EXPORT DeviceIntPtr AddInputDevice( + ClientPtr /*client*/, + DeviceProc /*deviceProc*/, + Bool /*autoStart*/); + +extern _X_EXPORT Bool EnableDevice( + DeviceIntPtr /*device*/, + BOOL /* sendevent */); + +extern _X_EXPORT Bool ActivateDevice( + DeviceIntPtr /*device*/, + BOOL /* sendevent */); + +extern _X_EXPORT Bool DisableDevice( + DeviceIntPtr /*device*/, + BOOL /* sendevent */); + +extern int InitAndStartDevices(void); + +extern void CloseDownDevices(void); + +extern void UndisplayDevices(void); + +extern _X_EXPORT int RemoveDevice( + DeviceIntPtr /*dev*/, + BOOL /* sendevent */); + +extern _X_EXPORT int NumMotionEvents(void); + +extern _X_EXPORT int dixLookupDevice( + DeviceIntPtr * /* dev */, + int /* id */, + ClientPtr /* client */, + Mask /* access_mode */); + +extern _X_EXPORT void QueryMinMaxKeyCodes( + KeyCode* /*minCode*/, + KeyCode* /*maxCode*/); + +extern _X_EXPORT Bool SetKeySymsMap( + KeySymsPtr /*dst*/, + KeySymsPtr /*src*/); + +extern _X_EXPORT Bool InitButtonClassDeviceStruct( + DeviceIntPtr /*device*/, + int /*numButtons*/, + Atom* /* labels */, + CARD8* /*map*/); + +extern _X_INTERNAL ValuatorClassPtr AllocValuatorClass( + ValuatorClassPtr src, + int numAxes); + +extern _X_EXPORT Bool InitValuatorClassDeviceStruct( + DeviceIntPtr /*device*/, + int /*numAxes*/, + Atom* /* labels */, + int /*numMotionEvents*/, + int /*mode*/); + +extern _X_EXPORT Bool InitPointerAccelerationScheme( + DeviceIntPtr /*dev*/, + int /*scheme*/); + +extern _X_EXPORT Bool InitAbsoluteClassDeviceStruct( + DeviceIntPtr /*device*/); + +extern _X_EXPORT Bool InitFocusClassDeviceStruct( + DeviceIntPtr /*device*/); + +typedef void (*BellProcPtr)( + int /*percent*/, + DeviceIntPtr /*device*/, + pointer /*ctrl*/, + int); + +typedef void (*KbdCtrlProcPtr)( + DeviceIntPtr /*device*/, + KeybdCtrl * /*ctrl*/); + +typedef void (*PtrCtrlProcPtr)( + DeviceIntPtr /*device*/, + PtrCtrl * /*ctrl*/); + +extern _X_EXPORT Bool InitPtrFeedbackClassDeviceStruct( + DeviceIntPtr /*device*/, + PtrCtrlProcPtr /*controlProc*/); + +typedef void (*StringCtrlProcPtr)( + DeviceIntPtr /*device*/, + StringCtrl * /*ctrl*/); + +extern _X_EXPORT Bool InitStringFeedbackClassDeviceStruct( + DeviceIntPtr /*device*/, + StringCtrlProcPtr /*controlProc*/, + int /*max_symbols*/, + int /*num_symbols_supported*/, + KeySym* /*symbols*/); + +typedef void (*BellCtrlProcPtr)( + DeviceIntPtr /*device*/, + BellCtrl * /*ctrl*/); + +extern _X_EXPORT Bool InitBellFeedbackClassDeviceStruct( + DeviceIntPtr /*device*/, + BellProcPtr /*bellProc*/, + BellCtrlProcPtr /*controlProc*/); + +typedef void (*LedCtrlProcPtr)( + DeviceIntPtr /*device*/, + LedCtrl * /*ctrl*/); + +extern _X_EXPORT Bool InitLedFeedbackClassDeviceStruct( + DeviceIntPtr /*device*/, + LedCtrlProcPtr /*controlProc*/); + +typedef void (*IntegerCtrlProcPtr)( + DeviceIntPtr /*device*/, + IntegerCtrl * /*ctrl*/); + + +extern _X_EXPORT Bool InitIntegerFeedbackClassDeviceStruct( + DeviceIntPtr /*device*/, + IntegerCtrlProcPtr /*controlProc*/); + +extern _X_EXPORT Bool InitPointerDeviceStruct( + DevicePtr /*device*/, + CARD8* /*map*/, + int /*numButtons*/, + Atom* /* btn_labels */, + PtrCtrlProcPtr /*controlProc*/, + int /*numMotionEvents*/, + int /*numAxes*/, + Atom* /* axes_labels */); + +extern _X_EXPORT Bool InitKeyboardDeviceStruct( + DeviceIntPtr /*device*/, + XkbRMLVOSet * /*rmlvo*/, + BellProcPtr /*bellProc*/, + KbdCtrlProcPtr /*controlProc*/); + +extern int ApplyPointerMapping( + DeviceIntPtr /* pDev */, + CARD8 * /* map */, + int /* len */, + ClientPtr /* client */); + +extern Bool BadDeviceMap( + BYTE* /*buff*/, + int /*length*/, + unsigned /*low*/, + unsigned /*high*/, + XID* /*errval*/); + +extern void NoteLedState( + DeviceIntPtr /*keybd*/, + int /*led*/, + Bool /*on*/); + +extern void MaybeStopHint( + DeviceIntPtr /*device*/, + ClientPtr /*client*/); + +extern void ProcessPointerEvent( + InternalEvent* /* ev */, + DeviceIntPtr /*mouse*/); + +extern void ProcessKeyboardEvent( + InternalEvent* /*ev*/, + DeviceIntPtr /*keybd*/); + +extern Bool LegalModifier( + unsigned int /*key*/, + DeviceIntPtr /*pDev*/); + +extern _X_EXPORT void ProcessInputEvents(void); + +extern _X_EXPORT void InitInput( + int /*argc*/, + char ** /*argv*/); +extern _X_EXPORT void CloseInput(void); + +extern _X_EXPORT int GetMaximumEventsNum(void); + +extern _X_EXPORT int GetEventList(EventListPtr* list); +extern _X_EXPORT EventListPtr InitEventList(int num_events); +extern _X_EXPORT void FreeEventList(EventListPtr list, int num_events); + +extern void CreateClassesChangedEvent(EventListPtr event, + DeviceIntPtr master, + DeviceIntPtr slave, + int type); +extern EventListPtr UpdateFromMaster( + EventListPtr events, + DeviceIntPtr pDev, + int type, + int *num_events); + +extern _X_EXPORT int GetPointerEvents( + EventListPtr events, + DeviceIntPtr pDev, + int type, + int buttons, + int flags, + const ValuatorMask *mask); + +extern _X_EXPORT int GetKeyboardEvents( + EventListPtr events, + DeviceIntPtr pDev, + int type, + int key_code); + +extern int GetKeyboardValuatorEvents( + EventListPtr events, + DeviceIntPtr pDev, + int type, + int key_code, + const ValuatorMask *mask); + +extern int GetProximityEvents( + EventListPtr events, + DeviceIntPtr pDev, + int type, + const ValuatorMask *mask); + +extern void PostSyntheticMotion( + DeviceIntPtr pDev, + int x, + int y, + int screen, + unsigned long time); + +extern _X_EXPORT int GetMotionHistorySize( + void); + +extern _X_EXPORT void AllocateMotionHistory( + DeviceIntPtr pDev); + +extern _X_EXPORT int GetMotionHistory( + DeviceIntPtr pDev, + xTimecoord **buff, + unsigned long start, + unsigned long stop, + ScreenPtr pScreen, + BOOL core); + +extern int AttachDevice(ClientPtr client, + DeviceIntPtr slave, + DeviceIntPtr master); + +extern _X_EXPORT DeviceIntPtr GetPairedDevice(DeviceIntPtr kbd); +extern DeviceIntPtr GetMaster(DeviceIntPtr dev, int type); + +extern _X_EXPORT int AllocDevicePair(ClientPtr client, + char* name, + DeviceIntPtr* ptr, + DeviceIntPtr* keybd, + DeviceProc ptr_proc, + DeviceProc keybd_proc, + Bool master); +extern void DeepCopyDeviceClasses(DeviceIntPtr from, + DeviceIntPtr to, + DeviceChangedEvent *dce); + +/* Helper functions. */ +extern _X_EXPORT int generate_modkeymap(ClientPtr client, DeviceIntPtr dev, + KeyCode **modkeymap, int *max_keys_per_mod); +extern int change_modmap(ClientPtr client, DeviceIntPtr dev, KeyCode *map, + int max_keys_per_mod); +extern int AllocXTestDevice(ClientPtr client, + char* name, + DeviceIntPtr* ptr, + DeviceIntPtr* keybd, + DeviceIntPtr master_ptr, + DeviceIntPtr master_keybd); +extern BOOL IsXTestDevice(DeviceIntPtr dev, DeviceIntPtr master); +extern DeviceIntPtr GetXTestDevice(DeviceIntPtr master); +extern void SendDevicePresenceEvent(int deviceid, int type); +extern _X_EXPORT InputAttributes *DuplicateInputAttributes(InputAttributes *attrs); +extern _X_EXPORT void FreeInputAttributes(InputAttributes *attrs); + +/* misc event helpers */ +extern Mask GetEventMask(DeviceIntPtr dev, xEvent* ev, InputClientsPtr clients); +extern Mask GetEventFilter(DeviceIntPtr dev, xEvent *event); +extern Mask GetWindowXI2Mask(DeviceIntPtr dev, WindowPtr win, xEvent* ev); +void FixUpEventFromWindow(SpritePtr pSprite, + xEvent *xE, + WindowPtr pWin, + Window child, + Bool calcChild); +extern WindowPtr XYToWindow(SpritePtr pSprite, int x, int y); +extern int EventIsDeliverable(DeviceIntPtr dev, InternalEvent* event, + WindowPtr win); +/** + * Return masks for EventIsDeliverable. + * @defgroup EventIsDeliverable return flags + * @{ + */ +#define XI_MASK (1 << 0) /**< XI mask set on window */ +#define CORE_MASK (1 << 1) /**< Core mask set on window */ +#define DONT_PROPAGATE_MASK (1 << 2) /**< DontPropagate mask set on window */ +#define XI2_MASK (1 << 3) /**< XI2 mask set on window */ +/* @} */ + +/* Implemented by the DDX. */ +extern _X_EXPORT int NewInputDeviceRequest( + InputOption *options, + InputAttributes *attrs, + DeviceIntPtr *dev); +extern _X_EXPORT void DeleteInputDeviceRequest( + DeviceIntPtr dev); + +extern _X_EXPORT void DDXRingBell( + int volume, + int pitch, + int duration); + +#define VALUATOR_MODE_ALL_AXES -1 +extern _X_HIDDEN int valuator_get_mode(DeviceIntPtr dev, int axis); +extern _X_HIDDEN void valuator_set_mode(DeviceIntPtr dev, int axis, int mode); + +/* Set to TRUE by default - os/utils.c sets it to FALSE on user request, + xfixes/cursor.c uses it to determine if the cursor is enabled */ +extern Bool EnableCursor; + +extern _X_EXPORT ValuatorMask *valuator_mask_new(int num_valuators); +extern _X_EXPORT void valuator_mask_free(ValuatorMask **mask); +extern _X_EXPORT void valuator_mask_set_range(ValuatorMask *mask, + int first_valuator, int num_valuators, + const int* valuators); +extern _X_EXPORT void valuator_mask_set(ValuatorMask *mask, + int valuator, + int data); +extern _X_EXPORT void valuator_mask_zero(ValuatorMask *mask); +extern _X_EXPORT int valuator_mask_size(const ValuatorMask *mask); +extern _X_EXPORT int valuator_mask_isset(const ValuatorMask *mask, int bit); +extern _X_EXPORT void valuator_mask_unset(ValuatorMask *mask, int bit); +extern _X_EXPORT int valuator_mask_num_valuators(const ValuatorMask *mask); +extern _X_EXPORT void valuator_mask_copy(ValuatorMask *dest, + const ValuatorMask *src); +extern _X_EXPORT int valuator_mask_get(const ValuatorMask *mask, int valnum); + +#endif /* INPUT_H */ diff --git a/include/inputstr.h b/include/inputstr.h new file mode 100644 index 0000000..2ee2fd8 --- /dev/null +++ b/include/inputstr.h @@ -0,0 +1,615 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + + +#ifndef INPUTSTRUCT_H +#define INPUTSTRUCT_H + +#include <pixman.h> +#include "input.h" +#include "window.h" +#include "dixstruct.h" +#include "cursorstr.h" +#include "geext.h" +#include "privates.h" + +#define BitIsOn(ptr, bit) (!!(((BYTE *) (ptr))[(bit)>>3] & (1 << ((bit) & 7)))) +#define SetBit(ptr, bit) (((BYTE *) (ptr))[(bit)>>3] |= (1 << ((bit) & 7))) +#define ClearBit(ptr, bit) (((BYTE *)(ptr))[(bit)>>3] &= ~(1 << ((bit) & 7))) +extern _X_EXPORT int CountBits(const uint8_t *mask, int len); + +#define SameClient(obj,client) \ + (CLIENT_BITS((obj)->resource) == (client)->clientAsMask) + +#define EMASKSIZE MAXDEVICES + 2 + +/* This is the last XI2 event supported by the server. If you add + * events to the protocol, the server will not support these events until + * this number here is bumped. + */ +#define XI2LASTEVENT 17 /* XI_RawMotion */ +#define XI2MASKSIZE ((XI2LASTEVENT + 7)/8) /* no of bits for masks */ + +/** + * This struct stores the core event mask for each client except the client + * that created the window. + * + * Each window that has events selected from other clients has at least one of + * these masks. If multiple clients selected for events on the same window, + * these masks are in a linked list. + * + * The event mask for the client that created the window is stored in + * win->eventMask instead. + * + * The resource id is simply a fake client ID to associate this mask with a + * client. + * + * Kludge: OtherClients and InputClients must be compatible, see code. + */ +typedef struct _OtherClients { + OtherClientsPtr next; /**< Pointer to the next mask */ + XID resource; /**< id for putting into resource manager */ + Mask mask; /**< Core event mask */ +} OtherClients; + +/** + * This struct stores the XI event mask for each client. + * + * Each window that has events selected has at least one of these masks. If + * multiple client selected for events on the same window, these masks are in + * a linked list. + */ +typedef struct _InputClients { + InputClientsPtr next; /**< Pointer to the next mask */ + XID resource; /**< id for putting into resource manager */ + Mask mask[EMASKSIZE]; /**< Actual XI event mask, deviceid is index */ + /** XI2 event masks. One per device, each bit is a mask of (1 << type) */ + unsigned char xi2mask[EMASKSIZE][XI2MASKSIZE]; +} InputClients; + +/** + * Combined XI event masks from all devices. + * + * This is the XI equivalent of the deliverableEvents, eventMask and + * dontPropagate mask of the WindowRec (or WindowOptRec). + * + * A window that has an XI client selecting for events has exactly one + * OtherInputMasks struct and exactly one InputClients struct hanging off + * inputClients. Each further client appends to the inputClients list. + * Each Mask field is per-device, with the device id as the index. + * Exception: for non-device events (Presence events), the MAXDEVICES + * deviceid is used. + */ +typedef struct _OtherInputMasks { + /** + * Bitwise OR of all masks by all clients and the window's parent's masks. + */ + Mask deliverableEvents[EMASKSIZE]; + /** + * Bitwise OR of all masks by all clients on this window. + */ + Mask inputEvents[EMASKSIZE]; + /** The do-not-propagate masks for each device. */ + Mask dontPropagateMask[EMASKSIZE]; + /** The clients that selected for events */ + InputClientsPtr inputClients; + /* XI2 event masks. One per device, each bit is a mask of (1 << type) */ + unsigned char xi2mask[EMASKSIZE][XI2MASKSIZE]; +} OtherInputMasks; + +/* + * The following structure gets used for both active and passive grabs. For + * active grabs some of the fields (e.g. modifiers) are not used. However, + * that is not much waste since there aren't many active grabs (one per + * keyboard/pointer device) going at once in the server. + */ + +#define MasksPerDetailMask 8 /* 256 keycodes and 256 possible + modifier combinations, but only + 3 buttons. */ + +typedef struct _DetailRec { /* Grab details may be bit masks */ + unsigned int exact; + Mask *pMask; +} DetailRec; + +typedef enum { + GRABTYPE_CORE, + GRABTYPE_XI, + GRABTYPE_XI2 +} GrabType; + +union _GrabMask { + Mask core; + Mask xi; + char xi2mask[EMASKSIZE][XI2MASKSIZE]; +}; + +/** + * Central struct for device grabs. + * The same struct is used for both core grabs and device grabs, with + * different fields being set. + * If the grab is a core grab (GrabPointer/GrabKeyboard), then the eventMask + * is a combination of standard event masks (i.e. PointerMotionMask | + * ButtonPressMask). + * If the grab is a device grab (GrabDevice), then the eventMask is a + * combination of event masks for a given XI event type (see SetEventInfo). + * + * If the grab is a result of a ButtonPress, then eventMask is the core mask + * and deviceMask is set to the XI event mask for the grab. + */ +typedef struct _GrabRec { + GrabPtr next; /* for chain of passive grabs */ + XID resource; + DeviceIntPtr device; + WindowPtr window; + unsigned ownerEvents:1; + unsigned keyboardMode:1; + unsigned pointerMode:1; + GrabType grabtype; + CARD8 type; /* event type */ + DetailRec modifiersDetail; + DeviceIntPtr modifierDevice; + DetailRec detail; /* key or button */ + WindowPtr confineTo; /* always NULL for keyboards */ + CursorPtr cursor; /* always NULL for keyboards */ + Mask eventMask; + Mask deviceMask; + /* XI2 event masks. One per device, each bit is a mask of (1 << type) */ + unsigned char xi2mask[EMASKSIZE][XI2MASKSIZE]; +} GrabRec; + +/** + * Sprite information for a device. + */ +typedef struct _SpriteRec { + CursorPtr current; + BoxRec hotLimits; /* logical constraints of hot spot */ + Bool confined; /* confined to screen */ + RegionPtr hotShape; /* additional logical shape constraint */ + BoxRec physLimits; /* physical constraints of hot spot */ + WindowPtr win; /* window of logical position */ + HotSpot hot; /* logical pointer position */ + HotSpot hotPhys; /* physical pointer position */ +#ifdef PANORAMIX + ScreenPtr screen; /* all others are in Screen 0 coordinates */ + RegionRec Reg1; /* Region 1 for confining motion */ + RegionRec Reg2; /* Region 2 for confining virtual motion */ + WindowPtr windows[MAXSCREENS]; + WindowPtr confineWin; /* confine window */ +#endif + /* The window trace information is used at dix/events.c to avoid having + * to compute all the windows between the root and the current pointer + * window each time a button or key goes down. The grabs on each of those + * windows must be checked. + * spriteTraces should only be used at dix/events.c! */ + WindowPtr *spriteTrace; + int spriteTraceSize; + int spriteTraceGood; + + /* Due to delays between event generation and event processing, it is + * possible that the pointer has crossed screen boundaries between the + * time in which it begins generating events and the time when + * those events are processed. + * + * pEnqueueScreen: screen the pointer was on when the event was generated + * pDequeueScreen: screen the pointer was on when the event is processed + */ + ScreenPtr pEnqueueScreen; + ScreenPtr pDequeueScreen; + +} SpriteRec; + +typedef struct _KeyClassRec { + int sourceid; + CARD8 down[DOWN_LENGTH]; + CARD8 postdown[DOWN_LENGTH]; + int modifierKeyCount[8]; + struct _XkbSrvInfo *xkbInfo; +} KeyClassRec, *KeyClassPtr; + +typedef struct _AxisInfo { + int resolution; + int min_resolution; + int max_resolution; + int min_value; + int max_value; + Atom label; + CARD8 mode; +} AxisInfo, *AxisInfoPtr; + +typedef struct _ValuatorAccelerationRec { + int number; + PointerAccelSchemeProc AccelSchemeProc; + void *accelData; /* at disposal of AccelScheme */ + DeviceCallbackProc AccelCleanupProc; +} ValuatorAccelerationRec, *ValuatorAccelerationPtr; + +typedef struct _ValuatorClassRec { + int sourceid; + int numMotionEvents; + int first_motion; + int last_motion; + void *motion; /* motion history buffer. Different layout + for MDs and SDs!*/ + WindowPtr motionHintWindow; + + AxisInfoPtr axes; + unsigned short numAxes; + double *axisVal; /* always absolute, but device-coord system */ + ValuatorAccelerationRec accelScheme; +} ValuatorClassRec; + +typedef struct _ButtonClassRec { + int sourceid; + CARD8 numButtons; + CARD8 buttonsDown; /* number of buttons currently down + This counts logical buttons, not + physical ones, i.e if some buttons + are mapped to 0, they're not counted + here */ + unsigned short state; + Mask motionMask; + CARD8 down[DOWN_LENGTH]; + CARD8 postdown[DOWN_LENGTH]; + CARD8 map[MAP_LENGTH]; + union _XkbAction *xkb_acts; + Atom labels[MAX_BUTTONS]; +} ButtonClassRec, *ButtonClassPtr; + +typedef struct _FocusClassRec { + int sourceid; + WindowPtr win; /* May be set to a int constant (e.g. PointerRootWin)! */ + int revert; + TimeStamp time; + WindowPtr *trace; + int traceSize; + int traceGood; +} FocusClassRec, *FocusClassPtr; + +typedef struct _ProximityClassRec { + int sourceid; + char in_proximity; +} ProximityClassRec, *ProximityClassPtr; + +typedef struct _AbsoluteClassRec { + int sourceid; + /* Calibration. */ + int min_x; + int max_x; + int min_y; + int max_y; + int flip_x; + int flip_y; + int rotation; + int button_threshold; + + /* Area. */ + int offset_x; + int offset_y; + int width; + int height; + int screen; + XID following; +} AbsoluteClassRec, *AbsoluteClassPtr; + +typedef struct _KbdFeedbackClassRec *KbdFeedbackPtr; +typedef struct _PtrFeedbackClassRec *PtrFeedbackPtr; +typedef struct _IntegerFeedbackClassRec *IntegerFeedbackPtr; +typedef struct _StringFeedbackClassRec *StringFeedbackPtr; +typedef struct _BellFeedbackClassRec *BellFeedbackPtr; +typedef struct _LedFeedbackClassRec *LedFeedbackPtr; + +typedef struct _KbdFeedbackClassRec { + BellProcPtr BellProc; + KbdCtrlProcPtr CtrlProc; + KeybdCtrl ctrl; + KbdFeedbackPtr next; + struct _XkbSrvLedInfo *xkb_sli; +} KbdFeedbackClassRec; + +typedef struct _PtrFeedbackClassRec { + PtrCtrlProcPtr CtrlProc; + PtrCtrl ctrl; + PtrFeedbackPtr next; +} PtrFeedbackClassRec; + +typedef struct _IntegerFeedbackClassRec { + IntegerCtrlProcPtr CtrlProc; + IntegerCtrl ctrl; + IntegerFeedbackPtr next; +} IntegerFeedbackClassRec; + +typedef struct _StringFeedbackClassRec { + StringCtrlProcPtr CtrlProc; + StringCtrl ctrl; + StringFeedbackPtr next; +} StringFeedbackClassRec; + +typedef struct _BellFeedbackClassRec { + BellProcPtr BellProc; + BellCtrlProcPtr CtrlProc; + BellCtrl ctrl; + BellFeedbackPtr next; +} BellFeedbackClassRec; + +typedef struct _LedFeedbackClassRec { + LedCtrlProcPtr CtrlProc; + LedCtrl ctrl; + LedFeedbackPtr next; + struct _XkbSrvLedInfo *xkb_sli; +} LedFeedbackClassRec; + + +typedef struct _ClassesRec { + KeyClassPtr key; + ValuatorClassPtr valuator; + ButtonClassPtr button; + FocusClassPtr focus; + ProximityClassPtr proximity; + AbsoluteClassPtr absolute; + KbdFeedbackPtr kbdfeed; + PtrFeedbackPtr ptrfeed; + IntegerFeedbackPtr intfeed; + StringFeedbackPtr stringfeed; + BellFeedbackPtr bell; + LedFeedbackPtr leds; +} ClassesRec; + + +/* Device properties */ +typedef struct _XIPropertyValue +{ + Atom type; /* ignored by server */ + short format; /* format of data for swapping - 8,16,32 */ + long size; /* size of data in (format/8) bytes */ + pointer data; /* private to client */ +} XIPropertyValueRec; + +typedef struct _XIProperty +{ + struct _XIProperty *next; + Atom propertyName; + BOOL deletable; /* clients can delete this prop? */ + XIPropertyValueRec value; +} XIPropertyRec; + +typedef XIPropertyRec *XIPropertyPtr; +typedef XIPropertyValueRec *XIPropertyValuePtr; + + +typedef struct _XIPropertyHandler +{ + struct _XIPropertyHandler* next; + long id; + int (*SetProperty) (DeviceIntPtr dev, + Atom property, + XIPropertyValuePtr prop, + BOOL checkonly); + int (*GetProperty) (DeviceIntPtr dev, + Atom property); + int (*DeleteProperty) (DeviceIntPtr dev, + Atom property); +} XIPropertyHandler, *XIPropertyHandlerPtr; + +/* states for devices */ + +#define NOT_GRABBED 0 +#define THAWED 1 +#define THAWED_BOTH 2 /* not a real state */ +#define FREEZE_NEXT_EVENT 3 +#define FREEZE_BOTH_NEXT_EVENT 4 +#define FROZEN 5 /* any state >= has device frozen */ +#define FROZEN_NO_EVENT 5 +#define FROZEN_WITH_EVENT 6 +#define THAW_OTHERS 7 + + +typedef struct _GrabInfoRec { + TimeStamp grabTime; + Bool fromPassiveGrab; /* true if from passive grab */ + Bool implicitGrab; /* implicit from ButtonPress */ + GrabRec activeGrab; + GrabPtr grab; + CARD8 activatingKey; + void (*ActivateGrab) ( + DeviceIntPtr /*device*/, + GrabPtr /*grab*/, + TimeStamp /*time*/, + Bool /*autoGrab*/); + void (*DeactivateGrab)( + DeviceIntPtr /*device*/); + struct { + Bool frozen; + int state; + GrabPtr other; /* if other grab has this frozen */ + DeviceEvent *event; /* saved to be replayed */ + } sync; +} GrabInfoRec, *GrabInfoPtr; + +typedef struct _SpriteInfoRec { + /* sprite must always point to a valid sprite. For devices sharing the + * sprite, let sprite point to a paired spriteOwner's sprite. */ + SpritePtr sprite; /* sprite information */ + Bool spriteOwner; /* True if device owns the sprite */ + DeviceIntPtr paired; /* The paired device. Keyboard if + spriteOwner is TRUE, otherwise the + pointer that owns the sprite. */ + + /* keep states for animated cursor */ + struct { + CursorPtr pCursor; + ScreenPtr pScreen; + int elt; + CARD32 time; + } anim; +} SpriteInfoRec, *SpriteInfoPtr; + +/* device types */ +#define MASTER_POINTER 1 +#define MASTER_KEYBOARD 2 +#define SLAVE 3 + +typedef struct _DeviceIntRec { + DeviceRec public; + DeviceIntPtr next; + Bool startup; /* true if needs to be turned on at + server intialization time */ + DeviceProc deviceProc; /* proc(DevicePtr, DEVICE_xx). It is + used to initialize, turn on, or + turn off the device */ + Bool inited; /* TRUE if INIT returns Success */ + Bool enabled; /* TRUE if ON returns Success */ + Bool coreEvents; /* TRUE if device also sends core */ + GrabInfoRec deviceGrab; /* grab on the device */ + int type; /* MASTER_POINTER, MASTER_KEYBOARD, SLAVE */ + Atom xinput_type; + char *name; + int id; + KeyClassPtr key; + ValuatorClassPtr valuator; + ButtonClassPtr button; + FocusClassPtr focus; + ProximityClassPtr proximity; + AbsoluteClassPtr absolute; + KbdFeedbackPtr kbdfeed; + PtrFeedbackPtr ptrfeed; + IntegerFeedbackPtr intfeed; + StringFeedbackPtr stringfeed; + BellFeedbackPtr bell; + LedFeedbackPtr leds; + struct _XkbInterest *xkb_interest; + char *config_info; /* used by the hotplug layer */ + ClassesPtr unused_classes; /* for master devices */ + int saved_master_id; /* for slaves while grabbed */ + PrivateRec *devPrivates; + DeviceUnwrapProc unwrapProc; + SpriteInfoPtr spriteInfo; + union { + DeviceIntPtr master; /* master device */ + DeviceIntPtr lastSlave; /* last slave device used */ + } u; + + /* last valuator values recorded, not posted to client; + * for slave devices, valuators is in device coordinates + * for master devices, valuators is in screen coordinates + * see dix/getevents.c + * remainder supports acceleration + */ + struct { + int valuators[MAX_VALUATORS]; + float remainder[MAX_VALUATORS]; + int numValuators; + DeviceIntPtr slave; + } last; + + /* Input device property handling. */ + struct { + XIPropertyPtr properties; + XIPropertyHandlerPtr handlers; /* NULL-terminated */ + } properties; + + /* coordinate transformation matrix for absolute input devices */ + struct pixman_f_transform transform; + + /* XTest related master device id */ + int xtest_master_id; +} DeviceIntRec; + +typedef struct { + int numDevices; /* total number of devices */ + DeviceIntPtr devices; /* all devices turned on */ + DeviceIntPtr off_devices; /* all devices turned off */ + DeviceIntPtr keyboard; /* the main one for the server */ + DeviceIntPtr pointer; + DeviceIntPtr all_devices; + DeviceIntPtr all_master_devices; +} InputInfo; + +extern _X_EXPORT InputInfo inputInfo; + +/* for keeping the events for devices grabbed synchronously */ +typedef struct _QdEvent *QdEventPtr; +typedef struct _QdEvent { + QdEventPtr next; + DeviceIntPtr device; + ScreenPtr pScreen; /* what screen the pointer was on */ + unsigned long months; /* milliseconds is in the event */ + InternalEvent *event; +} QdEventRec; + +/** + * syncEvents is the global structure for queued events. + * + * Devices can be frozen through GrabModeSync pointer grabs. If this is the + * case, events from these devices are added to "pending" instead of being + * processed normally. When the device is unfrozen, events in "pending" are + * replayed and processed as if they would come from the device directly. + */ +typedef struct _EventSyncInfo { + QdEventPtr pending, /**< list of queued events */ + *pendtail; /**< last event in list */ + /** The device to replay events for. Only set in AllowEvents(), in which + * case it is set to the device specified in the request. */ + DeviceIntPtr replayDev; /* kludgy rock to put flag for */ + + /** + * The window the events are supposed to be replayed on. + * This window may be set to the grab's window (but only when + * Replay{Pointer|Keyboard} is given in the XAllowEvents() + * request. */ + WindowPtr replayWin; /* ComputeFreezes */ + /** + * Flag to indicate whether we're in the process of + * replaying events. Only set in ComputeFreezes(). */ + Bool playingEvents; + TimeStamp time; +} EventSyncInfoRec, *EventSyncInfoPtr; + +extern EventSyncInfoRec syncEvents; + +#endif /* INPUTSTRUCT_H */ diff --git a/include/inpututils.h b/include/inpututils.h new file mode 100644 index 0000000..b8ca6ab --- /dev/null +++ b/include/inpututils.h @@ -0,0 +1,40 @@ +/* + * Copyright © 2010 Red Hat, Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + */ + +#ifdef HAVE_DIX_CONFIG_H +#include "dix-config.h" +#endif + +#ifndef INPUTUTILS_H +#define INPUTUTILS_H + +#include "input.h" + +struct _ValuatorMask { + int8_t last_bit; /* highest bit set in mask */ + uint8_t mask[(MAX_VALUATORS + 7)/8]; + int valuators[MAX_VALUATORS]; /* valuator data */ +}; + +#endif diff --git a/include/kdrive-config.h.in b/include/kdrive-config.h.in new file mode 100644 index 0000000..0e54aa1 --- /dev/null +++ b/include/kdrive-config.h.in @@ -0,0 +1,40 @@ +/* kdrive-config.h.in: not at all generated. -*- c -*- + */ + +#ifndef _KDRIVE_CONFIG_H_ +#define _KDRIVE_CONFIG_H_ + +#include <dix-config.h> +#include <xkb-config.h> + +/* Building kdrive server. */ +#undef KDRIVESERVER + +/* Include framebuffer support in X servers */ +#undef KDRIVEFBDEV + +/* Enable touchscreen support */ +#undef TOUCHSCREEN + +/* Support tslib touchscreen abstraction library */ +#undef TSLIB + +/* Support KDrive kbd driver */ +#undef KDRIVE_KBD + +/* Support KDrive mouse driver */ +#undef KDRIVE_MOUSE + +/* Support KDrive evdev driver */ +#undef KDRIVE_EVDEV + +/* Verbose debugging output hilarity */ +#undef DEBUG + +/* Have the backtrace() function. */ +#undef HAVE_BACKTRACE + +/* Have execinfo.h for backtrace(). */ +#undef HAVE_EXECINFO_H + +#endif /* _KDRIVE_CONFIG_H_ */ diff --git a/include/list.h b/include/list.h new file mode 100644 index 0000000..4ce20a8 --- /dev/null +++ b/include/list.h @@ -0,0 +1,103 @@ +/* + * Copyright © 2010 Intel Corporation + * Copyright © 2010 Francisco Jerez <currojerez@riseup.net> + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS + * IN THE SOFTWARE. + * + */ + +#ifndef _LIST_H_ +#define _LIST_H_ + +/* classic doubly-link circular list */ +struct list { + struct list *next, *prev; +}; + +static void +list_init(struct list *list) +{ + list->next = list->prev = list; +} + +static inline void +__list_add(struct list *entry, + struct list *prev, + struct list *next) +{ + next->prev = entry; + entry->next = next; + entry->prev = prev; + prev->next = entry; +} + +static inline void +list_add(struct list *entry, struct list *head) +{ + __list_add(entry, head, head->next); +} + +static inline void +__list_del(struct list *prev, struct list *next) +{ + next->prev = prev; + prev->next = next; +} + +static inline void +list_del(struct list *entry) +{ + __list_del(entry->prev, entry->next); + list_init(entry); +} + +static inline Bool +list_is_empty(struct list *head) +{ + return head->next == head; +} + +#ifndef container_of +#define container_of(ptr, type, member) \ + (type *)((char *)(ptr) - (char *) &((type *)0)->member) +#endif + +#define list_entry(ptr, type, member) \ + container_of(ptr, type, member) + +#define list_first_entry(ptr, type, member) \ + list_entry((ptr)->next, type, member) + +#define __container_of(ptr, sample, member) \ + (void *)((char *)(ptr) \ + - ((char *)&(sample)->member - (char *)(sample))) + +#define list_for_each_entry(pos, head, member) \ + for (pos = __container_of((head)->next, pos, member); \ + &pos->member != (head); \ + pos = __container_of(pos->member.next, pos, member)) + +#define list_for_each_entry_safe(pos, tmp, head, member) \ + for (pos = __container_of((head)->next, pos, member), \ + tmp = __container_of(pos->member.next, pos, member); \ + &pos->member != (head); \ + pos = tmp, tmp = __container_of(pos->member.next, tmp, member)) + +#endif diff --git a/include/misc.h b/include/misc.h new file mode 100644 index 0000000..62d813e --- /dev/null +++ b/include/misc.h @@ -0,0 +1,292 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +Copyright 1992, 1993 Data General Corporation; +Copyright 1992, 1993 OMRON Corporation + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that the +above copyright notice appear in all copies and that both that copyright +notice and this permission notice appear in supporting documentation, and that +neither the name OMRON or DATA GENERAL be used in advertising or publicity +pertaining to distribution of the software without specific, written prior +permission of the party whose name is to be used. Neither OMRON or +DATA GENERAL make any representation about the suitability of this software +for any purpose. It is provided "as is" without express or implied warranty. + +OMRON AND DATA GENERAL EACH DISCLAIM ALL WARRANTIES WITH REGARD TO THIS +SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, +IN NO EVENT SHALL OMRON OR DATA GENERAL BE LIABLE FOR ANY SPECIAL, INDIRECT +OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE +OF THIS SOFTWARE. + +******************************************************************/ +#ifndef MISC_H +#define MISC_H 1 +/* + * X internal definitions + * + */ + +#include <X11/Xosdefs.h> +#include <X11/Xfuncproto.h> +#include <X11/Xmd.h> +#include <X11/X.h> +#include <X11/Xdefs.h> + +#include <stddef.h> + +#ifndef MAXSCREENS +#define MAXSCREENS 16 +#endif +#define MAXCLIENTS 256 +#define MAXEXTENSIONS 128 +#define MAXFORMATS 8 +#define MAXDEVICES 40 /* input devices */ + +#define EXTENSION_EVENT_BASE 64 +#define EXTENSION_BASE 128 + +typedef unsigned long PIXEL; +typedef unsigned long ATOM; + + +#ifndef TRUE +#define TRUE 1 +#define FALSE 0 +#endif + +#ifndef _XTYPEDEF_CALLBACKLISTPTR +typedef struct _CallbackList *CallbackListPtr; /* also in dix.h */ +#define _XTYPEDEF_CALLBACKLISTPTR +#endif + +typedef struct _xReq *xReqPtr; + +#include "os.h" /* for ALLOCATE_LOCAL and DEALLOCATE_LOCAL */ +#include <X11/Xfuncs.h> /* for bcopy, bzero, and bcmp */ + +#define NullBox ((BoxPtr)0) +#define MILLI_PER_MIN (1000 * 60) +#define MILLI_PER_SECOND (1000) + + /* this next is used with None and ParentRelative to tell + PaintWin() what to use to paint the background. Also used + in the macro IS_VALID_PIXMAP */ + +#define USE_BACKGROUND_PIXEL 3 +#define USE_BORDER_PIXEL 3 + + +/* byte swap a 32-bit literal */ +#define lswapl(x) ((((x) & 0xff) << 24) |\ + (((x) & 0xff00) << 8) |\ + (((x) & 0xff0000) >> 8) |\ + (((x) >> 24) & 0xff)) + +/* byte swap a short literal */ +#define lswaps(x) ((((x) & 0xff) << 8) | (((x) >> 8) & 0xff)) + +#undef min +#undef max + +#define min(a, b) (((a) < (b)) ? (a) : (b)) +#define max(a, b) (((a) > (b)) ? (a) : (b)) +/* abs() is a function, not a macro; include the file declaring + * it in case we haven't done that yet. + */ +#include <stdlib.h> +#ifndef Fabs +#define Fabs(a) ((a) > 0.0 ? (a) : -(a)) /* floating absolute value */ +#endif +#define sign(x) ((x) < 0 ? -1 : ((x) > 0 ? 1 : 0)) +/* this assumes b > 0 */ +#define modulus(a, b, d) if (((d) = (a) % (b)) < 0) (d) += (b) +/* + * return the least significant bit in x which is set + * + * This works on 1's complement and 2's complement machines. + * If you care about the extra instruction on 2's complement + * machines, change to ((x) & (-(x))) + */ +#define lowbit(x) ((x) & (~(x) + 1)) + +/* XXX Not for modules */ +#include <limits.h> +#if !defined(MAXSHORT) || !defined(MINSHORT) || \ + !defined(MAXINT) || !defined(MININT) +/* + * Some implementations #define these through <math.h>, so preclude + * #include'ing it later. + */ + +#include <math.h> +#undef MAXSHORT +#define MAXSHORT SHRT_MAX +#undef MINSHORT +#define MINSHORT SHRT_MIN +#undef MAXINT +#define MAXINT INT_MAX +#undef MININT +#define MININT INT_MIN + +#include <assert.h> +#include <ctype.h> +#include <stdio.h> /* for fopen, etc... */ + +#endif + +/** + * Calculate the number of bytes needed to hold bits. + * @param bits The minimum number of bits needed. + * @return The number of bytes needed to hold bits. + */ +static inline int +bits_to_bytes(const int bits) { + return ((bits + 7) >> 3); +} +/** + * Calculate the number of 4-byte units needed to hold the given number of + * bytes. + * @param bytes The minimum number of bytes needed. + * @return The number of 4-byte units needed to hold bytes. + */ +static inline int +bytes_to_int32(const int bytes) { + return (((bytes) + 3) >> 2); +} + +/** + * Calculate the number of bytes (in multiples of 4) needed to hold bytes. + * @param bytes The minimum number of bytes needed. + * @return The closest multiple of 4 that is equal or higher than bytes. + */ +static inline int +pad_to_int32(const int bytes) { + return (((bytes) + 3) & ~3); +} + +extern char** +xstrtokenize(const char *str, const char* separators); + +/* some macros to help swap requests, replies, and events */ + +#define LengthRestB(stuff) \ + ((client->req_len << 2) - sizeof(*stuff)) + +#define LengthRestS(stuff) \ + ((client->req_len << 1) - (sizeof(*stuff) >> 1)) + +#define LengthRestL(stuff) \ + (client->req_len - (sizeof(*stuff) >> 2)) + +#define SwapRestS(stuff) \ + SwapShorts((short *)(stuff + 1), LengthRestS(stuff)) + +#define SwapRestL(stuff) \ + SwapLongs((CARD32 *)(stuff + 1), LengthRestL(stuff)) + +/* byte swap a 32-bit value */ +#define swapl(x, n) { \ + n = ((char *) (x))[0];\ + ((char *) (x))[0] = ((char *) (x))[3];\ + ((char *) (x))[3] = n;\ + n = ((char *) (x))[1];\ + ((char *) (x))[1] = ((char *) (x))[2];\ + ((char *) (x))[2] = n; } + +/* byte swap a short */ +#define swaps(x, n) { \ + n = ((char *) (x))[0];\ + ((char *) (x))[0] = ((char *) (x))[1];\ + ((char *) (x))[1] = n; } + +/* copy 32-bit value from src to dst byteswapping on the way */ +#define cpswapl(src, dst) { \ + ((char *)&(dst))[0] = ((char *) &(src))[3];\ + ((char *)&(dst))[1] = ((char *) &(src))[2];\ + ((char *)&(dst))[2] = ((char *) &(src))[1];\ + ((char *)&(dst))[3] = ((char *) &(src))[0]; } + +/* copy short from src to dst byteswapping on the way */ +#define cpswaps(src, dst) { \ + ((char *) &(dst))[0] = ((char *) &(src))[1];\ + ((char *) &(dst))[1] = ((char *) &(src))[0]; } + +extern _X_EXPORT void SwapLongs( + CARD32 *list, + unsigned long count); + +extern _X_EXPORT void SwapShorts( + short *list, + unsigned long count); + +extern _X_EXPORT void MakePredeclaredAtoms(void); + +extern _X_EXPORT int Ones( + unsigned long /*mask*/); + +typedef struct _xPoint *DDXPointPtr; +typedef struct pixman_box16 *BoxPtr; +typedef struct _xEvent *xEventPtr; +typedef struct _xRectangle *xRectanglePtr; +typedef struct _GrabRec *GrabPtr; + +/* typedefs from other places - duplicated here to minimize the amount + * of unnecessary junk that one would normally have to include to get + * these symbols defined + */ + +#ifndef _XTYPEDEF_CHARINFOPTR +typedef struct _CharInfo *CharInfoPtr; /* also in fonts/include/font.h */ +#define _XTYPEDEF_CHARINFOPTR +#endif + +extern _X_EXPORT unsigned long globalSerialNumber; +extern _X_EXPORT unsigned long serverGeneration; + +#endif /* MISC_H */ diff --git a/include/miscstruct.h b/include/miscstruct.h new file mode 100644 index 0000000..409b102 --- /dev/null +++ b/include/miscstruct.h @@ -0,0 +1,66 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef MISCSTRUCT_H +#define MISCSTRUCT_H 1 + +#include "misc.h" +#include <X11/Xprotostr.h> +#include <pixman.h> + +typedef xPoint DDXPointRec; + +typedef struct pixman_box16 BoxRec; + +typedef union _DevUnion { + pointer ptr; + long val; + unsigned long uval; + pointer (*fptr)(void); +} DevUnion; + +#endif /* MISCSTRUCT_H */ diff --git a/include/opaque.h b/include/opaque.h new file mode 100644 index 0000000..5c70717 --- /dev/null +++ b/include/opaque.h @@ -0,0 +1,77 @@ +/* + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. + +*/ + +#ifndef OPAQUE_H +#define OPAQUE_H + +#include <X11/Xmd.h> + +#include "globals.h" + +extern _X_EXPORT char *defaultTextFont; +extern _X_EXPORT char *defaultCursorFont; +extern _X_EXPORT int MaxClients; +extern _X_EXPORT volatile char isItTimeToYield; +extern _X_EXPORT volatile char dispatchException; + +/* bit values for dispatchException */ +#define DE_RESET 1 +#define DE_TERMINATE 2 +#define DE_PRIORITYCHANGE 4 /* set when a client's priority changes */ + +extern _X_EXPORT CARD32 TimeOutValue; +extern _X_EXPORT int ScreenSaverBlanking; +extern _X_EXPORT int ScreenSaverAllowExposures; +extern _X_EXPORT int defaultScreenSaverBlanking; +extern _X_EXPORT int defaultScreenSaverAllowExposures; +extern _X_EXPORT char *display; + +extern _X_EXPORT int defaultBackingStore; +extern _X_EXPORT Bool disableBackingStore; +extern _X_EXPORT Bool enableBackingStore; +extern _X_EXPORT Bool PartialNetwork; +extern _X_EXPORT Bool RunFromSigStopParent; +#ifdef RLIMIT_DATA +extern _X_EXPORT int limitDataSpace; +#endif +#ifdef RLIMIT_STACK +extern _X_EXPORT int limitStackSpace; +#endif +#ifdef RLIMIT_NOFILE +extern _X_EXPORT int limitNoFile; +#endif +extern _X_EXPORT Bool defeatAccessControl; +extern _X_EXPORT long maxBigRequestSize; +extern _X_EXPORT Bool party_like_its_1989; +extern _X_EXPORT Bool whiteRoot; +extern _X_EXPORT Bool bgNoneRoot; + +extern _X_EXPORT Bool CoreDump; + + +#endif /* OPAQUE_H */ diff --git a/include/os.h b/include/os.h new file mode 100644 index 0000000..d747040 --- /dev/null +++ b/include/os.h @@ -0,0 +1,539 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + + +#ifndef OS_H +#define OS_H + +#include "misc.h" +#include <stdarg.h> +#include <string.h> + +#define SCREEN_SAVER_ON 0 +#define SCREEN_SAVER_OFF 1 +#define SCREEN_SAVER_FORCER 2 +#define SCREEN_SAVER_CYCLE 3 + +#ifndef MAX_REQUEST_SIZE +#define MAX_REQUEST_SIZE 65535 +#endif +#ifndef MAX_BIG_REQUEST_SIZE +#define MAX_BIG_REQUEST_SIZE 4194303 +#endif + +typedef struct _FontPathRec *FontPathPtr; +typedef struct _NewClientRec *NewClientPtr; + +#ifndef xalloc +#define xnfalloc(size) XNFalloc((unsigned long)(size)) +#define xnfcalloc(_num, _size) XNFcalloc((unsigned long)(_num)*(unsigned long)(_size)) +#define xnfrealloc(ptr, size) XNFrealloc((pointer)(ptr), (unsigned long)(size)) + +#define xalloc(size) Xalloc((unsigned long)(size)) +#define xcalloc(_num, _size) Xcalloc((unsigned long)(_num)*(unsigned long)(_size)) +#define xrealloc(ptr, size) Xrealloc((pointer)(ptr), (unsigned long)(size)) +#define xfree(ptr) Xfree((pointer)(ptr)) +#define xstrdup(s) Xstrdup(s) +#define xnfstrdup(s) XNFstrdup(s) +#endif + +#include <stdio.h> +#include <stdarg.h> + +#ifdef DDXBEFORERESET +extern void ddxBeforeReset (void); +#endif + +#ifdef DDXOSVERRORF +extern _X_EXPORT void (*OsVendorVErrorFProc)(const char *, va_list args); +#endif + +extern _X_EXPORT int WaitForSomething( + int* /*pClientsReady*/ +); + +extern _X_EXPORT int ReadRequestFromClient(ClientPtr /*client*/); + +extern _X_EXPORT Bool InsertFakeRequest( + ClientPtr /*client*/, + char* /*data*/, + int /*count*/); + +extern _X_EXPORT void ResetCurrentRequest(ClientPtr /*client*/); + +extern _X_EXPORT void FlushAllOutput(void); + +extern _X_EXPORT void FlushIfCriticalOutputPending(void); + +extern _X_EXPORT void SetCriticalOutputPending(void); + +extern _X_EXPORT int WriteToClient(ClientPtr /*who*/, int /*count*/, const void* /*buf*/); + +extern _X_EXPORT void ResetOsBuffers(void); + +extern _X_EXPORT void InitConnectionLimits(void); + +extern _X_EXPORT void NotifyParentProcess(void); + +extern _X_EXPORT void CreateWellKnownSockets(void); + +extern _X_EXPORT void ResetWellKnownSockets(void); + +extern _X_EXPORT void CloseWellKnownConnections(void); + +extern _X_EXPORT XID AuthorizationIDOfClient(ClientPtr /*client*/); + +extern _X_EXPORT char *ClientAuthorized( + ClientPtr /*client*/, + unsigned int /*proto_n*/, + char* /*auth_proto*/, + unsigned int /*string_n*/, + char* /*auth_string*/); + +extern _X_EXPORT Bool EstablishNewConnections( + ClientPtr /*clientUnused*/, + pointer /*closure*/); + +extern _X_EXPORT void CheckConnections(void); + +extern _X_EXPORT void CloseDownConnection(ClientPtr /*client*/); + +extern _X_EXPORT void AddGeneralSocket(int /*fd*/); + +extern _X_EXPORT void RemoveGeneralSocket(int /*fd*/); + +extern _X_EXPORT void AddEnabledDevice(int /*fd*/); + +extern _X_EXPORT void RemoveEnabledDevice(int /*fd*/); + +extern _X_EXPORT int OnlyListenToOneClient(ClientPtr /*client*/); + +extern _X_EXPORT void ListenToAllClients(void); + +extern _X_EXPORT void IgnoreClient(ClientPtr /*client*/); + +extern _X_EXPORT void AttendClient(ClientPtr /*client*/); + +extern _X_EXPORT void MakeClientGrabImpervious(ClientPtr /*client*/); + +extern _X_EXPORT void MakeClientGrabPervious(ClientPtr /*client*/); + +#ifdef XQUARTZ +extern void ListenOnOpenFD(int /* fd */, int /* noxauth */); +#endif + +extern _X_EXPORT CARD32 GetTimeInMillis(void); + +extern _X_EXPORT void AdjustWaitForDelay( + pointer /*waitTime*/, + unsigned long /*newdelay*/); + +typedef struct _OsTimerRec *OsTimerPtr; + +typedef CARD32 (*OsTimerCallback)( + OsTimerPtr /* timer */, + CARD32 /* time */, + pointer /* arg */); + +extern _X_EXPORT void TimerInit(void); + +extern _X_EXPORT Bool TimerForce(OsTimerPtr /* timer */); + +#define TimerAbsolute (1<<0) +#define TimerForceOld (1<<1) + +extern _X_EXPORT OsTimerPtr TimerSet( + OsTimerPtr /* timer */, + int /* flags */, + CARD32 /* millis */, + OsTimerCallback /* func */, + pointer /* arg */); + +extern _X_EXPORT void TimerCheck(void); +extern _X_EXPORT void TimerCancel(OsTimerPtr /* pTimer */); +extern _X_EXPORT void TimerFree(OsTimerPtr /* pTimer */); + +extern _X_EXPORT void SetScreenSaverTimer(void); +extern _X_EXPORT void FreeScreenSaverTimer(void); + +extern _X_EXPORT void AutoResetServer(int /*sig*/); + +extern _X_EXPORT void GiveUp(int /*sig*/); + +extern _X_EXPORT void UseMsg(void); + +extern _X_EXPORT void ProcessCommandLine(int /*argc*/, char* /*argv*/[]); + +extern _X_EXPORT int set_font_authorizations( + char ** /* authorizations */, + int * /*authlen */, + pointer /* client */); + +#ifndef _HAVE_XALLOC_DECLS +#define _HAVE_XALLOC_DECLS + +/* + * Use malloc(3) instead. + */ +extern _X_EXPORT void *Xalloc(unsigned long /*amount*/) _X_DEPRECATED; +/* + * Use calloc(3) instead + */ +extern _X_EXPORT void *Xcalloc(unsigned long /*amount*/) _X_DEPRECATED; +/* + * Use realloc(3) instead + */ +extern _X_EXPORT void *Xrealloc(void * /*ptr*/, unsigned long /*amount*/) + _X_DEPRECATED; +/* + * Use free(3) instead + */ +extern _X_EXPORT void Xfree(void * /*ptr*/) _X_DEPRECATED; + +#endif + +/* + * This function malloc(3)s buffer, terminating the server if there is not + * enough memory. + */ +extern _X_EXPORT void *XNFalloc(unsigned long /*amount*/); +/* + * This function calloc(3)s buffer, terminating the server if there is not + * enough memory. + */ +extern _X_EXPORT void *XNFcalloc(unsigned long /*amount*/); +/* + * This function realloc(3)s passed buffer, terminating the server if there is + * not enough memory. + */ +extern _X_EXPORT void *XNFrealloc(void * /*ptr*/, unsigned long /*amount*/); + +/* + * This function strdup(3)s passed string. The only difference from the library + * function that it is safe to pass NULL, as NULL will be returned. + */ +extern _X_EXPORT char *Xstrdup(const char *s); + +/* + * This function strdup(3)s passed string, terminating the server if there is + * not enough memory. If NULL is passed to this function, NULL is returned. + */ +extern _X_EXPORT char *XNFstrdup(const char *s); + +/* Include new X*asprintf API */ +#include "Xprintf.h" + +/* Older api deprecated in favor of the asprintf versions */ +extern _X_EXPORT char *Xprintf(const char *fmt, ...) _X_ATTRIBUTE_PRINTF(1,2) _X_DEPRECATED; +extern _X_EXPORT char *Xvprintf(const char *fmt, va_list va)_X_ATTRIBUTE_PRINTF(1,0) _X_DEPRECATED; +extern _X_EXPORT char *XNFprintf(const char *fmt, ...) _X_ATTRIBUTE_PRINTF(1,2) _X_DEPRECATED; +extern _X_EXPORT char *XNFvprintf(const char *fmt, va_list va)_X_ATTRIBUTE_PRINTF(1,0) _X_DEPRECATED; + +typedef void (*OsSigHandlerPtr)(int /* sig */); +typedef int (*OsSigWrapperPtr)(int /* sig */); + +extern _X_EXPORT OsSigHandlerPtr OsSignal(int /* sig */, OsSigHandlerPtr /* handler */); +extern _X_EXPORT OsSigWrapperPtr OsRegisterSigWrapper(OsSigWrapperPtr newWrap); + +extern _X_EXPORT int auditTrailLevel; + +extern _X_EXPORT void LockServer(void); +extern _X_EXPORT void UnlockServer(void); + +extern _X_EXPORT int OsLookupColor( + int /*screen*/, + char * /*name*/, + unsigned /*len*/, + unsigned short * /*pred*/, + unsigned short * /*pgreen*/, + unsigned short * /*pblue*/); + +extern _X_EXPORT void OsInit(void); + +extern _X_EXPORT void OsCleanup(Bool); + +extern _X_EXPORT void OsVendorFatalError(void); + +extern _X_EXPORT void OsVendorInit(void); + +extern _X_EXPORT void OsBlockSignals (void); + +extern _X_EXPORT void OsReleaseSignals (void); + +extern _X_EXPORT void OsAbort (void) _X_NORETURN; + +#if !defined(WIN32) +extern _X_EXPORT int System(char *); +extern _X_EXPORT pointer Popen(char *, char *); +extern _X_EXPORT int Pclose(pointer); +extern _X_EXPORT pointer Fopen(char *, char *); +extern _X_EXPORT int Fclose(pointer); +#else +#define System(a) system(a) +#define Popen(a,b) popen(a,b) +#define Pclose(a) pclose(a) +#define Fopen(a,b) fopen(a,b) +#define Fclose(a) fclose(a) +#endif + +extern _X_EXPORT void CheckUserParameters(int argc, char **argv, char **envp); +extern _X_EXPORT void CheckUserAuthorization(void); + +extern _X_EXPORT int AddHost( + ClientPtr /*client*/, + int /*family*/, + unsigned /*length*/, + const void */*pAddr*/); + +extern _X_EXPORT Bool ForEachHostInFamily ( + int /*family*/, + Bool (* /*func*/ )( + unsigned char * /* addr */, + short /* len */, + pointer /* closure */), + pointer /*closure*/); + +extern _X_EXPORT int RemoveHost( + ClientPtr /*client*/, + int /*family*/, + unsigned /*length*/, + pointer /*pAddr*/); + +extern _X_EXPORT int GetHosts( + pointer * /*data*/, + int * /*pnHosts*/, + int * /*pLen*/, + BOOL * /*pEnabled*/); + +typedef struct sockaddr * sockaddrPtr; + +extern _X_EXPORT int InvalidHost(sockaddrPtr /*saddr*/, int /*len*/, ClientPtr client); + +extern _X_EXPORT int LocalClient(ClientPtr /* client */); + +extern _X_EXPORT int LocalClientCred(ClientPtr, int *, int *); + +#define LCC_UID_SET (1 << 0) +#define LCC_GID_SET (1 << 1) +#define LCC_PID_SET (1 << 2) +#define LCC_ZID_SET (1 << 3) + +typedef struct { + int fieldsSet; /* Bit mask of fields set */ + int euid; /* Effective uid */ + int egid; /* Primary effective group id */ + int nSuppGids; /* Number of supplementary group ids */ + int *pSuppGids; /* Array of supplementary group ids */ + int pid; /* Process id */ + int zoneid; /* Only set on Solaris 10 & later */ +} LocalClientCredRec; + +extern _X_EXPORT int GetLocalClientCreds(ClientPtr, LocalClientCredRec **); +extern _X_EXPORT void FreeLocalClientCreds(LocalClientCredRec *); + +extern _X_EXPORT int ChangeAccessControl(ClientPtr /*client*/, int /*fEnabled*/); + +extern _X_EXPORT int GetAccessControl(void); + + +extern _X_EXPORT void AddLocalHosts(void); + +extern _X_EXPORT void ResetHosts(char *display); + +extern _X_EXPORT void EnableLocalHost(void); + +extern _X_EXPORT void DisableLocalHost(void); + +extern _X_EXPORT void AccessUsingXdmcp(void); + +extern _X_EXPORT void DefineSelf(int /*fd*/); + +#if XDMCP +extern _X_EXPORT void AugmentSelf(pointer /*from*/, int /*len*/); + +extern _X_EXPORT void RegisterAuthorizations(void); +#endif + +extern _X_EXPORT void InitAuthorization(char * /*filename*/); + +/* extern int LoadAuthorization(void); */ + +extern _X_EXPORT int AuthorizationFromID ( + XID id, + unsigned short *name_lenp, + char **namep, + unsigned short *data_lenp, + char **datap); + +extern _X_EXPORT XID CheckAuthorization( + unsigned int /*namelength*/, + const char * /*name*/, + unsigned int /*datalength*/, + const char * /*data*/, + ClientPtr /*client*/, + char ** /*reason*/ +); + +extern _X_EXPORT void ResetAuthorization(void); + +extern _X_EXPORT int RemoveAuthorization ( + unsigned short name_length, + const char *name, + unsigned short data_length, + const char *data); + +extern _X_EXPORT int AddAuthorization( + unsigned int /*name_length*/, + const char * /*name*/, + unsigned int /*data_length*/, + char * /*data*/); + +#ifdef XCSECURITY +extern _X_EXPORT XID GenerateAuthorization( + unsigned int /* name_length */, + const char * /* name */, + unsigned int /* data_length */, + const char * /* data */, + unsigned int * /* data_length_return */, + char ** /* data_return */); +#endif + +extern _X_EXPORT int ddxProcessArgument(int /*argc*/, char * /*argv*/ [], int /*i*/); + +extern _X_EXPORT void ddxUseMsg(void); + +/* stuff for ReplyCallback */ +extern _X_EXPORT CallbackListPtr ReplyCallback; +typedef struct { + ClientPtr client; + const void *replyData; + unsigned long dataLenBytes; + unsigned long bytesRemaining; + Bool startOfReply; +} ReplyInfoRec; + +/* stuff for FlushCallback */ +extern _X_EXPORT CallbackListPtr FlushCallback; + +extern _X_EXPORT void AbortDDX(void); +extern _X_EXPORT void ddxGiveUp(void); +extern _X_EXPORT int TimeSinceLastInputEvent(void); + +/* strcasecmp.c */ +#if NEED_STRCASECMP +#define strcasecmp xstrcasecmp +extern _X_EXPORT int xstrcasecmp(const char *s1, const char *s2); +#endif + +#if NEED_STRNCASECMP +#define strncasecmp xstrncasecmp +extern _X_EXPORT int xstrncasecmp(const char *s1, const char *s2, size_t n); +#endif + +#if NEED_STRCASESTR +#define strcasestr xstrcasestr +extern _X_EXPORT char *xstrcasestr(const char *s, const char *find); +#endif + +#ifndef HAS_STRLCPY +extern _X_EXPORT size_t strlcpy(char *dst, const char *src, size_t siz); +extern _X_EXPORT size_t strlcat(char *dst, const char *src, size_t siz); +#endif + +/* Logging. */ +typedef enum _LogParameter { + XLOG_FLUSH, + XLOG_SYNC, + XLOG_VERBOSITY, + XLOG_FILE_VERBOSITY +} LogParameter; + +/* Flags for log messages. */ +typedef enum { + X_PROBED, /* Value was probed */ + X_CONFIG, /* Value was given in the config file */ + X_DEFAULT, /* Value is a default */ + X_CMDLINE, /* Value was given on the command line */ + X_NOTICE, /* Notice */ + X_ERROR, /* Error message */ + X_WARNING, /* Warning message */ + X_INFO, /* Informational message */ + X_NONE, /* No prefix */ + X_NOT_IMPLEMENTED, /* Not implemented */ + X_UNKNOWN = -1 /* unknown -- this must always be last */ +} MessageType; + +extern _X_EXPORT const char *LogInit(const char *fname, const char *backup); +extern _X_EXPORT void LogClose(void); +extern _X_EXPORT Bool LogSetParameter(LogParameter param, int value); +extern _X_EXPORT void LogVWrite(int verb, const char *f, va_list args); +extern _X_EXPORT void LogWrite(int verb, const char *f, ...) _X_ATTRIBUTE_PRINTF(2,3); +extern _X_EXPORT void LogVMessageVerb(MessageType type, int verb, const char *format, + va_list args); +extern _X_EXPORT void LogMessageVerb(MessageType type, int verb, const char *format, + ...) _X_ATTRIBUTE_PRINTF(3,4); +extern _X_EXPORT void LogMessage(MessageType type, const char *format, ...) + _X_ATTRIBUTE_PRINTF(2,3); +extern _X_EXPORT void FreeAuditTimer(void); +extern _X_EXPORT void AuditF(const char *f, ...) _X_ATTRIBUTE_PRINTF(1,2); +extern _X_EXPORT void VAuditF(const char *f, va_list args); +extern _X_EXPORT void FatalError(const char *f, ...) _X_ATTRIBUTE_PRINTF(1,2) _X_NORETURN; + +#ifdef DEBUG +#define DebugF ErrorF +#else +#define DebugF(...) /* */ +#endif + +extern _X_EXPORT void VErrorF(const char *f, va_list args); +extern _X_EXPORT void ErrorF(const char *f, ...) _X_ATTRIBUTE_PRINTF(1,2); +extern _X_EXPORT void Error(const char *str); +extern _X_EXPORT void LogPrintMarkers(void); + +extern _X_EXPORT void xorg_backtrace(void); + +#endif /* OS_H */ diff --git a/include/pixmap.h b/include/pixmap.h new file mode 100644 index 0000000..014a111 --- /dev/null +++ b/include/pixmap.h @@ -0,0 +1,119 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef PIXMAP_H +#define PIXMAP_H + +#include "misc.h" +#include "screenint.h" + +/* types for Drawable */ +#define DRAWABLE_WINDOW 0 +#define DRAWABLE_PIXMAP 1 +#define UNDRAWABLE_WINDOW 2 + +/* corresponding type masks for dixLookupDrawable() */ +#define M_DRAWABLE_WINDOW (1<<0) +#define M_DRAWABLE_PIXMAP (1<<1) +#define M_UNDRAWABLE_WINDOW (1<<2) +#define M_ANY (-1) +#define M_WINDOW (M_DRAWABLE_WINDOW|M_UNDRAWABLE_WINDOW) +#define M_DRAWABLE (M_DRAWABLE_WINDOW|M_DRAWABLE_PIXMAP) +#define M_UNDRAWABLE (M_UNDRAWABLE_WINDOW) + +/* flags to PaintWindow() */ +#define PW_BACKGROUND 0 +#define PW_BORDER 1 + +#define NullPixmap ((PixmapPtr)0) + +typedef struct _Drawable *DrawablePtr; +typedef struct _Pixmap *PixmapPtr; + +typedef union _PixUnion { + PixmapPtr pixmap; + unsigned long pixel; +} PixUnion; + +#define SamePixUnion(a,b,isPixel)\ + ((isPixel) ? (a).pixel == (b).pixel : (a).pixmap == (b).pixmap) + +#define EqualPixUnion(as, a, bs, b) \ + ((as) == (bs) && (SamePixUnion (a, b, as))) + +#define OnScreenDrawable(type) \ + (type == DRAWABLE_WINDOW) + +#define WindowDrawable(type) \ + ((type == DRAWABLE_WINDOW) || (type == UNDRAWABLE_WINDOW)) + +extern _X_EXPORT PixmapPtr GetScratchPixmapHeader( + ScreenPtr /*pScreen*/, + int /*width*/, + int /*height*/, + int /*depth*/, + int /*bitsPerPixel*/, + int /*devKind*/, + pointer /*pPixData*/); + +extern _X_EXPORT void FreeScratchPixmapHeader( + PixmapPtr /*pPixmap*/); + +extern _X_EXPORT Bool CreateScratchPixmapsForScreen( + int /*scrnum*/); + +extern _X_EXPORT void FreeScratchPixmapsForScreen( + int /*scrnum*/); + +extern _X_EXPORT PixmapPtr AllocatePixmap( + ScreenPtr /*pScreen*/, + int /*pixDataSize*/); + +extern _X_EXPORT void FreePixmap( + PixmapPtr /*pPixmap*/); + +#endif /* PIXMAP_H */ diff --git a/include/pixmapstr.h b/include/pixmapstr.h new file mode 100644 index 0000000..702faf0 --- /dev/null +++ b/include/pixmapstr.h @@ -0,0 +1,86 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef PIXMAPSTRUCT_H +#define PIXMAPSTRUCT_H +#include "pixmap.h" +#include "screenint.h" +#include "regionstr.h" +#include "privates.h" + +typedef struct _Drawable { + unsigned char type; /* DRAWABLE_<type> */ + unsigned char class; /* specific to type */ + unsigned char depth; + unsigned char bitsPerPixel; + XID id; /* resource id */ + short x; /* window: screen absolute, pixmap: 0 */ + short y; /* window: screen absolute, pixmap: 0 */ + unsigned short width; + unsigned short height; + ScreenPtr pScreen; + unsigned long serialNumber; +} DrawableRec; + +/* + * PIXMAP -- device dependent + */ + +typedef struct _Pixmap { + DrawableRec drawable; + PrivateRec *devPrivates; + int refcnt; + int devKind; /* This is the pitch of the pixmap, typically width*bpp/8. */ + DevUnion devPrivate; /* When !NULL, devPrivate.ptr points to the raw pixel data. */ +#ifdef COMPOSITE + short screen_x; + short screen_y; +#endif + unsigned usage_hint; /* see CREATE_PIXMAP_USAGE_* */ +} PixmapRec; + +#endif /* PIXMAPSTRUCT_H */ diff --git a/include/privates.h b/include/privates.h new file mode 100644 index 0000000..7ef2cb7 --- /dev/null +++ b/include/privates.h @@ -0,0 +1,298 @@ +/*********************************************************** + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHOR BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +******************************************************************/ + +#ifndef PRIVATES_H +#define PRIVATES_H 1 + +#include <X11/Xdefs.h> +#include <X11/Xosdefs.h> +#include <X11/Xfuncproto.h> +#include "misc.h" + +/***************************************************************** + * STUFF FOR PRIVATES + *****************************************************************/ + +typedef struct _Private PrivateRec, *PrivatePtr; + +typedef enum { + /* XSELinux uses the same private keys for numerous objects */ + PRIVATE_XSELINUX, + + /* Otherwise, you get a private in just the requested structure + */ + /* These can have objects created before all of the keys are registered */ + PRIVATE_SCREEN, + PRIVATE_EXTENSION, + PRIVATE_COLORMAP, + + /* These cannot have any objects before all relevant keys are registered */ + PRIVATE_DEVICE, + PRIVATE_CLIENT, + PRIVATE_PROPERTY, + PRIVATE_SELECTION, + PRIVATE_WINDOW, + PRIVATE_PIXMAP, + PRIVATE_GC, + PRIVATE_CURSOR, + PRIVATE_CURSOR_BITS, + + /* extension privates */ + PRIVATE_DBE_WINDOW, + PRIVATE_DAMAGE, + PRIVATE_GLYPH, + PRIVATE_GLYPHSET, + PRIVATE_PICTURE, + PRIVATE_SYNC_FENCE, + + /* last private type */ + PRIVATE_LAST, +} DevPrivateType; + +typedef struct _DevPrivateKeyRec { + int offset; + int size; + Bool initialized; + Bool allocated; + DevPrivateType type; + struct _DevPrivateKeyRec *next; +} DevPrivateKeyRec, *DevPrivateKey; + +typedef struct _DevScreenPrivateKeyRec { + DevPrivateKeyRec screenKey; +} DevScreenPrivateKeyRec, *DevScreenPrivateKey; + +/* + * Let drivers know how to initialize private keys + */ + +#define HAS_DEVPRIVATEKEYREC 1 +#define HAS_DIXREGISTERPRIVATEKEY 1 + +/* + * Register a new private index for the private type. + * + * This initializes the specified key and optionally requests pre-allocated + * private space for your driver/module. If you request no extra space, you + * may set and get a single pointer value using this private key. Otherwise, + * you can get the address of the extra space and store whatever data you like + * there. + * + * You may call dixRegisterPrivateKey more than once on the same key, but the + * size and type must match or the server will abort. + * + * dixRegisterPrivateKey returns FALSE if it fails to allocate memory + * during its operation. + */ +extern _X_EXPORT Bool +dixRegisterPrivateKey(DevPrivateKey key, DevPrivateType type, unsigned size); + +/* + * Check whether a private key has been registered + */ +static inline Bool +dixPrivateKeyRegistered(DevPrivateKey key) +{ + return key->initialized; +} + +/* + * Get the address of the private storage. + * + * For keys with pre-defined storage, this gets the base of that storage + * Otherwise, it returns the place where the private pointer is stored. + */ +static inline void * +dixGetPrivateAddr(PrivatePtr *privates, const DevPrivateKey key) +{ + assert(key->initialized); + return (char *) (*privates) + key->offset; +} + +/* + * Fetch a private pointer stored in the object + * + * Returns the pointer stored with dixSetPrivate. + * This must only be used with keys that have + * no pre-defined storage + */ +static inline void * +dixGetPrivate(PrivatePtr *privates, const DevPrivateKey key) +{ + assert (key->size == 0); + return *(void **) dixGetPrivateAddr(privates, key); +} + +/* + * Associate 'val' with 'key' in 'privates' so that later calls to + * dixLookupPrivate(privates, key) will return 'val'. + */ +static inline void +dixSetPrivate(PrivatePtr *privates, const DevPrivateKey key, pointer val) +{ + assert (key->size == 0); + *(pointer *) dixGetPrivateAddr(privates, key) = val; +} + +#include "dix.h" +#include "resource.h" + +/* + * Lookup a pointer to the private record. + * + * For privates with defined storage, return the address of the + * storage. For privates without defined storage, return the pointer + * contents + */ +static inline pointer +dixLookupPrivate(PrivatePtr *privates, const DevPrivateKey key) +{ + if (key->size) + return dixGetPrivateAddr(privates, key); + else + return dixGetPrivate(privates, key); +} + +/* + * Look up the address of the pointer to the storage + * + * This returns the place where the private pointer is stored, + * which is only valid for privates without predefined storage. + */ +static inline pointer * +dixLookupPrivateAddr(PrivatePtr *privates, const DevPrivateKey key) +{ + assert (key->size == 0); + return (pointer *)dixGetPrivateAddr(privates, key); +} + +extern _X_EXPORT Bool +dixRegisterScreenPrivateKey(DevScreenPrivateKey key, ScreenPtr pScreen, DevPrivateType type, unsigned size); + +extern _X_EXPORT DevPrivateKey +_dixGetScreenPrivateKey(const DevScreenPrivateKey key, ScreenPtr pScreen); + +static inline void * +dixGetScreenPrivateAddr(PrivatePtr *privates, const DevScreenPrivateKey key, ScreenPtr pScreen) +{ + return dixGetPrivateAddr(privates, _dixGetScreenPrivateKey(key, pScreen)); +} + +static inline void * +dixGetScreenPrivate(PrivatePtr *privates, const DevScreenPrivateKey key, ScreenPtr pScreen) +{ + return dixGetPrivate(privates, _dixGetScreenPrivateKey(key, pScreen)); +} + +static inline void +dixSetScreenPrivate(PrivatePtr *privates, const DevScreenPrivateKey key, ScreenPtr pScreen, pointer val) +{ + return dixSetPrivate(privates, _dixGetScreenPrivateKey(key, pScreen), val); +} + +static inline pointer +dixLookupScreenPrivate(PrivatePtr *privates, const DevScreenPrivateKey key, ScreenPtr pScreen) +{ + return dixLookupPrivate(privates, _dixGetScreenPrivateKey(key, pScreen)); +} + +static inline pointer * +dixLookupScreenPrivateAddr(PrivatePtr *privates, const DevScreenPrivateKey key, ScreenPtr pScreen) +{ + return dixLookupPrivateAddr(privates, _dixGetScreenPrivateKey(key, pScreen)); +} + +/* + * Allocates private data separately from main object. + * + * For objects created during server initialization, this allows those + * privates to be re-allocated as new private keys are registered. + * + * This includes screens, the serverClient, default colormaps and + * extensions entries. + */ +extern _X_EXPORT Bool +dixAllocatePrivates(PrivatePtr *privates, DevPrivateType type); + +/* + * Frees separately allocated private data + */ +extern _X_EXPORT void +dixFreePrivates(PrivatePtr privates, DevPrivateType type); + +/* + * Initialize privates by zeroing them + */ +extern _X_EXPORT void +_dixInitPrivates(PrivatePtr *privates, void *addr, DevPrivateType type); + +#define dixInitPrivates(o, v, type) _dixInitPrivates(&(o)->devPrivates, (v), type); + +/* + * Clean up privates + */ +extern _X_EXPORT void +_dixFiniPrivates(PrivatePtr privates, DevPrivateType type); + +#define dixFiniPrivates(o,t) _dixFiniPrivates((o)->devPrivates,t) + +/* + * Allocates private data at object creation time. Required + * for almost all objects, except for the list described + * above for dixAllocatePrivates. + */ +extern _X_EXPORT void * +_dixAllocateObjectWithPrivates(unsigned size, unsigned clear, unsigned offset, DevPrivateType type); + +#define dixAllocateObjectWithPrivates(t, type) (t *) _dixAllocateObjectWithPrivates(sizeof(t), sizeof(t), offsetof(t, devPrivates), type) + +extern _X_EXPORT void +_dixFreeObjectWithPrivates(void *object, PrivatePtr privates, DevPrivateType type); + +#define dixFreeObjectWithPrivates(o,t) _dixFreeObjectWithPrivates(o, (o)->devPrivates, t) + +/* + * Return size of privates for the specified type + */ +extern _X_EXPORT int +dixPrivatesSize(DevPrivateType type); + +/* + * Dump out private stats to ErrorF + */ +extern void +dixPrivateUsage(void); + +/* + * Resets the privates subsystem. dixResetPrivates is called from the main loop + * before each server generation. This function must only be called by main(). + */ +extern _X_EXPORT void +dixResetPrivates(void); + +/* + * Looks up the offset where the devPrivates field is located. + * + * Returns -1 if the specified resource has no dev privates. + * The position of the devPrivates field varies by structure + * and calling code might only know the resource type, not the + * structure definition. + */ +extern _X_EXPORT int +dixLookupPrivateOffset(RESTYPE type); + +/* + * Convenience macro for adding an offset to an object pointer + * when making a call to one of the devPrivates functions + */ +#define DEVPRIV_AT(ptr, offset) ((PrivatePtr *)((char *)(ptr) + offset)) + +#endif /* PRIVATES_H */ diff --git a/include/property.h b/include/property.h new file mode 100644 index 0000000..075eb4a --- /dev/null +++ b/include/property.h @@ -0,0 +1,91 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef PROPERTY_H +#define PROPERTY_H + +#include "window.h" + +typedef struct _Property *PropertyPtr; + +extern _X_EXPORT int dixLookupProperty( + PropertyPtr * /*result*/, + WindowPtr /*pWin*/, + Atom /*proprty*/, + ClientPtr /*pClient*/, + Mask /*access_mode*/); + +extern _X_EXPORT int dixChangeWindowProperty( + ClientPtr /*pClient*/, + WindowPtr /*pWin*/, + Atom /*property*/, + Atom /*type*/, + int /*format*/, + int /*mode*/, + unsigned long /*len*/, + pointer /*value*/, + Bool /*sendevent*/); + +extern _X_EXPORT int ChangeWindowProperty( + WindowPtr /*pWin*/, + Atom /*property*/, + Atom /*type*/, + int /*format*/, + int /*mode*/, + unsigned long /*len*/, + pointer /*value*/, + Bool /*sendevent*/); + +extern _X_EXPORT int DeleteProperty( + ClientPtr /*client*/, + WindowPtr /*pWin*/, + Atom /*propName*/); + +extern _X_EXPORT void DeleteAllWindowProperties( + WindowPtr /*pWin*/); + +#endif /* PROPERTY_H */ diff --git a/include/propertyst.h b/include/propertyst.h new file mode 100644 index 0000000..fd1148e --- /dev/null +++ b/include/propertyst.h @@ -0,0 +1,68 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef PROPERTYSTRUCT_H +#define PROPERTYSTRUCT_H +#include "misc.h" +#include "property.h" +#include "privates.h" +/* + * PROPERTY -- property element + */ + +typedef struct _Property { + struct _Property *next; + ATOM propertyName; + ATOM type; /* ignored by server */ + short format; /* format of data for swapping - 8,16,32 */ + long size; /* size of data in (format/8) bytes */ + pointer data; /* private to client */ + PrivateRec *devPrivates; +} PropertyRec; + +#endif /* PROPERTYSTRUCT_H */ + diff --git a/include/protocol-versions.h b/include/protocol-versions.h new file mode 100644 index 0000000..1d33bdd --- /dev/null +++ b/include/protocol-versions.h @@ -0,0 +1,148 @@ +/* + * Copyright © 2009 Red Hat, Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + */ + +/** + * This file specifies the server-supported protocol versions. + */ +#ifndef _PROTOCOL_VERSIONS_ +#define _PROTOCOL_VERSIONS_ + +/* Apple DRI */ +#define SERVER_APPLEDRI_MAJOR_VERSION 1 +#define SERVER_APPLEDRI_MINOR_VERSION 0 +#define SERVER_APPLEDRI_PATCH_VERSION 0 + +/* AppleWM */ +#define SERVER_APPLEWM_MAJOR_VERSION 1 +#define SERVER_APPLEWM_MINOR_VERSION 3 +#define SERVER_APPLEWM_PATCH_VERSION 0 + +/* Composite */ +#define SERVER_COMPOSITE_MAJOR_VERSION 0 +#define SERVER_COMPOSITE_MINOR_VERSION 4 + +/* Damage */ +#define SERVER_DAMAGE_MAJOR_VERSION 1 +#define SERVER_DAMAGE_MINOR_VERSION 1 + +/* DMX */ +#define SERVER_DMX_MAJOR_VERSION 2 +#define SERVER_DMX_MINOR_VERSION 2 +#define SERVER_DMX_PATCH_VERSION 20040604 + +/* Generic event extension */ +#define SERVER_GE_MAJOR_VERSION 1 +#define SERVER_GE_MINOR_VERSION 0 + +/* GLX */ +#define SERVER_GLX_MAJOR_VERSION 1 +#define SERVER_GLX_MINOR_VERSION 4 + +/* Xinerama */ +#define SERVER_PANORAMIX_MAJOR_VERSION 1 +#define SERVER_PANORAMIX_MINOR_VERSION 1 + +/* RandR */ +#define SERVER_RANDR_MAJOR_VERSION 1 +#define SERVER_RANDR_MINOR_VERSION 3 + +/* Record */ +#define SERVER_RECORD_MAJOR_VERSION 1 +#define SERVER_RECORD_MINOR_VERSION 13 + +/* Render */ +#define SERVER_RENDER_MAJOR_VERSION 0 +#define SERVER_RENDER_MINOR_VERSION 11 + +/* RandR Xinerama */ +#define SERVER_RRXINERAMA_MAJOR_VERSION 1 +#define SERVER_RRXINERAMA_MINOR_VERSION 1 + +/* Screensaver */ +#define SERVER_SAVER_MAJOR_VERSION 1 +#define SERVER_SAVER_MINOR_VERSION 1 + +/* Security */ +#define SERVER_SECURITY_MAJOR_VERSION 1 +#define SERVER_SECURITY_MINOR_VERSION 0 + +/* Shape */ +#define SERVER_SHAPE_MAJOR_VERSION 1 +#define SERVER_SHAPE_MINOR_VERSION 1 + +/* SHM */ +#define SERVER_SHM_MAJOR_VERSION 1 +#define SERVER_SHM_MINOR_VERSION 1 + +/* Sync */ +#define SERVER_SYNC_MAJOR_VERSION 3 +#define SERVER_SYNC_MINOR_VERSION 1 + +/* Windows WM */ +#define SERVER_WINDOWSWM_MAJOR_VERSION 1 +#define SERVER_WINDOWSWM_MINOR_VERSION 0 +#define SERVER_WINDOWSWM_PATCH_VERSION 0 + +/* Xcalibrate */ +#define SERVER_XCALIBRATE_MAJOR_VERSION 0 +#define SERVER_XCALIBRATE_MINOR_VERSION 1 + +/* DGA */ +#define SERVER_XDGA_MAJOR_VERSION 2 +#define SERVER_XDGA_MINOR_VERSION 0 + +/* Big Font */ +#define SERVER_XF86BIGFONT_MAJOR_VERSION 1 +#define SERVER_XF86BIGFONT_MINOR_VERSION 1 + +/* DRI */ +#define SERVER_XF86DRI_MAJOR_VERSION 4 +#define SERVER_XF86DRI_MINOR_VERSION 1 +#define SERVER_XF86DRI_PATCH_VERSION 20040604 + +/* Vidmode */ +#define SERVER_XF86VIDMODE_MAJOR_VERSION 2 +#define SERVER_XF86VIDMODE_MINOR_VERSION 2 + +/* Fixes */ +#define SERVER_XFIXES_MAJOR_VERSION 4 +#define SERVER_XFIXES_MINOR_VERSION 0 + +/* X Input */ +#define SERVER_XI_MAJOR_VERSION 2 +#define SERVER_XI_MINOR_VERSION 0 + +/* XKB */ +#define SERVER_XKB_MAJOR_VERSION 1 +#define SERVER_XKB_MINOR_VERSION 0 + +/* Resource */ +#define SERVER_XRES_MAJOR_VERSION 1 +#define SERVER_XRES_MINOR_VERSION 0 + +/* XvMC */ +#define SERVER_XVMC_MAJOR_VERSION 1 +#define SERVER_XVMC_MINOR_VERSION 1 + +#endif diff --git a/include/ptrveloc.h b/include/ptrveloc.h new file mode 100644 index 0000000..6f999a8 --- /dev/null +++ b/include/ptrveloc.h @@ -0,0 +1,140 @@ +/* + * + * Copyright © 2006-2009 Simon Thum simon dot thum at gmx dot de + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + */ + +#ifndef POINTERVELOCITY_H +#define POINTERVELOCITY_H + +#include <input.h> /* DeviceIntPtr */ + +/* constants for acceleration profiles */ + +#define AccelProfileNone -1 +#define AccelProfileClassic 0 +#define AccelProfileDeviceSpecific 1 +#define AccelProfilePolynomial 2 +#define AccelProfileSmoothLinear 3 +#define AccelProfileSimple 4 +#define AccelProfilePower 5 +#define AccelProfileLinear 6 +#define AccelProfileSmoothLimited 7 +#define AccelProfileLAST AccelProfileSmoothLimited + +/* fwd */ +struct _DeviceVelocityRec; + +/** + * profile + * returns actual acceleration depending on velocity, acceleration control,... + */ +typedef float (*PointerAccelerationProfileFunc) + (DeviceIntPtr dev, struct _DeviceVelocityRec* vel, + float velocity, float threshold, float accelCoeff); + +/** + * a motion history, with just enough information to + * calc mean velocity and decide which motion was along + * a more or less straight line + */ +typedef struct _MotionTracker { + int dx, dy; /* accumulated delta for each axis */ + int time; /* time of creation */ + int dir; /* initial direction bitfield */ +} MotionTracker, *MotionTrackerPtr; + +/* number of properties for predictable acceleration */ +#define NPROPS_PREDICTABLE_ACCEL 4 + +/** + * Contains all data needed to implement mouse ballistics + */ +typedef struct _DeviceVelocityRec { + MotionTrackerPtr tracker; + int num_tracker; + int cur_tracker; /* current index */ + float velocity; /* velocity as guessed by algorithm */ + float last_velocity; /* previous velocity estimate */ + int last_dx; /* last time-difference */ + int last_dy ; /* phase of last/current estimate */ + float corr_mul; /* config: multiply this into velocity */ + float const_acceleration; /* config: (recipr.) const deceleration */ + float min_acceleration; /* config: minimum acceleration */ + short reset_time; /* config: reset non-visible state after # ms */ + short use_softening; /* config: use softening of mouse values */ + float max_rel_diff; /* config: max. relative difference */ + float max_diff; /* config: max. difference */ + int initial_range; /* config: max. offset used as initial velocity */ + Bool average_accel; /* config: average acceleration over velocity */ + PointerAccelerationProfileFunc Profile; + PointerAccelerationProfileFunc deviceSpecificProfile; + void* profile_private;/* extended data, see SetAccelerationProfile() */ + struct { /* to be able to query this information */ + int profile_number; + } statistics; + long prop_handlers[NPROPS_PREDICTABLE_ACCEL]; +} DeviceVelocityRec, *DeviceVelocityPtr; + +extern _X_EXPORT void +InitVelocityData(DeviceVelocityPtr vel); + +extern _X_EXPORT void +InitTrackers(DeviceVelocityPtr vel, int ntracker); + +extern _X_EXPORT short +ProcessVelocityData2D(DeviceVelocityPtr vel, int dx, int dy, int time); + +extern _X_EXPORT float +BasicComputeAcceleration(DeviceIntPtr dev, DeviceVelocityPtr vel, + float velocity, float threshold, float acc); + +extern _X_EXPORT void +FreeVelocityData(DeviceVelocityPtr vel); + +extern _X_INTERNAL BOOL +InitializePredictableAccelerationProperties(DeviceIntPtr dev); + +extern _X_INTERNAL BOOL +DeletePredictableAccelerationProperties(DeviceIntPtr dev); + +extern _X_EXPORT int +SetAccelerationProfile(DeviceVelocityPtr vel, int profile_num); + +extern _X_EXPORT DeviceVelocityPtr +GetDevicePredictableAccelData(DeviceIntPtr dev); + +extern _X_EXPORT void +SetDeviceSpecificAccelerationProfile(DeviceVelocityPtr vel, + PointerAccelerationProfileFunc profile); + +extern _X_INTERNAL void +AccelerationDefaultCleanup(DeviceIntPtr dev); + +extern _X_INTERNAL void +acceleratePointerPredictable(DeviceIntPtr dev, int first_valuator, + int num_valuators, int *valuators, int evtime); + +extern _X_INTERNAL void +acceleratePointerLightweight(DeviceIntPtr dev, int first_valuator, + int num_valuators, int *valuators, int ignored); + +#endif /* POINTERVELOCITY_H */ diff --git a/include/region.h b/include/region.h new file mode 100644 index 0000000..e9d7e77 --- /dev/null +++ b/include/region.h @@ -0,0 +1,53 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef REGION_H +#define REGION_H + +#include "regionstr.h" + +#endif /* REGION_H */ diff --git a/include/regionstr.h b/include/regionstr.h new file mode 100644 index 0000000..627941b --- /dev/null +++ b/include/regionstr.h @@ -0,0 +1,370 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef REGIONSTRUCT_H +#define REGIONSTRUCT_H + +typedef struct pixman_region16 RegionRec, *RegionPtr; + +#include "miscstruct.h" + +/* Return values from RectIn() */ + +#define rgnOUT 0 +#define rgnIN 1 +#define rgnPART 2 + +#define NullRegion ((RegionPtr)0) + +/* + * clip region + */ + +typedef struct pixman_region16_data RegDataRec, *RegDataPtr; + +extern _X_EXPORT BoxRec RegionEmptyBox; +extern _X_EXPORT RegDataRec RegionEmptyData; +extern _X_EXPORT RegDataRec RegionBrokenData; +static inline Bool RegionNil(RegionPtr reg) { + return ((reg)->data && !(reg)->data->numRects); +} + +/* not a region */ + +static inline Bool RegionNar(RegionPtr reg) { + return ((reg)->data == &RegionBrokenData); +} + +static inline int RegionNumRects(RegionPtr reg) { + return ((reg)->data ? (reg)->data->numRects : 1); +} + +static inline int RegionSize(RegionPtr reg) { + return ((reg)->data ? (reg)->data->size : 0); +} + +static inline BoxPtr RegionRects(RegionPtr reg) { + return ((reg)->data ? (BoxPtr)((reg)->data + 1) : &(reg)->extents); +} + +static inline BoxPtr RegionBoxptr(RegionPtr reg) { + return ((BoxPtr)((reg)->data + 1)); +} + +static inline BoxPtr RegionBox(RegionPtr reg, int i) { + return (&RegionBoxptr(reg)[i]); +} + +static inline BoxPtr RegionTop(RegionPtr reg) { + return RegionBox(reg, (reg)->data->numRects); +} + +static inline BoxPtr RegionEnd(RegionPtr reg) { + return RegionBox(reg, (reg)->data->numRects - 1); +} + +static inline size_t RegionSizeof(int n) { + return (sizeof(RegDataRec) + ((n) * sizeof(BoxRec))); +} + +static inline void RegionInit(RegionPtr _pReg, BoxPtr _rect, int _size) +{ + if ((_rect) != NULL) + { + (_pReg)->extents = *(_rect); + (_pReg)->data = (RegDataPtr)NULL; + } + else + { + (_pReg)->extents = RegionEmptyBox; + if (((_size) > 1) && ((_pReg)->data = + (RegDataPtr)malloc(RegionSizeof(_size)))) + { + (_pReg)->data->size = (_size); + (_pReg)->data->numRects = 0; + } + else + (_pReg)->data = &RegionEmptyData; + } +} + +static inline void RegionUninit(RegionPtr _pReg) +{ + if ((_pReg)->data && (_pReg)->data->size) { + free((_pReg)->data); + (_pReg)->data = NULL; + } +} + +static inline void RegionReset(RegionPtr _pReg, BoxPtr _pBox) +{ + (_pReg)->extents = *(_pBox); + RegionUninit(_pReg); + (_pReg)->data = (RegDataPtr)NULL; +} + +static inline Bool RegionNotEmpty(RegionPtr _pReg) { + return !RegionNil(_pReg); +} + +static inline Bool RegionBroken(RegionPtr _pReg) { + return RegionNar(_pReg); +} + +static inline void RegionEmpty(RegionPtr _pReg) +{ + RegionUninit(_pReg); + (_pReg)->extents.x2 = (_pReg)->extents.x1; + (_pReg)->extents.y2 = (_pReg)->extents.y1; + (_pReg)->data = &RegionEmptyData; +} + +static inline BoxPtr RegionExtents(RegionPtr _pReg) +{ + return (&(_pReg)->extents); +} + +static inline void RegionNull(RegionPtr _pReg) +{ + (_pReg)->extents = RegionEmptyBox; + (_pReg)->data = &RegionEmptyData; +} + +extern _X_EXPORT void InitRegions(void); + +extern _X_EXPORT RegionPtr RegionCreate( + BoxPtr /*rect*/, + int /*size*/); + +extern _X_EXPORT void RegionDestroy( + RegionPtr /*pReg*/); + +static inline Bool +RegionCopy(RegionPtr dst, RegionPtr src) +{ + return pixman_region_copy (dst, src); +} + +static inline Bool +RegionIntersect( + RegionPtr newReg, /* destination Region */ + RegionPtr reg1, + RegionPtr reg2 /* source regions */ + ) +{ + return pixman_region_intersect (newReg, reg1, reg2); +} + +static inline Bool +RegionUnion( + RegionPtr newReg, /* destination Region */ + RegionPtr reg1, + RegionPtr reg2 /* source regions */ + ) +{ + return pixman_region_union (newReg, reg1, reg2); +} + +extern _X_EXPORT Bool RegionAppend( + RegionPtr /*dstrgn*/, + RegionPtr /*rgn*/); + +extern _X_EXPORT Bool RegionValidate( + RegionPtr /*badreg*/, + Bool * /*pOverlap*/); + +extern _X_EXPORT RegionPtr RegionFromRects( + int /*nrects*/, + xRectanglePtr /*prect*/, + int /*ctype*/); + +/*- + *----------------------------------------------------------------------- + * Subtract -- + * Subtract regS from regM and leave the result in regD. + * S stands for subtrahend, M for minuend and D for difference. + * + * Results: + * TRUE if successful. + * + * Side Effects: + * regD is overwritten. + * + *----------------------------------------------------------------------- + */ +static inline Bool +RegionSubtract(RegionPtr regD, RegionPtr regM, RegionPtr regS) +{ + return pixman_region_subtract (regD, regM, regS); +} + +/*- + *----------------------------------------------------------------------- + * Inverse -- + * Take a region and a box and return a region that is everything + * in the box but not in the region. The careful reader will note + * that this is the same as subtracting the region from the box... + * + * Results: + * TRUE. + * + * Side Effects: + * newReg is overwritten. + * + *----------------------------------------------------------------------- + */ + +static inline Bool +RegionInverse( + RegionPtr newReg, /* Destination region */ + RegionPtr reg1, /* Region to invert */ + BoxPtr invRect /* Bounding box for inversion */ + ) +{ + return pixman_region_inverse (newReg, reg1, invRect); +} + +static inline int +RegionContainsRect(RegionPtr region, BoxPtr prect) +{ + return pixman_region_contains_rectangle (region, prect); +} + +/* TranslateRegion(pReg, x, y) + translates in place +*/ + +static inline void +RegionTranslate(RegionPtr pReg, int x, int y) +{ + pixman_region_translate (pReg, x, y); +} + +extern _X_EXPORT Bool RegionBreak( + RegionPtr /*pReg*/); + +static inline Bool +RegionContainsPoint( + RegionPtr pReg, + int x, + int y, + BoxPtr box /* "return" value */ + ) +{ + return pixman_region_contains_point (pReg, x, y, box); +} + +static inline Bool +RegionEqual(RegionPtr reg1, RegionPtr reg2) +{ + return pixman_region_equal (reg1, reg2); +} + +extern _X_EXPORT Bool RegionRectAlloc( + RegionPtr /*pRgn*/, + int /*n*/ +); + +#ifdef DEBUG +extern _X_EXPORT Bool RegionIsValid( + RegionPtr /*prgn*/ +); +#endif + +extern _X_EXPORT void RegionPrint( + RegionPtr /*pReg*/); + +extern _X_EXPORT int RegionClipSpans( + RegionPtr /*prgnDst*/, + DDXPointPtr /*ppt*/, + int * /*pwidth*/, + int /*nspans*/, + DDXPointPtr /*pptNew*/, + int * /*pwidthNew*/, + int /*fSorted*/ +); + +#define INCLUDE_LEGACY_REGION_DEFINES +#ifdef INCLUDE_LEGACY_REGION_DEFINES + +#define REGION_NIL RegionNil +#define REGION_NAR RegionNar +#define REGION_NUM_RECTS RegionNumRects +#define REGION_SIZE RegionSize +#define REGION_RECTS RegionRects +#define REGION_BOXPTR RegionBoxptr +#define REGION_BOX RegionBox +#define REGION_TOP RegionTop +#define REGION_END RegionEnd +#define REGION_SZOF RegionSizeof +#define BITMAP_TO_REGION BitmapToRegion +#define REGION_CREATE(pScreen, r, s) RegionCreate(r,s) +#define REGION_COPY(pScreen, d, r) RegionCopy(d, r) +#define REGION_DESTROY(pScreen, r) RegionDestroy(r) +#define REGION_INTERSECT(pScreen, res, r1, r2) RegionIntersect(res, r1, r2) +#define REGION_UNION(pScreen, res, r1, r2) RegionUnion(res, r1, r2) +#define REGION_SUBTRACT(pScreen, res, r1, r2) RegionSubtract(res, r1, r2) +#define REGION_INVERSE(pScreen, n, r, b) RegionInverse(n, r, b) +#define REGION_TRANSLATE(pScreen, r, x, y) RegionTranslate(r, x, y) +#define RECT_IN_REGION(pScreen, r, b) RegionContainsRect(r, b) +#define POINT_IN_REGION(pScreen, r, x, y, b) RegionContainsPoint(r, x, y, b) +#define REGION_EQUAL(pScreen, r1, r2) RegionEqual(r1, r2) +#define REGION_APPEND(pScreen, d, r) RegionAppend(d, r) +#define REGION_VALIDATE(pScreen, r, o) RegionValidate(r, o) +#define RECTS_TO_REGION(pScreen, n, r, c) RegionFromRects(n, r, c) +#define REGION_BREAK(pScreen, r) RegionBreak(r) +#define REGION_INIT(pScreen, r, b, s) RegionInit(r, b, s) +#define REGION_UNINIT(pScreen, r) RegionUninit(r) +#define REGION_RESET(pScreen, r, b) RegionReset(r, b) +#define REGION_NOTEMPTY(pScreen, r) RegionNotEmpty(r) +#define REGION_BROKEN(pScreen, r) RegionBroken(r) +#define REGION_EMPTY(pScreen, r) RegionEmpty(r) +#define REGION_EXTENTS(pScreen, r) RegionExtents(r) +#define REGION_NULL(pScreen, r) RegionNull(r) + +#endif /* INCLUDE_LEGACY_REGION_DEFINES */ +#endif /* REGIONSTRUCT_H */ diff --git a/include/registry.h b/include/registry.h new file mode 100644 index 0000000..325f765 --- /dev/null +++ b/include/registry.h @@ -0,0 +1,64 @@ +/*********************************************************** + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHOR BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +******************************************************************/ + +#ifndef DIX_REGISTRY_H +#define DIX_REGISTRY_H + +/* + * Result returned from any unsuccessful lookup + */ +#define XREGISTRY_UNKNOWN "<unknown>" + +#ifdef XREGISTRY + +#include "resource.h" +#include "extnsionst.h" + +/* Internal string registry - for auditing, debugging, security, etc. */ + +/* + * Registration functions. The name string is not copied, so it must + * not be a stack variable. + */ +extern _X_EXPORT void RegisterResourceName(RESTYPE type, char *name); +extern _X_EXPORT void RegisterExtensionNames(ExtensionEntry *ext); + +/* + * Lookup functions. The returned string must not be modified or freed. + */ +extern _X_EXPORT const char *LookupMajorName(int major); +extern _X_EXPORT const char *LookupRequestName(int major, int minor); +extern _X_EXPORT const char *LookupEventName(int event); +extern _X_EXPORT const char *LookupErrorName(int error); +extern _X_EXPORT const char *LookupResourceName(RESTYPE rtype); + +/* + * Setup and teardown + */ +extern _X_EXPORT void dixResetRegistry(void); + +#else /* XREGISTRY */ + +/* Define calls away when the registry is not being built. */ + +#define RegisterResourceName(a, b) { ; } +#define RegisterExtensionNames(a) { ; } + +#define LookupMajorName(a) XREGISTRY_UNKNOWN +#define LookupRequestName(a, b) XREGISTRY_UNKNOWN +#define LookupEventName(a) XREGISTRY_UNKNOWN +#define LookupErrorName(a) XREGISTRY_UNKNOWN +#define LookupResourceName(a) XREGISTRY_UNKNOWN + +#define dixResetRegistry() { ; } + +#endif /* XREGISTRY */ +#endif /* DIX_REGISTRY_H */ diff --git a/include/resource.h b/include/resource.h new file mode 100644 index 0000000..080061f --- /dev/null +++ b/include/resource.h @@ -0,0 +1,284 @@ +/*********************************************************** + +Copyright 1987, 1989, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987, 1989 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef RESOURCE_H +#define RESOURCE_H 1 +#include "misc.h" +#include "dixaccess.h" + +/***************************************************************** + * STUFF FOR RESOURCES + *****************************************************************/ + +/* classes for Resource routines */ + +typedef unsigned long RESTYPE; + +#define RC_VANILLA ((RESTYPE)0) +#define RC_CACHED ((RESTYPE)1<<31) +#define RC_DRAWABLE ((RESTYPE)1<<30) +/* Use class RC_NEVERRETAIN for resources that should not be retained + * regardless of the close down mode when the client dies. (A client's + * event selections on objects that it doesn't own are good candidates.) + * Extensions can use this too! + */ +#define RC_NEVERRETAIN ((RESTYPE)1<<29) +#define RC_LASTPREDEF RC_NEVERRETAIN +#define RC_ANY (~(RESTYPE)0) + +/* types for Resource routines */ + +#define RT_WINDOW ((RESTYPE)1|RC_DRAWABLE) +#define RT_PIXMAP ((RESTYPE)2|RC_DRAWABLE) +#define RT_GC ((RESTYPE)3) +#undef RT_FONT +#undef RT_CURSOR +#define RT_FONT ((RESTYPE)4) +#define RT_CURSOR ((RESTYPE)5) +#define RT_COLORMAP ((RESTYPE)6) +#define RT_CMAPENTRY ((RESTYPE)7) +#define RT_OTHERCLIENT ((RESTYPE)8|RC_NEVERRETAIN) +#define RT_PASSIVEGRAB ((RESTYPE)9|RC_NEVERRETAIN) +#define RT_LASTPREDEF ((RESTYPE)9) +#define RT_NONE ((RESTYPE)0) + +/* bits and fields within a resource id */ +#define RESOURCE_AND_CLIENT_COUNT 29 /* 29 bits for XIDs */ +#if MAXCLIENTS == 64 +#define RESOURCE_CLIENT_BITS 6 +#endif +#if MAXCLIENTS == 128 +#define RESOURCE_CLIENT_BITS 7 +#endif +#if MAXCLIENTS == 256 +#define RESOURCE_CLIENT_BITS 8 +#endif +#if MAXCLIENTS == 512 +#define RESOURCE_CLIENT_BITS 9 +#endif +/* client field offset */ +#define CLIENTOFFSET (RESOURCE_AND_CLIENT_COUNT - RESOURCE_CLIENT_BITS) +/* resource field */ +#define RESOURCE_ID_MASK ((1 << CLIENTOFFSET) - 1) +/* client field */ +#define RESOURCE_CLIENT_MASK (((1 << RESOURCE_CLIENT_BITS) - 1) << CLIENTOFFSET) +/* extract the client mask from an XID */ +#define CLIENT_BITS(id) ((id) & RESOURCE_CLIENT_MASK) +/* extract the client id from an XID */ +#define CLIENT_ID(id) ((int)(CLIENT_BITS(id) >> CLIENTOFFSET)) +#define SERVER_BIT (Mask)0x40000000 /* use illegal bit */ + +#ifdef INVALID +#undef INVALID /* needed on HP/UX */ +#endif + +/* Invalid resource id */ +#define INVALID (0) + +#define BAD_RESOURCE 0xe0000000 + +#define rClient(obj) (clients[CLIENT_ID((obj)->resource)]) + +/* Resource state callback */ +extern _X_EXPORT CallbackListPtr ResourceStateCallback; + +typedef enum {ResourceStateAdding, + ResourceStateFreeing} ResourceState; + +typedef struct { + ResourceState state; + XID id; + RESTYPE type; + pointer value; +} ResourceStateInfoRec; + +typedef int (*DeleteType)( + pointer /*value*/, + XID /*id*/); + +typedef void (*FindResType)( + pointer /*value*/, + XID /*id*/, + pointer /*cdata*/); + +typedef void (*FindAllRes)( + pointer /*value*/, + XID /*id*/, + RESTYPE /*type*/, + pointer /*cdata*/); + +typedef Bool (*FindComplexResType)( + pointer /*value*/, + XID /*id*/, + pointer /*cdata*/); + +extern _X_EXPORT RESTYPE CreateNewResourceType( + DeleteType /*deleteFunc*/, char * /*name*/); + +extern _X_EXPORT void SetResourceTypeErrorValue( + RESTYPE /*type*/, int /*errorValue*/); + +extern _X_EXPORT RESTYPE CreateNewResourceClass(void); + +extern _X_EXPORT Bool InitClientResources( + ClientPtr /*client*/); + +extern _X_EXPORT XID FakeClientID( + int /*client*/); + +/* Quartz support on Mac OS X uses the CarbonCore + framework whose AddResource function conflicts here. */ +#ifdef __APPLE__ +#define AddResource Darwin_X_AddResource +#endif +extern _X_EXPORT Bool AddResource( + XID /*id*/, + RESTYPE /*type*/, + pointer /*value*/); + +extern _X_EXPORT void FreeResource( + XID /*id*/, + RESTYPE /*skipDeleteFuncType*/); + +extern _X_EXPORT void FreeResourceByType( + XID /*id*/, + RESTYPE /*type*/, + Bool /*skipFree*/); + +extern _X_EXPORT Bool ChangeResourceValue( + XID /*id*/, + RESTYPE /*rtype*/, + pointer /*value*/); + +extern _X_EXPORT void FindClientResourcesByType( + ClientPtr /*client*/, + RESTYPE /*type*/, + FindResType /*func*/, + pointer /*cdata*/); + +extern _X_EXPORT void FindAllClientResources( + ClientPtr /*client*/, + FindAllRes /*func*/, + pointer /*cdata*/); + +extern _X_EXPORT void FreeClientNeverRetainResources( + ClientPtr /*client*/); + +extern _X_EXPORT void FreeClientResources( + ClientPtr /*client*/); + +extern _X_EXPORT void FreeAllResources(void); + +extern _X_EXPORT Bool LegalNewID( + XID /*id*/, + ClientPtr /*client*/); + +extern _X_EXPORT pointer LookupClientResourceComplex( + ClientPtr client, + RESTYPE type, + FindComplexResType func, + pointer cdata); + +extern _X_EXPORT int dixLookupResourceByType( + pointer *result, + XID id, + RESTYPE rtype, + ClientPtr client, + Mask access_mode); + +extern _X_EXPORT int dixLookupResourceByClass( + pointer *result, + XID id, + RESTYPE rclass, + ClientPtr client, + Mask access_mode); + +extern _X_EXPORT void GetXIDRange( + int /*client*/, + Bool /*server*/, + XID * /*minp*/, + XID * /*maxp*/); + +extern _X_EXPORT unsigned int GetXIDList( + ClientPtr /*client*/, + unsigned int /*count*/, + XID * /*pids*/); + +extern _X_EXPORT RESTYPE lastResourceType; +extern _X_EXPORT RESTYPE TypeMask; + +/* + * These are deprecated compatibility functions and will be removed soon! + * Please use the noted replacements instead. + */ + +/* replaced by dixLookupResourceByType */ +extern _X_EXPORT pointer SecurityLookupIDByType( + ClientPtr client, + XID id, + RESTYPE rtype, + Mask access_mode) _X_DEPRECATED; + +/* replaced by dixLookupResourceByClass */ +extern _X_EXPORT pointer SecurityLookupIDByClass( + ClientPtr client, + XID id, + RESTYPE classes, + Mask access_mode) _X_DEPRECATED; + +/* replaced by dixLookupResourceByType */ +extern _X_EXPORT pointer LookupIDByType( + XID id, + RESTYPE rtype) _X_DEPRECATED; + +/* replaced by dixLookupResourceByClass */ +extern _X_EXPORT pointer LookupIDByClass( + XID id, + RESTYPE classes) _X_DEPRECATED; + +#endif /* RESOURCE_H */ + diff --git a/include/rgb.h b/include/rgb.h new file mode 100644 index 0000000..3e768b6 --- /dev/null +++ b/include/rgb.h @@ -0,0 +1,53 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef RGB_H +#define RGB_H +typedef struct _RGB { + unsigned short red, green, blue; + } RGB; +#endif /* RGB_H */ diff --git a/include/screenint.h b/include/screenint.h new file mode 100644 index 0000000..4e6c574 --- /dev/null +++ b/include/screenint.h @@ -0,0 +1,69 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef SCREENINT_H +#define SCREENINT_H + +#include "misc.h" + +typedef struct _PixmapFormat *PixmapFormatPtr; +typedef struct _Visual *VisualPtr; +typedef struct _Depth *DepthPtr; +typedef struct _Screen *ScreenPtr; + +extern _X_EXPORT int AddScreen( + Bool (* /*pfnInit*/)( + int /*index*/, + ScreenPtr /*pScreen*/, + int /*argc*/, + char ** /*argv*/), + int /*argc*/, + char** /*argv*/); + +typedef struct _ColormapRec *ColormapPtr; + +#endif /* SCREENINT_H */ diff --git a/include/scrnintstr.h b/include/scrnintstr.h new file mode 100644 index 0000000..a9357e8 --- /dev/null +++ b/include/scrnintstr.h @@ -0,0 +1,573 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef SCREENINTSTRUCT_H +#define SCREENINTSTRUCT_H + +#include "screenint.h" +#include "regionstr.h" +#include "colormap.h" +#include "cursor.h" +#include "validate.h" +#include <X11/Xproto.h> +#include "dix.h" +#include "privates.h" + +typedef struct _PixmapFormat { + unsigned char depth; + unsigned char bitsPerPixel; + unsigned char scanlinePad; + } PixmapFormatRec; + +typedef struct _Visual { + VisualID vid; + short class; + short bitsPerRGBValue; + short ColormapEntries; + short nplanes;/* = log2 (ColormapEntries). This does not + * imply that the screen has this many planes. + * it may have more or fewer */ + unsigned long redMask, greenMask, blueMask; + int offsetRed, offsetGreen, offsetBlue; + } VisualRec; + +typedef struct _Depth { + unsigned char depth; + short numVids; + VisualID *vids; /* block of visual ids for this depth */ + } DepthRec; + +typedef struct _ScreenSaverStuff { + WindowPtr pWindow; + XID wid; + char blanked; + Bool (*ExternalScreenSaver)( + ScreenPtr /*pScreen*/, + int /*xstate*/, + Bool /*force*/); +} ScreenSaverStuffRec; + + +/* + * There is a typedef for each screen function pointer so that code that + * needs to declare a screen function pointer (e.g. in a screen private + * or as a local variable) can easily do so and retain full type checking. + */ + +typedef Bool (* CloseScreenProcPtr)( + int /*index*/, + ScreenPtr /*pScreen*/); + +typedef void (* QueryBestSizeProcPtr)( + int /*class*/, + unsigned short * /*pwidth*/, + unsigned short * /*pheight*/, + ScreenPtr /*pScreen*/); + +typedef Bool (* SaveScreenProcPtr)( + ScreenPtr /*pScreen*/, + int /*on*/); + +typedef void (* GetImageProcPtr)( + DrawablePtr /*pDrawable*/, + int /*sx*/, + int /*sy*/, + int /*w*/, + int /*h*/, + unsigned int /*format*/, + unsigned long /*planeMask*/, + char * /*pdstLine*/); + +typedef void (* GetSpansProcPtr)( + DrawablePtr /*pDrawable*/, + int /*wMax*/, + DDXPointPtr /*ppt*/, + int* /*pwidth*/, + int /*nspans*/, + char * /*pdstStart*/); + +typedef void (* SourceValidateProcPtr)( + DrawablePtr /*pDrawable*/, + int /*x*/, + int /*y*/, + int /*width*/, + int /*height*/, + unsigned int /*subWindowMode*/); + +typedef Bool (* CreateWindowProcPtr)( + WindowPtr /*pWindow*/); + +typedef Bool (* DestroyWindowProcPtr)( + WindowPtr /*pWindow*/); + +typedef Bool (* PositionWindowProcPtr)( + WindowPtr /*pWindow*/, + int /*x*/, + int /*y*/); + +typedef Bool (* ChangeWindowAttributesProcPtr)( + WindowPtr /*pWindow*/, + unsigned long /*mask*/); + +typedef Bool (* RealizeWindowProcPtr)( + WindowPtr /*pWindow*/); + +typedef Bool (* UnrealizeWindowProcPtr)( + WindowPtr /*pWindow*/); + +typedef void (* RestackWindowProcPtr)( + WindowPtr /*pWindow*/, + WindowPtr /*pOldNextSib*/); + +typedef int (* ValidateTreeProcPtr)( + WindowPtr /*pParent*/, + WindowPtr /*pChild*/, + VTKind /*kind*/); + +typedef void (* PostValidateTreeProcPtr)( + WindowPtr /*pParent*/, + WindowPtr /*pChild*/, + VTKind /*kind*/); + +typedef void (* WindowExposuresProcPtr)( + WindowPtr /*pWindow*/, + RegionPtr /*prgn*/, + RegionPtr /*other_exposed*/); + +typedef void (* CopyWindowProcPtr)( + WindowPtr /*pWindow*/, + DDXPointRec /*ptOldOrg*/, + RegionPtr /*prgnSrc*/); + +typedef void (* ClearToBackgroundProcPtr)( + WindowPtr /*pWindow*/, + int /*x*/, + int /*y*/, + int /*w*/, + int /*h*/, + Bool /*generateExposures*/); + +typedef void (* ClipNotifyProcPtr)( + WindowPtr /*pWindow*/, + int /*dx*/, + int /*dy*/); + +/* pixmap will exist only for the duration of the current rendering operation */ +#define CREATE_PIXMAP_USAGE_SCRATCH 1 +/* pixmap will be the backing pixmap for a redirected window */ +#define CREATE_PIXMAP_USAGE_BACKING_PIXMAP 2 +/* pixmap will contain a glyph */ +#define CREATE_PIXMAP_USAGE_GLYPH_PICTURE 3 + +typedef PixmapPtr (* CreatePixmapProcPtr)( + ScreenPtr /*pScreen*/, + int /*width*/, + int /*height*/, + int /*depth*/, + unsigned /*usage_hint*/); + +typedef Bool (* DestroyPixmapProcPtr)( + PixmapPtr /*pPixmap*/); + +typedef Bool (* RealizeFontProcPtr)( + ScreenPtr /*pScreen*/, + FontPtr /*pFont*/); + +typedef Bool (* UnrealizeFontProcPtr)( + ScreenPtr /*pScreen*/, + FontPtr /*pFont*/); + +typedef void (* ConstrainCursorProcPtr)( + DeviceIntPtr /*pDev*/, + ScreenPtr /*pScreen*/, + BoxPtr /*pBox*/); + +typedef void (* CursorLimitsProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /*pScreen*/, + CursorPtr /*pCursor*/, + BoxPtr /*pHotBox*/, + BoxPtr /*pTopLeftBox*/); + +typedef Bool (* DisplayCursorProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /*pScreen*/, + CursorPtr /*pCursor*/); + +typedef Bool (* RealizeCursorProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /*pScreen*/, + CursorPtr /*pCursor*/); + +typedef Bool (* UnrealizeCursorProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /*pScreen*/, + CursorPtr /*pCursor*/); + +typedef void (* RecolorCursorProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /*pScreen*/, + CursorPtr /*pCursor*/, + Bool /*displayed*/); + +typedef Bool (* SetCursorPositionProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /*pScreen*/, + int /*x*/, + int /*y*/, + Bool /*generateEvent*/); + +typedef Bool (* CreateGCProcPtr)( + GCPtr /*pGC*/); + +typedef Bool (* CreateColormapProcPtr)( + ColormapPtr /*pColormap*/); + +typedef void (* DestroyColormapProcPtr)( + ColormapPtr /*pColormap*/); + +typedef void (* InstallColormapProcPtr)( + ColormapPtr /*pColormap*/); + +typedef void (* UninstallColormapProcPtr)( + ColormapPtr /*pColormap*/); + +typedef int (* ListInstalledColormapsProcPtr) ( + ScreenPtr /*pScreen*/, + XID* /*pmaps */); + +typedef void (* StoreColorsProcPtr)( + ColormapPtr /*pColormap*/, + int /*ndef*/, + xColorItem * /*pdef*/); + +typedef void (* ResolveColorProcPtr)( + unsigned short* /*pred*/, + unsigned short* /*pgreen*/, + unsigned short* /*pblue*/, + VisualPtr /*pVisual*/); + +typedef RegionPtr (* BitmapToRegionProcPtr)( + PixmapPtr /*pPix*/); + +typedef void (* SendGraphicsExposeProcPtr)( + ClientPtr /*client*/, + RegionPtr /*pRgn*/, + XID /*drawable*/, + int /*major*/, + int /*minor*/); + +typedef void (* ScreenBlockHandlerProcPtr)( + int /*screenNum*/, + pointer /*blockData*/, + pointer /*pTimeout*/, + pointer /*pReadmask*/); + +typedef void (* ScreenWakeupHandlerProcPtr)( + int /*screenNum*/, + pointer /*wakeupData*/, + unsigned long /*result*/, + pointer /*pReadMask*/); + +typedef Bool (* CreateScreenResourcesProcPtr)( + ScreenPtr /*pScreen*/); + +typedef Bool (* ModifyPixmapHeaderProcPtr)( + PixmapPtr /*pPixmap*/, + int /*width*/, + int /*height*/, + int /*depth*/, + int /*bitsPerPixel*/, + int /*devKind*/, + pointer /*pPixData*/); + +typedef PixmapPtr (* GetWindowPixmapProcPtr)( + WindowPtr /*pWin*/); + +typedef void (* SetWindowPixmapProcPtr)( + WindowPtr /*pWin*/, + PixmapPtr /*pPix*/); + +typedef PixmapPtr (* GetScreenPixmapProcPtr)( + ScreenPtr /*pScreen*/); + +typedef void (* SetScreenPixmapProcPtr)( + PixmapPtr /*pPix*/); + +typedef void (* MarkWindowProcPtr)( + WindowPtr /*pWin*/); + +typedef Bool (* MarkOverlappedWindowsProcPtr)( + WindowPtr /*parent*/, + WindowPtr /*firstChild*/, + WindowPtr * /*pLayerWin*/); + +typedef int (* ConfigNotifyProcPtr)( + WindowPtr /*pWin*/, + int /*x*/, + int /*y*/, + int /*w*/, + int /*h*/, + int /*bw*/, + WindowPtr /*pSib*/); + +typedef void (* MoveWindowProcPtr)( + WindowPtr /*pWin*/, + int /*x*/, + int /*y*/, + WindowPtr /*pSib*/, + VTKind /*kind*/); + +typedef void (* ResizeWindowProcPtr)( + WindowPtr /*pWin*/, + int /*x*/, + int /*y*/, + unsigned int /*w*/, + unsigned int /*h*/, + WindowPtr /*pSib*/ +); + +typedef WindowPtr (* GetLayerWindowProcPtr)( + WindowPtr /*pWin*/ +); + +typedef void (* HandleExposuresProcPtr)( + WindowPtr /*pWin*/); + +typedef void (* ReparentWindowProcPtr)( + WindowPtr /*pWin*/, + WindowPtr /*pPriorParent*/); + +typedef void (* SetShapeProcPtr)( + WindowPtr /*pWin*/, + int /* kind */); + +typedef void (* ChangeBorderWidthProcPtr)( + WindowPtr /*pWin*/, + unsigned int /*width*/); + +typedef void (* MarkUnrealizedWindowProcPtr)( + WindowPtr /*pChild*/, + WindowPtr /*pWin*/, + Bool /*fromConfigure*/); + +typedef Bool (* DeviceCursorInitializeProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /* pScreen */); + +typedef void (* DeviceCursorCleanupProcPtr)( + DeviceIntPtr /* pDev */, + ScreenPtr /* pScreen */); + +typedef void (*ConstrainCursorHarderProcPtr)( + DeviceIntPtr, ScreenPtr, int, int *, int *); + +typedef struct _Screen { + int myNum; /* index of this instance in Screens[] */ + ATOM id; + short x, y, width, height; + short mmWidth, mmHeight; + short numDepths; + unsigned char rootDepth; + DepthPtr allowedDepths; + unsigned long rootVisual; + unsigned long defColormap; + short minInstalledCmaps, maxInstalledCmaps; + char backingStoreSupport, saveUnderSupport; + unsigned long whitePixel, blackPixel; + GCPtr GCperDepth[MAXFORMATS+1]; + /* next field is a stipple to use as default in + a GC. we don't build default tiles of all depths + because they are likely to be of a color + different from the default fg pixel, so + we don't win anything by building + a standard one. + */ + PixmapPtr PixmapPerDepth[1]; + pointer devPrivate; + short numVisuals; + VisualPtr visuals; + WindowPtr root; + ScreenSaverStuffRec screensaver; + + /* Random screen procedures */ + + CloseScreenProcPtr CloseScreen; + QueryBestSizeProcPtr QueryBestSize; + SaveScreenProcPtr SaveScreen; + GetImageProcPtr GetImage; + GetSpansProcPtr GetSpans; + SourceValidateProcPtr SourceValidate; + + /* Window Procedures */ + + CreateWindowProcPtr CreateWindow; + DestroyWindowProcPtr DestroyWindow; + PositionWindowProcPtr PositionWindow; + ChangeWindowAttributesProcPtr ChangeWindowAttributes; + RealizeWindowProcPtr RealizeWindow; + UnrealizeWindowProcPtr UnrealizeWindow; + ValidateTreeProcPtr ValidateTree; + PostValidateTreeProcPtr PostValidateTree; + WindowExposuresProcPtr WindowExposures; + CopyWindowProcPtr CopyWindow; + ClearToBackgroundProcPtr ClearToBackground; + ClipNotifyProcPtr ClipNotify; + RestackWindowProcPtr RestackWindow; + + /* Pixmap procedures */ + + CreatePixmapProcPtr CreatePixmap; + DestroyPixmapProcPtr DestroyPixmap; + + /* Font procedures */ + + RealizeFontProcPtr RealizeFont; + UnrealizeFontProcPtr UnrealizeFont; + + /* Cursor Procedures */ + + ConstrainCursorProcPtr ConstrainCursor; + ConstrainCursorHarderProcPtr ConstrainCursorHarder; + CursorLimitsProcPtr CursorLimits; + DisplayCursorProcPtr DisplayCursor; + RealizeCursorProcPtr RealizeCursor; + UnrealizeCursorProcPtr UnrealizeCursor; + RecolorCursorProcPtr RecolorCursor; + SetCursorPositionProcPtr SetCursorPosition; + + /* GC procedures */ + + CreateGCProcPtr CreateGC; + + /* Colormap procedures */ + + CreateColormapProcPtr CreateColormap; + DestroyColormapProcPtr DestroyColormap; + InstallColormapProcPtr InstallColormap; + UninstallColormapProcPtr UninstallColormap; + ListInstalledColormapsProcPtr ListInstalledColormaps; + StoreColorsProcPtr StoreColors; + ResolveColorProcPtr ResolveColor; + + /* Region procedures */ + + BitmapToRegionProcPtr BitmapToRegion; + SendGraphicsExposeProcPtr SendGraphicsExpose; + + /* os layer procedures */ + + ScreenBlockHandlerProcPtr BlockHandler; + ScreenWakeupHandlerProcPtr WakeupHandler; + + pointer blockData; + pointer wakeupData; + + /* anybody can get a piece of this array */ + PrivateRec *devPrivates; + + CreateScreenResourcesProcPtr CreateScreenResources; + ModifyPixmapHeaderProcPtr ModifyPixmapHeader; + + GetWindowPixmapProcPtr GetWindowPixmap; + SetWindowPixmapProcPtr SetWindowPixmap; + GetScreenPixmapProcPtr GetScreenPixmap; + SetScreenPixmapProcPtr SetScreenPixmap; + + PixmapPtr pScratchPixmap; /* scratch pixmap "pool" */ + + unsigned int totalPixmapSize; + + MarkWindowProcPtr MarkWindow; + MarkOverlappedWindowsProcPtr MarkOverlappedWindows; + ConfigNotifyProcPtr ConfigNotify; + MoveWindowProcPtr MoveWindow; + ResizeWindowProcPtr ResizeWindow; + GetLayerWindowProcPtr GetLayerWindow; + HandleExposuresProcPtr HandleExposures; + ReparentWindowProcPtr ReparentWindow; + + SetShapeProcPtr SetShape; + + ChangeBorderWidthProcPtr ChangeBorderWidth; + MarkUnrealizedWindowProcPtr MarkUnrealizedWindow; + + /* Device cursor procedures */ + DeviceCursorInitializeProcPtr DeviceCursorInitialize; + DeviceCursorCleanupProcPtr DeviceCursorCleanup; + + /* set it in driver side if X server can copy the framebuffer content. + * Meant to be used together with '-background none' option, avoiding + * malicious users to steal framebuffer's content if that would be the + * default */ + Bool canDoBGNoneRoot; +} ScreenRec; + +static inline RegionPtr BitmapToRegion(ScreenPtr _pScreen, PixmapPtr pPix) { + return (*(_pScreen)->BitmapToRegion)(pPix); /* no mi version?! */ +} + +typedef struct _ScreenInfo { + int imageByteOrder; + int bitmapScanlineUnit; + int bitmapScanlinePad; + int bitmapBitOrder; + int numPixmapFormats; + PixmapFormatRec + formats[MAXFORMATS]; + int numScreens; + ScreenPtr screens[MAXSCREENS]; +} ScreenInfo; + +extern _X_EXPORT ScreenInfo screenInfo; + +extern _X_EXPORT void InitOutput( + ScreenInfo * /*pScreenInfo*/, + int /*argc*/, + char ** /*argv*/); + +#endif /* SCREENINTSTRUCT_H */ diff --git a/include/selection.h b/include/selection.h new file mode 100644 index 0000000..3271f6a --- /dev/null +++ b/include/selection.h @@ -0,0 +1,105 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef SELECTION_H +#define SELECTION_H 1 + +#include "dixstruct.h" +#include "privates.h" + +/* + * Selection data structures + */ + +typedef struct _Selection { + Atom selection; + TimeStamp lastTimeChanged; + Window window; + WindowPtr pWin; + ClientPtr client; + struct _Selection *next; + PrivateRec *devPrivates; +} Selection; + + +/* + * Selection API + */ + +extern _X_EXPORT int dixLookupSelection(Selection **result, Atom name, + ClientPtr client, Mask access_mode); + +extern _X_EXPORT Selection *CurrentSelections; + +extern _X_EXPORT CallbackListPtr SelectionCallback; + +typedef enum { + SelectionSetOwner, + SelectionWindowDestroy, + SelectionClientClose +} SelectionCallbackKind; + +typedef struct { + struct _Selection *selection; + ClientPtr client; + SelectionCallbackKind kind; +} SelectionInfoRec; + + +/* + * Selection server internals + */ + +extern _X_EXPORT void InitSelections(void); + +extern _X_EXPORT void DeleteWindowFromAnySelections(WindowPtr pWin); + +extern _X_EXPORT void DeleteClientFromAnySelections(ClientPtr client); + +#endif /* SELECTION_H */ + + diff --git a/include/servermd.h b/include/servermd.h new file mode 100644 index 0000000..271d936 --- /dev/null +++ b/include/servermd.h @@ -0,0 +1,355 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef SERVERMD_H +#define SERVERMD_H 1 + +/* + * Note: much of this is vestigial from mfb/cfb times. This should + * really be simplified even further. + */ + +/* + * Machine dependent values: + * GLYPHPADBYTES should be chosen with consideration for the space-time + * trade-off. Padding to 0 bytes means that there is no wasted space + * in the font bitmaps (both on disk and in memory), but that access of + * the bitmaps will cause odd-address memory references. Padding to + * 2 bytes would ensure even address memory references and would + * be suitable for a 68010-class machine, but at the expense of wasted + * space in the font bitmaps. Padding to 4 bytes would be good + * for real 32 bit machines, etc. Be sure that you tell the font + * compiler what kind of padding you want because its defines are + * kept separate from this. See server/include/font.h for how + * GLYPHPADBYTES is used. + */ + +#ifdef __avr32__ + +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 + +#endif /* __avr32__ */ + +#ifdef __arm32__ + +#define IMAGE_BYTE_ORDER LSBFirst +#define BITMAP_BIT_ORDER LSBFirst +#define GLYPHPADBYTES 4 + +#endif /* __arm32__ */ + +#if defined(__nds32__) + +#define IMAGE_BYTE_ORDER LSBFirst + +#if defined(XF86MONOVGA) || defined(XF86VGA16) || defined(XF86MONO) +# define BITMAP_BIT_ORDER MSBFirst +#else +# define BITMAP_BIT_ORDER LSBFirst +#endif + +#if defined(XF86MONOVGA) || defined(XF86VGA16) +# define BITMAP_SCANLINE_UNIT 8 +#endif + +#define GLYPHPADBYTES 4 +#define GETLEFTBITS_ALIGNMENT 1 +#define LARGE_INSTRUCTION_CACHE +#define AVOID_MEMORY_READ + +#endif /* __nds32__ */ + +#if defined __hppa__ + +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 /* to make fb work */ + /* byte boundries */ +#endif /* hpux || __hppa__ */ + +#if defined(__powerpc__) || defined(__ppc__) || defined(__ppc64__) + +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 + +#endif /* PowerPC */ + +#if defined(__sh__) + +#if defined(__BIG_ENDIAN__) +# define IMAGE_BYTE_ORDER MSBFirst +# define BITMAP_BIT_ORDER MSBFirst +# define GLYPHPADBYTES 4 +#else +# define IMAGE_BYTE_ORDER LSBFirst +# define BITMAP_BIT_ORDER LSBFirst +# define GLYPHPADBYTES 4 +#endif + +#endif /* SuperH */ + +#if defined(__m32r__) + +#if defined(__BIG_ENDIAN__) +# define IMAGE_BYTE_ORDER MSBFirst +# define BITMAP_BIT_ORDER MSBFirst +# define GLYPHPADBYTES 4 +#else +# define IMAGE_BYTE_ORDER LSBFirst +# define BITMAP_BIT_ORDER LSBFirst +# define GLYPHPADBYTES 4 +#endif + +#endif /* __m32r__ */ + +#if (defined(sun) && (defined(__sparc) || defined(sparc))) || \ + (defined(__uxp__) && (defined(sparc) || defined(mc68000))) || \ + defined(__sparc__) || defined(__mc68000__) + +#if defined(__sparc) || defined(__sparc__) +# if !defined(sparc) +# define sparc 1 +# endif +#endif + +#if defined(sun386) || defined(sun5) +# define IMAGE_BYTE_ORDER LSBFirst /* Values for the SUN only */ +# define BITMAP_BIT_ORDER LSBFirst +#else +# define IMAGE_BYTE_ORDER MSBFirst /* Values for the SUN only */ +# define BITMAP_BIT_ORDER MSBFirst +#endif + +#define GLYPHPADBYTES 4 + +#endif /* sun && !(i386 && SVR4) */ + + +#if defined(ibm032) || defined (ibm) + +#ifdef __i386__ +# define IMAGE_BYTE_ORDER LSBFirst /* Value for PS/2 only */ +#else +# define IMAGE_BYTE_ORDER MSBFirst /* Values for the RT only*/ +#endif +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 1 +/* ibm pcc doesn't understand pragmas. */ + +#ifdef __i386__ +#define BITMAP_SCANLINE_UNIT 8 +#endif + +#endif /* ibm */ + +#if (defined(mips) || defined(__mips)) + +#if defined(MIPSEL) || defined(__MIPSEL__) +# define IMAGE_BYTE_ORDER LSBFirst /* Values for the PMAX only */ +# define BITMAP_BIT_ORDER LSBFirst +# define GLYPHPADBYTES 4 +#else +# define IMAGE_BYTE_ORDER MSBFirst /* Values for the MIPS only */ +# define BITMAP_BIT_ORDER MSBFirst +# define GLYPHPADBYTES 4 +#endif + +#endif /* mips */ + +#if defined(__alpha) || defined(__alpha__) +# define IMAGE_BYTE_ORDER LSBFirst /* Values for the Alpha only */ +# define BITMAP_BIT_ORDER LSBFirst +# define GLYPHPADBYTES 4 + +#endif /* alpha */ + +#if defined (linux) && defined (__s390__) + +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 + +#define BITMAP_SCANLINE_UNIT 8 +#define FAST_UNALIGNED_READ + +#endif /* linux/s390 */ + +#if defined (linux) && defined (__s390x__) + +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 + +#define BITMAP_SCANLINE_UNIT 8 +#define FAST_UNALIGNED_READ + +#endif /* linux/s390x */ + + +#if defined(__ia64__) || defined(ia64) + +# define IMAGE_BYTE_ORDER LSBFirst +# define BITMAP_BIT_ORDER LSBFirst +# define GLYPHPADBYTES 4 + +#endif /* ia64 */ + +#if defined(__amd64__) || defined(amd64) || defined(__amd64) +# define IMAGE_BYTE_ORDER LSBFirst +# define BITMAP_BIT_ORDER LSBFirst +# define GLYPHPADBYTES 4 +/* ???? */ +#endif /* AMD64 */ + +#if defined(SVR4) && (defined(__i386__) || defined(__i386) ) || \ + defined(__alpha__) || defined(__alpha) || \ + defined(__i386__) || \ + defined(__s390x__) || defined(__s390__) + +#ifndef IMAGE_BYTE_ORDER +#define IMAGE_BYTE_ORDER LSBFirst +#endif + +#ifndef BITMAP_BIT_ORDER +# define BITMAP_BIT_ORDER LSBFirst +#endif + +#ifndef GLYPHPADBYTES +#define GLYPHPADBYTES 4 +#endif + +#endif /* SVR4 / BSD / i386 */ + +#if defined (linux) && defined (__mc68000__) + +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 + +#endif /* linux/m68k */ + + +/* linux on ARM */ +#if defined(linux) && defined(__arm__) +#define IMAGE_BYTE_ORDER LSBFirst +#define BITMAP_BIT_ORDER LSBFirst +#define GLYPHPADBYTES 4 +#endif + +/* linux on IBM S/390 */ +#if defined (linux) && defined (__s390__) +#define IMAGE_BYTE_ORDER MSBFirst +#define BITMAP_BIT_ORDER MSBFirst +#define GLYPHPADBYTES 4 +#endif /* linux/s390 */ + +/* size of buffer to use with GetImage, measured in bytes. There's obviously + * a trade-off between the amount of heap used and the number of times the + * ddx routine has to be called. + */ +#ifndef IMAGE_BUFSIZE +#define IMAGE_BUFSIZE (64*1024) +#endif + +/* pad scanline to a longword */ +#ifndef BITMAP_SCANLINE_UNIT +#define BITMAP_SCANLINE_UNIT 32 +#endif + +#ifndef BITMAP_SCANLINE_PAD +#define BITMAP_SCANLINE_PAD 32 +#define LOG2_BITMAP_PAD 5 +#define LOG2_BYTES_PER_SCANLINE_PAD 2 +#endif + +#include <X11/Xfuncproto.h> +/* + * This returns the number of padding units, for depth d and width w. + * For bitmaps this can be calculated with the macros above. + * Other depths require either grovelling over the formats field of the + * screenInfo or hardwired constants. + */ + +typedef struct _PaddingInfo { + int padRoundUp; /* pixels per pad unit - 1 */ + int padPixelsLog2; /* log 2 (pixels per pad unit) */ + int padBytesLog2; /* log 2 (bytes per pad unit) */ + int notPower2; /* bitsPerPixel not a power of 2 */ + int bytesPerPixel; /* only set when notPower2 is TRUE */ + int bitsPerPixel; /* bits per pixel */ +} PaddingInfo; +extern _X_EXPORT PaddingInfo PixmapWidthPaddingInfo[]; + +/* The only portable way to get the bpp from the depth is to look it up */ +#define BitsPerPixel(d) (PixmapWidthPaddingInfo[d].bitsPerPixel) + +#define PixmapWidthInPadUnits(w, d) \ + (PixmapWidthPaddingInfo[d].notPower2 ? \ + (((int)(w) * PixmapWidthPaddingInfo[d].bytesPerPixel + \ + PixmapWidthPaddingInfo[d].bytesPerPixel) >> \ + PixmapWidthPaddingInfo[d].padBytesLog2) : \ + ((int)((w) + PixmapWidthPaddingInfo[d].padRoundUp) >> \ + PixmapWidthPaddingInfo[d].padPixelsLog2)) + +/* + * Return the number of bytes to which a scanline of the given + * depth and width will be padded. + */ +#define PixmapBytePad(w, d) \ + (PixmapWidthInPadUnits(w, d) << PixmapWidthPaddingInfo[d].padBytesLog2) + +#define BitmapBytePad(w) \ + (((int)((w) + BITMAP_SCANLINE_PAD - 1) >> LOG2_BITMAP_PAD) << LOG2_BYTES_PER_SCANLINE_PAD) + +#define PixmapWidthInPadUnitsProto(w, d) PixmapWidthInPadUnits(w, d) +#define PixmapBytePadProto(w, d) PixmapBytePad(w, d) +#define BitmapBytePadProto(w) BitmapBytePad(w) + +#endif /* SERVERMD_H */ diff --git a/include/site.h b/include/site.h new file mode 100644 index 0000000..9c2836f --- /dev/null +++ b/include/site.h @@ -0,0 +1,127 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + +#ifndef SITE_H +#define SITE_H +/* + * The vendor string identifies the vendor responsible for the + * server executable. + */ +#ifndef VENDOR_STRING +#define VENDOR_STRING "The X.Org Foundation" +#endif + +/* + * The vendor release number identifies, for the purpose of submitting + * traceable bug reports, the release number of software produced + * by the vendor. + */ +#ifndef VENDOR_RELEASE +#define VENDOR_RELEASE 6600 +#endif + +/* + * The following constants are provided solely as a last line of defense. The + * normal build ALWAYS overrides them using a special rule given in + * server/dix/Imakefile. If you want to change either of these constants, + * you should set the DefaultFontPath or DefaultRGBDatabase configuration + * parameters. + * DO NOT CHANGE THESE VALUES OR THE DIX IMAKEFILE! + */ +#ifndef COMPILEDDEFAULTFONTPATH +#define COMPILEDDEFAULTFONTPATH "/usr/share/fonts/X11/misc/" +#endif + +/* + * The following constants contain default values for all of the variables + * that can be initialized on the server command line or in the environment. + */ +#define COMPILEDDEFAULTFONT "fixed" +#define COMPILEDCURSORFONT "cursor" +#ifndef COMPILEDDISPLAYCLASS +#define COMPILEDDISPLAYCLASS "MIT-unspecified" +#endif +#define DEFAULT_TIMEOUT 60 /* seconds */ +#define DEFAULT_KEYBOARD_CLICK 0 +#define DEFAULT_BELL 50 +#define DEFAULT_BELL_PITCH 400 +#define DEFAULT_BELL_DURATION 100 +#define DEFAULT_AUTOREPEAT TRUE +#define DEFAULT_AUTOREPEATS {\ + 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,\ + 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,\ + 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,\ + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00} + +#define DEFAULT_LEDS 0x0 /* all off */ +#define DEFAULT_LEDS_MASK 0xffffffff /* 32 */ +#define DEFAULT_INT_RESOLUTION 1000 +#define DEFAULT_INT_MIN_VALUE 0 +#define DEFAULT_INT_MAX_VALUE 100 +#define DEFAULT_INT_DISPLAYED 0 + +#define DEFAULT_PTR_NUMERATOR 2 +#define DEFAULT_PTR_DENOMINATOR 1 +#define DEFAULT_PTR_THRESHOLD 4 + +#define DEFAULT_SCREEN_SAVER_TIME (10 * (60 * 1000)) +#define DEFAULT_SCREEN_SAVER_INTERVAL (10 * (60 * 1000)) +#define DEFAULT_SCREEN_SAVER_BLANKING PreferBlanking +#define DEFAULT_SCREEN_SAVER_EXPOSURES AllowExposures +#ifndef DEFAULT_ACCESS_CONTROL +#define DEFAULT_ACCESS_CONTROL TRUE +#endif + +/* Default logging parameters. */ +#ifndef DEFAULT_LOG_VERBOSITY +#define DEFAULT_LOG_VERBOSITY 0 +#endif +#ifndef DEFAULT_LOG_FILE_VERBOSITY +#define DEFAULT_LOG_FILE_VERBOSITY 3 +#endif + +#endif /* SITE_H */ diff --git a/include/swaprep.h b/include/swaprep.h new file mode 100644 index 0000000..8c02737 --- /dev/null +++ b/include/swaprep.h @@ -0,0 +1,292 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef SWAPREP_H +#define SWAPREP_H 1 + +extern _X_EXPORT void Swap32Write( + ClientPtr /* pClient */, + int /* size */, + CARD32 * /* pbuf */); + +extern _X_EXPORT void CopySwap32Write( + ClientPtr /* pClient */, + int /* size */, + CARD32 * /* pbuf */); + +extern _X_EXPORT void CopySwap16Write( + ClientPtr /* pClient */, + int /* size */, + short * /* pbuf */); + +extern _X_EXPORT void SGenericReply( + ClientPtr /* pClient */, + int /* size */, + xGenericReply * /* pRep */); + +extern _X_EXPORT void SGetWindowAttributesReply( + ClientPtr /* pClient */, + int /* size */, + xGetWindowAttributesReply * /* pRep */); + +extern _X_EXPORT void SGetGeometryReply( + ClientPtr /* pClient */, + int /* size */, + xGetGeometryReply * /* pRep */); + +extern _X_EXPORT void SQueryTreeReply( + ClientPtr /* pClient */, + int /* size */, + xQueryTreeReply * /* pRep */); + +extern _X_EXPORT void SInternAtomReply( + ClientPtr /* pClient */, + int /* size */, + xInternAtomReply * /* pRep */); + +extern _X_EXPORT void SGetAtomNameReply( + ClientPtr /* pClient */, + int /* size */, + xGetAtomNameReply * /* pRep */); + +extern _X_EXPORT void SGetPropertyReply( + ClientPtr /* pClient */, + int /* size */, + xGetPropertyReply * /* pRep */); + +extern _X_EXPORT void SListPropertiesReply( + ClientPtr /* pClient */, + int /* size */, + xListPropertiesReply * /* pRep */); + +extern _X_EXPORT void SGetSelectionOwnerReply( + ClientPtr /* pClient */, + int /* size */, + xGetSelectionOwnerReply * /* pRep */); + +extern _X_EXPORT void SQueryPointerReply( + ClientPtr /* pClient */, + int /* size */, + xQueryPointerReply * /* pRep */); + +extern _X_EXPORT void SwapTimeCoordWrite( + ClientPtr /* pClient */, + int /* size */, + xTimecoord * /* pRep */); + +extern _X_EXPORT void SGetMotionEventsReply( + ClientPtr /* pClient */, + int /* size */, + xGetMotionEventsReply * /* pRep */); + +extern _X_EXPORT void STranslateCoordsReply( + ClientPtr /* pClient */, + int /* size */, + xTranslateCoordsReply * /* pRep */); + +extern _X_EXPORT void SGetInputFocusReply( + ClientPtr /* pClient */, + int /* size */, + xGetInputFocusReply * /* pRep */); + +extern _X_EXPORT void SQueryKeymapReply( + ClientPtr /* pClient */, + int /* size */, + xQueryKeymapReply * /* pRep */); + +extern _X_EXPORT void SQueryFontReply( + ClientPtr /* pClient */, + int /* size */, + xQueryFontReply * /* pRep */); + +extern _X_EXPORT void SQueryTextExtentsReply( + ClientPtr /* pClient */, + int /* size */, + xQueryTextExtentsReply * /* pRep */); + +extern _X_EXPORT void SListFontsReply( + ClientPtr /* pClient */, + int /* size */, + xListFontsReply * /* pRep */); + +extern _X_EXPORT void SListFontsWithInfoReply( + ClientPtr /* pClient */, + int /* size */, + xListFontsWithInfoReply * /* pRep */); + +extern _X_EXPORT void SGetFontPathReply( + ClientPtr /* pClient */, + int /* size */, + xGetFontPathReply * /* pRep */); + +extern _X_EXPORT void SGetImageReply( + ClientPtr /* pClient */, + int /* size */, + xGetImageReply * /* pRep */); + +extern _X_EXPORT void SListInstalledColormapsReply( + ClientPtr /* pClient */, + int /* size */, + xListInstalledColormapsReply * /* pRep */); + +extern _X_EXPORT void SAllocColorReply( + ClientPtr /* pClient */, + int /* size */, + xAllocColorReply * /* pRep */); + +extern _X_EXPORT void SAllocNamedColorReply( + ClientPtr /* pClient */, + int /* size */, + xAllocNamedColorReply * /* pRep */); + +extern _X_EXPORT void SAllocColorCellsReply( + ClientPtr /* pClient */, + int /* size */, + xAllocColorCellsReply * /* pRep */); + +extern _X_EXPORT void SAllocColorPlanesReply( + ClientPtr /* pClient */, + int /* size */, + xAllocColorPlanesReply * /* pRep */); + +extern _X_EXPORT void SQColorsExtend( + ClientPtr /* pClient */, + int /* size */, + xrgb * /* prgb */); + +extern _X_EXPORT void SQueryColorsReply( + ClientPtr /* pClient */, + int /* size */, + xQueryColorsReply * /* pRep */); + +extern _X_EXPORT void SLookupColorReply( + ClientPtr /* pClient */, + int /* size */, + xLookupColorReply * /* pRep */); + +extern _X_EXPORT void SQueryBestSizeReply( + ClientPtr /* pClient */, + int /* size */, + xQueryBestSizeReply * /* pRep */); + +extern _X_EXPORT void SListExtensionsReply( + ClientPtr /* pClient */, + int /* size */, + xListExtensionsReply * /* pRep */); + +extern _X_EXPORT void SGetKeyboardMappingReply( + ClientPtr /* pClient */, + int /* size */, + xGetKeyboardMappingReply * /* pRep */); + +extern _X_EXPORT void SGetPointerMappingReply( + ClientPtr /* pClient */, + int /* size */, + xGetPointerMappingReply * /* pRep */); + +extern _X_EXPORT void SGetModifierMappingReply( + ClientPtr /* pClient */, + int /* size */, + xGetModifierMappingReply * /* pRep */); + +extern _X_EXPORT void SGetKeyboardControlReply( + ClientPtr /* pClient */, + int /* size */, + xGetKeyboardControlReply * /* pRep */); + +extern _X_EXPORT void SGetPointerControlReply( + ClientPtr /* pClient */, + int /* size */, + xGetPointerControlReply * /* pRep */); + +extern _X_EXPORT void SGetScreenSaverReply( + ClientPtr /* pClient */, + int /* size */, + xGetScreenSaverReply * /* pRep */); + +extern _X_EXPORT void SLHostsExtend( + ClientPtr /* pClient */, + int /* size */, + char * /* buf */); + +extern _X_EXPORT void SListHostsReply( + ClientPtr /* pClient */, + int /* size */, + xListHostsReply * /* pRep */); + +extern _X_EXPORT void SErrorEvent( + xError * /* from */, + xError * /* to */); + +extern _X_EXPORT void SwapConnSetupInfo( + char * /* pInfo */, + char * /* pInfoTBase */); + +extern _X_EXPORT void WriteSConnectionInfo( + ClientPtr /* pClient */, + unsigned long /* size */, + char * /* pInfo */); + +extern _X_EXPORT void SwapConnSetupPrefix( + xConnSetupPrefix * /* pcspFrom */, + xConnSetupPrefix * /* pcspTo */); + +extern _X_EXPORT void WriteSConnSetupPrefix( + ClientPtr /* pClient */, + xConnSetupPrefix * /* pcsp */); + +#undef SWAPREP_PROC +#define SWAPREP_PROC(func) extern _X_EXPORT void func(xEvent * /* from */, xEvent * /* to */) + +SWAPREP_PROC(SCirculateEvent); +SWAPREP_PROC(SClientMessageEvent); +SWAPREP_PROC(SColormapEvent); +SWAPREP_PROC(SConfigureNotifyEvent); +SWAPREP_PROC(SConfigureRequestEvent); +SWAPREP_PROC(SCreateNotifyEvent); +SWAPREP_PROC(SDestroyNotifyEvent); +SWAPREP_PROC(SEnterLeaveEvent); +SWAPREP_PROC(SExposeEvent); +SWAPREP_PROC(SFocusEvent); +SWAPREP_PROC(SGraphicsExposureEvent); +SWAPREP_PROC(SGravityEvent); +SWAPREP_PROC(SKeyButtonPtrEvent); +SWAPREP_PROC(SKeymapNotifyEvent); +SWAPREP_PROC(SMapNotifyEvent); +SWAPREP_PROC(SMapRequestEvent); +SWAPREP_PROC(SMappingEvent); +SWAPREP_PROC(SNoExposureEvent); +SWAPREP_PROC(SPropertyEvent); +SWAPREP_PROC(SReparentEvent); +SWAPREP_PROC(SResizeRequestEvent); +SWAPREP_PROC(SSelectionClearEvent); +SWAPREP_PROC(SSelectionNotifyEvent); +SWAPREP_PROC(SSelectionRequestEvent); +SWAPREP_PROC(SUnmapNotifyEvent); +SWAPREP_PROC(SVisibilityEvent); + +#undef SWAPREP_PROC + +#endif /* SWAPREP_H */ diff --git a/include/swapreq.h b/include/swapreq.h new file mode 100644 index 0000000..8038f02 --- /dev/null +++ b/include/swapreq.h @@ -0,0 +1,108 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey <dickey@clark.net> + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef SWAPREQ_H +#define SWAPREQ_H 1 + +extern _X_EXPORT void SwapColorItem( + xColorItem * /* pItem */); + +extern _X_EXPORT void SwapConnClientPrefix( + xConnClientPrefix * /* pCCP */); + +#undef SWAPREQ_PROC + +#define SWAPREQ_PROC(func) extern _X_EXPORT int func(ClientPtr /* client */) + +SWAPREQ_PROC(SProcAllocColor); +SWAPREQ_PROC(SProcAllocColorCells); +SWAPREQ_PROC(SProcAllocColorPlanes); +SWAPREQ_PROC(SProcAllocNamedColor); +SWAPREQ_PROC(SProcChangeActivePointerGrab); +SWAPREQ_PROC(SProcChangeGC); +SWAPREQ_PROC(SProcChangeHosts); +SWAPREQ_PROC(SProcChangeKeyboardControl); +SWAPREQ_PROC(SProcChangeKeyboardMapping); +SWAPREQ_PROC(SProcChangePointerControl); +SWAPREQ_PROC(SProcChangeProperty); +SWAPREQ_PROC(SProcChangeWindowAttributes); +SWAPREQ_PROC(SProcClearToBackground); +SWAPREQ_PROC(SProcConfigureWindow); +SWAPREQ_PROC(SProcConvertSelection); +SWAPREQ_PROC(SProcCopyArea); +SWAPREQ_PROC(SProcCopyColormapAndFree); +SWAPREQ_PROC(SProcCopyGC); +SWAPREQ_PROC(SProcCopyPlane); +SWAPREQ_PROC(SProcCreateColormap); +SWAPREQ_PROC(SProcCreateCursor); +SWAPREQ_PROC(SProcCreateGC); +SWAPREQ_PROC(SProcCreateGlyphCursor); +SWAPREQ_PROC(SProcCreatePixmap); +SWAPREQ_PROC(SProcCreateWindow); +SWAPREQ_PROC(SProcDeleteProperty); +SWAPREQ_PROC(SProcFillPoly); +SWAPREQ_PROC(SProcFreeColors); +SWAPREQ_PROC(SProcGetImage); +SWAPREQ_PROC(SProcGetMotionEvents); +SWAPREQ_PROC(SProcGetProperty); +SWAPREQ_PROC(SProcGrabButton); +SWAPREQ_PROC(SProcGrabKey); +SWAPREQ_PROC(SProcGrabKeyboard); +SWAPREQ_PROC(SProcGrabPointer); +SWAPREQ_PROC(SProcImageText); +SWAPREQ_PROC(SProcInternAtom); +SWAPREQ_PROC(SProcListFonts); +SWAPREQ_PROC(SProcListFontsWithInfo); +SWAPREQ_PROC(SProcLookupColor); +SWAPREQ_PROC(SProcNoOperation); +SWAPREQ_PROC(SProcOpenFont); +SWAPREQ_PROC(SProcPoly); +SWAPREQ_PROC(SProcPolyText); +SWAPREQ_PROC(SProcPutImage); +SWAPREQ_PROC(SProcQueryBestSize); +SWAPREQ_PROC(SProcQueryColors); +SWAPREQ_PROC(SProcQueryExtension); +SWAPREQ_PROC(SProcRecolorCursor); +SWAPREQ_PROC(SProcReparentWindow); +SWAPREQ_PROC(SProcResourceReq); +SWAPREQ_PROC(SProcRotateProperties); +SWAPREQ_PROC(SProcSendEvent); +SWAPREQ_PROC(SProcSetClipRectangles); +SWAPREQ_PROC(SProcSetDashes); +SWAPREQ_PROC(SProcSetFontPath); +SWAPREQ_PROC(SProcSetInputFocus); +SWAPREQ_PROC(SProcSetScreenSaver); +SWAPREQ_PROC(SProcSetSelectionOwner); +SWAPREQ_PROC(SProcSimpleReq); +SWAPREQ_PROC(SProcStoreColors); +SWAPREQ_PROC(SProcStoreNamedColor); +SWAPREQ_PROC(SProcTranslateCoords); +SWAPREQ_PROC(SProcUngrabButton); +SWAPREQ_PROC(SProcUngrabKey); +SWAPREQ_PROC(SProcWarpPointer); + +#undef SWAPREQ_PROC + +#endif /* SWAPREQ_H */ diff --git a/include/validate.h b/include/validate.h new file mode 100644 index 0000000..e88fb41 --- /dev/null +++ b/include/validate.h @@ -0,0 +1,40 @@ + +/* + +Copyright 1989, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. +*/ + +#ifndef VALIDATE_H +#define VALIDATE_H + +#include "miscstruct.h" +#include "regionstr.h" + +typedef enum { VTOther, VTStack, VTMove, VTUnmap, VTMap, VTBroken } VTKind; + +/* union _Validate is now device dependent; see mivalidate.h for an example */ +typedef union _Validate *ValidatePtr; + +#define UnmapValData ((ValidatePtr)1) + +#endif /* VALIDATE_H */ diff --git a/include/version-config.h.in b/include/version-config.h.in new file mode 100644 index 0000000..8180dff --- /dev/null +++ b/include/version-config.h.in @@ -0,0 +1,16 @@ +/* version-config.h.in: not generated */ + +#ifndef VERSION_CONFIG_H +#define VERSION_CONFIG_H + +/* Vendor man version */ +#undef VENDOR_MAN_VERSION + +/* Vendor name */ +#undef VENDOR_NAME + +/* Vendor release */ +#undef VENDOR_RELEASE + +#endif /* VERSION_CONFIG_H */ + diff --git a/include/window.h b/include/window.h new file mode 100644 index 0000000..6fb2f8c --- /dev/null +++ b/include/window.h @@ -0,0 +1,269 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef WINDOW_H +#define WINDOW_H + +#include "misc.h" +#include "region.h" +#include "screenint.h" +#include <X11/Xproto.h> + +#define TOTALLY_OBSCURED 0 +#define UNOBSCURED 1 +#define OBSCURED 2 + +#define VisibilityNotViewable 3 + +/* return values for tree-walking callback procedures */ +#define WT_STOPWALKING 0 +#define WT_WALKCHILDREN 1 +#define WT_DONTWALKCHILDREN 2 +#define WT_NOMATCH 3 +#define NullWindow ((WindowPtr) 0) + +/* Forward declaration, we can't include input.h here */ +struct _DeviceIntRec; +struct _Cursor; + +typedef struct _BackingStore *BackingStorePtr; +typedef struct _Window *WindowPtr; + +typedef int (*VisitWindowProcPtr)( + WindowPtr /*pWin*/, + pointer /*data*/); + +extern _X_EXPORT int TraverseTree( + WindowPtr /*pWin*/, + VisitWindowProcPtr /*func*/, + pointer /*data*/); + +extern _X_EXPORT int WalkTree( + ScreenPtr /*pScreen*/, + VisitWindowProcPtr /*func*/, + pointer /*data*/); + +extern _X_EXPORT Bool CreateRootWindow( + ScreenPtr /*pScreen*/); + +extern _X_EXPORT void InitRootWindow( + WindowPtr /*pWin*/); + +typedef WindowPtr (* RealChildHeadProc) (WindowPtr pWin); + +extern _X_EXPORT void RegisterRealChildHeadProc (RealChildHeadProc proc); + +extern _X_EXPORT WindowPtr RealChildHead( + WindowPtr /*pWin*/); + +extern _X_EXPORT WindowPtr CreateWindow( + Window /*wid*/, + WindowPtr /*pParent*/, + int /*x*/, + int /*y*/, + unsigned int /*w*/, + unsigned int /*h*/, + unsigned int /*bw*/, + unsigned int /*class*/, + Mask /*vmask*/, + XID* /*vlist*/, + int /*depth*/, + ClientPtr /*client*/, + VisualID /*visual*/, + int* /*error*/); + +extern _X_EXPORT int DeleteWindow( + pointer /*pWin*/, + XID /*wid*/); + +extern _X_EXPORT int DestroySubwindows( + WindowPtr /*pWin*/, + ClientPtr /*client*/); + +/* Quartz support on Mac OS X uses the HIToolbox + framework whose ChangeWindowAttributes function conflicts here. */ +#ifdef __APPLE__ +#define ChangeWindowAttributes Darwin_X_ChangeWindowAttributes +#endif +extern _X_EXPORT int ChangeWindowAttributes( + WindowPtr /*pWin*/, + Mask /*vmask*/, + XID* /*vlist*/, + ClientPtr /*client*/); + +extern _X_EXPORT int ChangeWindowDeviceCursor( + WindowPtr /*pWin*/, + struct _DeviceIntRec* /*pDev*/, + struct _Cursor* /*pCursor*/); + +extern _X_EXPORT struct _Cursor* WindowGetDeviceCursor( + WindowPtr /*pWin*/, + struct _DeviceIntRec* /*pDev*/); + +/* Quartz support on Mac OS X uses the HIToolbox + framework whose GetWindowAttributes function conflicts here. */ +#ifdef __APPLE__ +#define GetWindowAttributes(w,c,x) Darwin_X_GetWindowAttributes(w,c,x) +extern void Darwin_X_GetWindowAttributes( +#else +extern _X_EXPORT void GetWindowAttributes( +#endif + WindowPtr /*pWin*/, + ClientPtr /*client*/, + xGetWindowAttributesReply* /* wa */); + +extern _X_EXPORT void GravityTranslate( + int /*x*/, + int /*y*/, + int /*oldx*/, + int /*oldy*/, + int /*dw*/, + int /*dh*/, + unsigned /*gravity*/, + int* /*destx*/, + int* /*desty*/); + +extern _X_EXPORT int ConfigureWindow( + WindowPtr /*pWin*/, + Mask /*mask*/, + XID* /*vlist*/, + ClientPtr /*client*/); + +extern _X_EXPORT int CirculateWindow( + WindowPtr /*pParent*/, + int /*direction*/, + ClientPtr /*client*/); + +extern _X_EXPORT int ReparentWindow( + WindowPtr /*pWin*/, + WindowPtr /*pParent*/, + int /*x*/, + int /*y*/, + ClientPtr /*client*/); + +extern _X_EXPORT int MapWindow( + WindowPtr /*pWin*/, + ClientPtr /*client*/); + +extern _X_EXPORT void MapSubwindows( + WindowPtr /*pParent*/, + ClientPtr /*client*/); + +extern _X_EXPORT int UnmapWindow( + WindowPtr /*pWin*/, + Bool /*fromConfigure*/); + +extern _X_EXPORT void UnmapSubwindows( + WindowPtr /*pWin*/); + +extern _X_EXPORT void HandleSaveSet( + ClientPtr /*client*/); + +extern _X_EXPORT Bool PointInWindowIsVisible( + WindowPtr /*pWin*/, + int /*x*/, + int /*y*/); + +extern _X_EXPORT RegionPtr NotClippedByChildren( + WindowPtr /*pWin*/); + +extern _X_EXPORT void SendVisibilityNotify( + WindowPtr /*pWin*/); + +extern _X_EXPORT int dixSaveScreens( + ClientPtr client, + int on, + int mode); + +extern _X_EXPORT int SaveScreens( + int on, + int mode); + +extern _X_EXPORT WindowPtr FindWindowWithOptional( + WindowPtr /*w*/); + +extern _X_EXPORT void CheckWindowOptionalNeed( + WindowPtr /*w*/); + +extern _X_EXPORT Bool MakeWindowOptional( + WindowPtr /*pWin*/); + +extern _X_EXPORT WindowPtr MoveWindowInStack( + WindowPtr /*pWin*/, + WindowPtr /*pNextSib*/); + +extern _X_EXPORT void SetWinSize( + WindowPtr /*pWin*/); + +extern _X_EXPORT void SetBorderSize( + WindowPtr /*pWin*/); + +extern _X_EXPORT void ResizeChildrenWinSize( + WindowPtr /*pWin*/, + int /*dx*/, + int /*dy*/, + int /*dw*/, + int /*dh*/); + +extern _X_EXPORT void ShapeExtensionInit(void); + +extern _X_EXPORT void SendShapeNotify( + WindowPtr /* pWin */, + int /* which */ ); + +extern _X_EXPORT RegionPtr CreateBoundingShape( + WindowPtr /* pWin */ ); + +extern _X_EXPORT RegionPtr CreateClipShape( + WindowPtr /* pWin */ ); + +extern _X_EXPORT void DisableMapUnmapEvents( + WindowPtr /* pWin */ ); +extern _X_EXPORT void EnableMapUnmapEvents( + WindowPtr /* pWin */ ); + +#endif /* WINDOW_H */ diff --git a/include/windowstr.h b/include/windowstr.h new file mode 100644 index 0000000..4a7a0f4 --- /dev/null +++ b/include/windowstr.h @@ -0,0 +1,221 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifndef WINDOWSTRUCT_H +#define WINDOWSTRUCT_H + +#include "window.h" +#include "pixmapstr.h" +#include "regionstr.h" +#include "cursor.h" +#include "property.h" +#include "resource.h" /* for ROOT_WINDOW_ID_BASE */ +#include "dix.h" +#include "privates.h" +#include "miscstruct.h" +#include <X11/Xprotostr.h> +#include "opaque.h" + +#define GuaranteeNothing 0 +#define GuaranteeVisBack 1 + +#define SameBackground(as, a, bs, b) \ + ((as) == (bs) && ((as) == None || \ + (as) == ParentRelative || \ + SamePixUnion(a,b,as == BackgroundPixel))) + +#define SameBorder(as, a, bs, b) \ + EqualPixUnion(as, a, bs, b) + +/* used as NULL-terminated list */ +typedef struct _DevCursorNode { + CursorPtr cursor; + DeviceIntPtr dev; + struct _DevCursorNode* next; +} DevCursNodeRec, *DevCursNodePtr, *DevCursorList; + +typedef struct _WindowOpt { + CursorPtr cursor; /* default: window.cursorNone */ + VisualID visual; /* default: same as parent */ + Colormap colormap; /* default: same as parent */ + Mask dontPropagateMask; /* default: window.dontPropagate */ + Mask otherEventMasks; /* default: 0 */ + struct _OtherClients *otherClients; /* default: NULL */ + struct _GrabRec *passiveGrabs; /* default: NULL */ + PropertyPtr userProps; /* default: NULL */ + unsigned long backingBitPlanes; /* default: ~0L */ + unsigned long backingPixel; /* default: 0 */ + RegionPtr boundingShape; /* default: NULL */ + RegionPtr clipShape; /* default: NULL */ + RegionPtr inputShape; /* default: NULL */ + struct _OtherInputMasks *inputMasks; /* default: NULL */ + DevCursorList deviceCursors; /* default: NULL */ +} WindowOptRec, *WindowOptPtr; + +#define BackgroundPixel 2L +#define BackgroundPixmap 3L + +/* + * The redirectDraw field can have one of three values: + * + * RedirectDrawNone + * A normal window; painted into the same pixmap as the parent + * and clipping parent and siblings to its geometry. These + * windows get a clip list equal to the intersection of their + * geometry with the parent geometry, minus the geometry + * of overlapping None and Clipped siblings. + * RedirectDrawAutomatic + * A redirected window which clips parent and sibling drawing. + * Contents for these windows are manage inside the server. + * These windows get an internal clip list equal to their + * geometry. + * RedirectDrawManual + * A redirected window which does not clip parent and sibling + * drawing; the window must be represented within the parent + * geometry by the client performing the redirection management. + * Contents for these windows are managed outside the server. + * These windows get an internal clip list equal to their + * geometry. + */ + +#define RedirectDrawNone 0 +#define RedirectDrawAutomatic 1 +#define RedirectDrawManual 2 + +typedef struct _Window { + DrawableRec drawable; + PrivateRec *devPrivates; + WindowPtr parent; /* ancestor chain */ + WindowPtr nextSib; /* next lower sibling */ + WindowPtr prevSib; /* next higher sibling */ + WindowPtr firstChild; /* top-most child */ + WindowPtr lastChild; /* bottom-most child */ + RegionRec clipList; /* clipping rectangle for output */ + RegionRec borderClip; /* NotClippedByChildren + border */ + union _Validate *valdata; + RegionRec winSize; + RegionRec borderSize; + DDXPointRec origin; /* position relative to parent */ + unsigned short borderWidth; + unsigned short deliverableEvents; /* all masks from all clients */ + Mask eventMask; /* mask from the creating client */ + PixUnion background; + PixUnion border; + pointer backStorage; /* null when BS disabled */ + WindowOptPtr optional; + unsigned backgroundState:2; /* None, Relative, Pixel, Pixmap */ + unsigned borderIsPixel:1; + unsigned cursorIsNone:1; /* else real cursor (might inherit) */ + unsigned backingStore:2; + unsigned saveUnder:1; + unsigned DIXsaveUnder:1; + unsigned bitGravity:4; + unsigned winGravity:4; + unsigned overrideRedirect:1; + unsigned visibility:2; + unsigned mapped:1; + unsigned realized:1; /* ancestors are all mapped */ + unsigned viewable:1; /* realized && InputOutput */ + unsigned dontPropagate:3;/* index into DontPropagateMasks */ + unsigned forcedBS:1; /* system-supplied backingStore */ + unsigned redirectDraw:2; /* COMPOSITE rendering redirect */ + unsigned forcedBG:1; /* must have an opaque background */ +#ifdef ROOTLESS + unsigned rootlessUnhittable:1; /* doesn't hit-test */ +#endif +#ifdef COMPOSITE + unsigned damagedDescendants:1; /* some descendants are damaged */ +#endif +} WindowRec; + +/* + * Ok, a bunch of macros for accessing the optional record + * fields (or filling the appropriate default value) + */ + +extern _X_EXPORT Mask DontPropagateMasks[]; + +#define wTrackParent(w,field) ((w)->optional ? \ + (w)->optional->field \ + : FindWindowWithOptional(w)->optional->field) +#define wUseDefault(w,field,def) ((w)->optional ? \ + (w)->optional->field \ + : def) + +#define wVisual(w) wTrackParent(w, visual) +#define wCursor(w) ((w)->cursorIsNone ? None : wTrackParent(w, cursor)) +#define wColormap(w) ((w)->drawable.class == InputOnly ? None : wTrackParent(w, colormap)) +#define wDontPropagateMask(w) wUseDefault(w, dontPropagateMask, DontPropagateMasks[(w)->dontPropagate]) +#define wOtherEventMasks(w) wUseDefault(w, otherEventMasks, 0) +#define wOtherClients(w) wUseDefault(w, otherClients, NULL) +#define wOtherInputMasks(w) wUseDefault(w, inputMasks, NULL) +#define wPassiveGrabs(w) wUseDefault(w, passiveGrabs, NULL) +#define wUserProps(w) wUseDefault(w, userProps, NULL) +#define wBackingBitPlanes(w) wUseDefault(w, backingBitPlanes, ~0L) +#define wBackingPixel(w) wUseDefault(w, backingPixel, 0) +#define wBoundingShape(w) wUseDefault(w, boundingShape, NULL) +#define wClipShape(w) wUseDefault(w, clipShape, NULL) +#define wInputShape(w) wUseDefault(w, inputShape, NULL) +#define wClient(w) (clients[CLIENT_ID((w)->drawable.id)]) +#define wBorderWidth(w) ((int) (w)->borderWidth) + +/* true when w needs a border drawn. */ + +#define HasBorder(w) ((w)->borderWidth || wClipShape(w)) + +typedef struct _ScreenSaverStuff *ScreenSaverStuffPtr; + +#define SCREEN_IS_BLANKED 0 +#define SCREEN_ISNT_SAVED 1 +#define SCREEN_IS_TILED 2 +#define SCREEN_IS_BLACK 3 + +#define HasSaverWindow(pScreen) (pScreen->screensaver.pWindow != NullWindow) + +extern _X_EXPORT int screenIsSaved; + +#endif /* WINDOWSTRUCT_H */ diff --git a/include/xkb-config.h.in b/include/xkb-config.h.in new file mode 100644 index 0000000..d3cdd19 --- /dev/null +++ b/include/xkb-config.h.in @@ -0,0 +1,35 @@ +/* xkb-config.h.in: not at all generated. -*- c -*- + * + */ + +#ifndef _XKB_CONFIG_H_ +#define _XKB_CONFIG_H_ + +/* Default set of XKB rules. */ +#undef XKB_DFLT_RULES + +/* Default XKB model. */ +#undef XKB_DFLT_MODEL + +/* Default XKB layout. */ +#undef XKB_DFLT_LAYOUT + +/* Default XKB variant. */ +#undef XKB_DFLT_VARIANT + +/* Default XKB options. */ +#undef XKB_DFLT_OPTIONS + +/* Path to XKB definitions. */ +#undef XKB_BASE_DIRECTORY + +/* Path to xkbcomp. */ +#undef XKB_BIN_DIRECTORY + +/* XKB output dir for compiled keymaps. */ +#undef XKM_OUTPUT_DIR + +/* Do not have `strcasecmp'. */ +#undef NEED_STRCASECMP + +#endif /* _XKB_CONFIG_H_ */ diff --git a/include/xkbfile.h b/include/xkbfile.h new file mode 100644 index 0000000..a4b99ee --- /dev/null +++ b/include/xkbfile.h @@ -0,0 +1,310 @@ +/************************************************************ + Copyright (c) 1994 by Silicon Graphics Computer Systems, Inc. + + Permission to use, copy, modify, and distribute this + software and its documentation for any purpose and without + fee is hereby granted, provided that the above copyright + notice appear in all copies and that both that copyright + notice and this permission notice appear in supporting + documentation, and that the name of Silicon Graphics not be + used in advertising or publicity pertaining to distribution + of the software without specific prior written permission. + Silicon Graphics makes no representation about the suitability + of this software for any purpose. It is provided "as is" + without any express or implied warranty. + + SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS + SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY + AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON + GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL + DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, + DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE + OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH + THE USE OR PERFORMANCE OF THIS SOFTWARE. + + ********************************************************/ + +#ifndef _XKBFILE_H_ +#define _XKBFILE_H_ 1 + +#include "xkbstr.h" + +/***====================================================================***/ + +#define XkbXKMFile 0 +#define XkbCFile 1 +#define XkbXKBFile 2 +#define XkbMessage 3 + +#define XkbMapDefined (1<<0) +#define XkbStateDefined (1<<1) + +typedef void (*XkbFileAddOnFunc)( + FILE * /* file */, + XkbDescPtr /* result */, + Bool /* topLevel */, + Bool /* showImplicit */, + int /* fileSection */, + void * /* priv */ +); + +/***====================================================================***/ + +#define _XkbSuccess 0 +#define _XkbErrMissingNames 1 +#define _XkbErrMissingTypes 2 +#define _XkbErrMissingReqTypes 3 +#define _XkbErrMissingSymbols 4 +#define _XkbErrMissingVMods 5 +#define _XkbErrMissingIndicators 6 +#define _XkbErrMissingCompatMap 7 +#define _XkbErrMissingSymInterps 8 +#define _XkbErrMissingGeometry 9 +#define _XkbErrIllegalDoodad 10 +#define _XkbErrIllegalTOCType 11 +#define _XkbErrIllegalContents 12 +#define _XkbErrEmptyFile 13 +#define _XkbErrFileNotFound 14 +#define _XkbErrFileCannotOpen 15 +#define _XkbErrBadValue 16 +#define _XkbErrBadMatch 17 +#define _XkbErrBadTypeName 18 +#define _XkbErrBadTypeWidth 19 +#define _XkbErrBadFileType 20 +#define _XkbErrBadFileVersion 21 +#define _XkbErrBadFileFormat 22 +#define _XkbErrBadAlloc 23 +#define _XkbErrBadLength 24 +#define _XkbErrXReqFailure 25 +#define _XkbErrBadImplementation 26 + +/***====================================================================***/ + +_XFUNCPROTOBEGIN + +extern _X_EXPORT char * XkbIndentText( + unsigned /* size */ +); + +extern _X_EXPORT char * XkbAtomText( + Atom /* atm */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbKeysymText( + KeySym /* sym */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbStringText( + char * /* str */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbKeyNameText( + char * /* name */, + unsigned /* format */ +); + +extern _X_EXPORT char * +XkbModIndexText( + unsigned /* ndx */, + unsigned /* format */ +); + +extern _X_EXPORT char * +XkbModMaskText( + unsigned /* mask */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbVModIndexText( + XkbDescPtr /* xkb */, + unsigned /* ndx */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbVModMaskText( + XkbDescPtr /* xkb */, + unsigned /* modMask */, + unsigned /* mask */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbConfigText( + unsigned /* config */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbSIMatchText( + unsigned /* type */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbIMWhichStateMaskText( + unsigned /* use_which */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbControlsMaskText( + unsigned /* ctrls */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbGeomFPText( + int /* val */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbDoodadTypeText( + unsigned /* type */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbActionTypeText( + unsigned /* type */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbActionText( + XkbDescPtr /* xkb */, + XkbAction * /* action */, + unsigned /* format */ +); + +extern _X_EXPORT char * XkbBehaviorText( + XkbDescPtr /* xkb */, + XkbBehavior * /* behavior */, + unsigned /* format */ +); + +/***====================================================================***/ + +#define _XkbKSLower (1<<0) +#define _XkbKSUpper (1<<1) + +#define XkbKSIsLower(k) (_XkbKSCheckCase(k)&_XkbKSLower) +#define XkbKSIsUpper(k) (_XkbKSCheckCase(k)&_XkbKSUpper) +#define XkbKSIsKeypad(k) (((k)>=XK_KP_Space)&&((k)<=XK_KP_Equal)) +#define XkbKSIsDeadKey(k) \ + (((k)>=XK_dead_grave)&&((k)<=XK_dead_semivoiced_sound)) + +extern _X_EXPORT unsigned _XkbKSCheckCase( + KeySym /* sym */ +); + +extern _X_EXPORT int XkbFindKeycodeByName( + XkbDescPtr /* xkb */, + char * /* name */, + Bool /* use_aliases */ +); + +/***====================================================================***/ + +extern _X_EXPORT Atom XkbInternAtom( + char * /* name */, + Bool /* onlyIfExists */ +); + +/***====================================================================***/ + +#ifdef _XKBGEOM_H_ + +#define XkbDW_Unknown 0 +#define XkbDW_Doodad 1 +#define XkbDW_Section 2 +typedef struct _XkbDrawable { + int type; + int priority; + union { + XkbDoodadPtr doodad; + XkbSectionPtr section; + } u; + struct _XkbDrawable * next; +} XkbDrawableRec,*XkbDrawablePtr; + +#endif + +/***====================================================================***/ + +extern _X_EXPORT unsigned XkbConvertGetByNameComponents( + Bool /* toXkm */, + unsigned /* orig */ +); + +extern _X_EXPORT Bool XkbNameMatchesPattern( + char * /* name */, + char * /* pattern */ +); + +/***====================================================================***/ + +extern _X_EXPORT Bool XkbWriteXKBKeycodes( + FILE * /* file */, + XkbDescPtr /* result */, + Bool /* topLevel */, + Bool /* showImplicit */, + XkbFileAddOnFunc /* addOn */, + void * /* priv */ +); + +extern _X_EXPORT Bool XkbWriteXKBKeyTypes( + FILE * /* file */, + XkbDescPtr /* result */, + Bool /* topLevel */, + Bool /* showImplicit */, + XkbFileAddOnFunc /* addOn */, + void * /* priv */ +); + +extern _X_EXPORT Bool XkbWriteXKBCompatMap( + FILE * /* file */, + XkbDescPtr /* result */, + Bool /* topLevel */, + Bool /* showImplicit */, + XkbFileAddOnFunc /* addOn */, + void * /* priv */ +); + +extern _X_EXPORT Bool XkbWriteXKBSymbols( + FILE * /* file */, + XkbDescPtr /* result */, + Bool /* topLevel */, + Bool /* showImplicit */, + XkbFileAddOnFunc /* addOn */, + void * /* priv */ +); + +extern _X_EXPORT Bool XkbWriteXKBGeometry( + FILE * /* file */, + XkbDescPtr /* result */, + Bool /* topLevel */, + Bool /* showImplicit */, + XkbFileAddOnFunc /* addOn */, + void * /* priv */ +); + +extern _X_EXPORT Bool XkbWriteXKBKeymapForNames( + FILE * /* file */, + XkbComponentNamesPtr /* names */, + XkbDescPtr /* xkb */, + unsigned /* want */, + unsigned /* need */ +); + +/***====================================================================***/ + +extern _X_EXPORT Bool XkmProbe( + FILE * /* file */ +); + +extern _X_EXPORT unsigned XkmReadFile( + FILE * /* file */, + unsigned /* need */, + unsigned /* want */, + XkbDescPtr * /* result */ +); + +_XFUNCPROTOEND + +#endif /* _XKBFILE_H_ */ diff --git a/include/xkbrules.h b/include/xkbrules.h new file mode 100644 index 0000000..0f3f934 --- /dev/null +++ b/include/xkbrules.h @@ -0,0 +1,125 @@ +#ifndef _XKBRULES_H_ +#define _XKBRULES_H_ 1 + +/************************************************************ + Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. + + Permission to use, copy, modify, and distribute this + software and its documentation for any purpose and without + fee is hereby granted, provided that the above copyright + notice appear in all copies and that both that copyright + notice and this permission notice appear in supporting + documentation, and that the name of Silicon Graphics not be + used in advertising or publicity pertaining to distribution + of the software without specific prior written permission. + Silicon Graphics makes no representation about the suitability + of this software for any purpose. It is provided "as is" + without any express or implied warranty. + + SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS + SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY + AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON + GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL + DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, + DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE + OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH + THE USE OR PERFORMANCE OF THIS SOFTWARE. + + ********************************************************/ + +/***====================================================================***/ + +typedef struct _XkbRMLVOSet { + char * rules; + char * model; + char * layout; + char * variant; + char * options; +} XkbRMLVOSet; + +typedef struct _XkbRF_VarDefs { + char * model; + char * layout; + char * variant; + char * options; +} XkbRF_VarDefsRec,*XkbRF_VarDefsPtr; + +typedef struct _XkbRF_Rule { + int number; + int layout_num; + int variant_num; + char * model; + char * layout; + char * variant; + char * option; + /* yields */ + char * keycodes; + char * symbols; + char * types; + char * compat; + char * geometry; + unsigned flags; +} XkbRF_RuleRec,*XkbRF_RulePtr; + +typedef struct _XkbRF_Group { + int number; + char * name; + char * words; +} XkbRF_GroupRec, *XkbRF_GroupPtr; + +#define XkbRF_PendingMatch (1L<<1) +#define XkbRF_Option (1L<<2) +#define XkbRF_Append (1L<<3) +#define XkbRF_Normal (1L<<4) +#define XkbRF_Invalid (1L<<5) + +typedef struct _XkbRF_Rules { + unsigned short sz_rules; + unsigned short num_rules; + XkbRF_RulePtr rules; + unsigned short sz_groups; + unsigned short num_groups; + XkbRF_GroupPtr groups; +} XkbRF_RulesRec, *XkbRF_RulesPtr; + +/***====================================================================***/ + +_XFUNCPROTOBEGIN + +/* Seems preferable to dragging xkbstr.h in. */ +struct _XkbComponentNames; + +extern _X_EXPORT Bool XkbRF_GetComponents( + XkbRF_RulesPtr /* rules */, + XkbRF_VarDefsPtr /* var_defs */, + struct _XkbComponentNames * /* names */ +); + +extern _X_EXPORT Bool XkbRF_LoadRules( + FILE * /* file */, + XkbRF_RulesPtr /* rules */ +); + +extern _X_EXPORT Bool XkbRF_LoadRulesByName( + char * /* base */, + char * /* locale */, + XkbRF_RulesPtr /* rules */ +); + +/***====================================================================***/ + +extern _X_EXPORT XkbRF_RulesPtr XkbRF_Create(void); + +extern _X_EXPORT void XkbRF_Free( + XkbRF_RulesPtr /* rules */, + Bool /* freeRules */ +); + +/***====================================================================***/ + +#define _XKB_RF_NAMES_PROP_ATOM "_XKB_RULES_NAMES" +#define _XKB_RF_NAMES_PROP_MAXLEN 1024 + +_XFUNCPROTOEND + +#endif /* _XKBRULES_H_ */ diff --git a/include/xkbsrv.h b/include/xkbsrv.h new file mode 100644 index 0000000..34ef574 --- /dev/null +++ b/include/xkbsrv.h @@ -0,0 +1,991 @@ +/************************************************************ +Copyright (c) 1993 by Silicon Graphics Computer Systems, Inc. + +Permission to use, copy, modify, and distribute this +software and its documentation for any purpose and without +fee is hereby granted, provided that the above copyright +notice appear in all copies and that both that copyright +notice and this permission notice appear in supporting +documentation, and that the name of Silicon Graphics not be +used in advertising or publicity pertaining to distribution +of the software without specific prior written permission. +Silicon Graphics makes no representation about the suitability +of this software for any purpose. It is provided "as is" +without any express or implied warranty. + +SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef _XKBSRV_H_ +#define _XKBSRV_H_ + +#define XkbAllocClientMap SrvXkbAllocClientMap +#define XkbAllocServerMap SrvXkbAllocServerMap +#define XkbChangeTypesOfKey SrvXkbChangeTypesOfKey +#define XkbCopyKeyTypes SrvXkbCopyKeyTypes +#define XkbFreeClientMap SrvXkbFreeClientMap +#define XkbFreeServerMap SrvXkbFreeServerMap +#define XkbKeyTypesForCoreSymbols SrvXkbKeyTypesForCoreSymbols +#define XkbApplyCompatMapToKey SrvXkbApplyCompatMapToKey +#define XkbResizeKeyActions SrvXkbResizeKeyActions +#define XkbResizeKeySyms SrvXkbResizeKeySyms +#define XkbResizeKeyType SrvXkbResizeKeyType +#define XkbAllocCompatMap SrvXkbAllocCompatMap +#define XkbAllocControls SrvXkbAllocControls +#define XkbAllocIndicatorMaps SrvXkbAllocIndicatorMaps +#define XkbAllocKeyboard SrvXkbAllocKeyboard +#define XkbAllocNames SrvXkbAllocNames +#define XkbFreeCompatMap SrvXkbFreeCompatMap +#define XkbFreeKeyboard SrvXkbFreeKeyboard +#define XkbFreeNames SrvXkbFreeNames +#define XkbLatchModifiers SrvXkbLatchModifiers +#define XkbLatchGroup SrvXkbLatchGroup +#define XkbVirtualModsToReal SrvXkbVirtualModsToReal +#define XkbChangeKeycodeRange SrvXkbChangeKeycodeRange +#define XkbApplyVirtualModChanges SrvXkbApplyVirtualModChanges + +#include <X11/extensions/XKBproto.h> +#include "xkbstr.h" +#include "xkbrules.h" +#include "inputstr.h" +#include "events.h" + +typedef struct _XkbInterest { + DeviceIntPtr dev; + ClientPtr client; + XID resource; + struct _XkbInterest * next; + CARD16 extDevNotifyMask; + CARD16 stateNotifyMask; + CARD16 namesNotifyMask; + CARD32 ctrlsNotifyMask; + CARD8 compatNotifyMask; + BOOL bellNotifyMask; + BOOL actionMessageMask; + CARD16 accessXNotifyMask; + CARD32 iStateNotifyMask; + CARD32 iMapNotifyMask; + CARD16 altSymsNotifyMask; + CARD32 autoCtrls; + CARD32 autoCtrlValues; +} XkbInterestRec,*XkbInterestPtr; + +typedef struct _XkbRadioGroup { + CARD8 flags; + CARD8 nMembers; + CARD8 dfltDown; + CARD8 currentDown; + CARD8 members[XkbRGMaxMembers]; +} XkbRadioGroupRec, *XkbRadioGroupPtr; + +typedef struct _XkbEventCause { + CARD8 kc; + CARD8 event; + CARD8 mjr; + CARD8 mnr; + ClientPtr client; +} XkbEventCauseRec,*XkbEventCausePtr; +#define XkbSetCauseKey(c,k,e) { (c)->kc= (k),(c)->event= (e),\ + (c)->mjr= (c)->mnr= 0; \ + (c)->client= NULL; } +#define XkbSetCauseReq(c,j,n,cl) { (c)->kc= (c)->event= 0,\ + (c)->mjr= (j),(c)->mnr= (n);\ + (c)->client= (cl); } +#define XkbSetCauseCoreReq(c,e,cl) XkbSetCauseReq(c,e,0,cl) +#define XkbSetCauseXkbReq(c,e,cl) XkbSetCauseReq(c,XkbReqCode,e,cl) +#define XkbSetCauseUnknown(c) XkbSetCauseKey(c,0,0) + +#define _OFF_TIMER 0 +#define _KRG_WARN_TIMER 1 +#define _KRG_TIMER 2 +#define _SK_TIMEOUT_TIMER 3 +#define _ALL_TIMEOUT_TIMER 4 + +#define _BEEP_NONE 0 +#define _BEEP_FEATURE_ON 1 +#define _BEEP_FEATURE_OFF 2 +#define _BEEP_FEATURE_CHANGE 3 +#define _BEEP_SLOW_WARN 4 +#define _BEEP_SLOW_PRESS 5 +#define _BEEP_SLOW_ACCEPT 6 +#define _BEEP_SLOW_REJECT 7 +#define _BEEP_SLOW_RELEASE 8 +#define _BEEP_STICKY_LATCH 9 +#define _BEEP_STICKY_LOCK 10 +#define _BEEP_STICKY_UNLOCK 11 +#define _BEEP_LED_ON 12 +#define _BEEP_LED_OFF 13 +#define _BEEP_LED_CHANGE 14 +#define _BEEP_BOUNCE_REJECT 15 + +typedef struct _XkbFilter { + CARD16 keycode; + CARD8 what; + CARD8 active; + CARD8 filterOthers; + CARD32 priv; + XkbAction upAction; + int (*filter)( + struct _XkbSrvInfo* /* xkbi */, + struct _XkbFilter * /* filter */, + unsigned /* keycode */, + XkbAction * /* action */ + ); + struct _XkbFilter *next; +} XkbFilterRec,*XkbFilterPtr; + +typedef struct _XkbSrvInfo { + XkbStateRec prev_state; + XkbStateRec state; + XkbDescPtr desc; + + DeviceIntPtr device; + KbdCtrlProcPtr kbdProc; + + XkbRadioGroupPtr radioGroups; + CARD8 nRadioGroups; + CARD8 clearMods; + CARD8 setMods; + INT16 groupChange; + + CARD16 dfltPtrDelta; + + double mouseKeysCurve; + double mouseKeysCurveFactor; + INT16 mouseKeysDX; + INT16 mouseKeysDY; + CARD8 mouseKeysFlags; + Bool mouseKeysAccel; + CARD8 mouseKeysCounter; + + CARD8 lockedPtrButtons; + CARD8 shiftKeyCount; + KeyCode mouseKey; + KeyCode inactiveKey; + KeyCode slowKey; + KeyCode repeatKey; + CARD8 krgTimerActive; + CARD8 beepType; + CARD8 beepCount; + + CARD32 flags; + CARD32 lastPtrEventTime; + CARD32 lastShiftEventTime; + OsTimerPtr beepTimer; + OsTimerPtr mouseKeyTimer; + OsTimerPtr slowKeysTimer; + OsTimerPtr bounceKeysTimer; + OsTimerPtr repeatKeyTimer; + OsTimerPtr krgTimer; + + int szFilters; + XkbFilterPtr filters; +} XkbSrvInfoRec, *XkbSrvInfoPtr; + +#define XkbSLI_IsDefault (1L<<0) +#define XkbSLI_HasOwnState (1L<<1) + +typedef struct _XkbSrvLedInfo { + CARD16 flags; + CARD16 class; + CARD16 id; + union { + KbdFeedbackPtr kf; + LedFeedbackPtr lf; + } fb; + + CARD32 physIndicators; + CARD32 autoState; + CARD32 explicitState; + CARD32 effectiveState; + + CARD32 mapsPresent; + CARD32 namesPresent; + XkbIndicatorMapPtr maps; + Atom * names; + + CARD32 usesBase; + CARD32 usesLatched; + CARD32 usesLocked; + CARD32 usesEffective; + CARD32 usesCompat; + CARD32 usesControls; + + CARD32 usedComponents; +} XkbSrvLedInfoRec, *XkbSrvLedInfoPtr; + +/* + * Settings for xkbClientFlags field (used by DIX) + * These flags _must_ not overlap with XkbPCF_* + */ +#define _XkbClientInitialized (1<<15) + +#define _XkbWantsDetectableAutoRepeat(c)\ + ((c)->xkbClientFlags&XkbPCF_DetectableAutoRepeatMask) + +/* + * Settings for flags field + */ +#define _XkbStateNotifyInProgress (1<<0) + +typedef struct +{ + ProcessInputProc processInputProc; + /* If processInputProc is set to something different than realInputProc, + * UNWRAP and COND_WRAP will not touch processInputProc and update only + * realInputProc. This ensures that + * processInputProc == (frozen ? EnqueueEvent : realInputProc) + * + * WRAP_PROCESS_INPUT_PROC should only be called during initialization, + * since it may destroy this invariant. + */ + ProcessInputProc realInputProc; + DeviceUnwrapProc unwrapProc; +} xkbDeviceInfoRec, *xkbDeviceInfoPtr; + +#define WRAP_PROCESS_INPUT_PROC(device, oldprocs, proc, unwrapproc) \ + device->public.processInputProc = proc; \ + oldprocs->processInputProc = \ + oldprocs->realInputProc = device->public.realInputProc; \ + device->public.realInputProc = proc; \ + oldprocs->unwrapProc = device->unwrapProc; \ + device->unwrapProc = unwrapproc; + +#define COND_WRAP_PROCESS_INPUT_PROC(device, oldprocs, proc, unwrapproc) \ + if (device->public.processInputProc == device->public.realInputProc)\ + device->public.processInputProc = proc; \ + oldprocs->processInputProc = \ + oldprocs->realInputProc = device->public.realInputProc; \ + device->public.realInputProc = proc; \ + oldprocs->unwrapProc = device->unwrapProc; \ + device->unwrapProc = unwrapproc; + +#define UNWRAP_PROCESS_INPUT_PROC(device, oldprocs, backupproc) \ + backupproc = device->public.realInputProc; \ + if (device->public.processInputProc == device->public.realInputProc)\ + device->public.processInputProc = oldprocs->realInputProc; \ + device->public.realInputProc = oldprocs->realInputProc; \ + device->unwrapProc = oldprocs->unwrapProc; + +extern _X_EXPORT DevPrivateKeyRec xkbDevicePrivateKeyRec; +#define xkbDevicePrivateKey (&xkbDevicePrivateKeyRec) + +#define XKBDEVICEINFO(dev) ((xkbDeviceInfoPtr)dixLookupPrivate(&(dev)->devPrivates, xkbDevicePrivateKey)) + +extern void xkbUnwrapProc(DeviceIntPtr, DeviceHandleProc, pointer); + +/***====================================================================***/ + + +/***====================================================================***/ + +#define XkbAX_KRGMask (XkbSlowKeysMask|XkbBounceKeysMask) +#define XkbAllFilteredEventsMask \ + (XkbAccessXKeysMask|XkbRepeatKeysMask|XkbMouseKeysAccelMask|XkbAX_KRGMask) + +/***====================================================================***/ + +extern _X_EXPORT int XkbReqCode; +extern _X_EXPORT int XkbEventBase; +extern _X_EXPORT int XkbKeyboardErrorCode; +extern _X_EXPORT char * XkbBaseDirectory; +extern _X_EXPORT char * XkbBinDirectory; + +extern _X_EXPORT CARD32 xkbDebugFlags; + +#define _XkbLibError(c,l,d) /* Epoch fail */ +#define _XkbErrCode2(a,b) ((XID)((((unsigned int)(a))<<24)|((b)&0xffffff))) +#define _XkbErrCode3(a,b,c) _XkbErrCode2(a,(((unsigned int)(b))<<16)|(c)) +#define _XkbErrCode4(a,b,c,d) _XkbErrCode3(a,b,((((unsigned int)(c))<<8)|(d))) + +extern _X_EXPORT int DeviceKeyPress,DeviceKeyRelease,DeviceMotionNotify; +extern _X_EXPORT int DeviceButtonPress,DeviceButtonRelease; + +#define Status int + +extern _X_EXPORT void XkbUseMsg( + void +); + +extern _X_EXPORT int XkbProcessArguments( + int /* argc */, + char ** /* argv */, + int /* i */ +); + +extern _X_EXPORT Bool XkbInitPrivates(void); + +extern _X_EXPORT void XkbSetExtension(DeviceIntPtr device, ProcessInputProc proc); + +extern _X_EXPORT void XkbFreeCompatMap( + XkbDescPtr /* xkb */, + unsigned int /* which */, + Bool /* freeMap */ +); + +extern _X_EXPORT void XkbFreeNames( + XkbDescPtr /* xkb */, + unsigned int /* which */, + Bool /* freeMap */ +); + +extern _X_EXPORT int _XkbLookupAnyDevice( + DeviceIntPtr *pDev, + int id, + ClientPtr client, + Mask access_mode, + int *xkb_err +); + +extern _X_EXPORT int _XkbLookupKeyboard( + DeviceIntPtr *pDev, + int id, + ClientPtr client, + Mask access_mode, + int *xkb_err +); + +extern _X_EXPORT int _XkbLookupBellDevice( + DeviceIntPtr *pDev, + int id, + ClientPtr client, + Mask access_mode, + int *xkb_err +); + +extern _X_EXPORT int _XkbLookupLedDevice( + DeviceIntPtr *pDev, + int id, + ClientPtr client, + Mask access_mode, + int *xkb_err +); + +extern _X_EXPORT int _XkbLookupButtonDevice( + DeviceIntPtr *pDev, + int id, + ClientPtr client, + Mask access_mode, + int *xkb_err +); + +extern _X_EXPORT XkbDescPtr XkbAllocKeyboard( + void +); + +extern _X_EXPORT Status XkbAllocClientMap( + XkbDescPtr /* xkb */, + unsigned int /* which */, + unsigned int /* nTypes */ +); + +extern _X_EXPORT Status XkbAllocServerMap( + XkbDescPtr /* xkb */, + unsigned int /* which */, + unsigned int /* nNewActions */ +); + +extern _X_EXPORT void XkbFreeClientMap( + XkbDescPtr /* xkb */, + unsigned int /* what */, + Bool /* freeMap */ +); + +extern _X_EXPORT void XkbFreeServerMap( + XkbDescPtr /* xkb */, + unsigned int /* what */, + Bool /* freeMap */ +); + +extern _X_EXPORT Status XkbAllocIndicatorMaps( + XkbDescPtr /* xkb */ +); + +extern _X_EXPORT Status XkbAllocCompatMap( + XkbDescPtr /* xkb */, + unsigned int /* which */, + unsigned int /* nInterpret */ +); + +extern _X_EXPORT Status XkbAllocNames( + XkbDescPtr /* xkb */, + unsigned int /* which */, + int /* nTotalRG */, + int /* nTotalAliases */ +); + +extern _X_EXPORT Status XkbAllocControls( + XkbDescPtr /* xkb */, + unsigned int /* which*/ +); + +extern _X_EXPORT Status XkbCopyKeyTypes( + XkbKeyTypePtr /* from */, + XkbKeyTypePtr /* into */, + int /* num_types */ +); + +extern _X_EXPORT Status XkbResizeKeyType( + XkbDescPtr /* xkb */, + int /* type_ndx */, + int /* map_count */, + Bool /* want_preserve */, + int /* new_num_lvls */ +); + +extern _X_EXPORT void XkbFreeKeyboard( + XkbDescPtr /* xkb */, + unsigned int /* which */, + Bool /* freeDesc */ +); + +extern _X_EXPORT void XkbFreeComponentNames( + XkbComponentNamesPtr /* names */, + Bool /* freeNames */ +); + +extern _X_EXPORT void XkbSetActionKeyMods( + XkbDescPtr /* xkb */, + XkbAction * /* act */, + unsigned int /* mods */ +); + +extern _X_EXPORT unsigned int XkbMaskForVMask( + XkbDescPtr /* xkb */, + unsigned int /* vmask */ +); + +extern _X_EXPORT Bool XkbVirtualModsToReal( + XkbDescPtr /* xkb */, + unsigned int /* virtua_mask */, + unsigned int * /* mask_rtrn */ +); + +extern _X_EXPORT unsigned int XkbAdjustGroup( + int /* group */, + XkbControlsPtr /* ctrls */ +); + +extern _X_EXPORT KeySym *XkbResizeKeySyms( + XkbDescPtr /* xkb */, + int /* key */, + int /* needed */ +); + +extern _X_EXPORT XkbAction *XkbResizeKeyActions( + XkbDescPtr /* xkb */, + int /* key */, + int /* needed */ +); + +extern _X_EXPORT void XkbUpdateKeyTypesFromCore( + DeviceIntPtr /* pXDev */, + KeySymsPtr /* syms */, + KeyCode /* first */, + CARD8 /* num */, + XkbChangesPtr /* pChanges */ +); + +extern _X_EXPORT void XkbUpdateDescActions( + XkbDescPtr /* xkb */, + KeyCode /* first */, + CARD8 /* num */, + XkbChangesPtr /* changes */ +); + +extern _X_EXPORT void XkbUpdateActions( + DeviceIntPtr /* pXDev */, + KeyCode /* first */, + CARD8 /* num */, + XkbChangesPtr /* pChanges */, + unsigned int * /* needChecksRtrn */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT KeySymsPtr XkbGetCoreMap( + DeviceIntPtr /* keybd */ +); + +extern _X_EXPORT void XkbApplyMappingChange( + DeviceIntPtr /* pXDev */, + KeySymsPtr /* map */, + KeyCode /* firstKey */, + CARD8 /* num */, + CARD8 * /* modmap */, + ClientPtr /* client */ +); + +extern _X_EXPORT void XkbSetIndicators( + DeviceIntPtr /* pXDev */, + CARD32 /* affect */, + CARD32 /* values */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbUpdateIndicators( + DeviceIntPtr /* keybd */, + CARD32 /* changed */, + Bool /* check_edevs */, + XkbChangesPtr /* pChanges */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT XkbSrvLedInfoPtr XkbAllocSrvLedInfo( + DeviceIntPtr /* dev */, + KbdFeedbackPtr /* kf */, + LedFeedbackPtr /* lf */, + unsigned int /* needed_parts */ +); + +extern _X_EXPORT XkbSrvLedInfoPtr XkbCopySrvLedInfo( + DeviceIntPtr /* dev */, + XkbSrvLedInfoPtr /* src */, + KbdFeedbackPtr /* kf */, + LedFeedbackPtr /* lf */ +); + + +extern _X_EXPORT XkbSrvLedInfoPtr XkbFindSrvLedInfo( + DeviceIntPtr /* dev */, + unsigned int /* class */, + unsigned int /* id */, + unsigned int /* needed_parts */ +); + +extern _X_EXPORT void XkbApplyLedNameChanges( + DeviceIntPtr /* dev */, + XkbSrvLedInfoPtr /* sli */, + unsigned int /* changed_names */, + xkbExtensionDeviceNotify * /* ed */, + XkbChangesPtr /* changes */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbApplyLedMapChanges( + DeviceIntPtr /* dev */, + XkbSrvLedInfoPtr /* sli */, + unsigned int /* changed_maps */, + xkbExtensionDeviceNotify * /* ed */, + XkbChangesPtr /* changes */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbApplyLedStateChanges( + DeviceIntPtr /* dev */, + XkbSrvLedInfoPtr /* sli */, + unsigned int /* changed_leds */, + xkbExtensionDeviceNotify * /* ed */, + XkbChangesPtr /* changes */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbFlushLedEvents( + DeviceIntPtr /* dev */, + DeviceIntPtr /* kbd */, + XkbSrvLedInfoPtr /* sli */, + xkbExtensionDeviceNotify * /* ed */, + XkbChangesPtr /* changes */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT unsigned int XkbIndicatorsToUpdate( + DeviceIntPtr /* dev */, + unsigned long /* state_changes */, + Bool /* enabled_ctrl_changes */ +); + +extern _X_EXPORT void XkbComputeDerivedState( + XkbSrvInfoPtr /* xkbi */ +); + +extern _X_EXPORT void XkbCheckSecondaryEffects( + XkbSrvInfoPtr /* xkbi */, + unsigned int /* which */, + XkbChangesPtr /* changes */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbCheckIndicatorMaps( + DeviceIntPtr /* dev */, + XkbSrvLedInfoPtr /* sli */, + unsigned int /* which */ +); + +extern _X_EXPORT unsigned int XkbStateChangedFlags( + XkbStatePtr /* old */, + XkbStatePtr /* new */ +); + +extern _X_EXPORT void XkbSendStateNotify( + DeviceIntPtr /* kbd */, + xkbStateNotify * /* pSN */ +); + +extern _X_EXPORT void XkbSendMapNotify( + DeviceIntPtr /* kbd */, + xkbMapNotify * /* ev */ +); + +extern _X_EXPORT int XkbComputeControlsNotify( + DeviceIntPtr /* kbd */, + XkbControlsPtr /* old */, + XkbControlsPtr /* new */, + xkbControlsNotify * /* pCN */, + Bool /* forceCtrlProc */ +); + +extern _X_EXPORT void XkbSendControlsNotify( + DeviceIntPtr /* kbd */, + xkbControlsNotify * /* ev */ +); + +extern _X_EXPORT void XkbSendCompatMapNotify( + DeviceIntPtr /* kbd */, + xkbCompatMapNotify * /* ev */ +); + +extern _X_EXPORT void XkbHandleBell( + BOOL /* force */, + BOOL /* eventOnly */, + DeviceIntPtr /* kbd */, + CARD8 /* percent */, + pointer /* ctrl */, + CARD8 /* class */, + Atom /* name */, + WindowPtr /* pWin */, + ClientPtr /* pClient */ +); + +extern _X_EXPORT void XkbSendAccessXNotify( + DeviceIntPtr /* kbd */, + xkbAccessXNotify * /* pEv */ +); + +extern _X_EXPORT void XkbSendNamesNotify( + DeviceIntPtr /* kbd */, + xkbNamesNotify * /* ev */ +); + +extern _X_EXPORT void XkbSendActionMessage( + DeviceIntPtr /* kbd */, + xkbActionMessage * /* ev */ +); + +extern _X_EXPORT void XkbSendExtensionDeviceNotify( + DeviceIntPtr /* kbd */, + ClientPtr /* client */, + xkbExtensionDeviceNotify * /* ev */ +); + +extern _X_EXPORT void XkbSendNotification( + DeviceIntPtr /* kbd */, + XkbChangesPtr /* pChanges */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbProcessKeyboardEvent( + DeviceEvent* /* event */, + DeviceIntPtr /* keybd */ +); + +extern _X_EXPORT void XkbHandleActions( + DeviceIntPtr /* dev */, + DeviceIntPtr /* kbd */, + DeviceEvent* /* event */ +); + +extern _X_EXPORT Bool XkbEnableDisableControls( + XkbSrvInfoPtr /* xkbi */, + unsigned long /* change */, + unsigned long /* newValues */, + XkbChangesPtr /* changes */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void AccessXInit( + DeviceIntPtr /* dev */ +); + +extern _X_EXPORT Bool AccessXFilterPressEvent( + DeviceEvent* /* event */, + DeviceIntPtr /* keybd */ +); + +extern _X_EXPORT Bool AccessXFilterReleaseEvent( + DeviceEvent* /* event */, + DeviceIntPtr /* keybd */ +); + +extern _X_EXPORT void AccessXCancelRepeatKey( + XkbSrvInfoPtr /* xkbi */, + KeyCode /* key */ +); + +extern _X_EXPORT void AccessXComputeCurveFactor( + XkbSrvInfoPtr /* xkbi */, + XkbControlsPtr /* ctrls */ +); + +extern _X_EXPORT XkbInterestPtr XkbFindClientResource( + DevicePtr /* inDev */, + ClientPtr /* client */ +); + +extern _X_EXPORT XkbInterestPtr XkbAddClientResource( + DevicePtr /* inDev */, + ClientPtr /* client */, + XID /* id */ +); + +extern _X_EXPORT int XkbRemoveResourceClient( + DevicePtr /* inDev */, + XID /* id */ +); + +extern _X_EXPORT int XkbDDXAccessXBeep( + DeviceIntPtr /* dev */, + unsigned int /* what */, + unsigned int /* which */ +); + +extern _X_EXPORT int XkbDDXUsesSoftRepeat( + DeviceIntPtr /* dev */ +); + +extern _X_EXPORT void XkbDDXKeybdCtrlProc( + DeviceIntPtr /* dev */, + KeybdCtrl * /* ctrl */ +); + +extern _X_EXPORT void XkbDDXChangeControls( + DeviceIntPtr /* dev */, + XkbControlsPtr /* old */, + XkbControlsPtr /* new */ +); + +extern _X_EXPORT void XkbDDXUpdateDeviceIndicators( + DeviceIntPtr /* dev */, + XkbSrvLedInfoPtr /* sli */, + CARD32 /* newState */ +); + +extern _X_EXPORT int XkbDDXTerminateServer( + DeviceIntPtr /* dev */, + KeyCode /* key */, + XkbAction * /* act */ +); + +extern _X_EXPORT int XkbDDXSwitchScreen( + DeviceIntPtr /* dev */, + KeyCode /* key */, + XkbAction * /* act */ +); + +extern _X_EXPORT int XkbDDXPrivate( + DeviceIntPtr /* dev */, + KeyCode /* key */, + XkbAction * /* act */ +); + +extern _X_EXPORT void XkbDisableComputedAutoRepeats( + DeviceIntPtr /* pXDev */, + unsigned int /* key */ +); + +extern _X_EXPORT void XkbSetRepeatKeys( + DeviceIntPtr /* pXDev */, + int /* key */, + int /* onoff */ +); + +extern _X_EXPORT int XkbLatchModifiers( + DeviceIntPtr /* pXDev */, + CARD8 /* mask */, + CARD8 /* latches */ +); + +extern _X_EXPORT int XkbLatchGroup( + DeviceIntPtr /* pXDev */, + int /* group */ +); + +extern _X_EXPORT void XkbClearAllLatchesAndLocks( + DeviceIntPtr /* dev */, + XkbSrvInfoPtr /* xkbi */, + Bool /* genEv */, + XkbEventCausePtr /* cause */ +); + +extern _X_EXPORT void XkbGetRulesDflts( + XkbRMLVOSet * /* rmlvo */ +); + +extern _X_EXPORT void XkbFreeRMLVOSet( + XkbRMLVOSet * /* rmlvo */, + Bool /* freeRMLVO */ +); + +extern _X_EXPORT void XkbSetRulesDflts( + XkbRMLVOSet * /* rmlvo */ +); + +extern _X_EXPORT void XkbDeleteRulesDflts( + void +); + +extern _X_EXPORT int SProcXkbDispatch( + ClientPtr /* client */ +); + +extern _X_EXPORT XkbGeometryPtr XkbLookupNamedGeometry( + DeviceIntPtr /* dev */, + Atom /* name */, + Bool * /* shouldFree */ +); + +extern _X_EXPORT char * _XkbDupString( + const char * /* str */ +); + +extern _X_EXPORT void XkbConvertCase( + KeySym /* sym */, + KeySym * /* lower */, + KeySym * /* upper */ +); + +extern _X_EXPORT Status XkbChangeKeycodeRange( + XkbDescPtr /* xkb */, + int /* minKC */, + int /* maxKC */, + XkbChangesPtr /* changes */ +); + +extern _X_EXPORT void XkbFreeSrvLedInfo( + XkbSrvLedInfoPtr /* sli */ +); + +extern _X_EXPORT void XkbFreeInfo( + XkbSrvInfoPtr /* xkbi */ +); + +extern _X_EXPORT Status XkbChangeTypesOfKey( + XkbDescPtr /* xkb */, + int /* key */, + int /* nGroups */, + unsigned int /* groups */, + int * /* newTypesIn */, + XkbMapChangesPtr /* changes */ +); + +extern _X_EXPORT int XkbKeyTypesForCoreSymbols( + XkbDescPtr /* xkb */, + int /* map_width */, + KeySym * /* core_syms */, + unsigned int /* protected */, + int * /* types_inout */, + KeySym * /* xkb_syms_rtrn */ +); + +extern _X_EXPORT Bool XkbApplyCompatMapToKey( + XkbDescPtr /* xkb */, + KeyCode /* key */, + XkbChangesPtr /* changes */ +); + +extern _X_EXPORT Bool XkbApplyVirtualModChanges( + XkbDescPtr /* xkb */, + unsigned int /* changed */, + XkbChangesPtr /* changes */ +); + +extern _X_EXPORT void XkbSendNewKeyboardNotify( + DeviceIntPtr /* kbd */, + xkbNewKeyboardNotify * /* pNKN */ +); + +extern Bool XkbCopyKeymap( + XkbDescPtr /* dst */, + XkbDescPtr /* src */); + +extern _X_EXPORT Bool XkbCopyDeviceKeymap( + DeviceIntPtr /* dst */, + DeviceIntPtr /* src */); + +extern void XkbFilterEvents( + ClientPtr /* pClient */, + int /* nEvents */, + xEvent* /* xE */); + +extern int XkbGetEffectiveGroup( + XkbSrvInfoPtr /* xkbi */, + XkbStatePtr /* xkbstate */, + CARD8 /* keycode */); + +extern void XkbMergeLockedPtrBtns( + DeviceIntPtr /* master */); + +extern void XkbFakeDeviceButton( + DeviceIntPtr /* dev */, + int /* press */, + int /* button */); + + +#include "xkbfile.h" +#include "xkbrules.h" + +#define _XkbListKeycodes 0 +#define _XkbListTypes 1 +#define _XkbListCompat 2 +#define _XkbListSymbols 3 +#define _XkbListGeometry 4 +#define _XkbListNumComponents 5 + +typedef struct _XkbSrvListInfo { + int szPool; + int nPool; + char * pool; + + int maxRtrn; + int nTotal; + + char * pattern[_XkbListNumComponents]; + int nFound[_XkbListNumComponents]; +} XkbSrvListInfoRec,*XkbSrvListInfoPtr; + +extern _X_EXPORT Status XkbDDXList( + DeviceIntPtr /* dev */, + XkbSrvListInfoPtr /* listing */, + ClientPtr /* client */ +); + +extern _X_EXPORT unsigned int XkbDDXLoadKeymapByNames( + DeviceIntPtr /* keybd */, + XkbComponentNamesPtr /* names */, + unsigned int /* want */, + unsigned int /* need */, + XkbDescPtr * /* finfoRtrn */, + char * /* keymapNameRtrn */, + int /* keymapNameRtrnLen */ +); + +extern _X_EXPORT Bool XkbDDXNamesFromRules( + DeviceIntPtr /* keybd */, + char * /* rules */, + XkbRF_VarDefsPtr /* defs */, + XkbComponentNamesPtr /* names */ +); + +extern _X_EXPORT XkbDescPtr XkbCompileKeymap( + DeviceIntPtr /* dev */, + XkbRMLVOSet * /* rmlvo */ +); + +#endif /* _XKBSRV_H_ */ diff --git a/include/xkbstr.h b/include/xkbstr.h new file mode 100644 index 0000000..4afe010 --- /dev/null +++ b/include/xkbstr.h @@ -0,0 +1,633 @@ +/************************************************************ +Copyright (c) 1993 by Silicon Graphics Computer Systems, Inc. + +Permission to use, copy, modify, and distribute this +software and its documentation for any purpose and without +fee is hereby granted, provided that the above copyright +notice appear in all copies and that both that copyright +notice and this permission notice appear in supporting +documentation, and that the name of Silicon Graphics not be +used in advertising or publicity pertaining to distribution +of the software without specific prior written permission. +Silicon Graphics makes no representation about the suitability +of this software for any purpose. It is provided "as is" +without any express or implied warranty. + +SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +#ifndef _XKBSTR_H_ +#define _XKBSTR_H_ + +#include <X11/extensions/XKB.h> + +#define XkbCharToInt(v) ((int) ((v) & 0x80 ? ((v) | (~0xff)) : ((v) & 0x7f))) +#define XkbIntTo2Chars(i, h, l) ((h) = (i >> 8) & 0xff, (l) = (i) & 0xff) + +#if defined(WORD64) && defined(UNSIGNEDBITFIELDS) +#define Xkb2CharsToInt(h, l) ((int) ((h) & 0x80 ? \ + (((h) << 8) | (l) | (~0xffff)) : \ + (((h) << 8) | (l) & 0x7fff)) +#else +#define Xkb2CharsToInt(h,l) ((short)(((h)<<8)|(l))) +#endif + + /* + * Common data structures and access macros + */ + +typedef struct _XkbStateRec { + unsigned char group; /* base + latched + locked */ + /* FIXME: Why are base + latched short and not char?? */ + unsigned short base_group; /* physically ... down? */ + unsigned short latched_group; + unsigned char locked_group; + + unsigned char mods; /* base + latched + locked */ + unsigned char base_mods; /* physically down */ + unsigned char latched_mods; + unsigned char locked_mods; + + unsigned char compat_state; /* mods + group for core state */ + + /* grab mods = all depressed and latched mods, _not_ locked mods */ + unsigned char grab_mods; /* grab mods minus internal mods */ + unsigned char compat_grab_mods; /* grab mods + group for core state, + but not locked groups if + IgnoreGroupLocks set */ + + /* effective mods = all mods (depressed, latched, locked) */ + unsigned char lookup_mods; /* effective mods minus internal mods */ + unsigned char compat_lookup_mods; /* effective mods + group */ + + unsigned short ptr_buttons; /* core pointer buttons */ +} XkbStateRec,*XkbStatePtr; +#define XkbStateFieldFromRec(s) XkbBuildCoreState((s)->lookup_mods,(s)->group) +#define XkbGrabStateFromRec(s) XkbBuildCoreState((s)->grab_mods,(s)->group) + +typedef struct _XkbMods { + unsigned char mask; /* effective mods */ + unsigned char real_mods; + unsigned short vmods; +} XkbModsRec,*XkbModsPtr; + +typedef struct _XkbKTMapEntry { + Bool active; + unsigned char level; + XkbModsRec mods; +} XkbKTMapEntryRec,*XkbKTMapEntryPtr; + +typedef struct _XkbKeyType { + XkbModsRec mods; + unsigned char num_levels; + unsigned char map_count; + XkbKTMapEntryPtr map; + XkbModsPtr preserve; + Atom name; + Atom * level_names; +} XkbKeyTypeRec, *XkbKeyTypePtr; + +#define XkbNumGroups(g) ((g)&0x0f) +#define XkbOutOfRangeGroupInfo(g) ((g)&0xf0) +#define XkbOutOfRangeGroupAction(g) ((g)&0xc0) +#define XkbOutOfRangeGroupNumber(g) (((g)&0x30)>>4) +#define XkbSetGroupInfo(g, w, n) (((w) & 0xc0) | (((n) & 3) << 4) | \ + ((g) & 0x0f)) +#define XkbSetNumGroups(g,n) (((g)&0xf0)|((n)&0x0f)) + + /* + * Structures and access macros used primarily by the server + */ + +typedef struct _XkbBehavior { + unsigned char type; + unsigned char data; +} XkbBehavior; + +#define XkbAnyActionDataSize 7 +typedef struct _XkbAnyAction { + unsigned char type; + unsigned char data[XkbAnyActionDataSize]; +} XkbAnyAction; + +typedef struct _XkbModAction { + unsigned char type; + unsigned char flags; + unsigned char mask; + unsigned char real_mods; + /* FIXME: Make this an int. */ + unsigned char vmods1; + unsigned char vmods2; +} XkbModAction; +#define XkbModActionVMods(a) ((short) (((a)->vmods1 << 8) | (a)->vmods2)) +#define XkbSetModActionVMods(a,v) \ + ((a)->vmods1 = (((v) >> 8) & 0xff), \ + (a)->vmods2 = (v) & 0xff) + +typedef struct _XkbGroupAction { + unsigned char type; + unsigned char flags; + /* FIXME: Make this an int. */ + char group_XXX; +} XkbGroupAction; +#define XkbSAGroup(a) (XkbCharToInt((a)->group_XXX)) +#define XkbSASetGroup(a,g) ((a)->group_XXX=(g)) + +typedef struct _XkbISOAction { + unsigned char type; + unsigned char flags; + unsigned char mask; + unsigned char real_mods; + /* FIXME: Make this an int. */ + char group_XXX; + unsigned char affect; + unsigned char vmods1; + unsigned char vmods2; +} XkbISOAction; + +typedef struct _XkbPtrAction { + unsigned char type; + unsigned char flags; + /* FIXME: Make this an int. */ + unsigned char high_XXX; + unsigned char low_XXX; + unsigned char high_YYY; + unsigned char low_YYY; +} XkbPtrAction; +#define XkbPtrActionX(a) (Xkb2CharsToInt((a)->high_XXX,(a)->low_XXX)) +#define XkbPtrActionY(a) (Xkb2CharsToInt((a)->high_YYY,(a)->low_YYY)) +#define XkbSetPtrActionX(a,x) (XkbIntTo2Chars(x,(a)->high_XXX,(a)->low_XXX)) +#define XkbSetPtrActionY(a,y) (XkbIntTo2Chars(y,(a)->high_YYY,(a)->low_YYY)) + +typedef struct _XkbPtrBtnAction { + unsigned char type; + unsigned char flags; + unsigned char count; + unsigned char button; +} XkbPtrBtnAction; + +typedef struct _XkbPtrDfltAction { + unsigned char type; + unsigned char flags; + unsigned char affect; + char valueXXX; +} XkbPtrDfltAction; +#define XkbSAPtrDfltValue(a) (XkbCharToInt((a)->valueXXX)) +#define XkbSASetPtrDfltValue(a, c) ((a)->valueXXX = (c) & 0xff) + +typedef struct _XkbSwitchScreenAction { + unsigned char type; + unsigned char flags; + char screenXXX; +} XkbSwitchScreenAction; +#define XkbSAScreen(a) (XkbCharToInt((a)->screenXXX)) +#define XkbSASetScreen(a, s) ((a)->screenXXX = (s) & 0xff) + +typedef struct _XkbCtrlsAction { + unsigned char type; + unsigned char flags; + /* FIXME: Make this an int. */ + unsigned char ctrls3; + unsigned char ctrls2; + unsigned char ctrls1; + unsigned char ctrls0; +} XkbCtrlsAction; +#define XkbActionSetCtrls(a, c) ((a)->ctrls3 = ((c) >> 24) & 0xff, \ + (a)->ctrls2 = ((c) >> 16) & 0xff, \ + (a)->ctrls1 = ((c) >> 8) & 0xff, \ + (a)->ctrls0 = (c) & 0xff) +#define XkbActionCtrls(a) ((((unsigned int)(a)->ctrls3)<<24)|\ + (((unsigned int)(a)->ctrls2)<<16)|\ + (((unsigned int)(a)->ctrls1)<<8)|\ + ((unsigned int) (a)->ctrls0)) + +typedef struct _XkbMessageAction { + unsigned char type; + unsigned char flags; + unsigned char message[6]; +} XkbMessageAction; + +typedef struct _XkbRedirectKeyAction { + unsigned char type; + unsigned char new_key; + unsigned char mods_mask; + unsigned char mods; + /* FIXME: Make this an int. */ + unsigned char vmods_mask0; + unsigned char vmods_mask1; + unsigned char vmods0; + unsigned char vmods1; +} XkbRedirectKeyAction; + +#define XkbSARedirectVMods(a) ((((unsigned int)(a)->vmods1)<<8)|\ + ((unsigned int)(a)->vmods0)) +/* FIXME: This is blatantly not setting vmods. Yeesh. */ +#define XkbSARedirectSetVMods(a,m) (((a)->vmods_mask1=(((m)>>8)&0xff)),\ + ((a)->vmods_mask0=((m)&0xff))) +#define XkbSARedirectVModsMask(a) ((((unsigned int)(a)->vmods_mask1)<<8)|\ + ((unsigned int)(a)->vmods_mask0)) +#define XkbSARedirectSetVModsMask(a,m) (((a)->vmods_mask1=(((m)>>8)&0xff)),\ + ((a)->vmods_mask0=((m)&0xff))) + +typedef struct _XkbDeviceBtnAction { + unsigned char type; + unsigned char flags; + unsigned char count; + unsigned char button; + unsigned char device; +} XkbDeviceBtnAction; + +typedef struct _XkbDeviceValuatorAction { + unsigned char type; + unsigned char device; + unsigned char v1_what; + unsigned char v1_ndx; + unsigned char v1_value; + unsigned char v2_what; + unsigned char v2_ndx; + unsigned char v2_value; +} XkbDeviceValuatorAction; + +typedef union _XkbAction { + XkbAnyAction any; + XkbModAction mods; + XkbGroupAction group; + XkbISOAction iso; + XkbPtrAction ptr; + XkbPtrBtnAction btn; + XkbPtrDfltAction dflt; + XkbSwitchScreenAction screen; + XkbCtrlsAction ctrls; + XkbMessageAction msg; + XkbRedirectKeyAction redirect; + XkbDeviceBtnAction devbtn; + XkbDeviceValuatorAction devval; + unsigned char type; +} XkbAction; + +typedef struct _XkbControls { + unsigned char mk_dflt_btn; + unsigned char num_groups; + unsigned char groups_wrap; + XkbModsRec internal; + XkbModsRec ignore_lock; + unsigned int enabled_ctrls; + unsigned short repeat_delay; + unsigned short repeat_interval; + unsigned short slow_keys_delay; + unsigned short debounce_delay; + unsigned short mk_delay; + unsigned short mk_interval; + unsigned short mk_time_to_max; + unsigned short mk_max_speed; + short mk_curve; + unsigned short ax_options; + unsigned short ax_timeout; + unsigned short axt_opts_mask; + unsigned short axt_opts_values; + unsigned int axt_ctrls_mask; + unsigned int axt_ctrls_values; + unsigned char per_key_repeat[XkbPerKeyBitArraySize]; +} XkbControlsRec, *XkbControlsPtr; + +#define XkbAX_AnyFeedback(c) ((c)->enabled_ctrls&XkbAccessXFeedbackMask) +#define XkbAX_NeedOption(c,w) ((c)->ax_options&(w)) +#define XkbAX_NeedFeedback(c, w) (XkbAX_AnyFeedback((c)) && \ + XkbAX_NeedOption((c), (w))) + +typedef struct _XkbServerMapRec { + unsigned short num_acts; + unsigned short size_acts; + XkbAction *acts; + + XkbBehavior *behaviors; + unsigned short *key_acts; +#if defined(__cplusplus) || defined(c_plusplus) + /* explicit is a C++ reserved word */ + unsigned char *c_explicit; +#else + unsigned char *explicit; +#endif + unsigned char vmods[XkbNumVirtualMods]; + unsigned short *vmodmap; +} XkbServerMapRec, *XkbServerMapPtr; + +#define XkbSMKeyActionsPtr(m, k) (&(m)->acts[(m)->key_acts[(k)]]) + + /* + * Structures and access macros used primarily by clients + */ + +typedef struct _XkbSymMapRec { + unsigned char kt_index[XkbNumKbdGroups]; + unsigned char group_info; + unsigned char width; + unsigned short offset; +} XkbSymMapRec, *XkbSymMapPtr; + +typedef struct _XkbClientMapRec { + unsigned char size_types; + unsigned char num_types; + XkbKeyTypePtr types; + + unsigned short size_syms; + unsigned short num_syms; + KeySym *syms; + XkbSymMapPtr key_sym_map; + + unsigned char *modmap; +} XkbClientMapRec, *XkbClientMapPtr; + +#define XkbCMKeyGroupInfo(m, k) ((m)->key_sym_map[(k)].group_info) +#define XkbCMKeyNumGroups(m, k) (XkbNumGroups((m)->key_sym_map[(k)].group_info)) +#define XkbCMKeyGroupWidth(m, k, g) (XkbCMKeyType((m), (k), (g))->num_levels) +#define XkbCMKeyGroupsWidth(m, k) ((m)->key_sym_map[(k)].width) +#define XkbCMKeyTypeIndex(m, k, g) ((m)->key_sym_map[(k)].kt_index[(g) & 0x3]) +#define XkbCMKeyType(m, k, g) (&(m)->types[XkbCMKeyTypeIndex((m), (k), (g))]) +#define XkbCMKeyNumSyms(m, k) (XkbCMKeyGroupsWidth((m), (k)) * \ + XkbCMKeyNumGroups((m), (k))) +#define XkbCMKeySymsOffset(m, k) ((m)->key_sym_map[(k)].offset) +#define XkbCMKeySymsPtr(m, k) (&(m)->syms[XkbCMKeySymsOffset((m), (k))]) + + /* + * Compatibility structures and access macros + */ + +typedef struct _XkbSymInterpretRec { + KeySym sym; + unsigned char flags; + unsigned char match; + unsigned char mods; + unsigned char virtual_mod; + XkbAnyAction act; +} XkbSymInterpretRec,*XkbSymInterpretPtr; + +typedef struct _XkbCompatMapRec { + XkbSymInterpretPtr sym_interpret; + XkbModsRec groups[XkbNumKbdGroups]; + unsigned short num_si; + unsigned short size_si; +} XkbCompatMapRec, *XkbCompatMapPtr; + +typedef struct _XkbIndicatorMapRec { + unsigned char flags; + /* FIXME: For some reason, interepretation of groups is wildly + * different between which being base/latched/locked. */ + unsigned char which_groups; + unsigned char groups; + unsigned char which_mods; + XkbModsRec mods; + unsigned int ctrls; +} XkbIndicatorMapRec, *XkbIndicatorMapPtr; + +#define XkbIM_IsAuto(i) (!((i)->flags & XkbIM_NoAutomatic) && \ + (((i)->which_groups&&(i)->groups)||\ + ((i)->which_mods&&(i)->mods.mask)||\ + (i)->ctrls)) +#define XkbIM_InUse(i) ((i)->flags || (i)->which_groups || (i)->which_mods || \ + (i)->ctrls) + + +typedef struct _XkbIndicatorRec { + unsigned long phys_indicators; + XkbIndicatorMapRec maps[XkbNumIndicators]; +} XkbIndicatorRec,*XkbIndicatorPtr; + +typedef struct _XkbKeyNameRec { + char name[XkbKeyNameLength]; +} XkbKeyNameRec,*XkbKeyNamePtr; + +typedef struct _XkbKeyAliasRec { + char real[XkbKeyNameLength]; + char alias[XkbKeyNameLength]; +} XkbKeyAliasRec,*XkbKeyAliasPtr; + + /* + * Names for everything + */ +typedef struct _XkbNamesRec { + Atom keycodes; + Atom geometry; + Atom symbols; + Atom types; + Atom compat; + Atom vmods[XkbNumVirtualMods]; + Atom indicators[XkbNumIndicators]; + Atom groups[XkbNumKbdGroups]; + XkbKeyNamePtr keys; + XkbKeyAliasPtr key_aliases; + Atom *radio_groups; + Atom phys_symbols; + + unsigned char num_keys; + unsigned char num_key_aliases; + unsigned short num_rg; +} XkbNamesRec,*XkbNamesPtr; + +typedef struct _XkbGeometry *XkbGeometryPtr; + /* + * Tie it all together into one big keyboard description + */ +typedef struct _XkbDesc { + unsigned int defined; + unsigned short flags; + unsigned short device_spec; + KeyCode min_key_code; + KeyCode max_key_code; + + XkbControlsPtr ctrls; + XkbServerMapPtr server; + XkbClientMapPtr map; + XkbIndicatorPtr indicators; + XkbNamesPtr names; + XkbCompatMapPtr compat; + XkbGeometryPtr geom; +} XkbDescRec, *XkbDescPtr; +#define XkbKeyKeyTypeIndex(d, k, g) (XkbCMKeyTypeIndex((d)->map, (k), (g))) +#define XkbKeyKeyType(d, k, g) (XkbCMKeyType((d)->map, (k), (g))) +#define XkbKeyGroupWidth(d, k, g) (XkbCMKeyGroupWidth((d)->map, (k), (g))) +#define XkbKeyGroupsWidth(d, k) (XkbCMKeyGroupsWidth((d)->map, (k))) +#define XkbKeyGroupInfo(d,k) (XkbCMKeyGroupInfo((d)->map,(k))) +#define XkbKeyNumGroups(d,k) (XkbCMKeyNumGroups((d)->map,(k))) +#define XkbKeyNumSyms(d,k) (XkbCMKeyNumSyms((d)->map,(k))) +#define XkbKeySymsPtr(d,k) (XkbCMKeySymsPtr((d)->map,(k))) +#define XkbKeySym(d, k, n) (XkbKeySymsPtr((d), (k))[(n)]) +#define XkbKeySymEntry(d,k,sl,g) \ + (XkbKeySym((d), (k), (XkbKeyGroupsWidth((d), (k)) * (g)) + (sl))) +#define XkbKeyAction(d,k,n) \ + (XkbKeyHasActions((d), (k)) ? & XkbKeyActionsPtr((d), (k))[(n)] : NULL) +#define XkbKeyActionEntry(d,k,sl,g) \ + (XkbKeyHasActions((d), (k)) ? \ + XkbKeyAction((d), (k), ((XkbKeyGroupsWidth((d), (k)) * (g)) + (sl))) : \ + NULL) + +#define XkbKeyHasActions(d, k) (!!(d)->server->key_acts[(k)]) +#define XkbKeyNumActions(d, k) (XkbKeyHasActions((d), (k)) ? \ + XkbKeyNumSyms((d), (k)) : 1) +#define XkbKeyActionsPtr(d, k) (XkbSMKeyActionsPtr((d)->server, (k))) +#define XkbKeycodeInRange(d, k) ((k) >= (d)->min_key_code && \ + (k) <= (d)->max_key_code) +#define XkbNumKeys(d) ((d)->max_key_code-(d)->min_key_code+1) + + + /* + * The following structures can be used to track changes + * to a keyboard device + */ +typedef struct _XkbMapChanges { + unsigned short changed; + KeyCode min_key_code; + KeyCode max_key_code; + unsigned char first_type; + unsigned char num_types; + KeyCode first_key_sym; + unsigned char num_key_syms; + KeyCode first_key_act; + unsigned char num_key_acts; + KeyCode first_key_behavior; + unsigned char num_key_behaviors; + KeyCode first_key_explicit; + unsigned char num_key_explicit; + KeyCode first_modmap_key; + unsigned char num_modmap_keys; + KeyCode first_vmodmap_key; + unsigned char num_vmodmap_keys; + unsigned char pad; + unsigned short vmods; +} XkbMapChangesRec,*XkbMapChangesPtr; + +typedef struct _XkbControlsChanges { + unsigned int changed_ctrls; + unsigned int enabled_ctrls_changes; + Bool num_groups_changed; +} XkbControlsChangesRec,*XkbControlsChangesPtr; + +typedef struct _XkbIndicatorChanges { + unsigned int state_changes; + unsigned int map_changes; +} XkbIndicatorChangesRec,*XkbIndicatorChangesPtr; + +typedef struct _XkbNameChanges { + unsigned int changed; + unsigned char first_type; + unsigned char num_types; + unsigned char first_lvl; + unsigned char num_lvls; + unsigned char num_aliases; + unsigned char num_rg; + unsigned char first_key; + unsigned char num_keys; + unsigned short changed_vmods; + unsigned long changed_indicators; + unsigned char changed_groups; +} XkbNameChangesRec,*XkbNameChangesPtr; + +typedef struct _XkbCompatChanges { + unsigned char changed_groups; + unsigned short first_si; + unsigned short num_si; +} XkbCompatChangesRec,*XkbCompatChangesPtr; + +typedef struct _XkbChanges { + unsigned short device_spec; + unsigned short state_changes; + XkbMapChangesRec map; + XkbControlsChangesRec ctrls; + XkbIndicatorChangesRec indicators; + XkbNameChangesRec names; + XkbCompatChangesRec compat; +} XkbChangesRec, *XkbChangesPtr; + + /* + * These data structures are used to construct a keymap from + * a set of components or to list components in the server + * database. + */ +typedef struct _XkbComponentNames { + char * keycodes; + char * types; + char * compat; + char * symbols; + char * geometry; +} XkbComponentNamesRec, *XkbComponentNamesPtr; + +typedef struct _XkbComponentName { + unsigned short flags; + char * name; +} XkbComponentNameRec,*XkbComponentNamePtr; + +typedef struct _XkbComponentList { + int num_keymaps; + int num_keycodes; + int num_types; + int num_compat; + int num_symbols; + int num_geometry; + XkbComponentNamePtr keymaps; + XkbComponentNamePtr keycodes; + XkbComponentNamePtr types; + XkbComponentNamePtr compat; + XkbComponentNamePtr symbols; + XkbComponentNamePtr geometry; +} XkbComponentListRec, *XkbComponentListPtr; + + /* + * The following data structures describe and track changes to a + * non-keyboard extension device + */ +typedef struct _XkbDeviceLedInfo { + unsigned short led_class; + unsigned short led_id; + unsigned int phys_indicators; + unsigned int maps_present; + unsigned int names_present; + unsigned int state; + Atom names[XkbNumIndicators]; + XkbIndicatorMapRec maps[XkbNumIndicators]; +} XkbDeviceLedInfoRec,*XkbDeviceLedInfoPtr; + +typedef struct _XkbDeviceInfo { + char * name; + Atom type; + unsigned short device_spec; + Bool has_own_state; + unsigned short supported; + unsigned short unsupported; + + unsigned short num_btns; + XkbAction * btn_acts; + + unsigned short sz_leds; + unsigned short num_leds; + unsigned short dflt_kbd_fb; + unsigned short dflt_led_fb; + XkbDeviceLedInfoPtr leds; +} XkbDeviceInfoRec,*XkbDeviceInfoPtr; + +#define XkbXI_DevHasBtnActs(d) ((d)->num_btns > 0 && (d)->btn_acts) +#define XkbXI_LegalDevBtn(d,b) (XkbXI_DevHasBtnActs(d) && (b) < (d)->num_btns) +#define XkbXI_DevHasLeds(d) ((d)->num_leds > 0 && (d)->leds) + +typedef struct _XkbDeviceLedChanges { + unsigned short led_class; + unsigned short led_id; + unsigned int defined; /* names or maps changed */ + struct _XkbDeviceLedChanges *next; +} XkbDeviceLedChangesRec,*XkbDeviceLedChangesPtr; + +typedef struct _XkbDeviceChanges { + unsigned int changed; + unsigned short first_btn; + unsigned short num_btns; + XkbDeviceLedChangesRec leds; +} XkbDeviceChangesRec,*XkbDeviceChangesPtr; + +#endif /* _XKBSTR_H_ */ diff --git a/include/xorg-config.h.in b/include/xorg-config.h.in new file mode 100644 index 0000000..56ffda2 --- /dev/null +++ b/include/xorg-config.h.in @@ -0,0 +1,145 @@ +/* xorg-config.h.in: not at all generated. -*- c -*- + * + * This file differs from xorg-server.h.in in that -server is installed + * with the rest of the SDK for external drivers/modules to use, whereas + * -config is for internal use only (i.e. building the DDX). + * + */ + +#ifndef _XORG_CONFIG_H_ +#define _XORG_CONFIG_H_ + +#include <dix-config.h> +#include <xkb-config.h> + +/* Building Xorg server. */ +#undef XORGSERVER + +/* Current X.Org version. */ +#undef XORG_VERSION_CURRENT + +/* Name of X server. */ +#undef __XSERVERNAME__ + +/* URL to go to for support. */ +#undef __VENDORDWEBSUPPORT__ + +/* Built-in output drivers. */ +#undef DRIVERS + +/* Built-in input drivers. */ +#undef IDRIVERS + +/* Path to configuration file. */ +#undef XF86CONFIGFILE + +/* Path to configuration file. */ +#undef __XCONFIGFILE__ + +/* Name of configuration directory. */ +#undef __XCONFIGDIR__ + +/* Path to loadable modules. */ +#undef DEFAULT_MODULE_PATH + +/* Path to installed libraries. */ +#undef DEFAULT_LIBRARY_PATH + +/* Path to server log file. */ +#undef DEFAULT_LOGPREFIX + +/* Building DRI-capable DDX. */ +#undef XF86DRI + +/* Build DRI2 extension */ +#undef DRI2 + +/* Define to 1 if you have the <stropts.h> header file. */ +#undef HAVE_STROPTS_H + +/* Define to 1 if you have the <sys/kd.h> header file. */ +#undef HAVE_SYS_KD_H + +/* Define to 1 if you have the <sys/vt.h> header file. */ +#undef HAVE_SYS_VT_H + +/* Define to 1 if you have the `walkcontext' function (used on Solaris for + xorg_backtrace in hw/xfree86/common/xf86Events.c */ +#undef HAVE_WALKCONTEXT + +/* Define to 1 if unsigned long is 64 bits. */ +#undef _XSERVER64 + +/* Building vgahw module */ +#undef WITH_VGAHW + +/* Define to 1 if NetBSD built-in MTRR support is available */ +#undef HAS_MTRR_BUILTIN + +/* Define to 1 if BSD MTRR support is available */ +#undef HAS_MTRR_SUPPORT + +/* NetBSD PIO alpha IO */ +#undef USE_ALPHA_PIO + +/* BSD AMD64 iopl */ +#undef USE_AMD64_IOPL + +/* BSD /dev/io */ +#undef USE_DEV_IO + +/* BSD i386 iopl */ +#undef USE_I386_IOPL + +/* System is BSD-like */ +#undef CSRG_BASED + +/* System has PC console */ +#undef PCCONS_SUPPORT + +/* System has PCVT console */ +#undef PCVT_SUPPORT + +/* System has syscons console */ +#undef SYSCONS_SUPPORT + +/* System has wscons console */ +#undef WSCONS_SUPPORT + +/* System has /dev/xf86 aperture driver */ +#undef HAS_APERTURE_DRV + +/* Has backtrace support */ +#undef HAVE_BACKTRACE + +/* Name of the period field in struct kbd_repeat */ +#undef LNX_KBD_PERIOD_NAME + +/* Have execinfo.h */ +#undef HAVE_EXECINFO_H + +/* Have pci_system_init_dev_mem() */ +#undef HAVE_PCI_SYSTEM_INIT_DEV_MEM + +/* Define to 1 if you have the `pci_device_is_boot_vga' function. */ +#undef HAVE_PCI_DEVICE_IS_BOOT_VGA + +/* Have pci_enable_device */ +#undef HAVE_PCI_DEVICE_ENABLE + +/* Define to 1 if you have the `pci_device_vgaarb_init' function. */ +#undef HAVE_PCI_DEVICE_VGAARB_INIT + +/* Path to text files containing PCI IDs */ +#undef PCI_TXT_IDS_PATH + +/* Use SIGIO handlers for input device events by default */ +#undef USE_SIGIO_BY_DEFAULT + +/* Support PC98 */ +#undef SUPPORT_PC98 + +/* Build with libdrm support */ +#undef WITH_LIBDRM + +#endif /* _XORG_CONFIG_H_ */ diff --git a/include/xorg-server.h.in b/include/xorg-server.h.in new file mode 100644 index 0000000..b10b994 --- /dev/null +++ b/include/xorg-server.h.in @@ -0,0 +1,191 @@ +/* xorg-server.h.in -*- c -*- + * + * This file is the template file for the xorg-server.h file which gets + * installed as part of the SDK. The #defines in this file overlap + * with those from config.h, but only for those options that we want + * to export to external modules. Boilerplate autotool #defines such + * as HAVE_STUFF and PACKAGE_NAME is kept in config.h + * + * It is still possible to update config.h.in using autoheader, since + * autoheader only creates a .h.in file for the first + * AM_CONFIG_HEADER() line, and thus does not overwrite this file. + * + * However, it should be kept in sync with this file. + */ + +#ifndef _XORG_SERVER_H_ +#define _XORG_SERVER_H_ + +/* Support BigRequests extension */ +#undef BIGREQS + +/* Default font path */ +#undef COMPILEDDEFAULTFONTPATH + +/* Support Composite Extension */ +#undef COMPOSITE + +/* Build DPMS extension */ +#undef DPMSExtension + +/* Build GLX extension */ +#undef GLXEXT + +/* Support XDM-AUTH*-1 */ +#undef HASXDMAUTH + +/* Support SHM */ +#undef HAS_SHM + +/* Support IPv6 for TCP connections */ +#undef IPv6 + +/* Support MIT-SHM Extension */ +#undef MITSHM + +/* Internal define for Xinerama */ +#undef PANORAMIX + +/* Support RANDR extension */ +#undef RANDR + +/* Support RENDER extension */ +#undef RENDER + +/* Support X resource extension */ +#undef RES + +/* Support MIT-SCREEN-SAVER extension */ +#undef SCREENSAVER + +/* Support SHAPE extension */ +#undef SHAPE + +/* Define to 1 on systems derived from System V Release 4 */ +#undef SVR4 + +/* Support TCP socket connections */ +#undef TCPCONN + +/* Enable touchscreen support */ +#undef TOUCHSCREEN + +/* Support tslib touchscreen abstraction library */ +#undef TSLIB + +/* Support UNIX socket connections */ +#undef UNIXCONN + +/* unaligned word accesses behave as expected */ +#undef WORKING_UNALIGNED_INT + +/* Support XCMisc extension */ +#undef XCMISC + +/* Support Xdmcp */ +#undef XDMCP + +/* Build XFree86 BigFont extension */ +#undef XF86BIGFONT + +/* Support XFree86 Video Mode extension */ +#undef XF86VIDMODE + +/* Build XDGA support */ +#undef XFreeXDGA + +/* Support Xinerama extension */ +#undef XINERAMA + +/* Support X Input extension */ +#undef XINPUT + +/* XKB default rules */ +#undef XKB_DFLT_RULES + +/* Support loadable input and output drivers */ +#undef XLOADABLE + +/* Build DRI extension */ +#undef XF86DRI + +/* Build DRI2 extension */ +#undef DRI2 + +/* Build Xorg server */ +#undef XORGSERVER + +/* Vendor release */ +#undef XORG_RELEASE + +/* Current Xorg version */ +#undef XORG_VERSION_CURRENT + +/* Build Xv Extension */ +#undef XvExtension + +/* Build XvMC Extension */ +#undef XvMCExtension + +/* Support XSync extension */ +#undef XSYNC + +/* Support XTest extension */ +#undef XTEST + +/* Support Xv Extension */ +#undef XV + +/* Vendor name */ +#undef XVENDORNAME + +/* BSD-compliant source */ +#undef _BSD_SOURCE + +/* POSIX-compliant source */ +#undef _POSIX_SOURCE + +/* X/Open-compliant source */ +#undef _XOPEN_SOURCE + +/* Vendor web address for support */ +#undef __VENDORDWEBSUPPORT__ + +/* Location of configuration file */ +#undef __XCONFIGFILE__ + +/* Name of X server */ +#undef __XSERVERNAME__ + +/* Building vgahw module */ +#undef WITH_VGAHW + +/* System is BSD-like */ +#undef CSRG_BASED + +/* System has PC console */ +#undef PCCONS_SUPPORT + +/* System has PCVT console */ +#undef PCVT_SUPPORT + +/* System has syscons console */ +#undef SYSCONS_SUPPORT + +/* System has wscons console */ +#undef WSCONS_SUPPORT + +/* Loadable XFree86 server awesomeness */ +#undef XFree86LOADER + +/* Use libpciaccess */ +#undef XSERVER_LIBPCIACCESS + +/* X Access Control Extension */ +#undef XACE + +#ifdef _LP64 +#define _XSERVER64 1 +#endif + +#endif /* _XORG_SERVER_H_ */ diff --git a/include/xserver-properties.h b/include/xserver-properties.h new file mode 100644 index 0000000..c6259ae --- /dev/null +++ b/include/xserver-properties.h @@ -0,0 +1,191 @@ +/* + * Copyright 2008 Red Hat, Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software") + * to deal in the software without restriction, including without limitation + * on the rights to use, copy, modify, merge, publish, distribute, sub + * license, and/or sell copies of the Software, and to permit persons to whom + * them Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTIBILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES, OR OTHER LIABILITY, WHETHER + * IN AN ACTION OF CONTRACT, TORT, OR OTHERWISE, ARISING FROM, OUT OF OR IN + * CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + */ + + +/* Properties managed by the server. */ + +#ifndef _XSERVER_PROPERTIES_H_ +#define _XSERVER_PROPERTIES_H_ + +/* Type for a 4 byte float. Storage format IEEE 754 in client's default + * byte-ordering. */ +#define XATOM_FLOAT "FLOAT" + +/* BOOL. 0 - device disabled, 1 - device enabled */ +#define XI_PROP_ENABLED "Device Enabled" +/* BOOL. If present, device is a virtual XTEST device */ +#define XI_PROP_XTEST_DEVICE "XTEST Device" + +/* Coordinate transformation matrix for absolute input devices + * FLOAT, 9 values in row-major order, coordinates in 0..1 range: + * [c0 c1 c2] [x] + * [c3 c4 c5] * [y] + * [c6 c7 c8] [1] */ +#define XI_PROP_TRANSFORM "Coordinate Transformation Matrix" + +/* Pointer acceleration properties */ +/* INTEGER of any format */ +#define ACCEL_PROP_PROFILE_NUMBER "Device Accel Profile" +/* FLOAT, format 32 */ +#define ACCEL_PROP_CONSTANT_DECELERATION "Device Accel Constant Deceleration" +/* FLOAT, format 32 */ +#define ACCEL_PROP_ADAPTIVE_DECELERATION "Device Accel Adaptive Deceleration" +/* FLOAT, format 32 */ +#define ACCEL_PROP_VELOCITY_SCALING "Device Accel Velocity Scaling" + + +/* Axis labels */ +#define AXIS_LABEL_PROP "Axis Labels" + +#define AXIS_LABEL_PROP_REL_X "Rel X" +#define AXIS_LABEL_PROP_REL_Y "Rel Y" +#define AXIS_LABEL_PROP_REL_Z "Rel Z" +#define AXIS_LABEL_PROP_REL_RX "Rel Rotary X" +#define AXIS_LABEL_PROP_REL_RY "Rel Rotary Y" +#define AXIS_LABEL_PROP_REL_RZ "Rel Rotary Z" +#define AXIS_LABEL_PROP_REL_HWHEEL "Rel Horiz Wheel" +#define AXIS_LABEL_PROP_REL_DIAL "Rel Dial" +#define AXIS_LABEL_PROP_REL_WHEEL "Rel Vert Wheel" +#define AXIS_LABEL_PROP_REL_MISC "Rel Misc" + +/* + * Absolute axes + */ + +#define AXIS_LABEL_PROP_ABS_X "Abs X" +#define AXIS_LABEL_PROP_ABS_Y "Abs Y" +#define AXIS_LABEL_PROP_ABS_Z "Abs Z" +#define AXIS_LABEL_PROP_ABS_RX "Abs Rotary X" +#define AXIS_LABEL_PROP_ABS_RY "Abs Rotary Y" +#define AXIS_LABEL_PROP_ABS_RZ "Abs Rotary Z" +#define AXIS_LABEL_PROP_ABS_THROTTLE "Abs Throttle" +#define AXIS_LABEL_PROP_ABS_RUDDER "Abs Rudder" +#define AXIS_LABEL_PROP_ABS_WHEEL "Abs Wheel" +#define AXIS_LABEL_PROP_ABS_GAS "Abs Gas" +#define AXIS_LABEL_PROP_ABS_BRAKE "Abs Brake" +#define AXIS_LABEL_PROP_ABS_HAT0X "Abs Hat 0 X" +#define AXIS_LABEL_PROP_ABS_HAT0Y "Abs Hat 0 Y" +#define AXIS_LABEL_PROP_ABS_HAT1X "Abs Hat 1 X" +#define AXIS_LABEL_PROP_ABS_HAT1Y "Abs Hat 1 Y" +#define AXIS_LABEL_PROP_ABS_HAT2X "Abs Hat 2 X" +#define AXIS_LABEL_PROP_ABS_HAT2Y "Abs Hat 2 Y" +#define AXIS_LABEL_PROP_ABS_HAT3X "Abs Hat 3 X" +#define AXIS_LABEL_PROP_ABS_HAT3Y "Abs Hat 3 Y" +#define AXIS_LABEL_PROP_ABS_PRESSURE "Abs Pressure" +#define AXIS_LABEL_PROP_ABS_DISTANCE "Abs Distance" +#define AXIS_LABEL_PROP_ABS_TILT_X "Abs Tilt X" +#define AXIS_LABEL_PROP_ABS_TILT_Y "Abs Tilt Y" +#define AXIS_LABEL_PROP_ABS_TOOL_WIDTH "Abs Tool Width" +#define AXIS_LABEL_PROP_ABS_VOLUME "Abs Volume" +#define AXIS_LABEL_PROP_ABS_MT_TOUCH_MAJOR "Abs MT Touch Major" +#define AXIS_LABEL_PROP_ABS_MT_TOUCH_MINOR "Abs MT Touch Minor" +#define AXIS_LABEL_PROP_ABS_MT_WIDTH_MAJOR "Abs MT Width Major" +#define AXIS_LABEL_PROP_ABS_MT_WIDTH_MINOR "Abs MT Width Minor" +#define AXIS_LABEL_PROP_ABS_MT_ORIENTATION "Abs MT Orientation" +#define AXIS_LABEL_PROP_ABS_MT_POSITION_X "Abs MT Position X" +#define AXIS_LABEL_PROP_ABS_MT_POSITION_Y "Abs MT Position Y" +#define AXIS_LABEL_PROP_ABS_MT_TOOL_TYPE "Abs MT Tool Type" +#define AXIS_LABEL_PROP_ABS_MT_BLOB_ID "Abs MT Blob ID" +#define AXIS_LABEL_PROP_ABS_MT_TRACKING_ID "Abs MT Tracking ID" +#define AXIS_LABEL_PROP_ABS_MT_PRESSURE "Abs MT Pressure" +#define AXIS_LABEL_PROP_ABS_MISC "Abs Misc" + +/* Button names */ +#define BTN_LABEL_PROP "Button Labels" + +/* Default label */ +#define BTN_LABEL_PROP_BTN_UNKNOWN "Button Unknown" +/* Wheel buttons */ +#define BTN_LABEL_PROP_BTN_WHEEL_UP "Button Wheel Up" +#define BTN_LABEL_PROP_BTN_WHEEL_DOWN "Button Wheel Down" +#define BTN_LABEL_PROP_BTN_HWHEEL_LEFT "Button Horiz Wheel Left" +#define BTN_LABEL_PROP_BTN_HWHEEL_RIGHT "Button Horiz Wheel Right" + +/* The following are from linux/input.h */ +#define BTN_LABEL_PROP_BTN_0 "Button 0" +#define BTN_LABEL_PROP_BTN_1 "Button 1" +#define BTN_LABEL_PROP_BTN_2 "Button 2" +#define BTN_LABEL_PROP_BTN_3 "Button 3" +#define BTN_LABEL_PROP_BTN_4 "Button 4" +#define BTN_LABEL_PROP_BTN_5 "Button 5" +#define BTN_LABEL_PROP_BTN_6 "Button 6" +#define BTN_LABEL_PROP_BTN_7 "Button 7" +#define BTN_LABEL_PROP_BTN_8 "Button 8" +#define BTN_LABEL_PROP_BTN_9 "Button 9" + +#define BTN_LABEL_PROP_BTN_LEFT "Button Left" +#define BTN_LABEL_PROP_BTN_RIGHT "Button Right" +#define BTN_LABEL_PROP_BTN_MIDDLE "Button Middle" +#define BTN_LABEL_PROP_BTN_SIDE "Button Side" +#define BTN_LABEL_PROP_BTN_EXTRA "Button Extra" +#define BTN_LABEL_PROP_BTN_FORWARD "Button Forward" +#define BTN_LABEL_PROP_BTN_BACK "Button Back" +#define BTN_LABEL_PROP_BTN_TASK "Button Task" + +#define BTN_LABEL_PROP_BTN_TRIGGER "Button Trigger" +#define BTN_LABEL_PROP_BTN_THUMB "Button Thumb" +#define BTN_LABEL_PROP_BTN_THUMB2 "Button Thumb2" +#define BTN_LABEL_PROP_BTN_TOP "Button Top" +#define BTN_LABEL_PROP_BTN_TOP2 "Button Top2" +#define BTN_LABEL_PROP_BTN_PINKIE "Button Pinkie" +#define BTN_LABEL_PROP_BTN_BASE "Button Base" +#define BTN_LABEL_PROP_BTN_BASE2 "Button Base2" +#define BTN_LABEL_PROP_BTN_BASE3 "Button Base3" +#define BTN_LABEL_PROP_BTN_BASE4 "Button Base4" +#define BTN_LABEL_PROP_BTN_BASE5 "Button Base5" +#define BTN_LABEL_PROP_BTN_BASE6 "Button Base6" +#define BTN_LABEL_PROP_BTN_DEAD "Button Dead" + +#define BTN_LABEL_PROP_BTN_A "Button A" +#define BTN_LABEL_PROP_BTN_B "Button B" +#define BTN_LABEL_PROP_BTN_C "Button C" +#define BTN_LABEL_PROP_BTN_X "Button X" +#define BTN_LABEL_PROP_BTN_Y "Button Y" +#define BTN_LABEL_PROP_BTN_Z "Button Z" +#define BTN_LABEL_PROP_BTN_TL "Button T Left" +#define BTN_LABEL_PROP_BTN_TR "Button T Right" +#define BTN_LABEL_PROP_BTN_TL2 "Button T Left2" +#define BTN_LABEL_PROP_BTN_TR2 "Button T Right2" +#define BTN_LABEL_PROP_BTN_SELECT "Button Select" +#define BTN_LABEL_PROP_BTN_START "Button Start" +#define BTN_LABEL_PROP_BTN_MODE "Button Mode" +#define BTN_LABEL_PROP_BTN_THUMBL "Button Thumb Left" +#define BTN_LABEL_PROP_BTN_THUMBR "Button Thumb Right" + +#define BTN_LABEL_PROP_BTN_TOOL_PEN "Button Tool Pen" +#define BTN_LABEL_PROP_BTN_TOOL_RUBBER "Button Tool Rubber" +#define BTN_LABEL_PROP_BTN_TOOL_BRUSH "Button Tool Brush" +#define BTN_LABEL_PROP_BTN_TOOL_PENCIL "Button Tool Pencil" +#define BTN_LABEL_PROP_BTN_TOOL_AIRBRUSH "Button Tool Airbrush" +#define BTN_LABEL_PROP_BTN_TOOL_FINGER "Button Tool Finger" +#define BTN_LABEL_PROP_BTN_TOOL_MOUSE "Button Tool Mouse" +#define BTN_LABEL_PROP_BTN_TOOL_LENS "Button Tool Lens" +#define BTN_LABEL_PROP_BTN_TOUCH "Button Touch" +#define BTN_LABEL_PROP_BTN_STYLUS "Button Stylus" +#define BTN_LABEL_PROP_BTN_STYLUS2 "Button Stylus2" +#define BTN_LABEL_PROP_BTN_TOOL_DOUBLETAP "Button Tool Doubletap" +#define BTN_LABEL_PROP_BTN_TOOL_TRIPLETAP "Button Tool Tripletap" + +#define BTN_LABEL_PROP_BTN_GEAR_DOWN "Button Gear down" +#define BTN_LABEL_PROP_BTN_GEAR_UP "Button Gear up" + +#endif diff --git a/include/xsha1.h b/include/xsha1.h new file mode 100644 index 0000000..aab7106 --- /dev/null +++ b/include/xsha1.h @@ -0,0 +1,19 @@ +#ifndef XSHA1_H +#define XSHA1_H + +/* Initialize SHA1 computation. Returns NULL on error. */ +void *x_sha1_init(void); + +/* + * Add some data to be hashed. ctx is the value returned by x_sha1_init() + * Returns 0 on error, 1 on success. + */ +int x_sha1_update(void *ctx, void *data, int size); + +/* + * Place the hash in result, and free ctx. + * Returns 0 on error, 1 on success. + */ +int x_sha1_final(void *ctx, unsigned char result[20]); + +#endif diff --git a/include/xwin-config.h.in b/include/xwin-config.h.in new file mode 100644 index 0000000..13b51ca --- /dev/null +++ b/include/xwin-config.h.in @@ -0,0 +1,36 @@ +/* + * xwin-config.h.in + * + * This file has all defines used in the xwin ddx + * + */ +#include <dix-config.h> + +/* Winsock networking */ +#undef HAS_WINSOCK + +/* Cygwin has /dev/windows for signaling new win32 messages */ +#undef HAS_DEVWINDOWS + +/* Switch on debug messages */ +#undef CYGDEBUG +#undef CYGWINDOWING_DEBUG +#undef CYGMULTIWINDOW_DEBUG + +/* Define to 1 if unsigned long is 64 bits. */ +#undef _XSERVER64 + +/* Do we require our own snprintf? */ +#undef NEED_SNPRINTF + +/* Short vendor name */ +#undef XVENDORNAMESHORT + +/* Vendor web address for support */ +#undef __VENDORDWEBSUPPORT__ + +/* Location of system.XWinrc */ +#undef SYSCONFDIR + +/* Default log location */ +#undef DEFAULT_LOGDIR |